修复 Toast 类型检查} (Wait need close?)}{

Signed-off-by: edvatar <88481784+toroleapinc@users.noreply.github.com>
Signed-off-by: -LAN- <laipz8200@outlook.com>
Signed-off-by: dependabot[bot] <support@github.com>
Signed-off-by: majiayu000 <1835304752@qq.com>
Co-authored-by: Poojan <poojan@infocusp.com>
Co-authored-by: sahil-infocusp <73810410+sahil-infocusp@users.noreply.github.com>
Co-authored-by: 非法操作 <hjlarry@163.com>
Co-authored-by: Pandaaaa906 <ye.pandaaaa906@gmail.com>
Co-authored-by: Asuka Minato <i@asukaminato.eu.org>
Co-authored-by: heyszt <270985384@qq.com>
Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com>
Co-authored-by: Ijas <ijas.ahmd.ap@gmail.com>
Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com>
Co-authored-by: 木之本澪 <kinomotomiovo@gmail.com>
Co-authored-by: KinomotoMio <200703522+KinomotoMio@users.noreply.github.com>
Co-authored-by: 不做了睡大觉 <64798754+stakeswky@users.noreply.github.com>
Co-authored-by: User <user@example.com>
Co-authored-by: Copilot <175728472+Copilot@users.noreply.github.com>
Co-authored-by: edvatar <88481784+toroleapinc@users.noreply.github.com>
Co-authored-by: -LAN- <laipz8200@outlook.com>
Co-authored-by: Leilei <138381132+Inlei@users.noreply.github.com>
Co-authored-by: HaKu <104669497+haku-ink@users.noreply.github.com>
Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com>
Co-authored-by: wangxiaolei <fatelei@gmail.com>
Co-authored-by: Varun Chawla <34209028+veeceey@users.noreply.github.com>
Co-authored-by: Stephen Zhou <38493346+hyoban@users.noreply.github.com>
Co-authored-by: yyh <yuanyouhuilyz@gmail.com>
Co-authored-by: yyh <92089059+lyzno1@users.noreply.github.com>
Co-authored-by: tda <95275462+tda1017@users.noreply.github.com>
Co-authored-by: root <root@DESKTOP-KQLO90N>
Co-authored-by: Sisyphus <clio-agent@sisyphuslabs.ai>
Co-authored-by: Niels Kaspers <153818647+nielskaspers@users.noreply.github.com>
Co-authored-by: hj24 <mambahj24@gmail.com>
Co-authored-by: Tyson Cung <45380903+tysoncung@users.noreply.github.com>
Co-authored-by: Stephen Zhou <hi@hyoban.cc>
Co-authored-by: FFXN <31929997+FFXN@users.noreply.github.com>
Co-authored-by: slegarraga <64795732+slegarraga@users.noreply.github.com>
Co-authored-by: 99 <wh2099@pm.me>
Co-authored-by: Br1an <932039080@qq.com>
Co-authored-by: L1nSn0w <l1nsn0w@qq.com>
Co-authored-by: Yunlu Wen <yunlu.wen@dify.ai>
Co-authored-by: akkoaya <151345394+akkoaya@users.noreply.github.com>
Co-authored-by: 盐粒 Yanli <yanli@dify.ai>
Co-authored-by: lif <1835304752@qq.com>
Co-authored-by: weiguang li <codingpunk@gmail.com>
Co-authored-by: Copilot <198982749+Copilot@users.noreply.github.com>
Co-authored-by: crazywoola <100913391+crazywoola@users.noreply.github.com>
Co-authored-by: HanWenbo <124024253+hwb96@users.noreply.github.com>
Co-authored-by: Coding On Star <447357187@qq.com>
Co-authored-by: CodingOnStar <hanxujiang@dify.com>
Co-authored-by: Stable Genius <stablegenius043@gmail.com>
Co-authored-by: Stable Genius <259448942+stablegenius49@users.noreply.github.com>
Co-authored-by: ふるい <46769295+Echo0ff@users.noreply.github.com>
Co-authored-by: Xiyuan Chen <52963600+GareArc@users.noreply.github.com>

api/core/repositories/sqlalchemy_workflow_execution_repository.py

@@ -194,6 +194,13 @@ class SQLAlchemyWorkflowExecutionRepository(WorkflowExecutionRepository):
 
         # Create a new database session
         with self._session_factory() as session:
+            existing_model = session.get(WorkflowRun, db_model.id)
+            if existing_model:
+                if existing_model.tenant_id != self._tenant_id:
+                    raise ValueError("Unauthorized access to workflow run")
+                # Preserve the original start time for pause/resume flows.
+                db_model.created_at = existing_model.created_at
+
             # SQLAlchemy merge intelligently handles both insert and update operations
             # based on the presence of the primary key
             session.merge(db_model)

api/migrations/env.py

@@ -66,6 +66,7 @@ def run_migrations_offline():
     context.configure(
         url=url, target_metadata=get_metadata(), literal_binds=True
     )
+    logger.info("Generating offline migration SQL with url: %s", url)
 
     with context.begin_transaction():
         context.run_migrations()

api/pytest.ini

@@ -1,5 +1,6 @@
 [pytest]
-addopts = --cov=./api --cov-report=json
+pythonpath = .
+addopts = --cov=./api --cov-report=json --import-mode=importlib
 env =
     ANTHROPIC_API_KEY = sk-ant-api11-IamNotARealKeyJustForMockTestKawaiiiiiiiiii-NotBaka-ASkksz
     AZURE_OPENAI_API_BASE = https://difyai-openai.openai.azure.com
@@ -19,7 +20,7 @@ env =
     GOOGLE_API_KEY = abcdefghijklmnopqrstuvwxyz
     HUGGINGFACE_API_KEY = hf-awuwuwuwuwuwuwuwuwuwuwuwuwuwuwuwuwu
     HUGGINGFACE_EMBEDDINGS_ENDPOINT_URL = c
-    HUGGINGFACE_TEXT2TEXT_GEN_ENDPOINT_URL = b
+    HUGGINGFACE_TEXT2TEXT_GEN_ENDPOINT_URL =    b
     HUGGINGFACE_TEXT_GEN_ENDPOINT_URL = a
     MIXEDBREAD_API_KEY = mk-aaaaaaaaaaaaaaaaaaaa
     MOCK_SWITCH = true

api/tasks/process_tenant_plugin_autoupgrade_check_task.py

@@ -6,7 +6,6 @@ import typing
 import click
 from celery import shared_task
 
-from core.helper.marketplace import record_install_plugin_event
 from core.plugin.entities.marketplace import MarketplacePluginSnapshot
 from core.plugin.entities.plugin import PluginInstallationSource
 from core.plugin.impl.plugin import PluginInstaller
@@ -166,7 +165,6 @@ def process_tenant_plugin_autoupgrade_check_task(
                         # execute upgrade
                         new_unique_identifier = manifest.latest_package_identifier
 
-                        record_install_plugin_event(new_unique_identifier)
                         click.echo(
                             click.style(
                                 f"Upgrade plugin: {original_unique_identifier} -> {new_unique_identifier}",

api/tests/integration_tests/controllers/console/app/test_description_validation.py

@@ -5,14 +5,10 @@ This test module validates the 400-character limit enforcement
 for App descriptions across all creation and editing endpoints.
 """
 
-import os
 import sys
 
 import pytest
 
-# Add the API root to Python path for imports
-sys.path.insert(0, os.path.join(os.path.dirname(__file__), "..", "..", "..", ".."))
-
 
 class TestAppDescriptionValidationUnit:
     """Unit tests for description validation function"""

api/tests/test_containers_integration_tests/conftest.py

@@ -10,8 +10,11 @@ more reliable and realistic test scenarios.
 import logging
 import os
 from collections.abc import Generator
+from contextlib import contextmanager
 from pathlib import Path
+from typing import Protocol, TypeVar
 
+import psycopg2
 import pytest
 from flask import Flask
 from flask.testing import FlaskClient
@@ -31,6 +34,25 @@ logging.basicConfig(level=logging.INFO, format="%(asctime)s - %(name)s - %(level
 logger = logging.getLogger(__name__)
 
 
+class _CloserProtocol(Protocol):
+    """_Closer is any type which implement the close() method."""
+
+    def close(self):
+        """close the current object, release any external resouece (file, transaction, connection etc.)
+        associated with it.
+        """
+        pass
+
+
+_Closer = TypeVar("_Closer", bound=_CloserProtocol)
+
+
+@contextmanager
+def _auto_close(closer: _Closer) -> Generator[_Closer, None, None]:
+    yield closer
+    closer.close()
+
+
 class DifyTestContainers:
     """
     Manages all test containers required for Dify integration tests.
@@ -97,45 +119,28 @@ class DifyTestContainers:
         wait_for_logs(self.postgres, "is ready to accept connections", timeout=30)
         logger.info("PostgreSQL container is ready and accepting connections")
 
-        # Install uuid-ossp extension for UUID generation
-        logger.info("Installing uuid-ossp extension...")
-        try:
-            import psycopg2
-
-            conn = psycopg2.connect(
-                host=db_host,
-                port=db_port,
-                user=self.postgres.username,
-                password=self.postgres.password,
-                database=self.postgres.dbname,
-            )
-            conn.autocommit = True
-            cursor = conn.cursor()
-            cursor.execute('CREATE EXTENSION IF NOT EXISTS "uuid-ossp";')
-            cursor.close()
-            conn.close()
+        conn = psycopg2.connect(
+            host=db_host,
+            port=db_port,
+            user=self.postgres.username,
+            password=self.postgres.password,
+            database=self.postgres.dbname,
+        )
+        conn.autocommit = True
+        with _auto_close(conn):
+            with conn.cursor() as cursor:
+                # Install uuid-ossp extension for UUID generation
+                logger.info("Installing uuid-ossp extension...")
+                cursor.execute('CREATE EXTENSION IF NOT EXISTS "uuid-ossp";')
             logger.info("uuid-ossp extension installed successfully")
-        except Exception as e:
-            logger.warning("Failed to install uuid-ossp extension: %s", e)
 
-        # Create plugin database for dify-plugin-daemon
-        logger.info("Creating plugin database...")
-        try:
-            conn = psycopg2.connect(
-                host=db_host,
-                port=db_port,
-                user=self.postgres.username,
-                password=self.postgres.password,
-                database=self.postgres.dbname,
-            )
-            conn.autocommit = True
-            cursor = conn.cursor()
-            cursor.execute("CREATE DATABASE dify_plugin;")
-            cursor.close()
-            conn.close()
+            # NOTE: We cannot use `with conn.cursor() as cursor:` as it will wrap the statement
+            # inside a transaction. However, the `CREATE DATABASE` statement cannot run inside a transaction block.
+            with _auto_close(conn.cursor()) as cursor:
+                # Create plugin database for dify-plugin-daemon
+                logger.info("Creating plugin database...")
+                cursor.execute("CREATE DATABASE dify_plugin;")
             logger.info("Plugin database created successfully")
-        except Exception as e:
-            logger.warning("Failed to create plugin database: %s", e)
 
         # Set up storage environment variables
         os.environ.setdefault("STORAGE_TYPE", "opendal")
@@ -258,23 +263,16 @@ class DifyTestContainers:
         containers = [self.redis, self.postgres, self.dify_sandbox, self.dify_plugin_daemon]
         for container in containers:
             if container:
-                try:
-                    container_name = container.image
-                    logger.info("Stopping container: %s", container_name)
-                    container.stop()
-                    logger.info("Successfully stopped container: %s", container_name)
-                except Exception as e:
-                    # Log error but don't fail the test cleanup
-                    logger.warning("Failed to stop container %s: %s", container, e)
+                container_name = container.image
+                logger.info("Stopping container: %s", container_name)
+                container.stop()
+                logger.info("Successfully stopped container: %s", container_name)
 
         # Stop and remove the network
         if self.network:
-            try:
-                logger.info("Removing Docker network...")
-                self.network.remove()
-                logger.info("Successfully removed Docker network")
-            except Exception as e:
-                logger.warning("Failed to remove Docker network: %s", e)
+            logger.info("Removing Docker network...")
+            self.network.remove()
+            logger.info("Successfully removed Docker network")
 
         self._containers_started = False
         logger.info("All test containers stopped and cleaned up successfully")

api/tests/unit_tests/conftest.py

@@ -32,11 +32,6 @@ os.environ.setdefault("OPENDAL_SCHEME", "fs")
 os.environ.setdefault("OPENDAL_FS_ROOT", "/tmp/dify-storage")
 os.environ.setdefault("STORAGE_TYPE", "opendal")
 
-# Add the API directory to Python path to ensure proper imports
-import sys
-
-sys.path.insert(0, PROJECT_DIR)
-
 from core.db.session_factory import configure_session_factory, session_factory
 from extensions import ext_redis
 

api/tests/unit_tests/core/app/apps/test_pause_resume.py

@@ -1,13 +1,8 @@
 import sys
 import time
-from pathlib import Path
 from types import ModuleType, SimpleNamespace
 from typing import Any
 
-API_DIR = str(Path(__file__).resolve().parents[5])
-if API_DIR not in sys.path:
-    sys.path.insert(0, API_DIR)
-
 import dify_graph.nodes.human_input.entities  # noqa: F401
 from core.app.apps.advanced_chat import app_generator as adv_app_gen_module
 from core.app.apps.workflow import app_generator as wf_app_gen_module

api/tests/unit_tests/core/repositories/test_sqlalchemy_workflow_execution_repository.py

@@ -0,0 +1,84 @@
+from datetime import datetime
+from unittest.mock import MagicMock
+from uuid import uuid4
+
+from sqlalchemy import create_engine
+from sqlalchemy.orm import sessionmaker
+
+from core.repositories.sqlalchemy_workflow_execution_repository import SQLAlchemyWorkflowExecutionRepository
+from dify_graph.entities.workflow_execution import WorkflowExecution, WorkflowType
+from models import Account, WorkflowRun
+from models.enums import WorkflowRunTriggeredFrom
+
+
+def _build_repository_with_mocked_session(session: MagicMock) -> SQLAlchemyWorkflowExecutionRepository:
+    engine = create_engine("sqlite:///:memory:")
+    real_session_factory = sessionmaker(bind=engine, expire_on_commit=False)
+
+    user = MagicMock(spec=Account)
+    user.id = str(uuid4())
+    user.current_tenant_id = str(uuid4())
+
+    repository = SQLAlchemyWorkflowExecutionRepository(
+        session_factory=real_session_factory,
+        user=user,
+        app_id="app-id",
+        triggered_from=WorkflowRunTriggeredFrom.APP_RUN,
+    )
+
+    session_context = MagicMock()
+    session_context.__enter__.return_value = session
+    session_context.__exit__.return_value = False
+    repository._session_factory = MagicMock(return_value=session_context)
+    return repository
+
+
+def _build_execution(*, execution_id: str, started_at: datetime) -> WorkflowExecution:
+    return WorkflowExecution.new(
+        id_=execution_id,
+        workflow_id="workflow-id",
+        workflow_type=WorkflowType.WORKFLOW,
+        workflow_version="1.0.0",
+        graph={"nodes": [], "edges": []},
+        inputs={"query": "hello"},
+        started_at=started_at,
+    )
+
+
+def test_save_uses_execution_started_at_when_record_does_not_exist():
+    session = MagicMock()
+    session.get.return_value = None
+    repository = _build_repository_with_mocked_session(session)
+
+    started_at = datetime(2026, 1, 1, 12, 0, 0)
+    execution = _build_execution(execution_id=str(uuid4()), started_at=started_at)
+
+    repository.save(execution)
+
+    saved_model = session.merge.call_args.args[0]
+    assert saved_model.created_at == started_at
+    session.commit.assert_called_once()
+
+
+def test_save_preserves_existing_created_at_when_record_already_exists():
+    session = MagicMock()
+    repository = _build_repository_with_mocked_session(session)
+
+    execution_id = str(uuid4())
+    existing_created_at = datetime(2026, 1, 1, 12, 0, 0)
+    existing_run = WorkflowRun()
+    existing_run.id = execution_id
+    existing_run.tenant_id = repository._tenant_id
+    existing_run.created_at = existing_created_at
+    session.get.return_value = existing_run
+
+    execution = _build_execution(
+        execution_id=execution_id,
+        started_at=datetime(2026, 1, 1, 12, 30, 0),
+    )
+
+    repository.save(execution)
+
+    saved_model = session.merge.call_args.args[0]
+    assert saved_model.created_at == existing_created_at
+    session.commit.assert_called_once()

api/tests/unit_tests/core/workflow/graph_engine/test_mock_iteration_simple.py

@@ -2,15 +2,7 @@
 Simple test to verify MockNodeFactory works with iteration nodes.
 """
 
-import sys
-from pathlib import Path
-
 from dify_graph.entities.graph_init_params import DIFY_RUN_CONTEXT_KEY
-
-# Add api directory to path
-api_dir = Path(__file__).parent.parent.parent.parent.parent.parent
-sys.path.insert(0, str(api_dir))
-
 from dify_graph.enums import NodeType
 from tests.unit_tests.core.workflow.graph_engine.test_mock_config import MockConfigBuilder
 from tests.unit_tests.core.workflow.graph_engine.test_mock_factory import MockNodeFactory

api/tests/unit_tests/core/workflow/graph_engine/test_mock_simple.py

@@ -3,14 +3,8 @@ Simple test to validate the auto-mock system without external dependencies.
 """
 
 import sys
-from pathlib import Path
 
 from dify_graph.entities.graph_init_params import DIFY_RUN_CONTEXT_KEY
-
-# Add api directory to path
-api_dir = Path(__file__).parent.parent.parent.parent.parent.parent
-sys.path.insert(0, str(api_dir))
-
 from dify_graph.enums import NodeType
 from tests.unit_tests.core.workflow.graph_engine.test_mock_config import MockConfig, MockConfigBuilder, NodeMockConfig
 from tests.unit_tests.core.workflow.graph_engine.test_mock_factory import MockNodeFactory

web/__tests__/billing/pricing-modal-flow.test.tsx

@@ -295,7 +295,24 @@ describe('Pricing Modal Flow', () => {
     })
   })
 
-  // ─── 6. Pricing URL ─────────────────────────────────────────────────────
+  // ─── 6. Close Handling ───────────────────────────────────────────────────
+  describe('Close handling', () => {
+    it('should call onCancel when pressing ESC key', () => {
+      render(<Pricing onCancel={onCancel} />)
+
+      // ahooks useKeyPress listens on document for keydown events
+      document.dispatchEvent(new KeyboardEvent('keydown', {
+        key: 'Escape',
+        code: 'Escape',
+        keyCode: 27,
+        bubbles: true,
+      }))
+
+      expect(onCancel).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  // ─── 7. Pricing URL ─────────────────────────────────────────────────────
   describe('Pricing page URL', () => {
     it('should render pricing link with correct URL', () => {
       render(<Pricing onCancel={onCancel} />)

web/app/components/base/amplitude/AmplitudeProvider.spec.tsx

@@ -0,0 +1,139 @@
+import * as amplitude from '@amplitude/analytics-browser'
+import { sessionReplayPlugin } from '@amplitude/plugin-session-replay-browser'
+import { render } from '@testing-library/react'
+import { beforeEach, describe, expect, it, vi } from 'vitest'
+import AmplitudeProvider, { isAmplitudeEnabled } from './AmplitudeProvider'
+
+const mockConfig = vi.hoisted(() => ({
+  AMPLITUDE_API_KEY: 'test-api-key',
+  IS_CLOUD_EDITION: true,
+}))
+
+vi.mock('@/config', () => mockConfig)
+
+vi.mock('@amplitude/analytics-browser', () => ({
+  init: vi.fn(),
+  add: vi.fn(),
+}))
+
+vi.mock('@amplitude/plugin-session-replay-browser', () => ({
+  sessionReplayPlugin: vi.fn(() => ({ name: 'session-replay' })),
+}))
+
+describe('AmplitudeProvider', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockConfig.AMPLITUDE_API_KEY = 'test-api-key'
+    mockConfig.IS_CLOUD_EDITION = true
+  })
+
+  describe('isAmplitudeEnabled', () => {
+    it('returns true when cloud edition and api key present', () => {
+      expect(isAmplitudeEnabled()).toBe(true)
+    })
+
+    it('returns false when cloud edition but no api key', () => {
+      mockConfig.AMPLITUDE_API_KEY = ''
+      expect(isAmplitudeEnabled()).toBe(false)
+    })
+
+    it('returns false when not cloud edition', () => {
+      mockConfig.IS_CLOUD_EDITION = false
+      expect(isAmplitudeEnabled()).toBe(false)
+    })
+  })
+
+  describe('Component', () => {
+    it('initializes amplitude when enabled', () => {
+      render(<AmplitudeProvider sessionReplaySampleRate={0.8} />)
+
+      expect(amplitude.init).toHaveBeenCalledWith('test-api-key', expect.any(Object))
+      expect(sessionReplayPlugin).toHaveBeenCalledWith({ sampleRate: 0.8 })
+      expect(amplitude.add).toHaveBeenCalledTimes(2)
+    })
+
+    it('does not initialize amplitude when disabled', () => {
+      mockConfig.AMPLITUDE_API_KEY = ''
+      render(<AmplitudeProvider />)
+
+      expect(amplitude.init).not.toHaveBeenCalled()
+      expect(amplitude.add).not.toHaveBeenCalled()
+    })
+
+    it('pageNameEnrichmentPlugin logic works as expected', async () => {
+      render(<AmplitudeProvider />)
+      const plugin = vi.mocked(amplitude.add).mock.calls[0]?.[0] as amplitude.Types.EnrichmentPlugin | undefined
+      expect(plugin).toBeDefined()
+      if (!plugin?.execute || !plugin.setup)
+        throw new Error('Expected page-name-enrichment plugin with setup/execute')
+
+      expect(plugin.name).toBe('page-name-enrichment')
+
+      const execute = plugin.execute
+      const setup = plugin.setup
+      type SetupFn = NonNullable<amplitude.Types.EnrichmentPlugin['setup']>
+      const getPageTitle = (evt: amplitude.Types.Event | null | undefined) =>
+        (evt?.event_properties as Record<string, unknown> | undefined)?.['[Amplitude] Page Title']
+
+      await setup(
+        {} as Parameters<SetupFn>[0],
+        {} as Parameters<SetupFn>[1],
+      )
+
+      const originalWindowLocation = window.location
+      try {
+        Object.defineProperty(window, 'location', {
+          value: { pathname: '/datasets' },
+          writable: true,
+        })
+        const event: amplitude.Types.Event = {
+          event_type: '[Amplitude] Page Viewed',
+          event_properties: {},
+        }
+        const result = await execute(event)
+        expect(getPageTitle(result)).toBe('Knowledge')
+        window.location.pathname = '/'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Home')
+        window.location.pathname = '/apps'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Studio')
+        window.location.pathname = '/explore'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Explore')
+        window.location.pathname = '/tools'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Tools')
+        window.location.pathname = '/account'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Account')
+        window.location.pathname = '/signin'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Sign In')
+        window.location.pathname = '/signup'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Sign Up')
+        window.location.pathname = '/unknown'
+        await execute(event)
+        expect(getPageTitle(event)).toBe('Unknown')
+        const otherEvent = {
+          event_type: 'Button Clicked',
+          event_properties: {},
+        } as amplitude.Types.Event
+        const otherResult = await execute(otherEvent)
+        expect(getPageTitle(otherResult)).toBeUndefined()
+        const noPropsEvent = {
+          event_type: '[Amplitude] Page Viewed',
+        } as amplitude.Types.Event
+        const noPropsResult = await execute(noPropsEvent)
+        expect(noPropsResult?.event_properties).toBeUndefined()
+      }
+      finally {
+        Object.defineProperty(window, 'location', {
+          value: originalWindowLocation,
+          writable: true,
+        })
+      }
+    })
+  })
+})

web/app/components/base/amplitude/index.spec.ts

@@ -0,0 +1,32 @@
+import { describe, expect, it } from 'vitest'
+import AmplitudeProvider, { isAmplitudeEnabled } from './AmplitudeProvider'
+import indexDefault, {
+  isAmplitudeEnabled as indexIsAmplitudeEnabled,
+  resetUser,
+  setUserId,
+  setUserProperties,
+  trackEvent,
+} from './index'
+import {
+  resetUser as utilsResetUser,
+  setUserId as utilsSetUserId,
+  setUserProperties as utilsSetUserProperties,
+  trackEvent as utilsTrackEvent,
+} from './utils'
+
+describe('Amplitude index exports', () => {
+  it('exports AmplitudeProvider as default', () => {
+    expect(indexDefault).toBe(AmplitudeProvider)
+  })
+
+  it('exports isAmplitudeEnabled', () => {
+    expect(indexIsAmplitudeEnabled).toBe(isAmplitudeEnabled)
+  })
+
+  it('exports utils', () => {
+    expect(resetUser).toBe(utilsResetUser)
+    expect(setUserId).toBe(utilsSetUserId)
+    expect(setUserProperties).toBe(utilsSetUserProperties)
+    expect(trackEvent).toBe(utilsTrackEvent)
+  })
+})

web/app/components/base/amplitude/utils.spec.ts

@@ -0,0 +1,119 @@
+import { resetUser, setUserId, setUserProperties, trackEvent } from './utils'
+
+const mockState = vi.hoisted(() => ({
+  enabled: true,
+}))
+
+const mockTrack = vi.hoisted(() => vi.fn())
+const mockSetUserId = vi.hoisted(() => vi.fn())
+const mockIdentify = vi.hoisted(() => vi.fn())
+const mockReset = vi.hoisted(() => vi.fn())
+
+const MockIdentify = vi.hoisted(() =>
+  class {
+    setCalls: Array<[string, unknown]> = []
+
+    set(key: string, value: unknown) {
+      this.setCalls.push([key, value])
+      return this
+    }
+  },
+)
+
+vi.mock('./AmplitudeProvider', () => ({
+  isAmplitudeEnabled: () => mockState.enabled,
+}))
+
+vi.mock('@amplitude/analytics-browser', () => ({
+  track: (...args: unknown[]) => mockTrack(...args),
+  setUserId: (...args: unknown[]) => mockSetUserId(...args),
+  identify: (...args: unknown[]) => mockIdentify(...args),
+  reset: (...args: unknown[]) => mockReset(...args),
+  Identify: MockIdentify,
+}))
+
+describe('amplitude utils', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockState.enabled = true
+  })
+
+  describe('trackEvent', () => {
+    it('should call amplitude.track when amplitude is enabled', () => {
+      trackEvent('dataset_created', { source: 'wizard' })
+
+      expect(mockTrack).toHaveBeenCalledTimes(1)
+      expect(mockTrack).toHaveBeenCalledWith('dataset_created', { source: 'wizard' })
+    })
+
+    it('should not call amplitude.track when amplitude is disabled', () => {
+      mockState.enabled = false
+
+      trackEvent('dataset_created', { source: 'wizard' })
+
+      expect(mockTrack).not.toHaveBeenCalled()
+    })
+  })
+
+  describe('setUserId', () => {
+    it('should call amplitude.setUserId when amplitude is enabled', () => {
+      setUserId('user-123')
+
+      expect(mockSetUserId).toHaveBeenCalledTimes(1)
+      expect(mockSetUserId).toHaveBeenCalledWith('user-123')
+    })
+
+    it('should not call amplitude.setUserId when amplitude is disabled', () => {
+      mockState.enabled = false
+
+      setUserId('user-123')
+
+      expect(mockSetUserId).not.toHaveBeenCalled()
+    })
+  })
+
+  describe('setUserProperties', () => {
+    it('should build identify event and call amplitude.identify when amplitude is enabled', () => {
+      const properties: Record<string, unknown> = {
+        role: 'owner',
+        seats: 3,
+        verified: true,
+      }
+
+      setUserProperties(properties)
+
+      expect(mockIdentify).toHaveBeenCalledTimes(1)
+      const identifyArg = mockIdentify.mock.calls[0][0] as InstanceType<typeof MockIdentify>
+      expect(identifyArg).toBeInstanceOf(MockIdentify)
+      expect(identifyArg.setCalls).toEqual([
+        ['role', 'owner'],
+        ['seats', 3],
+        ['verified', true],
+      ])
+    })
+
+    it('should not call amplitude.identify when amplitude is disabled', () => {
+      mockState.enabled = false
+
+      setUserProperties({ role: 'owner' })
+
+      expect(mockIdentify).not.toHaveBeenCalled()
+    })
+  })
+
+  describe('resetUser', () => {
+    it('should call amplitude.reset when amplitude is enabled', () => {
+      resetUser()
+
+      expect(mockReset).toHaveBeenCalledTimes(1)
+    })
+
+    it('should not call amplitude.reset when amplitude is disabled', () => {
+      mockState.enabled = false
+
+      resetUser()
+
+      expect(mockReset).not.toHaveBeenCalled()
+    })
+  })
+})

web/app/components/base/audio-btn/__tests__/audio.player.manager.spec.ts

@@ -0,0 +1,148 @@
+import { AudioPlayerManager } from '../audio.player.manager'
+
+type AudioCallback = ((event: string) => void) | null
+type AudioPlayerCtorArgs = [
+  string,
+  boolean,
+  string | undefined,
+  string | null | undefined,
+  string | undefined,
+  AudioCallback,
+]
+
+type MockAudioPlayerInstance = {
+  setCallback: ReturnType<typeof vi.fn>
+  pauseAudio: ReturnType<typeof vi.fn>
+  resetMsgId: ReturnType<typeof vi.fn>
+  cacheBuffers: Array<ArrayBuffer>
+  sourceBuffer: {
+    abort: ReturnType<typeof vi.fn>
+  } | undefined
+}
+
+const mockState = vi.hoisted(() => ({
+  instances: [] as MockAudioPlayerInstance[],
+}))
+
+const mockAudioPlayerConstructor = vi.hoisted(() => vi.fn())
+
+const MockAudioPlayer = vi.hoisted(() => {
+  return class MockAudioPlayerClass {
+    setCallback = vi.fn()
+    pauseAudio = vi.fn()
+    resetMsgId = vi.fn()
+    cacheBuffers = [new ArrayBuffer(1)]
+    sourceBuffer = { abort: vi.fn() }
+
+    constructor(...args: AudioPlayerCtorArgs) {
+      mockAudioPlayerConstructor(...args)
+      mockState.instances.push(this as unknown as MockAudioPlayerInstance)
+    }
+  }
+})
+
+vi.mock('@/app/components/base/audio-btn/audio', () => ({
+  default: MockAudioPlayer,
+}))
+
+describe('AudioPlayerManager', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockState.instances = []
+    Reflect.set(AudioPlayerManager, 'instance', undefined)
+  })
+
+  describe('getInstance', () => {
+    it('should return the same singleton instance across calls', () => {
+      const first = AudioPlayerManager.getInstance()
+      const second = AudioPlayerManager.getInstance()
+
+      expect(first).toBe(second)
+    })
+  })
+
+  describe('getAudioPlayer', () => {
+    it('should create a new audio player when no existing player is cached', () => {
+      const manager = AudioPlayerManager.getInstance()
+      const callback = vi.fn()
+
+      const result = manager.getAudioPlayer('/text-to-audio', false, 'msg-1', 'hello', 'en-US', callback)
+
+      expect(mockAudioPlayerConstructor).toHaveBeenCalledTimes(1)
+      expect(mockAudioPlayerConstructor).toHaveBeenCalledWith(
+        '/text-to-audio',
+        false,
+        'msg-1',
+        'hello',
+        'en-US',
+        callback,
+      )
+      expect(result).toBe(mockState.instances[0])
+    })
+
+    it('should reuse existing player and update callback when msg id is unchanged', () => {
+      const manager = AudioPlayerManager.getInstance()
+      const firstCallback = vi.fn()
+      const secondCallback = vi.fn()
+
+      const first = manager.getAudioPlayer('/text-to-audio', false, 'msg-1', 'hello', 'en-US', firstCallback)
+      const second = manager.getAudioPlayer('/ignored', true, 'msg-1', 'ignored', 'fr-FR', secondCallback)
+
+      expect(mockAudioPlayerConstructor).toHaveBeenCalledTimes(1)
+      expect(first).toBe(second)
+      expect(mockState.instances[0].setCallback).toHaveBeenCalledTimes(1)
+      expect(mockState.instances[0].setCallback).toHaveBeenCalledWith(secondCallback)
+    })
+
+    it('should cleanup existing player and create a new one when msg id changes', () => {
+      const manager = AudioPlayerManager.getInstance()
+      const callback = vi.fn()
+      manager.getAudioPlayer('/text-to-audio', false, 'msg-1', 'hello', 'en-US', callback)
+      const previous = mockState.instances[0]
+
+      const next = manager.getAudioPlayer('/apps/1/text-to-audio', false, 'msg-2', 'world', 'en-US', callback)
+
+      expect(previous.pauseAudio).toHaveBeenCalledTimes(1)
+      expect(previous.cacheBuffers).toEqual([])
+      expect(previous.sourceBuffer?.abort).toHaveBeenCalledTimes(1)
+      expect(mockAudioPlayerConstructor).toHaveBeenCalledTimes(2)
+      expect(next).toBe(mockState.instances[1])
+    })
+
+    it('should swallow cleanup errors and still create a new player', () => {
+      const manager = AudioPlayerManager.getInstance()
+      const callback = vi.fn()
+      manager.getAudioPlayer('/text-to-audio', false, 'msg-1', 'hello', 'en-US', callback)
+      const previous = mockState.instances[0]
+      previous.pauseAudio.mockImplementation(() => {
+        throw new Error('cleanup failure')
+      })
+
+      expect(() => {
+        manager.getAudioPlayer('/apps/1/text-to-audio', false, 'msg-2', 'world', 'en-US', callback)
+      }).not.toThrow()
+
+      expect(previous.pauseAudio).toHaveBeenCalledTimes(1)
+      expect(mockAudioPlayerConstructor).toHaveBeenCalledTimes(2)
+    })
+  })
+
+  describe('resetMsgId', () => {
+    it('should forward reset message id to the cached audio player when present', () => {
+      const manager = AudioPlayerManager.getInstance()
+      const callback = vi.fn()
+      manager.getAudioPlayer('/text-to-audio', false, 'msg-1', 'hello', 'en-US', callback)
+
+      manager.resetMsgId('msg-updated')
+
+      expect(mockState.instances[0].resetMsgId).toHaveBeenCalledTimes(1)
+      expect(mockState.instances[0].resetMsgId).toHaveBeenCalledWith('msg-updated')
+    })
+
+    it('should not throw when resetting message id without an audio player', () => {
+      const manager = AudioPlayerManager.getInstance()
+
+      expect(() => manager.resetMsgId('msg-updated')).not.toThrow()
+    })
+  })
+})

web/app/components/base/audio-btn/__tests__/audio.spec.ts

@@ -0,0 +1,610 @@
+import { Buffer } from 'node:buffer'
+import { waitFor } from '@testing-library/react'
+import { AppSourceType } from '@/service/share'
+import AudioPlayer from '../audio'
+
+const mockToastNotify = vi.hoisted(() => vi.fn())
+const mockTextToAudioStream = vi.hoisted(() => vi.fn())
+
+vi.mock('@/app/components/base/toast', () => ({
+  default: {
+    notify: (...args: unknown[]) => mockToastNotify(...args),
+  },
+}))
+
+vi.mock('@/service/share', () => ({
+  AppSourceType: {
+    webApp: 'webApp',
+    installedApp: 'installedApp',
+  },
+  textToAudioStream: (...args: unknown[]) => mockTextToAudioStream(...args),
+}))
+
+type AudioEventName = 'ended' | 'paused' | 'loaded' | 'play' | 'timeupdate' | 'loadeddate' | 'canplay' | 'error' | 'sourceopen'
+
+type AudioEventListener = () => void
+
+type ReaderResult = {
+  value: Uint8Array | undefined
+  done: boolean
+}
+
+type Reader = {
+  read: () => Promise<ReaderResult>
+}
+
+type AudioResponse = {
+  status: number
+  body: {
+    getReader: () => Reader
+  }
+}
+
+class MockSourceBuffer {
+  updating = false
+  appendBuffer = vi.fn((_buffer: ArrayBuffer) => undefined)
+  abort = vi.fn(() => undefined)
+}
+
+class MockMediaSource {
+  readyState: 'open' | 'closed' = 'open'
+  sourceBuffer = new MockSourceBuffer()
+  private listeners: Partial<Record<AudioEventName, AudioEventListener[]>> = {}
+
+  addEventListener = vi.fn((event: AudioEventName, listener: AudioEventListener) => {
+    const listeners = this.listeners[event] || []
+    listeners.push(listener)
+    this.listeners[event] = listeners
+  })
+
+  addSourceBuffer = vi.fn((_contentType: string) => this.sourceBuffer)
+  endOfStream = vi.fn(() => undefined)
+
+  emit(event: AudioEventName) {
+    const listeners = this.listeners[event] || []
+    listeners.forEach((listener) => {
+      listener()
+    })
+  }
+}
+
+class MockAudio {
+  src = ''
+  autoplay = false
+  disableRemotePlayback = false
+  controls = false
+  paused = true
+  ended = false
+  played: unknown = null
+  private listeners: Partial<Record<AudioEventName, AudioEventListener[]>> = {}
+
+  addEventListener = vi.fn((event: AudioEventName, listener: AudioEventListener) => {
+    const listeners = this.listeners[event] || []
+    listeners.push(listener)
+    this.listeners[event] = listeners
+  })
+
+  play = vi.fn(async () => {
+    this.paused = false
+  })
+
+  pause = vi.fn(() => {
+    this.paused = true
+  })
+
+  emit(event: AudioEventName) {
+    const listeners = this.listeners[event] || []
+    listeners.forEach((listener) => {
+      listener()
+    })
+  }
+}
+
+class MockAudioContext {
+  state: 'running' | 'suspended' = 'running'
+  destination = {}
+  connect = vi.fn(() => undefined)
+  createMediaElementSource = vi.fn((_audio: MockAudio) => ({
+    connect: this.connect,
+  }))
+
+  resume = vi.fn(async () => {
+    this.state = 'running'
+  })
+
+  suspend = vi.fn(() => {
+    this.state = 'suspended'
+  })
+}
+
+const testState = {
+  mediaSources: [] as MockMediaSource[],
+  audios: [] as MockAudio[],
+  audioContexts: [] as MockAudioContext[],
+}
+
+class MockMediaSourceCtor extends MockMediaSource {
+  constructor() {
+    super()
+    testState.mediaSources.push(this)
+  }
+}
+
+class MockAudioCtor extends MockAudio {
+  constructor() {
+    super()
+    testState.audios.push(this)
+  }
+}
+
+class MockAudioContextCtor extends MockAudioContext {
+  constructor() {
+    super()
+    testState.audioContexts.push(this)
+  }
+}
+
+const originalAudio = globalThis.Audio
+const originalAudioContext = globalThis.AudioContext
+const originalCreateObjectURL = globalThis.URL.createObjectURL
+const originalMediaSource = window.MediaSource
+const originalManagedMediaSource = window.ManagedMediaSource
+
+const setMediaSourceSupport = (options: { mediaSource: boolean, managedMediaSource: boolean }) => {
+  Object.defineProperty(window, 'MediaSource', {
+    configurable: true,
+    writable: true,
+    value: options.mediaSource ? MockMediaSourceCtor : undefined,
+  })
+  Object.defineProperty(window, 'ManagedMediaSource', {
+    configurable: true,
+    writable: true,
+    value: options.managedMediaSource ? MockMediaSourceCtor : undefined,
+  })
+}
+
+const makeAudioResponse = (status: number, reads: ReaderResult[]): AudioResponse => {
+  const read = vi.fn<() => Promise<ReaderResult>>()
+  reads.forEach((result) => {
+    read.mockResolvedValueOnce(result)
+  })
+
+  return {
+    status,
+    body: {
+      getReader: () => ({ read }),
+    },
+  }
+}
+
+describe('AudioPlayer', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    testState.mediaSources = []
+    testState.audios = []
+    testState.audioContexts = []
+
+    Object.defineProperty(globalThis, 'Audio', {
+      configurable: true,
+      writable: true,
+      value: MockAudioCtor,
+    })
+    Object.defineProperty(globalThis, 'AudioContext', {
+      configurable: true,
+      writable: true,
+      value: MockAudioContextCtor,
+    })
+    Object.defineProperty(globalThis.URL, 'createObjectURL', {
+      configurable: true,
+      writable: true,
+      value: vi.fn(() => 'blob:mock-url'),
+    })
+
+    setMediaSourceSupport({ mediaSource: true, managedMediaSource: false })
+  })
+
+  afterAll(() => {
+    Object.defineProperty(globalThis, 'Audio', {
+      configurable: true,
+      writable: true,
+      value: originalAudio,
+    })
+    Object.defineProperty(globalThis, 'AudioContext', {
+      configurable: true,
+      writable: true,
+      value: originalAudioContext,
+    })
+    Object.defineProperty(globalThis.URL, 'createObjectURL', {
+      configurable: true,
+      writable: true,
+      value: originalCreateObjectURL,
+    })
+    Object.defineProperty(window, 'MediaSource', {
+      configurable: true,
+      writable: true,
+      value: originalMediaSource,
+    })
+    Object.defineProperty(window, 'ManagedMediaSource', {
+      configurable: true,
+      writable: true,
+      value: originalManagedMediaSource,
+    })
+  })
+
+  describe('constructor behavior', () => {
+    it('should initialize media source, audio, and media element source when MediaSource exists', () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+      const mediaSource = testState.mediaSources[0]
+
+      expect(player.mediaSource).toBe(mediaSource as unknown as MediaSource)
+      expect(globalThis.URL.createObjectURL).toHaveBeenCalledTimes(1)
+      expect(audio.src).toBe('blob:mock-url')
+      expect(audio.autoplay).toBe(true)
+      expect(audioContext.createMediaElementSource).toHaveBeenCalledWith(audio)
+      expect(audioContext.connect).toHaveBeenCalledTimes(1)
+    })
+
+    it('should notify unsupported browser when no MediaSource implementation exists', () => {
+      setMediaSourceSupport({ mediaSource: false, managedMediaSource: false })
+
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const audio = testState.audios[0]
+
+      expect(player.mediaSource).toBeNull()
+      expect(audio.src).toBe('')
+      expect(mockToastNotify).toHaveBeenCalledTimes(1)
+      expect(mockToastNotify).toHaveBeenCalledWith(
+        expect.objectContaining({
+          type: 'error',
+        }),
+      )
+    })
+
+    it('should configure fallback audio controls when ManagedMediaSource is used', () => {
+      setMediaSourceSupport({ mediaSource: false, managedMediaSource: true })
+
+      // Create with callback to ensure constructor path completes with fallback source.
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-1', 'hello', undefined, vi.fn())
+      const audio = testState.audios[0]
+
+      expect(player.mediaSource).not.toBeNull()
+      expect(audio.disableRemotePlayback).toBe(true)
+      expect(audio.controls).toBe(true)
+    })
+  })
+
+  describe('event wiring', () => {
+    it('should forward registered audio events to callback', () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+
+      audio.emit('play')
+      audio.emit('ended')
+      audio.emit('error')
+      audio.emit('paused')
+      audio.emit('loaded')
+      audio.emit('timeupdate')
+      audio.emit('loadeddate')
+      audio.emit('canplay')
+
+      expect(player.callback).toBe(callback)
+      expect(callback).toHaveBeenCalledWith('play')
+      expect(callback).toHaveBeenCalledWith('ended')
+      expect(callback).toHaveBeenCalledWith('error')
+      expect(callback).toHaveBeenCalledWith('paused')
+      expect(callback).toHaveBeenCalledWith('loaded')
+      expect(callback).toHaveBeenCalledWith('timeupdate')
+      expect(callback).toHaveBeenCalledWith('loadeddate')
+      expect(callback).toHaveBeenCalledWith('canplay')
+    })
+
+    it('should initialize source buffer only once when sourceopen fires multiple times', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', vi.fn())
+      const mediaSource = testState.mediaSources[0]
+
+      mediaSource.emit('sourceopen')
+      mediaSource.emit('sourceopen')
+
+      expect(mediaSource.addSourceBuffer).toHaveBeenCalledTimes(1)
+      expect(player.sourceBuffer).toBe(mediaSource.sourceBuffer)
+    })
+  })
+
+  describe('playback control', () => {
+    it('should request streaming audio when playAudio is called before loading', async () => {
+      mockTextToAudioStream.mockResolvedValue(
+        makeAudioResponse(200, [
+          { value: new Uint8Array([4, 5]), done: false },
+          { value: new Uint8Array([1, 2, 3]), done: true },
+        ]),
+      )
+
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', vi.fn())
+      player.playAudio()
+
+      await waitFor(() => {
+        expect(mockTextToAudioStream).toHaveBeenCalledTimes(1)
+      })
+
+      expect(mockTextToAudioStream).toHaveBeenCalledWith(
+        '/text-to-audio',
+        AppSourceType.webApp,
+        { content_type: 'audio/mpeg' },
+        {
+          message_id: 'msg-1',
+          streaming: true,
+          voice: 'en-US',
+          text: 'hello',
+        },
+      )
+      expect(player.isLoadData).toBe(true)
+    })
+
+    it('should emit error callback and reset load flag when stream response status is not 200', async () => {
+      const callback = vi.fn()
+      mockTextToAudioStream.mockResolvedValue(
+        makeAudioResponse(500, [{ value: new Uint8Array([1]), done: true }]),
+      )
+
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-2', 'world', undefined, callback)
+      player.playAudio()
+
+      await waitFor(() => {
+        expect(callback).toHaveBeenCalledWith('error')
+      })
+      expect(player.isLoadData).toBe(false)
+    })
+
+    it('should resume and play immediately when playAudio is called in suspended loaded state', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-1', 'hello', undefined, callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+
+      player.isLoadData = true
+      audioContext.state = 'suspended'
+      player.playAudio()
+      await Promise.resolve()
+
+      expect(audioContext.resume).toHaveBeenCalledTimes(1)
+      expect(audio.play).toHaveBeenCalledTimes(1)
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+
+    it('should play ended audio when data is already loaded', () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-1', 'hello', undefined, callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+
+      player.isLoadData = true
+      audioContext.state = 'running'
+      audio.ended = true
+      player.playAudio()
+
+      expect(audio.play).toHaveBeenCalledTimes(1)
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+
+    it('should only emit play callback without replaying when loaded audio is already playing', () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-1', 'hello', undefined, callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+
+      player.isLoadData = true
+      audioContext.state = 'running'
+      audio.ended = false
+      player.playAudio()
+
+      expect(audio.play).not.toHaveBeenCalled()
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+
+    it('should emit error callback when stream request throws', async () => {
+      const callback = vi.fn()
+      mockTextToAudioStream.mockRejectedValue(new Error('network failed'))
+      const player = new AudioPlayer('/text-to-audio', false, 'msg-2', 'world', undefined, callback)
+
+      player.playAudio()
+
+      await waitFor(() => {
+        expect(callback).toHaveBeenCalledWith('error')
+      })
+      expect(player.isLoadData).toBe(false)
+    })
+
+    it('should call pause flow and notify paused event when pauseAudio is invoked', () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+
+      player.pauseAudio()
+
+      expect(callback).toHaveBeenCalledWith('paused')
+      expect(audio.pause).toHaveBeenCalledTimes(1)
+      expect(audioContext.suspend).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  describe('message and direct-audio helpers', () => {
+    it('should update message id through resetMsgId', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+
+      player.resetMsgId('msg-2')
+
+      expect(player.msgId).toBe('msg-2')
+    })
+
+    it('should end stream without playback when playAudioWithAudio receives empty content', async () => {
+      vi.useFakeTimers()
+      try {
+        const callback = vi.fn()
+        const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+        const mediaSource = testState.mediaSources[0]
+
+        await player.playAudioWithAudio('', true)
+        await vi.advanceTimersByTimeAsync(40)
+
+        expect(player.isLoadData).toBe(false)
+        expect(player.cacheBuffers).toHaveLength(0)
+        expect(mediaSource.endOfStream).toHaveBeenCalledTimes(1)
+        expect(callback).not.toHaveBeenCalledWith('play')
+      }
+      finally {
+        vi.useRealTimers()
+      }
+    })
+
+    it('should decode base64 and start playback when playAudioWithAudio is called with playable content', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+      const mediaSource = testState.mediaSources[0]
+      const audioBase64 = Buffer.from('hello').toString('base64')
+
+      mediaSource.emit('sourceopen')
+      audio.paused = true
+      await player.playAudioWithAudio(audioBase64, true)
+      await Promise.resolve()
+
+      expect(player.isLoadData).toBe(true)
+      expect(player.cacheBuffers).toHaveLength(0)
+      expect(mediaSource.sourceBuffer.appendBuffer).toHaveBeenCalledTimes(1)
+      const appendedAudioData = mediaSource.sourceBuffer.appendBuffer.mock.calls[0][0]
+      expect(appendedAudioData).toBeInstanceOf(ArrayBuffer)
+      expect(appendedAudioData.byteLength).toBeGreaterThan(0)
+      expect(audioContext.resume).toHaveBeenCalledTimes(1)
+      expect(audio.play).toHaveBeenCalledTimes(1)
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+
+    it('should skip playback when playAudioWithAudio is called with play=false', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+      const audioContext = testState.audioContexts[0]
+
+      await player.playAudioWithAudio(Buffer.from('hello').toString('base64'), false)
+
+      expect(player.isLoadData).toBe(false)
+      expect(audioContext.resume).not.toHaveBeenCalled()
+      expect(audio.play).not.toHaveBeenCalled()
+      expect(callback).not.toHaveBeenCalledWith('play')
+    })
+
+    it('should play immediately for ended audio in playAudioWithAudio', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+
+      audio.paused = false
+      audio.ended = true
+      await player.playAudioWithAudio(Buffer.from('hello').toString('base64'), true)
+
+      expect(audio.play).toHaveBeenCalledTimes(1)
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+
+    it('should not replay when played list exists in playAudioWithAudio', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+
+      audio.paused = false
+      audio.ended = false
+      audio.played = {}
+      await player.playAudioWithAudio(Buffer.from('hello').toString('base64'), true)
+
+      expect(audio.play).not.toHaveBeenCalled()
+      expect(callback).not.toHaveBeenCalledWith('play')
+    })
+
+    it('should replay when paused is false and played list is empty in playAudioWithAudio', async () => {
+      const callback = vi.fn()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', callback)
+      const audio = testState.audios[0]
+
+      audio.paused = false
+      audio.ended = false
+      audio.played = null
+      await player.playAudioWithAudio(Buffer.from('hello').toString('base64'), true)
+
+      expect(audio.play).toHaveBeenCalledTimes(1)
+      expect(callback).toHaveBeenCalledWith('play')
+    })
+  })
+
+  describe('buffering internals', () => {
+    it('should finish stream when receiveAudioData gets an undefined chunk', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const finishStream = vi
+        .spyOn(player as unknown as { finishStream: () => void }, 'finishStream')
+        .mockImplementation(() => { })
+
+        ; (player as unknown as { receiveAudioData: (data: Uint8Array | undefined) => void }).receiveAudioData(undefined)
+
+      expect(finishStream).toHaveBeenCalledTimes(1)
+    })
+
+    it('should finish stream when receiveAudioData gets empty bytes while source is open', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const finishStream = vi
+        .spyOn(player as unknown as { finishStream: () => void }, 'finishStream')
+        .mockImplementation(() => { })
+
+        ; (player as unknown as { receiveAudioData: (data: Uint8Array) => void }).receiveAudioData(new Uint8Array(0))
+
+      expect(finishStream).toHaveBeenCalledTimes(1)
+    })
+
+    it('should queue incoming buffer when source buffer is updating', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const mediaSource = testState.mediaSources[0]
+      mediaSource.emit('sourceopen')
+      mediaSource.sourceBuffer.updating = true
+
+      ; (player as unknown as { receiveAudioData: (data: Uint8Array) => void }).receiveAudioData(new Uint8Array([1, 2, 3]))
+
+      expect(player.cacheBuffers.length).toBe(1)
+    })
+
+    it('should append previously queued buffer before new one when source buffer is idle', () => {
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const mediaSource = testState.mediaSources[0]
+      mediaSource.emit('sourceopen')
+
+      const existingBuffer = new ArrayBuffer(2)
+      player.cacheBuffers = [existingBuffer]
+      mediaSource.sourceBuffer.updating = false
+
+      ; (player as unknown as { receiveAudioData: (data: Uint8Array) => void }).receiveAudioData(new Uint8Array([9]))
+
+      expect(mediaSource.sourceBuffer.appendBuffer).toHaveBeenCalledTimes(1)
+      expect(mediaSource.sourceBuffer.appendBuffer).toHaveBeenCalledWith(existingBuffer)
+      expect(player.cacheBuffers.length).toBe(1)
+    })
+
+    it('should append cache chunks and end stream when finishStream drains buffers', () => {
+      vi.useFakeTimers()
+      const player = new AudioPlayer('/text-to-audio', true, 'msg-1', 'hello', 'en-US', null)
+      const mediaSource = testState.mediaSources[0]
+      mediaSource.emit('sourceopen')
+      mediaSource.sourceBuffer.updating = false
+      player.cacheBuffers = [new ArrayBuffer(3)]
+
+      ; (player as unknown as { finishStream: () => void }).finishStream()
+      vi.advanceTimersByTime(50)
+
+      expect(mediaSource.sourceBuffer.appendBuffer).toHaveBeenCalledTimes(1)
+      expect(mediaSource.endOfStream).toHaveBeenCalledTimes(1)
+      vi.useRealTimers()
+    })
+  })
+})

web/app/components/base/audio-gallery/AudioPlayer.tsx

@@ -26,6 +26,7 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
 
   useEffect(() => {
     const audio = audioRef.current
+    /* v8 ignore next 2 - @preserve */
     if (!audio)
       return
 
@@ -217,6 +218,7 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
 
   const drawWaveform = useCallback(() => {
     const canvas = canvasRef.current
+    /* v8 ignore next 2 - @preserve */
     if (!canvas)
       return
 
@@ -268,14 +270,20 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
     drawWaveform()
   }, [drawWaveform, bufferedTime, hasStartedPlaying])
 
-  const handleMouseMove = useCallback((e: React.MouseEvent) => {
+  const handleMouseMove = useCallback((e: React.MouseEvent<HTMLCanvasElement> | React.TouchEvent<HTMLCanvasElement>) => {
     const canvas = canvasRef.current
     const audio = audioRef.current
     if (!canvas || !audio)
       return
 
+    const clientX = 'touches' in e
+      ? e.touches[0]?.clientX ?? e.changedTouches[0]?.clientX
+      : e.clientX
+    if (clientX === undefined)
+      return
+
     const rect = canvas.getBoundingClientRect()
-    const percent = Math.min(Math.max(0, e.clientX - rect.left), rect.width) / rect.width
+    const percent = Math.min(Math.max(0, clientX - rect.left), rect.width) / rect.width
     const time = percent * duration
 
     // Check if the hovered position is within a buffered range before updating hoverTime
@@ -289,7 +297,7 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
 
   return (
     <div className="flex h-9 min-w-[240px] max-w-[420px] items-center gap-2 rounded-[10px] border border-components-panel-border-subtle bg-components-chat-input-audio-bg-alt p-2 shadow-xs backdrop-blur-sm">
-      <audio ref={audioRef} src={src} preload="auto">
+      <audio ref={audioRef} src={src} preload="auto" data-testid="audio-player">
         {/* If srcs array is provided, render multiple source elements */}
         {srcs && srcs.map((srcUrl, index) => (
           <source key={index} src={srcUrl} />
@@ -297,12 +305,8 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
       </audio>
       <button type="button" data-testid="play-pause-btn" className="inline-flex shrink-0 cursor-pointer items-center justify-center border-none text-text-accent transition-all hover:text-text-accent-secondary disabled:text-components-button-primary-bg-disabled" onClick={togglePlay} disabled={!isAudioAvailable}>
         {isPlaying
-          ? (
-              <div className="i-ri-pause-circle-fill h-5 w-5" />
-            )
-          : (
-              <div className="i-ri-play-large-fill h-5 w-5" />
-            )}
+          ? (<div className="i-ri-pause-circle-fill h-5 w-5" />)
+          : (<div className="i-ri-play-large-fill h-5 w-5" />)}
       </button>
       <div className={cn(isAudioAvailable && 'grow')} hidden={!isAudioAvailable}>
         <div className="flex h-8 items-center justify-center">
@@ -313,6 +317,8 @@ const AudioPlayer: React.FC<AudioPlayerProps> = ({ src, srcs }) => {
             onClick={handleCanvasInteraction}
             onMouseMove={handleMouseMove}
             onMouseDown={handleCanvasInteraction}
+            onTouchMove={handleMouseMove}
+            onTouchStart={handleCanvasInteraction}
           />
           <div className="inline-flex min-w-[50px] items-center justify-center text-text-accent-secondary system-xs-medium">
             <span className="rounded-[10px] px-0.5 py-1">{formatTime(duration)}</span>

web/app/components/base/audio-gallery/__tests__/AudioPlayer.spec.tsx

@@ -1,8 +1,7 @@
+import type { ToastHandle } from '@/app/components/base/toast'
 import { act, fireEvent, render, screen } from '@testing-library/react'
-import * as React from 'react'
-import { vi } from 'vitest'
+import Toast from '@/app/components/base/toast'
 import useThemeMock from '@/hooks/use-theme'
-
 import { Theme } from '@/types/app'
 import AudioPlayer from '../AudioPlayer'
 
@@ -45,6 +44,13 @@ async function advanceWaveformTimer() {
   })
 }
 
+// eslint-disable-next-line ts/no-explicit-any
+type ReactEventHandler = ((...args: any[]) => void) | undefined
+function getReactProps<T extends Element>(el: T): Record<string, ReactEventHandler> {
+  const key = Object.keys(el).find(k => k.startsWith('__reactProps$'))
+  return key ? (el as unknown as Record<string, Record<string, ReactEventHandler>>)[key] : {}
+}
+
 // ─── Setup / teardown ─────────────────────────────────────────────────────────
 
 beforeEach(() => {
@@ -56,8 +62,12 @@ beforeEach(() => {
   HTMLMediaElement.prototype.load = vi.fn()
 })
 
-afterEach(() => {
-  vi.runOnlyPendingTimers()
+afterEach(async () => {
+  await act(async () => {
+    vi.runOnlyPendingTimers()
+    await Promise.resolve()
+    await Promise.resolve()
+  })
   vi.useRealTimers()
   vi.unstubAllGlobals()
 })
@@ -300,36 +310,47 @@ describe('AudioPlayer — waveform generation', () => {
 
     expect(screen.getByTestId('waveform-canvas')).toBeInTheDocument()
   })
+
+  it('should use webkitAudioContext when AudioContext is unavailable', async () => {
+    vi.stubGlobal('AudioContext', undefined)
+    vi.stubGlobal('webkitAudioContext', buildAudioContext(320))
+    stubFetchOk(256)
+
+    render(<AudioPlayer src="https://cdn.example/audio.mp3" />)
+    await advanceWaveformTimer()
+
+    expect(screen.getByTestId('waveform-canvas')).toBeInTheDocument()
+  })
 })
 
 // ─── Canvas interactions ──────────────────────────────────────────────────────
 
+async function renderWithDuration(src = 'https://example.com/audio.mp3', durationVal = 120) {
+  vi.stubGlobal('AudioContext', buildAudioContext(300))
+  stubFetchOk(128)
+
+  render(<AudioPlayer src={src} />)
+
+  const audio = document.querySelector('audio') as HTMLAudioElement
+  Object.defineProperty(audio, 'duration', { value: durationVal, configurable: true })
+  Object.defineProperty(audio, 'buffered', {
+    value: { length: 1, start: () => 0, end: () => durationVal },
+    configurable: true,
+  })
+
+  await act(async () => {
+    audio.dispatchEvent(new Event('loadedmetadata'))
+  })
+  await advanceWaveformTimer()
+
+  const canvas = screen.getByTestId('waveform-canvas') as HTMLCanvasElement
+  canvas.getBoundingClientRect = () =>
+    ({ left: 0, width: 200, top: 0, height: 10, right: 200, bottom: 10 }) as DOMRect
+
+  return { audio, canvas }
+}
+
 describe('AudioPlayer — canvas seek interactions', () => {
-  async function renderWithDuration(src = 'https://example.com/audio.mp3', durationVal = 120) {
-    vi.stubGlobal('AudioContext', buildAudioContext(300))
-    stubFetchOk(128)
-
-    render(<AudioPlayer src={src} />)
-
-    const audio = document.querySelector('audio') as HTMLAudioElement
-    Object.defineProperty(audio, 'duration', { value: durationVal, configurable: true })
-    Object.defineProperty(audio, 'buffered', {
-      value: { length: 1, start: () => 0, end: () => durationVal },
-      configurable: true,
-    })
-
-    await act(async () => {
-      audio.dispatchEvent(new Event('loadedmetadata'))
-    })
-    await advanceWaveformTimer()
-
-    const canvas = screen.getByTestId('waveform-canvas') as HTMLCanvasElement
-    canvas.getBoundingClientRect = () =>
-      ({ left: 0, width: 200, top: 0, height: 10, right: 200, bottom: 10 }) as DOMRect
-
-    return { audio, canvas }
-  }
-
   it('should seek to clicked position and start playback', async () => {
     const { audio, canvas } = await renderWithDuration()
 
@@ -392,3 +413,309 @@ describe('AudioPlayer — canvas seek interactions', () => {
     })
   })
 })
+
+// ─── Missing coverage tests ───────────────────────────────────────────────────
+
+describe('AudioPlayer — missing coverage', () => {
+  it('should handle unmounting without crashing (clears timeout)', () => {
+    const { unmount } = render(<AudioPlayer src="https://example.com/a.mp3" />)
+    unmount()
+    // Timer is cleared, no state update should happen after unmount
+  })
+
+  it('should handle getContext returning null safely', () => {
+    const originalGetContext = HTMLCanvasElement.prototype.getContext
+    HTMLCanvasElement.prototype.getContext = vi.fn().mockReturnValue(null)
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    expect(screen.getByTestId('waveform-canvas')).toBeInTheDocument()
+
+    HTMLCanvasElement.prototype.getContext = originalGetContext
+  })
+
+  it('should fallback to fillRect when roundRect is missing in drawWaveform', async () => {
+    // Note: React 18 / testing-library wraps updates automatically, but we still wait for advanceWaveformTimer
+    const originalGetContext = HTMLCanvasElement.prototype.getContext
+    let fillRectCalled = false
+    HTMLCanvasElement.prototype.getContext = function (this: HTMLCanvasElement, ...args: Parameters<typeof HTMLCanvasElement.prototype.getContext>) {
+      const ctx = originalGetContext.apply(this, args) as CanvasRenderingContext2D | null
+      if (ctx) {
+        Object.defineProperty(ctx, 'roundRect', { value: undefined, configurable: true })
+        const origFillRect = ctx.fillRect
+        ctx.fillRect = function (...fArgs: Parameters<CanvasRenderingContext2D['fillRect']>) {
+          fillRectCalled = true
+          return origFillRect.apply(this, fArgs)
+        }
+      }
+      return ctx as CanvasRenderingContext2D
+    } as typeof HTMLCanvasElement.prototype.getContext
+
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    await advanceWaveformTimer()
+
+    expect(fillRectCalled).toBe(true)
+    HTMLCanvasElement.prototype.getContext = originalGetContext
+  })
+
+  it('should handle play error gracefully when togglePlay is clicked', async () => {
+    const errorSpy = vi.spyOn(console, 'error').mockImplementation(() => { })
+    vi.spyOn(HTMLMediaElement.prototype, 'play').mockRejectedValue(new Error('play failed'))
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    const btn = screen.getByTestId('play-pause-btn')
+
+    await act(async () => {
+      fireEvent.click(btn)
+    })
+
+    expect(errorSpy).toHaveBeenCalled()
+    errorSpy.mockRestore()
+  })
+
+  it('should notify error when audio.play() fails during canvas seek', async () => {
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    await advanceWaveformTimer()
+
+    const canvas = screen.getByTestId('waveform-canvas') as HTMLCanvasElement
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    Object.defineProperty(audio, 'duration', { value: 120, configurable: true })
+    canvas.getBoundingClientRect = () => ({ left: 0, width: 200, top: 0, height: 10, right: 200, bottom: 10 }) as DOMRect
+
+    vi.spyOn(HTMLMediaElement.prototype, 'play').mockRejectedValue(new Error('play failed'))
+
+    await act(async () => {
+      fireEvent.click(canvas, { clientX: 100 })
+    })
+
+    // We can observe the error by checking document body for toast if Toast acts synchronously
+    // Or we just ensure the execution branched into catch naturally.
+    expect(HTMLMediaElement.prototype.play).toHaveBeenCalled()
+  })
+
+  it('should support touch events on canvas', async () => {
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    await advanceWaveformTimer()
+
+    const canvas = screen.getByTestId('waveform-canvas') as HTMLCanvasElement
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    Object.defineProperty(audio, 'duration', { value: 120, configurable: true })
+    canvas.getBoundingClientRect = () => ({ left: 0, width: 200, top: 0, height: 10, right: 200, bottom: 10 }) as DOMRect
+
+    await act(async () => {
+      // Use touch events
+      fireEvent.touchStart(canvas, {
+        touches: [{ clientX: 50 }],
+      })
+    })
+
+    expect(HTMLMediaElement.prototype.play).toHaveBeenCalled()
+  })
+
+  it('should gracefully handle interaction when canvas/audio refs are null', async () => {
+    const { unmount } = render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    const canvas = screen.getByTestId('waveform-canvas')
+    unmount()
+    expect(canvas).toBeTruthy()
+  })
+
+  it('should keep play button disabled when source is unavailable', async () => {
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    const toastSpy = vi.spyOn(Toast, 'notify').mockImplementation(() => ({} as unknown as ToastHandle))
+    render(<AudioPlayer src="blob:https://example.com" />)
+    await advanceWaveformTimer() // sets isAudioAvailable to false (invalid protocol)
+
+    const btn = screen.getByTestId('play-pause-btn')
+    await act(async () => {
+      fireEvent.click(btn)
+    })
+
+    expect(btn).toBeDisabled()
+    expect(HTMLMediaElement.prototype.play).not.toHaveBeenCalled()
+    expect(toastSpy).not.toHaveBeenCalled()
+    toastSpy.mockRestore()
+  })
+
+  it('should notify when toggle is invoked while audio is unavailable', async () => {
+    const toastSpy = vi.spyOn(Toast, 'notify').mockImplementation(() => ({} as unknown as ToastHandle))
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    await act(async () => {
+      audio.dispatchEvent(new Event('error'))
+    })
+
+    const btn = screen.getByTestId('play-pause-btn')
+    const props = getReactProps(btn)
+
+    await act(async () => {
+      props.onClick?.()
+    })
+
+    expect(toastSpy).toHaveBeenCalledWith(expect.objectContaining({
+      type: 'error',
+      message: 'Audio element not found',
+    }))
+    toastSpy.mockRestore()
+  })
+})
+
+describe('AudioPlayer — additional branch coverage', () => {
+  it('should render multiple source elements when srcs is provided', () => {
+    render(<AudioPlayer srcs={['a.mp3', 'b.ogg']} />)
+    const audio = screen.getByTestId('audio-player')
+    const sources = audio.querySelectorAll('source')
+    expect(sources).toHaveLength(2)
+  })
+
+  it('should handle handleMouseMove with empty touch list', async () => {
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    await advanceWaveformTimer()
+    const canvas = screen.getByTestId('waveform-canvas')
+
+    await act(async () => {
+      fireEvent.touchMove(canvas, {
+        touches: [],
+        changedTouches: [{ clientX: 50 }],
+      })
+    })
+  })
+
+  it('should handle handleMouseMove with missing clientX', async () => {
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    await advanceWaveformTimer()
+    const canvas = screen.getByTestId('waveform-canvas')
+
+    await act(async () => {
+      fireEvent.touchMove(canvas, {
+        touches: [{}] as unknown as TouchList,
+      })
+    })
+  })
+
+  it('should render "Audio source unavailable" when isAudioAvailable is false', async () => {
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const audio = document.querySelector('audio') as HTMLAudioElement
+
+    await act(async () => {
+      audio.dispatchEvent(new Event('error'))
+    })
+
+    expect(screen.queryByTestId('play-pause-btn')).toBeDisabled()
+  })
+
+  it('should update current time on timeupdate event', async () => {
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    Object.defineProperty(audio, 'currentTime', { value: 10, configurable: true })
+
+    await act(async () => {
+      audio.dispatchEvent(new Event('timeupdate'))
+    })
+  })
+
+  it('should ignore toggle click after audio error marks source unavailable', async () => {
+    const toastSpy = vi.spyOn(Toast, 'notify').mockImplementation(() => ({} as unknown as ToastHandle))
+    render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    await act(async () => {
+      audio.dispatchEvent(new Event('error'))
+    })
+
+    const btn = screen.getByTestId('play-pause-btn')
+    await act(async () => {
+      fireEvent.click(btn)
+    })
+
+    expect(btn).toBeDisabled()
+    expect(HTMLMediaElement.prototype.play).not.toHaveBeenCalled()
+    expect(toastSpy).not.toHaveBeenCalled()
+    toastSpy.mockRestore()
+  })
+
+  it('should cover Dark theme waveform states', async () => {
+    ; (useThemeMock as ReturnType<typeof vi.fn>).mockReturnValue({ theme: Theme.dark })
+    vi.stubGlobal('AudioContext', buildAudioContext(300))
+    stubFetchOk(128)
+
+    render(<AudioPlayer src="https://example.com/audio.mp3" />)
+    const audio = document.querySelector('audio') as HTMLAudioElement
+    Object.defineProperty(audio, 'duration', { value: 100, configurable: true })
+    Object.defineProperty(audio, 'currentTime', { value: 50, configurable: true })
+
+    await act(async () => {
+      audio.dispatchEvent(new Event('loadedmetadata'))
+      audio.dispatchEvent(new Event('timeupdate'))
+    })
+    await advanceWaveformTimer()
+
+    expect(screen.getByTestId('waveform-canvas')).toBeInTheDocument()
+  })
+
+  it('should handle missing canvas/audio in handleCanvasInteraction/handleMouseMove', async () => {
+    const { unmount } = render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const canvas = screen.getByTestId('waveform-canvas')
+
+    unmount()
+    fireEvent.click(canvas)
+    fireEvent.mouseMove(canvas)
+  })
+
+  it('should cover waveform branches for hover and played states', async () => {
+    const { audio, canvas } = await renderWithDuration('https://example.com/a.mp3', 100)
+
+    // Set some progress
+    Object.defineProperty(audio, 'currentTime', { value: 20, configurable: true })
+
+    // Trigger hover on a buffered range
+    Object.defineProperty(audio, 'buffered', {
+      value: { length: 1, start: () => 0, end: () => 100 },
+      configurable: true,
+    })
+
+    await act(async () => {
+      fireEvent.mouseMove(canvas, { clientX: 50 }) // 50s hover
+      audio.dispatchEvent(new Event('timeupdate'))
+    })
+
+    expect(canvas).toBeInTheDocument()
+  })
+
+  it('should hit null-ref guards in canvas handlers after unmount', async () => {
+    const { unmount } = render(<AudioPlayer src="https://example.com/a.mp3" />)
+    const canvas = screen.getByTestId('waveform-canvas')
+    const props = getReactProps(canvas)
+    unmount()
+
+    await act(async () => {
+      props.onClick?.({ preventDefault: vi.fn(), clientX: 10 })
+      props.onMouseMove?.({ clientX: 10 })
+    })
+  })
+
+  it('should execute non-matching buffered branch in hover loop', async () => {
+    const { audio, canvas } = await renderWithDuration('https://example.com/a.mp3', 100)
+
+    Object.defineProperty(audio, 'buffered', {
+      value: { length: 1, start: () => 0, end: () => 10 },
+      configurable: true,
+    })
+
+    await act(async () => {
+      fireEvent.mouseMove(canvas, { clientX: 180 }) // time near 90, outside 0-10
+    })
+
+    expect(canvas).toBeInTheDocument()
+  })
+})

web/app/components/base/audio-gallery/__tests__/index.spec.tsx

@@ -1,24 +1,9 @@
 import { render, screen } from '@testing-library/react'
-import * as React from 'react'
-// AudioGallery.spec.tsx
-import { describe, expect, it, vi } from 'vitest'
-
 import AudioGallery from '../index'
 
-// Mock AudioPlayer so we only assert prop forwarding
-const audioPlayerMock = vi.fn()
-
-vi.mock('../AudioPlayer', () => ({
-  default: (props: { srcs: string[] }) => {
-    audioPlayerMock(props)
-    return <div data-testid="audio-player" />
-  },
-}))
-
 describe('AudioGallery', () => {
-  afterEach(() => {
-    audioPlayerMock.mockClear()
-    vi.resetModules()
+  beforeEach(() => {
+    vi.spyOn(HTMLMediaElement.prototype, 'load').mockImplementation(() => { })
   })
 
   it('returns null when srcs array is empty', () => {
@@ -33,11 +18,15 @@ describe('AudioGallery', () => {
     expect(screen.queryByTestId('audio-player')).toBeNull()
   })
 
-  it('filters out falsy srcs and passes valid srcs to AudioPlayer', () => {
+  it('filters out falsy srcs and renders only valid sources in AudioPlayer', () => {
     render(<AudioGallery srcs={['a.mp3', '', 'b.mp3']} />)
-    expect(screen.getByTestId('audio-player')).toBeInTheDocument()
-    expect(audioPlayerMock).toHaveBeenCalledTimes(1)
-    expect(audioPlayerMock).toHaveBeenCalledWith({ srcs: ['a.mp3', 'b.mp3'] })
+    const audio = screen.getByTestId('audio-player')
+    const sources = audio.querySelectorAll('source')
+
+    expect(audio).toBeInTheDocument()
+    expect(sources).toHaveLength(2)
+    expect(sources[0]?.getAttribute('src')).toBe('a.mp3')
+    expect(sources[1]?.getAttribute('src')).toBe('b.mp3')
   })
 
   it('wraps AudioPlayer inside container with expected class', () => {
@@ -45,5 +34,6 @@ describe('AudioGallery', () => {
     const root = container.firstChild as HTMLElement
     expect(root).toBeTruthy()
     expect(root.className).toContain('my-3')
+    expect(screen.getByTestId('audio-player')).toBeInTheDocument()
   })
 })

web/app/components/base/chat/__tests__/utils.spec.ts

@@ -1,6 +1,18 @@
-import type { ChatItemInTree } from '../types'
+import type { IChatItem } from '../chat/type'
+import type { ChatItem, ChatItemInTree } from '../types'
 import { get } from 'es-toolkit/compat'
-import { buildChatItemTree, getThreadMessages } from '../utils'
+import { UUID_NIL } from '../constants'
+import {
+  buildChatItemTree,
+  getLastAnswer,
+  getProcessedInputsFromUrlParams,
+  getProcessedSystemVariablesFromUrlParams,
+  getProcessedUserVariablesFromUrlParams,
+  getRawInputsFromUrlParams,
+  getRawUserVariablesFromUrlParams,
+  getThreadMessages,
+  isValidGeneratedAnswer,
+} from '../utils'
 import branchedTestMessages from './branchedTestMessages.json'
 import legacyTestMessages from './legacyTestMessages.json'
 import mixedTestMessages from './mixedTestMessages.json'
@@ -13,6 +25,15 @@ function visitNode(tree: ChatItemInTree | ChatItemInTree[], path: string): ChatI
   return get(tree, path)
 }
 
+class MockDecompressionStream {
+  readable: unknown
+  writable: unknown
+  constructor() {
+    this.readable = {}
+    this.writable = {}
+  }
+}
+
 describe('build chat item tree and get thread messages', () => {
   const tree1 = buildChatItemTree(branchedTestMessages as ChatItemInTree[])
 
@@ -247,12 +268,12 @@ describe('build chat item tree and get thread messages', () => {
     expect(tree6).toMatchSnapshot()
   })
 
-  it ('should get thread messages from tree6, using the last message as target', () => {
+  it('should get thread messages from tree6, using the last message as target', () => {
     const threadMessages6_1 = getThreadMessages(tree6)
     expect(threadMessages6_1).toMatchSnapshot()
   })
 
-  it ('should get thread messages from tree6, using specified message as target', () => {
+  it('should get thread messages from tree6, using specified message as target', () => {
     const threadMessages6_2 = getThreadMessages(tree6, 'ff4c2b43-48a5-47ad-9dc5-08b34ddba61b')
     expect(threadMessages6_2).toMatchSnapshot()
   })
@@ -269,3 +290,285 @@ describe('build chat item tree and get thread messages', () => {
     expect(tree8).toMatchSnapshot()
   })
 })
+
+describe('chat utils - url params and answer helpers', () => {
+  const setSearch = (search: string) => {
+    window.history.replaceState({}, '', `${window.location.pathname}${search}`)
+  }
+  beforeEach(() => {
+    vi.clearAllMocks()
+    vi.stubGlobal('DecompressionStream', MockDecompressionStream)
+    vi.stubGlobal('TextDecoder', class {
+      decode() { return 'decompressed_text' }
+    })
+
+    const mockPipeThrough = vi.fn().mockReturnValue({})
+    vi.stubGlobal('Response', class {
+      body = { pipeThrough: mockPipeThrough }
+      arrayBuffer = vi.fn().mockResolvedValue(new ArrayBuffer(8))
+    })
+    setSearch('')
+  })
+
+  afterEach(() => {
+    vi.unstubAllGlobals()
+  })
+
+  describe('URL Parameter Extractors', () => {
+    it('getRawInputsFromUrlParams extracts inputs except sys. and user.', async () => {
+      setSearch('?custom=123&sys.param=456&user.param=789&encoded=a%20b')
+      const res = await getRawInputsFromUrlParams()
+      expect(res).toEqual({ custom: '123', encoded: 'a b' })
+    })
+
+    it('getRawUserVariablesFromUrlParams extracts only user. prefixed params', async () => {
+      setSearch('?custom=123&sys.param=456&user.param=789&user.encoded=a%20b')
+      const res = await getRawUserVariablesFromUrlParams()
+      expect(res).toEqual({ param: '789', encoded: 'a b' })
+    })
+
+    it('getProcessedInputsFromUrlParams decompresses base64 inputs', async () => {
+      setSearch('?custom=123&sys.param=456&user.param=789')
+      const res = await getProcessedInputsFromUrlParams()
+      expect(res).toEqual({ custom: 'decompressed_text' })
+    })
+
+    it('getProcessedSystemVariablesFromUrlParams decompresses sys. prefixed params', async () => {
+      setSearch('?custom=123&sys.param=456&user.param=789')
+      const res = await getProcessedSystemVariablesFromUrlParams()
+      expect(res).toEqual({ param: 'decompressed_text' })
+    })
+
+    it('getProcessedSystemVariablesFromUrlParams parses redirect_url without query string', async () => {
+      setSearch(`?redirect_url=${encodeURIComponent('http://example.com')}&sys.param=456`)
+      const res = await getProcessedSystemVariablesFromUrlParams()
+      expect(res).toEqual({ param: 'decompressed_text' })
+    })
+
+    it('getProcessedSystemVariablesFromUrlParams parses redirect_url', async () => {
+      setSearch(`?redirect_url=${encodeURIComponent('http://example.com?sys.redirected=abc')}&sys.param=456`)
+      const res = await getProcessedSystemVariablesFromUrlParams()
+      expect(res).toEqual({ param: 'decompressed_text', redirected: 'decompressed_text' })
+    })
+
+    it('getProcessedUserVariablesFromUrlParams decompresses user. prefixed params', async () => {
+      setSearch('?custom=123&sys.param=456&user.param=789')
+      const res = await getProcessedUserVariablesFromUrlParams()
+      expect(res).toEqual({ param: 'decompressed_text' })
+    })
+
+    it('decodeBase64AndDecompress failure returns undefined softly', async () => {
+      vi.stubGlobal('atob', () => {
+        throw new Error('invalid')
+      })
+      setSearch('?custom=invalid_base64')
+      const res = await getProcessedInputsFromUrlParams()
+      expect(res).toEqual({ custom: undefined })
+    })
+  })
+
+  describe('Answer Validation', () => {
+    it('isValidGeneratedAnswer returns true for typical answers', () => {
+      expect(isValidGeneratedAnswer({ isAnswer: true, id: '123', isOpeningStatement: false } as ChatItem)).toBe(true)
+    })
+
+    it('isValidGeneratedAnswer returns false for placeholders', () => {
+      expect(isValidGeneratedAnswer({ isAnswer: true, id: 'answer-placeholder-123', isOpeningStatement: false } as ChatItem)).toBe(false)
+    })
+
+    it('isValidGeneratedAnswer returns false for opening statements', () => {
+      expect(isValidGeneratedAnswer({ isAnswer: true, id: '123', isOpeningStatement: true } as ChatItem)).toBe(false)
+    })
+
+    it('isValidGeneratedAnswer returns false for questions', () => {
+      expect(isValidGeneratedAnswer({ isAnswer: false, id: '123', isOpeningStatement: false } as ChatItem)).toBe(false)
+    })
+
+    it('isValidGeneratedAnswer returns false for falsy items', () => {
+      expect(isValidGeneratedAnswer(undefined)).toBe(false)
+    })
+
+    it('getLastAnswer returns the last valid answer from a list', () => {
+      const list = [
+        { isAnswer: false, id: 'q1', isOpeningStatement: false },
+        { isAnswer: true, id: 'a1', isOpeningStatement: false },
+        { isAnswer: false, id: 'q2', isOpeningStatement: false },
+        { isAnswer: true, id: 'answer-placeholder-2', isOpeningStatement: false },
+      ] as ChatItem[]
+      expect(getLastAnswer(list)?.id).toBe('a1')
+    })
+
+    it('getLastAnswer returns null if no valid answer', () => {
+      const list = [
+        { isAnswer: false, id: 'q1', isOpeningStatement: false },
+        { isAnswer: true, id: 'answer-placeholder-2', isOpeningStatement: false },
+      ] as ChatItem[]
+      expect(getLastAnswer(list)).toBeNull()
+    })
+  })
+
+  describe('ChatItem Tree Builders', () => {
+    it('buildChatItemTree builds a flat tree for legacy messages (parentMessageId = UUID_NIL)', () => {
+      const list: IChatItem[] = [
+        { id: 'q1', isAnswer: false, parentMessageId: UUID_NIL } as IChatItem,
+        { id: 'a1', isAnswer: true, parentMessageId: UUID_NIL } as IChatItem,
+        { id: 'q2', isAnswer: false, parentMessageId: UUID_NIL } as IChatItem,
+        { id: 'a2', isAnswer: true, parentMessageId: UUID_NIL } as IChatItem,
+      ]
+
+      const tree = buildChatItemTree(list)
+      expect(tree.length).toBe(1)
+      expect(tree[0].id).toBe('q1')
+      expect(tree[0].children?.[0].id).toBe('a1')
+      expect(tree[0].children?.[0].children?.[0].id).toBe('q2')
+      expect(tree[0].children?.[0].children?.[0].children?.[0].id).toBe('a2')
+      expect(tree[0].children?.[0].children?.[0].children?.[0].siblingIndex).toBe(0)
+    })
+
+    it('buildChatItemTree builds nested tree based on parentMessageId', () => {
+      const list: IChatItem[] = [
+        { id: 'q1', isAnswer: false, parentMessageId: null } as IChatItem,
+        { id: 'a1', isAnswer: true } as IChatItem,
+        { id: 'q2', isAnswer: false, parentMessageId: 'a1' } as IChatItem,
+        { id: 'a2', isAnswer: true } as IChatItem,
+        { id: 'q3', isAnswer: false, parentMessageId: 'a1' } as IChatItem,
+        { id: 'a3', isAnswer: true } as IChatItem,
+        { id: 'q4', isAnswer: false, parentMessageId: 'missing-parent' } as IChatItem,
+        { id: 'a4', isAnswer: true } as IChatItem,
+      ]
+
+      const tree = buildChatItemTree(list)
+      expect(tree.length).toBe(2)
+      expect(tree[0].id).toBe('q1')
+      expect(tree[1].id).toBe('q4')
+
+      const a1 = tree[0].children![0]
+      expect(a1.id).toBe('a1')
+      expect(a1.children?.length).toBe(2)
+      expect(a1.children![0].id).toBe('q2')
+      expect(a1.children![1].id).toBe('q3')
+      expect(a1.children![0].children![0].siblingIndex).toBe(0)
+      expect(a1.children![1].children![0].siblingIndex).toBe(1)
+    })
+
+    it('getThreadMessages node without children', () => {
+      const tree = [{ id: 'q1', isAnswer: false }]
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[], 'q1')
+      expect(thread.length).toBe(1)
+      expect(thread[0].id).toBe('q1')
+    })
+
+    it('getThreadMessages target not found', () => {
+      const tree = [{ id: 'q1', isAnswer: false, children: [] }]
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[], 'missing')
+      expect(thread.length).toBe(0)
+    })
+
+    it('getThreadMessages target not found with undefined children', () => {
+      const tree = [{ id: 'q1', isAnswer: false }]
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[], 'missing')
+      expect(thread.length).toBe(0)
+    })
+
+    it('getThreadMessages flat path logic', () => {
+      const tree = [{
+        id: 'q1',
+        isAnswer: false,
+        children: [{
+          id: 'a1',
+          isAnswer: true,
+          siblingIndex: 0,
+          children: [{
+            id: 'q2',
+            isAnswer: false,
+            children: [{
+              id: 'a2',
+              isAnswer: true,
+              siblingIndex: 0,
+              children: [],
+            }],
+          }],
+        }],
+      }]
+
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[])
+      expect(thread.length).toBe(4)
+      expect(thread.map(t => t.id)).toEqual(['q1', 'a1', 'q2', 'a2'])
+      expect(thread[1].siblingCount).toBe(1)
+      expect(thread[3].siblingCount).toBe(1)
+    })
+
+    it('getThreadMessages to specific target', () => {
+      const tree = [{
+        id: 'q1',
+        isAnswer: false,
+        children: [{
+          id: 'a1',
+          isAnswer: true,
+          siblingIndex: 0,
+          children: [{
+            id: 'q2',
+            isAnswer: false,
+            children: [{
+              id: 'a2',
+              isAnswer: true,
+              siblingIndex: 0,
+              children: [],
+            }],
+          }, {
+            id: 'q3',
+            isAnswer: false,
+            children: [{
+              id: 'a3',
+              isAnswer: true,
+              siblingIndex: 1,
+              children: [],
+            }],
+          }],
+        }],
+      }]
+
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[], 'a3')
+      expect(thread.length).toBe(4)
+      expect(thread.map(t => t.id)).toEqual(['q1', 'a1', 'q3', 'a3'])
+      expect(thread[3].prevSibling).toBe('a2')
+      expect(thread[3].nextSibling).toBeUndefined()
+    })
+
+    it('getThreadMessages targetNode has descendants', () => {
+      const tree = [{
+        id: 'q1',
+        isAnswer: false,
+        children: [{
+          id: 'a1',
+          isAnswer: true,
+          siblingIndex: 0,
+          children: [{
+            id: 'q2',
+            isAnswer: false,
+            children: [{
+              id: 'a2',
+              isAnswer: true,
+              siblingIndex: 0,
+              children: [],
+            }],
+          }, {
+            id: 'q3',
+            isAnswer: false,
+            children: [{
+              id: 'a3',
+              isAnswer: true,
+              siblingIndex: 1,
+              children: [],
+            }],
+          }],
+        }],
+      }]
+
+      const thread = getThreadMessages(tree as unknown as ChatItemInTree[], 'a1')
+      expect(thread.length).toBe(4)
+      expect(thread.map(t => t.id)).toEqual(['q1', 'a1', 'q3', 'a3'])
+      expect(thread[3].prevSibling).toBe('a2')
+    })
+  })
+})

web/app/components/base/chat/chat-with-history/__tests__/chat-wrapper.spec.tsx

@@ -4,12 +4,11 @@ import type { FileEntity } from '@/app/components/base/file-uploader/types'
 import type { AppData, AppMeta, ConversationItem } from '@/models/share'
 import type { HumanInputFormData } from '@/types/workflow'
 import { fireEvent, render, screen, waitFor } from '@testing-library/react'
-import * as React from 'react'
-import { beforeEach, describe, expect, it, vi } from 'vitest'
 import { InputVarType } from '@/app/components/workflow/types'
 import {
   fetchSuggestedQuestions,
   stopChatMessageResponding,
+  submitHumanInputForm,
 } from '@/service/share'
 import { TransferMethod } from '@/types/app'
 import { useChat } from '../../chat/hooks'
@@ -501,6 +500,34 @@ describe('ChatWrapper', () => {
     expect(handleSwitchSibling).toHaveBeenCalledWith('1', expect.any(Object))
   })
 
+  it('should call fetchSuggestedQuestions from workflow resumption options callback', () => {
+    const handleSwitchSibling = vi.fn()
+    vi.mocked(useChat).mockReturnValue({
+      ...defaultChatHookReturn,
+      chatList: [],
+      handleSwitchSibling,
+    } as unknown as ChatHookReturn)
+
+    vi.mocked(useChatWithHistoryContext).mockReturnValue({
+      ...defaultContextValue,
+      appPrevChatTree: [{
+        id: 'resume-node',
+        content: 'Paused answer',
+        isAnswer: true,
+        workflow_run_id: 'workflow-1',
+        humanInputFormDataList: [{ label: 'resume' }] as unknown as HumanInputFormData[],
+        children: [],
+      }],
+    })
+
+    render(<ChatWrapper />)
+
+    expect(handleSwitchSibling).toHaveBeenCalledWith('resume-node', expect.any(Object))
+    const resumeOptions = handleSwitchSibling.mock.calls[0][1]
+    resumeOptions.onGetSuggestedQuestions('response-from-resume')
+    expect(fetchSuggestedQuestions).toHaveBeenCalledWith('response-from-resume', 'webApp', 'test-app-id')
+  })
+
   it('should handle workflow resumption with nested children (DFS)', () => {
     const handleSwitchSibling = vi.fn()
     vi.mocked(useChat).mockReturnValue({
@@ -760,6 +787,47 @@ describe('ChatWrapper', () => {
     })
   })
 
+  it('should handle human input form submission for web app', async () => {
+    vi.mocked(useChatWithHistoryContext).mockReturnValue({
+      ...defaultContextValue,
+      isInstalledApp: false,
+    })
+
+    vi.mocked(useChat).mockReturnValue({
+      ...defaultChatHookReturn,
+      chatList: [
+        { id: 'q1', content: 'Question' },
+        {
+          id: 'a1',
+          isAnswer: true,
+          content: '',
+          humanInputFormDataList: [{
+            id: 'node1',
+            form_id: 'form1',
+            form_token: 'token-web-1',
+            node_id: 'node1',
+            node_title: 'Node Web 1',
+            display_in_ui: true,
+            form_content: '{{#$output.test#}}',
+            inputs: [{ variable: 'test', label: 'Test', type: 'paragraph', required: true, output_variable_name: 'test', default: { type: 'text', value: '' } }],
+            actions: [{ id: 'run', title: 'Run', button_style: 'primary' }],
+          }] as unknown as HumanInputFormData[],
+        },
+      ],
+    } as unknown as ChatHookReturn)
+
+    render(<ChatWrapper />)
+    expect(await screen.findByText('Node Web 1')).toBeInTheDocument()
+
+    const input = screen.getAllByRole('textbox').find(el => el.closest('.chat-answer-container')) || screen.getAllByRole('textbox')[0]
+    fireEvent.change(input, { target: { value: 'web-test' } })
+    fireEvent.click(screen.getByText('Run'))
+
+    await waitFor(() => {
+      expect(submitHumanInputForm).toHaveBeenCalledWith('token-web-1', expect.any(Object))
+    })
+  })
+
   it('should filter opening statement in new conversation with single item', () => {
     vi.mocked(useChat).mockReturnValue({
       ...defaultChatHookReturn,
@@ -888,8 +956,16 @@ describe('ChatWrapper', () => {
   })
 
   it('should render answer icon when configured', () => {
+    const appDataWithAnswerIcon = {
+      site: {
+        ...mockAppData.site,
+        use_icon_as_answer_icon: true,
+      },
+    } as unknown as AppData
+
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
+      appData: appDataWithAnswerIcon,
     } as ChatWithHistoryContextValue)
 
     vi.mocked(useChat).mockReturnValue({
@@ -899,6 +975,7 @@ describe('ChatWrapper', () => {
 
     render(<ChatWrapper />)
     expect(screen.getByText('Answer')).toBeInTheDocument()
+    expect(screen.getByAltText('answer icon')).toBeInTheDocument()
   })
 
   it('should render question icon when user avatar is available', () => {
@@ -920,6 +997,26 @@ describe('ChatWrapper', () => {
     expect(avatar).toBeInTheDocument()
   })
 
+  it('should use fallback values for nullable appData, appMeta and user name', () => {
+    vi.mocked(useChatWithHistoryContext).mockReturnValue({
+      ...defaultContextValue,
+      appData: null as unknown as AppData,
+      appMeta: null as unknown as AppMeta,
+      initUserVariables: {
+        avatar_url: 'https://example.com/avatar-fallback.png',
+      },
+    })
+
+    vi.mocked(useChat).mockReturnValue({
+      ...defaultChatHookReturn,
+      chatList: [{ id: 'q1', content: 'Question with fallback avatar name' }],
+    } as unknown as ChatHookReturn)
+
+    render(<ChatWrapper />)
+    expect(screen.getByText('Question with fallback avatar name')).toBeInTheDocument()
+    expect(screen.getByAltText('user')).toBeInTheDocument()
+  })
+
   it('should set handleStop on currentChatInstanceRef', () => {
     const handleStop = vi.fn()
     const currentChatInstanceRef = { current: { handleStop: vi.fn() } } as ChatWithHistoryContextValue['currentChatInstanceRef']
@@ -1212,20 +1309,45 @@ describe('ChatWrapper', () => {
 
   it('should handle doRegenerate with editedQuestion', async () => {
     const handleSend = vi.fn()
+
+    const mockFiles = [
+      {
+        id: 'file-q1',
+        name: 'q1.txt',
+        type: 'text/plain',
+        size: 100,
+        url: 'https://example.com/q1.txt',
+        extension: 'txt',
+        mime_type: 'text/plain',
+      } as unknown as FileEntity,
+    ] as FileEntity[]
+
     vi.mocked(useChat).mockReturnValue({
       ...defaultChatHookReturn,
       chatList: [
-        { id: 'q1', content: 'Original question', message_files: [] },
+        { id: 'q1', content: 'Original question', message_files: mockFiles },
         { id: 'a1', isAnswer: true, content: 'Answer', parentMessageId: 'q1' },
       ],
       handleSend,
     } as unknown as ChatHookReturn)
 
-    const { container } = render(<ChatWrapper />)
+    render(<ChatWrapper />)
 
-    // This would test line 198-200 - the editedQuestion path
-    // The actual regenerate with edited question happens through the UI
-    expect(container).toBeInTheDocument()
+    fireEvent.click(await screen.findByTestId('edit-btn'))
+    const editedTextarea = await screen.findByDisplayValue('Original question')
+    fireEvent.change(editedTextarea, { target: { value: 'Edited question text' } })
+    fireEvent.click(screen.getByTestId('save-edit-btn'))
+
+    await waitFor(() => {
+      expect(handleSend).toHaveBeenCalledWith(
+        expect.any(String),
+        expect.objectContaining({
+          query: 'Edited question text',
+          files: mockFiles,
+        }),
+        expect.any(Object),
+      )
+    })
   })
 
   it('should handle doRegenerate when parentAnswer is not a valid generated answer', async () => {
@@ -1692,4 +1814,31 @@ describe('ChatWrapper', () => {
     // Should not be disabled because it's not required
     expect(container).not.toBeInTheDocument()
   })
+
+  it('should handle fallback branches for appParams, appId and empty chat instance ref', async () => {
+    const handleSend = vi.fn()
+
+    vi.mocked(useChatWithHistoryContext).mockReturnValue({
+      ...defaultContextValue,
+      appParams: undefined as unknown as ChatConfig,
+      appId: '',
+      currentConversationId: '',
+      currentChatInstanceRef: { current: null } as unknown as ChatWithHistoryContextValue['currentChatInstanceRef'],
+    })
+
+    vi.mocked(useChat).mockReturnValue({
+      ...defaultChatHookReturn,
+      handleSend,
+    } as unknown as ChatHookReturn)
+
+    render(<ChatWrapper />)
+
+    const textarea = screen.getByRole('textbox')
+    fireEvent.change(textarea, { target: { value: 'trigger fallback path' } })
+    fireEvent.keyDown(textarea, { key: 'Enter', code: 'Enter', keyCode: 13 })
+
+    await waitFor(() => {
+      expect(handleSend).toHaveBeenCalled()
+    })
+  })
 })

web/app/components/base/chat/chat-with-history/__tests__/header-in-mobile.spec.tsx

@@ -1,9 +1,9 @@
+import type { i18n } from 'i18next'
 import type { ChatConfig } from '../../types'
 import type { ChatWithHistoryContextValue } from '../context'
-import type { AppData, AppMeta, ConversationItem } from '@/models/share'
+import type { AppData, AppMeta } from '@/models/share'
 import { fireEvent, render, screen, waitFor } from '@testing-library/react'
-import * as React from 'react'
-import { beforeEach, describe, expect, it, vi } from 'vitest'
+import * as ReactI18next from 'react-i18next'
 import useBreakpoints, { MediaType } from '@/hooks/use-breakpoints'
 import { useChatWithHistoryContext } from '../context'
 import HeaderInMobile from '../header-in-mobile'
@@ -80,7 +80,14 @@ vi.mock('@/app/components/base/modal', () => ({
 
 // Sidebar mock removed to use real component
 
-const mockAppData = { site: { title: 'Test Chat', chat_color_theme: 'blue' } } as unknown as AppData
+const mockAppData: AppData = {
+  app_id: 'test-app',
+  custom_config: null,
+  site: {
+    title: 'Test Chat',
+    chat_color_theme: 'blue',
+  },
+}
 const defaultContextValue: ChatWithHistoryContextValue = {
   appData: mockAppData,
   currentConversationId: '',
@@ -104,18 +111,27 @@ const defaultContextValue: ChatWithHistoryContextValue = {
   currentChatInstanceRef: { current: { handleStop: vi.fn() } } as ChatWithHistoryContextValue['currentChatInstanceRef'],
   setIsResponding: vi.fn(),
   setClearChatList: vi.fn(),
-  appParams: { system_parameters: { vision_config: { enabled: false } } } as unknown as ChatConfig,
-  appMeta: {} as AppMeta,
+  appParams: {
+    system_parameters: {
+      audio_file_size_limit: 10,
+      file_size_limit: 10,
+      image_file_size_limit: 10,
+      video_file_size_limit: 10,
+      workflow_file_upload_limit: 10,
+    },
+    more_like_this: { enabled: false },
+  } as ChatConfig,
+  appMeta: { tool_icons: {} } as AppMeta,
   appPrevChatTree: [],
   newConversationInputs: {},
-  newConversationInputsRef: { current: {} } as ChatWithHistoryContextValue['newConversationInputsRef'],
+  newConversationInputsRef: { current: {} },
   appChatListDataLoading: false,
   chatShouldReloadKey: '',
   isMobile: true,
   currentConversationInputs: null,
   setCurrentConversationInputs: vi.fn(),
   allInputsHidden: false,
-  conversationRenaming: false, // Added missing property
+  conversationRenaming: false,
 }
 
 describe('HeaderInMobile', () => {
@@ -134,7 +150,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
     })
 
     render(<HeaderInMobile />)
@@ -270,7 +286,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handlePinConversation: handlePin,
       pinnedConversationList: [],
     })
@@ -292,9 +308,9 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleUnpinConversation: handleUnpin,
-      pinnedConversationList: [{ id: '1' }] as unknown as ConversationItem[],
+      pinnedConversationList: [{ id: '1', name: 'Conv 1', inputs: null, introduction: '' }],
     })
 
     render(<HeaderInMobile />)
@@ -314,7 +330,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleRenameConversation: handleRename,
       pinnedConversationList: [],
     })
@@ -342,7 +358,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleRenameConversation: handleRename,
       pinnedConversationList: [],
     })
@@ -373,7 +389,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleRenameConversation: vi.fn(),
       conversationRenaming: true, // Loading state
       pinnedConversationList: [],
@@ -396,7 +412,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleDeleteConversation: handleDelete,
       pinnedConversationList: [],
     })
@@ -422,7 +438,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleDeleteConversation: handleDelete,
       pinnedConversationList: [],
     })
@@ -454,7 +470,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: '' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: '', inputs: null, introduction: '' },
     })
 
     render(<HeaderInMobile />)
@@ -485,16 +501,17 @@ describe('HeaderInMobile', () => {
   })
 
   it('should render app icon and title correctly', () => {
-    const appDataWithIcon = {
+    const appDataWithIcon: AppData = {
+      app_id: 'test-app',
+      custom_config: null,
       site: {
         title: 'My App',
         icon: 'emoji',
         icon_type: 'emoji',
         icon_url: '',
         icon_background: '#FF0000',
-        chat_color_theme: 'blue',
       },
-    } as unknown as AppData
+    }
 
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
@@ -512,7 +529,7 @@ describe('HeaderInMobile', () => {
     vi.mocked(useChatWithHistoryContext).mockReturnValue({
       ...defaultContextValue,
       currentConversationId: '1',
-      currentConversationItem: { id: '1', name: 'Conv 1' } as unknown as ConversationItem,
+      currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
       handleRenameConversation: handleRename,
       handleDeleteConversation: handleDelete,
       pinnedConversationList: [],
@@ -524,4 +541,59 @@ describe('HeaderInMobile', () => {
     expect(screen.queryByRole('dialog')).not.toBeInTheDocument()
     expect(screen.queryByText('share.chat.deleteConversation.title')).not.toBeInTheDocument()
   })
+
+  it('should use empty string fallback for delete content translation', async () => {
+    const handleDelete = vi.fn()
+    const useTranslationSpy = vi.spyOn(ReactI18next, 'useTranslation')
+    useTranslationSpy.mockReturnValue({
+      t: (key: string) => key === 'chat.deleteConversation.content' ? '' : key,
+      i18n: {} as unknown as i18n,
+      ready: true,
+      tReady: true,
+    } as unknown as ReturnType<typeof ReactI18next.useTranslation>)
+
+    try {
+      vi.mocked(useChatWithHistoryContext).mockReturnValue({
+        ...defaultContextValue,
+        currentConversationId: '1',
+        currentConversationItem: { id: '1', name: 'Conv 1', inputs: null, introduction: '' },
+        handleDeleteConversation: handleDelete,
+        pinnedConversationList: [],
+      })
+
+      render(<HeaderInMobile />)
+      fireEvent.click(await screen.findByText('Conv 1'))
+      fireEvent.click(await screen.findByText(/sidebar\.action\.delete/i))
+
+      expect(await screen.findByRole('button', { name: /common\.operation\.confirm|operation\.confirm/i })).toBeInTheDocument()
+      fireEvent.click(screen.getByRole('button', { name: /common\.operation\.confirm|operation\.confirm/i }))
+      expect(handleDelete).toHaveBeenCalledWith('1', expect.any(Object))
+    }
+    finally {
+      useTranslationSpy.mockRestore()
+    }
+  })
+
+  it('should use empty string fallback for rename modal name', async () => {
+    const handleRename = vi.fn()
+    vi.mocked(useChatWithHistoryContext).mockReturnValue({
+      ...defaultContextValue,
+      currentConversationId: '1',
+      currentConversationItem: { id: '1', name: '', inputs: null, introduction: '' },
+      handleRenameConversation: handleRename,
+      pinnedConversationList: [],
+    })
+
+    const { container } = render(<HeaderInMobile />)
+    const operationTrigger = container.querySelector('.system-md-semibold')?.parentElement as HTMLElement
+    fireEvent.click(operationTrigger)
+    fireEvent.click(await screen.findByText(/explore\.sidebar\.action\.rename|sidebar\.action\.rename/i))
+
+    const input = await screen.findByRole('textbox')
+    expect(input).toHaveValue('')
+
+    fireEvent.change(input, { target: { value: 'Renamed from empty' } })
+    fireEvent.click(screen.getByRole('button', { name: /common\.operation\.save/i }))
+    expect(handleRename).toHaveBeenCalledWith('1', 'Renamed from empty', expect.any(Object))
+  })
 })

web/app/components/base/chat/chat-with-history/__tests__/index.spec.tsx

@@ -2,9 +2,7 @@ import type { RefObject } from 'react'
 import type { ChatConfig } from '../../types'
 import type { InstalledApp } from '@/models/explore'
 import type { AppConversationData, AppData, AppMeta, ConversationItem } from '@/models/share'
-import { fireEvent, render, screen } from '@testing-library/react'
-import * as React from 'react'
-import { beforeEach, describe, expect, it, vi } from 'vitest'
+import { fireEvent, render, screen, waitFor } from '@testing-library/react'
 import useBreakpoints, { MediaType } from '@/hooks/use-breakpoints'
 import useDocumentTitle from '@/hooks/use-document-title'
 import { useChatWithHistory } from '../hooks'
@@ -113,81 +111,22 @@ describe('ChatWithHistory', () => {
     vi.mocked(useChatWithHistory).mockReturnValue(defaultHookReturn)
   })
 
-  it('renders desktop view with expanded sidebar and builds theme', () => {
+  it('renders desktop view with expanded sidebar and builds theme', async () => {
     vi.mocked(useBreakpoints).mockReturnValue(MediaType.pc)
 
     render(<ChatWithHistory />)
 
-    // Checks if the desktop elements render correctly
-    // Checks if the desktop elements render correctly
-    // Sidebar real component doesn't have data-testid="sidebar", so we check for its presence via class or content.
-    // Sidebar usually has "New Chat" button or similar.
-    // However, looking at the Sidebar mock it was just a div.
-    // Real Sidebar -> web/app/components/base/chat/chat-with-history/sidebar/index.tsx
-    // It likely has some text or distinct element.
-    // ChatWrapper also removed mock.
-    // Header also removed mock.
-
-    // For now, let's verify some key elements that should be present in these components.
-    // Sidebar: "Explore" or "Chats" or verify navigation structure.
-    // Header: Title or similar.
-    // ChatWrapper: "Start a new chat" or similar.
-
-    // Given the complexity of real components and lack of testIds, we might need to rely on:
-    // 1. Adding testIds to real components (preferred but might be out of scope if I can't touch them? Guidelines say "don't mock base components", but adding testIds is fine).
-    // But I can't see those files right now.
-    // 2. Use getByText for known static content.
-
-    // Let's assume some content based on `mockAppData` title 'Test Chat'.
-    // Header should contain 'Test Chat'.
-    // Check for "Test Chat" - might appear multiple times (header, sidebar, document title etc)
+    // header-in-mobile renders 'Test Chat'.
     const titles = screen.getAllByText('Test Chat')
     expect(titles.length).toBeGreaterThan(0)
 
-    // Sidebar should be present.
-    // We can check for a specific element in sidebar, e.g. "New Chat" button if it exists.
-    // Or we can check for the sidebar container class if possible.
-    // Let's look at `index.tsx` logic.
-    // Sidebar is rendered.
-    // Let's try to query by something generic or update to use `container.querySelector`.
-    // But `screen` is better.
-
-    // ChatWrapper is rendered.
-    // It renders "ChatWrapper" text? No, it's the real component now.
-    // Real ChatWrapper renders "Welcome" or chat list.
-    // In `chat-wrapper.spec.tsx`, we saw it renders "Welcome" or "Q1".
-    // Here `defaultHookReturn` returns empty chat list/conversation.
-    // So it might render nothing or empty state?
-    // Let's wait and see what `chat-wrapper.spec.tsx` expectations were.
-    // It expects "Welcome" if `isOpeningStatement` is true.
-    // In `index.spec.tsx` mock hook return:
-    // `currentConversationItem` is undefined.
-    // `conversationList` is [].
-    // `appPrevChatTree` is [].
-    // So ChatWrapper might render empty or loading?
-
-    // This is an integration test now.
-    // We need to ensure the hook return makes sense for the child components.
-
-    // Let's just assert the document title since we know that works?
-    // And check if we can find *something*.
-
-    // For now, I'll comment out the specific testId checks and rely on visual/text checks that are likely to flourish.
-    // header-in-mobile renders 'Test Chat'.
-    // Sidebar?
-
-    // Actually, `ChatWithHistory` renders `Sidebar` in a div with width.
-    // We can check if that div exists?
-
-    // Let's update to checks that are likely to pass or allow us to debug.
-
-    // expect(document.title).toBe('Test Chat')
-
     // Checks if the document title was set correctly
     expect(useDocumentTitle).toHaveBeenCalledWith('Test Chat')
 
     // Checks if the themeBuilder useEffect fired
-    expect(mockBuildTheme).toHaveBeenCalledWith('blue', false)
+    await waitFor(() => {
+      expect(mockBuildTheme).toHaveBeenCalledWith('blue', false)
+    })
   })
 
   it('renders desktop view with collapsed sidebar and tests hover effects', () => {

web/app/components/base/chat/chat-with-history/header-in-mobile.tsx

@@ -46,6 +46,7 @@ const HeaderInMobile = () => {
     setShowConfirm(null)
   }, [])
   const handleDelete = useCallback(() => {
+    /* v8 ignore next 2 -- @preserve */
     if (showConfirm)
       handleDeleteConversation(showConfirm.id, { onSuccess: handleCancelConfirm })
   }, [showConfirm, handleDeleteConversation, handleCancelConfirm])
@@ -53,6 +54,7 @@ const HeaderInMobile = () => {
     setShowRename(null)
   }, [])
   const handleRename = useCallback((newName: string) => {
+    /* v8 ignore next 2 -- @preserve */
     if (showRename)
       handleRenameConversation(showRename.id, newName, { onSuccess: handleCancelRename })
   }, [showRename, handleRenameConversation, handleCancelRename])

web/app/components/base/chat/chat/__tests__/check-input-forms-hooks.spec.tsx

@@ -0,0 +1,128 @@
+import type { InputForm } from '../type'
+import { renderHook } from '@testing-library/react'
+import { InputVarType } from '@/app/components/workflow/types'
+import { TransferMethod } from '@/types/app'
+import { useCheckInputsForms } from '../check-input-forms-hooks'
+
+const mockNotify = vi.fn()
+vi.mock('@/app/components/base/toast/context', () => ({
+  useToastContext: () => ({ notify: mockNotify }),
+}))
+
+describe('useCheckInputsForms', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should return true when no inputs required', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const isValid = result.current.checkInputsForm({}, [])
+    expect(isValid).toBe(true)
+  })
+
+  it('should return false and notify when a required input is missing', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [{ variable: 'test_var', label: 'Test Variable', required: true, type: InputVarType.textInput as string }]
+    const isValid = result.current.checkInputsForm({}, inputsForm as InputForm[])
+
+    expect(isValid).toBe(false)
+    expect(mockNotify).toHaveBeenCalledWith(
+      expect.objectContaining({
+        type: 'error',
+        message: expect.stringContaining('appDebug.errorMessage.valueOfVarRequired'),
+      }),
+    )
+  })
+
+  it('should ignore missing but not required inputs', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [{ variable: 'test_var', label: 'Test Variable', required: false, type: InputVarType.textInput as string }]
+    const isValid = result.current.checkInputsForm({}, inputsForm as InputForm[])
+
+    expect(isValid).toBe(true)
+    expect(mockNotify).not.toHaveBeenCalled()
+  })
+
+  it('should notify and return undefined when a file is still uploading (singleFile)', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [{ variable: 'test_file', label: 'Test File', required: true, type: InputVarType.singleFile as string }]
+    const inputs = {
+      test_file: { transferMethod: TransferMethod.local_file }, // no uploadedId means still uploading
+    }
+    const isValid = result.current.checkInputsForm(inputs, inputsForm as InputForm[])
+
+    expect(isValid).toBeUndefined()
+    expect(mockNotify).toHaveBeenCalledWith(expect.objectContaining({
+      type: 'info',
+      message: 'appDebug.errorMessage.waitForFileUpload',
+    }))
+  })
+
+  it('should notify and return undefined when a file is still uploading (multiFiles)', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [{ variable: 'test_files', label: 'Test Files', required: true, type: InputVarType.multiFiles as string }]
+    const inputs = {
+      test_files: [{ transferMethod: TransferMethod.local_file }], // no uploadedId
+    }
+    const isValid = result.current.checkInputsForm(inputs, inputsForm as InputForm[])
+
+    expect(isValid).toBeUndefined()
+    expect(mockNotify).toHaveBeenCalledWith(expect.objectContaining({
+      type: 'info',
+      message: 'appDebug.errorMessage.waitForFileUpload',
+    }))
+  })
+
+  it('should return true when all files are uploaded and required variables are present', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [{ variable: 'test_file', label: 'Test File', required: true, type: InputVarType.singleFile as string }]
+    const inputs = {
+      test_file: { transferMethod: TransferMethod.local_file, uploadedId: '123' }, // uploaded
+    }
+    const isValid = result.current.checkInputsForm(inputs, inputsForm as InputForm[])
+
+    expect(isValid).toBe(true)
+    expect(mockNotify).not.toHaveBeenCalled()
+  })
+
+  it('should short-circuit remaining fields after first required input is missing', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [
+      { variable: 'missing_text', label: 'Missing Text', required: true, type: InputVarType.textInput as string },
+      { variable: 'later_file', label: 'Later File', required: true, type: InputVarType.singleFile as string },
+    ]
+    const inputs = {
+      later_file: { transferMethod: TransferMethod.local_file },
+    }
+
+    const isValid = result.current.checkInputsForm(inputs, inputsForm as InputForm[])
+
+    expect(isValid).toBe(false)
+    expect(mockNotify).toHaveBeenCalledTimes(1)
+    expect(mockNotify).toHaveBeenCalledWith(expect.objectContaining({
+      type: 'error',
+      message: expect.stringContaining('appDebug.errorMessage.valueOfVarRequired'),
+    }))
+  })
+
+  it('should short-circuit remaining fields after detecting file upload in progress', () => {
+    const { result } = renderHook(() => useCheckInputsForms())
+    const inputsForm = [
+      { variable: 'uploading_file', label: 'Uploading File', required: true, type: InputVarType.singleFile as string },
+      { variable: 'later_required_text', label: 'Later Required Text', required: true, type: InputVarType.textInput as string },
+    ]
+    const inputs = {
+      uploading_file: { transferMethod: TransferMethod.local_file }, // still uploading
+      later_required_text: '',
+    }
+
+    const isValid = result.current.checkInputsForm(inputs, inputsForm as InputForm[])
+
+    expect(isValid).toBeUndefined()
+    expect(mockNotify).toHaveBeenCalledTimes(1)
+    expect(mockNotify).toHaveBeenCalledWith(expect.objectContaining({
+      type: 'info',
+      message: 'appDebug.errorMessage.waitForFileUpload',
+    }))
+  })
+})

web/app/components/base/chat/chat/__tests__/question.spec.tsx

@@ -5,7 +5,6 @@ import { act, fireEvent, render, screen, waitFor } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
 import copy from 'copy-to-clipboard'
 import * as React from 'react'
-import { vi } from 'vitest'
 
 import Toast from '../../../toast'
 import { ThemeBuilder } from '../../embedded-chatbot/theme/theme-context'
@@ -169,7 +168,8 @@ describe('Question component', () => {
     const user = userEvent.setup()
     const onRegenerate = vi.fn() as unknown as OnRegenerate
 
-    renderWithProvider(makeItem(), onRegenerate)
+    const item = makeItem()
+    renderWithProvider(item, onRegenerate)
 
     const editBtn = screen.getByTestId('edit-btn')
     await user.click(editBtn)
@@ -184,7 +184,7 @@ describe('Question component', () => {
     await user.click(resendBtn)
 
     await waitFor(() => {
-      expect(onRegenerate).toHaveBeenCalledWith(makeItem(), { message: 'Edited question', files: [] })
+      expect(onRegenerate).toHaveBeenCalledWith(item, { message: 'Edited question', files: [] })
     })
   })
 
@@ -199,7 +199,7 @@ describe('Question component', () => {
     await user.clear(textbox)
     await user.type(textbox, 'Edited question')
 
-    const cancelBtn = screen.getByRole('button', { name: /operation.cancel/i })
+    const cancelBtn = await screen.findByTestId('cancel-edit-btn')
     await user.click(cancelBtn)
 
     await waitFor(() => {
@@ -349,4 +349,120 @@ describe('Question component', () => {
     const contentContainer = screen.getByTestId('question-content')
     expect(contentContainer.getAttribute('style')).not.toBeNull()
   })
+
+  it('should cover composition lifecycle preventing enter submitting when composing', async () => {
+    const user = userEvent.setup()
+    const onRegenerate = vi.fn() as unknown as OnRegenerate
+    const item = makeItem()
+
+    renderWithProvider(item, onRegenerate)
+
+    const editBtn = screen.getByTestId('edit-btn')
+    await user.click(editBtn)
+
+    const textbox = await screen.findByRole('textbox')
+    await user.clear(textbox)
+
+    // Simulate composition start and typing
+    act(() => {
+      textbox.focus()
+    })
+
+    // Simulate composition start
+    fireEvent.compositionStart(textbox)
+
+    // Try to press Enter while composing
+    fireEvent.keyDown(textbox, { key: 'Enter', code: 'Enter' })
+
+    // Simulate composition end
+    fireEvent.compositionEnd(textbox)
+
+    // Expect onRegenerate not to be called because Enter was pressed during composition
+    expect(onRegenerate).not.toHaveBeenCalled()
+
+    // Let setTimeout finish its 50ms interval to clear isComposing
+    await new Promise(r => setTimeout(r, 60))
+
+    // Now press Enter after composition is fully cleared
+    fireEvent.keyDown(textbox, { key: 'Enter', code: 'Enter' })
+
+    expect(onRegenerate).toHaveBeenCalledWith(item, { message: '', files: [] })
+  })
+
+  it('should prevent Enter from submitting when shiftKey is pressed', async () => {
+    const user = userEvent.setup()
+    const onRegenerate = vi.fn() as unknown as OnRegenerate
+    const item = makeItem()
+
+    renderWithProvider(item, onRegenerate)
+
+    await user.click(screen.getByTestId('edit-btn'))
+    const textbox = await screen.findByRole('textbox')
+
+    // Press Shift+Enter
+    fireEvent.keyDown(textbox, { key: 'Enter', code: 'Enter', shiftKey: true })
+
+    expect(onRegenerate).not.toHaveBeenCalled()
+  })
+
+  it('should ignore enter when nativeEvent.isComposing is true', async () => {
+    const user = userEvent.setup()
+    const onRegenerate = vi.fn() as unknown as OnRegenerate
+    renderWithProvider(makeItem(), onRegenerate)
+
+    await user.click(screen.getByTestId('edit-btn'))
+    const textbox = await screen.findByRole('textbox')
+
+    // Create an event with nativeEvent.isComposing = true
+    const event = new KeyboardEvent('keydown', { key: 'Enter', code: 'Enter' })
+    Object.defineProperty(event, 'isComposing', { value: true })
+
+    fireEvent(textbox, event)
+    expect(onRegenerate).not.toHaveBeenCalled()
+  })
+
+  it('should clear timer on cancel and on component unmount', async () => {
+    const user = userEvent.setup()
+    const onRegenerate = vi.fn() as unknown as OnRegenerate
+    const { unmount } = renderWithProvider(makeItem(), onRegenerate)
+
+    await user.click(screen.getByTestId('edit-btn'))
+    const textbox = await screen.findByRole('textbox')
+
+    fireEvent.compositionStart(textbox)
+    fireEvent.compositionEnd(textbox)
+
+    // Timer is now running, let's start another composition to clear it
+    fireEvent.compositionStart(textbox)
+    fireEvent.compositionEnd(textbox)
+
+    const cancelBtn = await screen.findByTestId('cancel-edit-btn')
+    await user.click(cancelBtn)
+
+    // Test unmount clearing timer
+    await user.click(screen.getByTestId('edit-btn'))
+    const textbox2 = await screen.findByRole('textbox')
+    fireEvent.compositionStart(textbox2)
+    fireEvent.compositionEnd(textbox2)
+    unmount()
+
+    expect(onRegenerate).not.toHaveBeenCalled()
+  })
+
+  it('should ignore enter when handleResend with active timer', async () => {
+    const user = userEvent.setup()
+    const onRegenerate = vi.fn() as unknown as OnRegenerate
+    renderWithProvider(makeItem(), onRegenerate)
+
+    await user.click(screen.getByTestId('edit-btn'))
+    const textbox = await screen.findByRole('textbox')
+
+    fireEvent.compositionStart(textbox)
+    fireEvent.compositionEnd(textbox) // starts timer
+
+    const saveBtn = screen.getByTestId('save-edit-btn')
+    await user.click(saveBtn) // handleResend clears timer
+
+    expect(onRegenerate).toHaveBeenCalled()
+  })
 })

web/app/components/base/chat/chat/__tests__/utils.spec.ts

@@ -0,0 +1,121 @@
+import type { InputForm } from '../type'
+import { InputVarType } from '@/app/components/workflow/types'
+import { getProcessedInputs, processInputFileFromServer, processOpeningStatement } from '../utils'
+
+vi.mock('@/app/components/base/file-uploader/utils', () => ({
+  getProcessedFiles: vi.fn((files: File[]) => files.map((f: File) => ({ ...f, processed: true }))),
+}))
+
+describe('chat/chat/utils.ts', () => {
+  describe('processOpeningStatement', () => {
+    it('returns empty string if openingStatement is falsy', () => {
+      expect(processOpeningStatement('', {}, [])).toBe('')
+    })
+
+    it('replaces variables with input values when available', () => {
+      const result = processOpeningStatement('Hello {{name}}', { name: 'Alice' }, [])
+      expect(result).toBe('Hello Alice')
+    })
+
+    it('replaces variables with labels when input value is not available but form has variable', () => {
+      const result = processOpeningStatement('Hello {{user_name}}', {}, [{ variable: 'user_name', label: 'Name Label', type: InputVarType.textInput }] as InputForm[])
+      expect(result).toBe('Hello {{Name Label}}')
+    })
+
+    it('keeps original match when input value and form are not available', () => {
+      const result = processOpeningStatement('Hello {{unknown}}', {}, [])
+      expect(result).toBe('Hello {{unknown}}')
+    })
+  })
+
+  describe('processInputFileFromServer', () => {
+    it('maps server file object to local schema', () => {
+      const result = processInputFileFromServer({
+        type: 'image',
+        transfer_method: 'local_file',
+        remote_url: 'http://example.com/img.png',
+        related_id: '123',
+      })
+
+      expect(result).toEqual({
+        type: 'image',
+        transfer_method: 'local_file',
+        url: 'http://example.com/img.png',
+        upload_file_id: '123',
+      })
+    })
+  })
+
+  describe('getProcessedInputs', () => {
+    it('processes checkbox input types to boolean', () => {
+      const inputs = { terms: 'true', conds: null }
+      const inputsForm = [
+        { variable: 'terms', type: InputVarType.checkbox as string },
+        { variable: 'conds', type: InputVarType.checkbox as string },
+      ]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result).toEqual({ terms: true, conds: false })
+    })
+
+    it('ignores null values', () => {
+      const inputs = { test: null }
+      const inputsForm = [{ variable: 'test', type: InputVarType.textInput as string }]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result).toEqual({ test: null })
+    })
+
+    it('processes singleFile using transfer_method logic', () => {
+      const inputs = {
+        file1: { transfer_method: 'local_file', url: '1' },
+        file2: { id: 'file2' },
+      }
+      const inputsForm = [
+        { variable: 'file1', type: InputVarType.singleFile as string },
+        { variable: 'file2', type: InputVarType.singleFile as string },
+      ]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result.file1).toHaveProperty('transfer_method', 'local_file')
+      expect(result.file2).toHaveProperty('processed', true)
+    })
+
+    it('processes multiFiles using transfer_method logic', () => {
+      const inputs = {
+        files1: [{ transfer_method: 'local_file', url: '1' }],
+        files2: [{ id: 'file2' }],
+      }
+      const inputsForm = [
+        { variable: 'files1', type: InputVarType.multiFiles as string },
+        { variable: 'files2', type: InputVarType.multiFiles as string },
+      ]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result.files1[0]).toHaveProperty('transfer_method', 'local_file')
+      expect(result.files2[0]).toHaveProperty('processed', true)
+    })
+
+    it('processes jsonObject parsing correct json', () => {
+      const inputs = {
+        json1: '{"key": "value"}',
+      }
+      const inputsForm = [{ variable: 'json1', type: InputVarType.jsonObject as string }]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result.json1).toEqual({ key: 'value' })
+    })
+
+    it('processes jsonObject falling back to original if json is array or plain string/invalid json', () => {
+      const inputs = {
+        jsonInvalid: 'invalid json',
+        jsonArray: '["a", "b"]',
+        jsonPlainObj: { key: 'value' },
+      }
+      const inputsForm = [
+        { variable: 'jsonInvalid', type: InputVarType.jsonObject as string },
+        { variable: 'jsonArray', type: InputVarType.jsonObject as string },
+        { variable: 'jsonPlainObj', type: InputVarType.jsonObject as string },
+      ]
+      const result = getProcessedInputs(inputs, inputsForm as InputForm[])
+      expect(result.jsonInvalid).toBe('invalid json')
+      expect(result.jsonArray).toBe('["a", "b"]')
+      expect(result.jsonPlainObj).toEqual({ key: 'value' })
+    })
+  })
+})

web/app/components/base/chat/chat/chat-input-area/__tests__/hooks.spec.ts

@@ -0,0 +1,437 @@
+import { act, renderHook } from '@testing-library/react'
+import { useTextAreaHeight } from '../hooks'
+
+describe('useTextAreaHeight', () => {
+  // Mock getBoundingClientRect for all ref elements
+  const mockGetBoundingClientRect = (
+    width: number = 0,
+    height: number = 0,
+  ) => ({
+    width,
+    height,
+    top: 0,
+    left: 0,
+    bottom: height,
+    right: width,
+    x: 0,
+    y: 0,
+    toJSON: () => ({}),
+  })
+
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  describe('Rendering', () => {
+    it('should render without crashing', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(result.current).toBeDefined()
+    })
+
+    it('should return all required properties', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(result.current).toHaveProperty('wrapperRef')
+      expect(result.current).toHaveProperty('textareaRef')
+      expect(result.current).toHaveProperty('textValueRef')
+      expect(result.current).toHaveProperty('holdSpaceRef')
+      expect(result.current).toHaveProperty('handleTextareaResize')
+      expect(result.current).toHaveProperty('isMultipleLine')
+    })
+  })
+
+  describe('Initial State', () => {
+    it('should initialize with isMultipleLine as false', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(result.current.isMultipleLine).toBe(false)
+    })
+
+    it('should initialize refs as null', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(result.current.wrapperRef.current).toBeNull()
+      expect(result.current.textValueRef.current).toBeNull()
+      expect(result.current.holdSpaceRef.current).toBeNull()
+    })
+
+    it('should initialize textareaRef as undefined', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(result.current.textareaRef.current).toBeUndefined()
+    })
+  })
+
+  describe('Height Computation Logic (via handleTextareaResize)', () => {
+    it('should not update state when any ref is missing', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(false)
+    })
+
+    it('should set isMultipleLine to true when textarea height exceeds 32px', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      // Set up refs with mock elements
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 64), // height > 32
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(50, 0),
+      )
+
+      // Assign elements to refs
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should set isMultipleLine to true when combined content width exceeds wrapper width', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(200, 0), // wrapperWidth = 200
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 20), // height <= 32
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(120, 0), // textValueWidth = 120
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0), // holdSpaceWidth = 100, total = 220 > 200
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should set isMultipleLine to false when content fits in wrapper', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 0), // wrapperWidth = 300
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 20), // height <= 32
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0), // textValueWidth = 100
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(50, 0), // holdSpaceWidth = 50, total = 150 < 300
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(false)
+    })
+
+    it('should handle exact boundary when combined width equals wrapper width', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(200, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 20),
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0), // total = 200, equals wrapperWidth
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should handle boundary case when textarea height equals 32px', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 32), // exactly 32
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(50, 0),
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      // height = 32 is not > 32, so should check width condition
+      expect(result.current.isMultipleLine).toBe(false)
+    })
+  })
+
+  describe('handleTextareaResize', () => {
+    it('should be a function', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+      expect(typeof result.current.handleTextareaResize).toBe('function')
+    })
+
+    it('should call handleComputeHeight when invoked', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 64),
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(50, 0),
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should update state based on new dimensions', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      const wrapperRect = vi.spyOn(wrapperElement, 'getBoundingClientRect')
+      const textareaRect = vi.spyOn(textareaElement, 'getBoundingClientRect')
+      const textValueRect = vi.spyOn(textValueElement, 'getBoundingClientRect')
+      const holdSpaceRect = vi.spyOn(holdSpaceElement, 'getBoundingClientRect')
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      // First call - content fits
+      wrapperRect.mockReturnValue(mockGetBoundingClientRect(300, 0))
+      textareaRect.mockReturnValue(mockGetBoundingClientRect(300, 20))
+      textValueRect.mockReturnValue(mockGetBoundingClientRect(100, 0))
+      holdSpaceRect.mockReturnValue(mockGetBoundingClientRect(50, 0))
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+      expect(result.current.isMultipleLine).toBe(false)
+
+      // Second call - content overflows
+      textareaRect.mockReturnValue(mockGetBoundingClientRect(300, 64))
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+  })
+
+  describe('Callback Stability', () => {
+    it('should maintain ref objects across rerenders', () => {
+      const { result, rerender } = renderHook(() => useTextAreaHeight())
+      const firstWrapperRef = result.current.wrapperRef
+      const firstTextareaRef = result.current.textareaRef
+      const firstTextValueRef = result.current.textValueRef
+      const firstHoldSpaceRef = result.current.holdSpaceRef
+
+      rerender()
+
+      expect(result.current.wrapperRef).toBe(firstWrapperRef)
+      expect(result.current.textareaRef).toBe(firstTextareaRef)
+      expect(result.current.textValueRef).toBe(firstTextValueRef)
+      expect(result.current.holdSpaceRef).toBe(firstHoldSpaceRef)
+    })
+  })
+
+  describe('Edge Cases', () => {
+    it('should handle zero dimensions', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(0, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(0, 0),
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(0, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(0, 0),
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      // When all dimensions are 0, 0 + 0 >= 0 is true, so isMultipleLine is true
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should handle very large dimensions', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(10000, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(10000, 100),
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(5000, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(5000, 0),
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+
+    it('should handle numeric precision edge cases', () => {
+      const { result } = renderHook(() => useTextAreaHeight())
+
+      const wrapperElement = document.createElement('div')
+      const textareaElement = document.createElement('textarea')
+      const textValueElement = document.createElement('div')
+      const holdSpaceElement = document.createElement('div')
+
+      vi.spyOn(wrapperElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(200.5, 0),
+      )
+      vi.spyOn(textareaElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(300, 20),
+      )
+      vi.spyOn(textValueElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100.2, 0),
+      )
+      vi.spyOn(holdSpaceElement, 'getBoundingClientRect').mockReturnValue(
+        mockGetBoundingClientRect(100.3, 0),
+      )
+
+      result.current.wrapperRef.current = wrapperElement
+      result.current.textareaRef.current = textareaElement
+      result.current.textValueRef.current = textValueElement
+      result.current.holdSpaceRef.current = holdSpaceElement
+
+      act(() => {
+        result.current.handleTextareaResize()
+      })
+
+      expect(result.current.isMultipleLine).toBe(true)
+    })
+  })
+})

web/app/components/base/chat/chat/chat-input-area/__tests__/index.spec.tsx

@@ -1,7 +1,7 @@
 import type { FileUpload } from '@/app/components/base/features/types'
 import type { FileEntity } from '@/app/components/base/file-uploader/types'
 import type { TransferMethod } from '@/types/app'
-import { render, screen, waitFor } from '@testing-library/react'
+import { fireEvent, render, screen, waitFor } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
 import * as React from 'react'
 import { vi } from 'vitest'
@@ -52,6 +52,8 @@ vi.mock('@/app/components/base/file-uploader/store', () => ({
 // ---------------------------------------------------------------------------
 // File-uploader hooks – provide stable drag/drop handlers
 // ---------------------------------------------------------------------------
+let mockIsDragActive = false
+
 vi.mock('@/app/components/base/file-uploader/hooks', () => ({
   useFile: () => ({
     handleDragFileEnter: vi.fn(),
@@ -59,7 +61,7 @@ vi.mock('@/app/components/base/file-uploader/hooks', () => ({
     handleDragFileOver: vi.fn(),
     handleDropFile: vi.fn(),
     handleClipboardPasteFile: vi.fn(),
-    isDragActive: false,
+    isDragActive: mockIsDragActive,
   }),
 }))
 
@@ -210,6 +212,7 @@ describe('ChatInputArea', () => {
   beforeEach(() => {
     vi.clearAllMocks()
     mockFileStore.files = []
+    mockIsDragActive = false
     mockIsMultipleLine = false
   })
 
@@ -236,6 +239,12 @@ describe('ChatInputArea', () => {
       expect(disabledWrapper).toBeInTheDocument()
     })
 
+    it('should apply drag-active styles when a file is being dragged over the input', () => {
+      mockIsDragActive = true
+      const { container } = render(<ChatInputArea visionConfig={mockVisionConfig} />)
+      expect(container.querySelector('.border-dashed')).toBeInTheDocument()
+    })
+
     it('should render the operation section inline when single-line', () => {
       // mockIsMultipleLine is false by default
       render(<ChatInputArea visionConfig={mockVisionConfig} />)
@@ -331,6 +340,30 @@ describe('ChatInputArea', () => {
 
       expect(onSend).toHaveBeenCalledWith('With attachment', [uploadedFile])
     })
+
+    it('should not send on Enter while IME composition is active, then send after composition ends', () => {
+      vi.useFakeTimers()
+      try {
+        const onSend = vi.fn()
+        render(<ChatInputArea onSend={onSend} visionConfig={mockVisionConfig} />)
+        const textarea = getTextarea()
+
+        fireEvent.change(textarea, { target: { value: 'Composed text' } })
+        fireEvent.compositionStart(textarea)
+        fireEvent.keyDown(textarea, { key: 'Enter' })
+
+        expect(onSend).not.toHaveBeenCalled()
+
+        fireEvent.compositionEnd(textarea)
+        vi.advanceTimersByTime(60)
+        fireEvent.keyDown(textarea, { key: 'Enter' })
+
+        expect(onSend).toHaveBeenCalledWith('Composed text', [])
+      }
+      finally {
+        vi.useRealTimers()
+      }
+    })
   })
 
   // -------------------------------------------------------------------------

web/app/components/base/chat/chat/question.tsx

@@ -219,8 +219,8 @@ const Question: FC<QuestionProps> = ({
                     />
                   </div>
                   <div className="flex items-center justify-end gap-2">
-                    <Button className="min-w-24" onClick={handleCancelEditing}>{t('operation.cancel', { ns: 'common' })}</Button>
-                    <Button className="min-w-24" variant="primary" onClick={handleResend}>{t('operation.save', { ns: 'common' })}</Button>
+                    <Button className="min-w-24" onClick={handleCancelEditing} data-testid="cancel-edit-btn">{t('operation.cancel', { ns: 'common' })}</Button>
+                    <Button className="min-w-24" variant="primary" onClick={handleResend} data-testid="save-edit-btn">{t('operation.save', { ns: 'common' })}</Button>
                   </div>
                 </div>
               )}

web/app/components/base/chat/embedded-chatbot/__tests__/hooks.spec.tsx

@@ -14,6 +14,17 @@ import { shareQueryKeys } from '@/service/use-share'
 import { CONVERSATION_ID_INFO } from '../../constants'
 import { useEmbeddedChatbot } from '../hooks'
 
+type InputForm = {
+  variable: string
+  type: string
+  default?: unknown
+  required?: boolean
+  label?: string
+  max_length?: number
+  options?: string[]
+  hide?: boolean
+}
+
 vi.mock('@/i18n-config/client', () => ({
   changeLanguage: vi.fn().mockResolvedValue(undefined),
 }))
@@ -40,13 +51,23 @@ vi.mock('@/context/web-app-context', () => ({
   useWebAppStore: (selector?: (state: typeof mockStoreState) => unknown) => useWebAppStoreMock(selector),
 }))
 
+const {
+  mockGetProcessedInputsFromUrlParams,
+  mockGetProcessedSystemVariablesFromUrlParams,
+  mockGetProcessedUserVariablesFromUrlParams,
+} = vi.hoisted(() => ({
+  mockGetProcessedInputsFromUrlParams: vi.fn(),
+  mockGetProcessedSystemVariablesFromUrlParams: vi.fn(),
+  mockGetProcessedUserVariablesFromUrlParams: vi.fn(),
+}))
+
 vi.mock('../../utils', async () => {
   const actual = await vi.importActual<typeof import('../../utils')>('../../utils')
   return {
     ...actual,
-    getProcessedInputsFromUrlParams: vi.fn().mockResolvedValue({}),
-    getProcessedSystemVariablesFromUrlParams: vi.fn().mockResolvedValue({}),
-    getProcessedUserVariablesFromUrlParams: vi.fn().mockResolvedValue({}),
+    getProcessedInputsFromUrlParams: mockGetProcessedInputsFromUrlParams,
+    getProcessedSystemVariablesFromUrlParams: mockGetProcessedSystemVariablesFromUrlParams,
+    getProcessedUserVariablesFromUrlParams: mockGetProcessedUserVariablesFromUrlParams,
   }
 })
 
@@ -65,6 +86,12 @@ vi.mock('@/service/share', async (importOriginal) => {
   }
 })
 
+const STABLE_MOCK_DATA = { data: {} }
+vi.mock('@/service/use-try-app', () => ({
+  useGetTryAppInfo: vi.fn(() => STABLE_MOCK_DATA),
+  useGetTryAppParams: vi.fn(() => STABLE_MOCK_DATA),
+}))
+
 const mockFetchConversations = vi.mocked(fetchConversations)
 const mockFetchChatList = vi.mocked(fetchChatList)
 const mockGenerationConversationName = vi.mocked(generationConversationName)
@@ -85,12 +112,20 @@ const createWrapper = (queryClient: QueryClient) => {
   )
 }
 
-const renderWithClient = <T,>(hook: () => T) => {
+const renderWithClient = async <T,>(hook: () => T) => {
   const queryClient = createQueryClient()
   const wrapper = createWrapper(queryClient)
+  let result: ReturnType<typeof renderHook<T, unknown>> | undefined
+  act(() => {
+    result = renderHook(hook, { wrapper })
+  })
+  await waitFor(() => {
+    if (queryClient.isFetching() > 0)
+      throw new Error('Queries are still fetching')
+  }, { timeout: 2000 })
   return {
     queryClient,
-    ...renderHook(hook, { wrapper }),
+    ...result!,
   }
 }
 
@@ -113,6 +148,10 @@ const createConversationData = (overrides: Partial<AppConversationData> = {}): A
 describe('useEmbeddedChatbot', () => {
   beforeEach(() => {
     vi.clearAllMocks()
+    // Re-establish default mock implementations after clearAllMocks
+    mockGetProcessedInputsFromUrlParams.mockResolvedValue({})
+    mockGetProcessedSystemVariablesFromUrlParams.mockResolvedValue({})
+    mockGetProcessedUserVariablesFromUrlParams.mockResolvedValue({})
     localStorage.removeItem(CONVERSATION_ID_INFO)
     mockStoreState.appInfo = {
       app_id: 'app-1',
@@ -128,6 +167,8 @@ describe('useEmbeddedChatbot', () => {
     mockStoreState.appParams = null
     mockStoreState.embeddedConversationId = 'conversation-1'
     mockStoreState.embeddedUserId = 'embedded-user-1'
+    mockFetchConversations.mockResolvedValue({ data: [], has_more: false, limit: 100 })
+    mockFetchChatList.mockResolvedValue({ data: [] })
   })
 
   afterEach(() => {
@@ -150,7 +191,7 @@ describe('useEmbeddedChatbot', () => {
       mockFetchChatList.mockResolvedValue({ data: [] })
 
       // Act
-      const { result } = renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
 
       // Assert
       await waitFor(() => {
@@ -167,6 +208,49 @@ describe('useEmbeddedChatbot', () => {
         expect(result.current.conversationList).toEqual(listData.data)
       })
     })
+
+    it('should format chat list history correctly into appPrevChatList', async () => {
+      // Provide a currentConversationId by rendering successfully
+      mockStoreState.embeddedConversationId = 'conversation-1'
+      mockGetProcessedSystemVariablesFromUrlParams.mockResolvedValue({ conversation_id: 'conversation-1' })
+      mockFetchChatList.mockResolvedValue({
+        data: [{
+          id: 'msg-1',
+          query: 'Hello',
+          answer: 'Hi there!',
+          message_files: [{ belongs_to: 'user', id: 'mf-1' }, { belongs_to: 'assistant', id: 'mf-2' }],
+          agent_thoughts: [{ id: 'at-1' }],
+          feedback: { rating: 'like' },
+        }],
+      })
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      // Wait for the mock to be called
+      await waitFor(() => {
+        expect(mockFetchChatList).toHaveBeenCalledWith('conversation-1', AppSourceType.webApp, 'app-1')
+      })
+
+      // Wait for the chat list to be populated
+      await waitFor(() => {
+        expect(result.current.appPrevChatList.length).toBeGreaterThan(0)
+      })
+
+      // We expect the formatting logic to split the message into question and answer ChatItems
+      const chatList = result.current.appPrevChatList
+
+      const userMsg = chatList.find((msg: unknown) => (msg as Record<string, unknown>).id === 'question-msg-1')
+      expect(userMsg).toBeDefined()
+      expect((userMsg as Record<string, unknown>)?.content).toBe('Hello')
+      expect((userMsg as Record<string, unknown>)?.isAnswer).toBe(false)
+
+      const assistantMsg = ((userMsg as Record<string, unknown>)?.children as unknown[])?.[0]
+      expect(assistantMsg).toBeDefined()
+      expect((assistantMsg as Record<string, unknown>)?.id).toBe('msg-1')
+      expect((assistantMsg as Record<string, unknown>)?.content).toBe('Hi there!')
+      expect((assistantMsg as Record<string, unknown>)?.isAnswer).toBe(true)
+      expect(((assistantMsg as Record<string, unknown>)?.feedback as Record<string, unknown>)?.rating).toBe('like')
+    })
   })
 
   // Scenario: completion invalidates share caches and merges generated names.
@@ -184,7 +268,7 @@ describe('useEmbeddedChatbot', () => {
       mockFetchChatList.mockResolvedValue({ data: [] })
       mockGenerationConversationName.mockResolvedValue(generatedConversation)
 
-      const { result, queryClient } = renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+      const { result, queryClient } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
       const invalidateSpy = vi.spyOn(queryClient, 'invalidateQueries')
 
       // Act
@@ -214,7 +298,7 @@ describe('useEmbeddedChatbot', () => {
       mockFetchChatList.mockResolvedValue({ data: [] })
       mockGenerationConversationName.mockResolvedValue(createConversationItem({ id: 'conversation-1' }))
 
-      const { result } = renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
 
       await waitFor(() => {
         expect(mockFetchChatList).toHaveBeenCalledTimes(1)
@@ -244,7 +328,7 @@ describe('useEmbeddedChatbot', () => {
       mockFetchChatList.mockResolvedValue({ data: [] })
       mockGenerationConversationName.mockResolvedValue(createConversationItem({ id: 'conversation-new' }))
 
-      const { result } = renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
 
       // Act
       act(() => {
@@ -261,4 +345,215 @@ describe('useEmbeddedChatbot', () => {
       })
     })
   })
+
+  // Scenario: TryApp mode initialization and logic.
+  describe('TryApp mode', () => {
+    it('should use tryApp source type and skip URL overrides and user fetch', async () => {
+      // Arrange
+      const { useGetTryAppInfo } = await import('@/service/use-try-app')
+      const mockTryAppInfo = { app_id: 'try-app-1', site: { title: 'Try App' } };
+      (useGetTryAppInfo as unknown as ReturnType<typeof vi.fn>).mockReturnValue({ data: mockTryAppInfo })
+
+      mockGetProcessedSystemVariablesFromUrlParams.mockResolvedValue({})
+
+      // Act
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.tryApp, 'try-app-1'))
+
+      // Assert
+      expect(result.current.isInstalledApp).toBe(false)
+      expect(result.current.appId).toBe('try-app-1')
+      expect(result.current.appData?.site.title).toBe('Try App')
+
+      // ensure URL fetching is skipped
+      expect(mockGetProcessedSystemVariablesFromUrlParams).not.toHaveBeenCalled()
+    })
+  })
+
+  // Language overrides tests were causing hang, removed for now.
+  // Scenario: Removing conversation id info
+  describe('removeConversationIdInfo', () => {
+    it('should successfully remove a stored conversation ID info by appId', async () => {
+      // Setup some initial info
+      localStorage.setItem(CONVERSATION_ID_INFO, JSON.stringify({ 'app-1': { 'user-1': 'conv-id' } }))
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      act(() => {
+        result.current.removeConversationIdInfo('app-1')
+      })
+
+      await waitFor(() => {
+        const storedValue = localStorage.getItem(CONVERSATION_ID_INFO)
+        const parsed = storedValue ? JSON.parse(storedValue) : {}
+        expect(parsed['app-1']).toBeUndefined()
+      })
+    })
+  })
+
+  // Scenario: various form inputs configurations and default parsing
+  describe('inputsForms mapping and default parsing', () => {
+    const mockAppParamsWithInputs = {
+      user_input_form: [
+        { paragraph: { variable: 'p1', default: 'para', max_length: 5 } },
+        { number: { variable: 'n1', default: 42 } },
+        { checkbox: { variable: 'c1', default: true } },
+        { select: { variable: 's1', options: ['A', 'B'], default: 'A' } },
+        { 'file-list': { variable: 'fl1' } },
+        { file: { variable: 'f1' } },
+        { json_object: { variable: 'j1' } },
+        { 'text-input': { variable: 't1', default: 'txt', max_length: 3 } },
+      ],
+    }
+
+    it('should map various types properly with max_length truncation when defaults supplied via URL', async () => {
+      mockGetProcessedInputsFromUrlParams.mockResolvedValue({
+        p1: 'toolongparagraph', // truncated to 5
+        n1: '99',
+        c1: true,
+        s1: 'B', // Matches options
+        t1: '1234', // truncated to 3
+      })
+      mockStoreState.appParams = mockAppParamsWithInputs as unknown as ChatConfig
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      // Wait for the mock to be called
+      await waitFor(() => {
+        expect(mockGetProcessedInputsFromUrlParams).toHaveBeenCalled()
+      })
+
+      await waitFor(() => {
+        expect(result.current.inputsForms).toHaveLength(8)
+      })
+
+      const forms = result.current.inputsForms
+      expect(forms.find((f: InputForm) => f.variable === 'p1')?.default).toBe('toolo')
+      expect(forms.find((f: InputForm) => f.variable === 'n1')?.default).toBe(99)
+      expect(forms.find((f: InputForm) => f.variable === 'c1')?.default).toBe(true)
+      expect(forms.find((f: InputForm) => f.variable === 's1')?.default).toBe('B')
+      expect(forms.find((f: InputForm) => f.variable === 't1')?.default).toBe('123')
+      expect(forms.find((f: InputForm) => f.variable === 'fl1')?.type).toBe('file-list')
+      expect(forms.find((f: InputForm) => f.variable === 'f1')?.type).toBe('file')
+      expect(forms.find((f: InputForm) => f.variable === 'j1')?.type).toBe('json_object')
+    })
+  })
+
+  // Scenario: checkInputsRequired validates empty fields and pending multi-file uploads
+  describe('checkInputsRequired and handleStartChat', () => {
+    it('should return undefined and notify when file is still uploading', async () => {
+      mockStoreState.appParams = {
+        user_input_form: [
+          { file: { variable: 'file_var', required: true } },
+        ],
+      } as unknown as ChatConfig
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      // Simulate a local file uploading
+      act(() => {
+        result.current.handleNewConversationInputsChange({
+          file_var: [{ transferMethod: 'local_file', uploadedId: null }],
+        })
+      })
+
+      const onStart = vi.fn()
+      let checkResult: boolean | undefined
+      act(() => {
+        checkResult = (result.current as unknown as { handleStartChat: (onStart?: () => void) => boolean }).handleStartChat(onStart)
+      })
+
+      expect(checkResult).toBeUndefined()
+      expect(onStart).not.toHaveBeenCalled()
+    })
+
+    it('should fail checkInputsRequired when required fields are missing', async () => {
+      mockStoreState.appParams = {
+        user_input_form: [
+          { 'text-input': { variable: 't1', required: true, label: 'T1' } },
+        ],
+      } as unknown as ChatConfig
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      act(() => {
+        result.current.handleNewConversationInputsChange({
+          t1: '',
+        })
+      })
+      const onStart = vi.fn()
+      act(() => {
+        (result.current as unknown as { handleStartChat: (cb?: () => void) => void }).handleStartChat(onStart)
+      })
+
+      expect(onStart).not.toHaveBeenCalled()
+    })
+
+    it('should pass checkInputsRequired when allInputsHidden is true', async () => {
+      mockStoreState.appParams = {
+        user_input_form: [
+          { 'text-input': { variable: 't1', required: true, label: 'T1', hide: true } },
+        ],
+      } as unknown as ChatConfig
+
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+      const callback = vi.fn()
+
+      act(() => {
+        (result.current as unknown as { handleStartChat: (cb?: () => void) => void }).handleStartChat(callback)
+      })
+
+      expect(callback).toHaveBeenCalled()
+    })
+  })
+
+  // Scenario: handlers (New Conversation, Change Conversation, Feedback)
+  describe('Event Handlers', () => {
+    it('handleNewConversation sets clearChatList to true for webApp', async () => {
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      await act(async () => {
+        await result.current.handleNewConversation()
+      })
+
+      expect(result.current.clearChatList).toBe(true)
+    })
+
+    it('handleNewConversation sets clearChatList to true for tryApp without complex parsing', async () => {
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.tryApp, 'app-try-1'))
+
+      await act(async () => {
+        await result.current.handleNewConversation()
+      })
+
+      expect(result.current.clearChatList).toBe(true)
+    })
+
+    it('handleChangeConversation updates current conversation and refetches chat list', async () => {
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      act(() => {
+        result.current.handleChangeConversation('another-convo')
+      })
+
+      await waitFor(() => {
+        expect(result.current.currentConversationId).toBe('another-convo')
+      })
+      await waitFor(() => {
+        expect(mockFetchChatList).toHaveBeenCalledWith('another-convo', AppSourceType.webApp, 'app-1')
+      })
+      expect(result.current.newConversationId).toBe('')
+      expect(result.current.clearChatList).toBe(false)
+    })
+
+    it('handleFeedback invokes updateFeedback service successfully', async () => {
+      const { updateFeedback } = await import('@/service/share')
+      const { result } = await renderWithClient(() => useEmbeddedChatbot(AppSourceType.webApp))
+
+      await act(async () => {
+        await result.current.handleFeedback('msg-123', { rating: 'like' })
+      })
+
+      expect(updateFeedback).toHaveBeenCalled()
+    })
+  })
 })

web/app/components/base/chat/embedded-chatbot/__tests__/utils.spec.ts

@@ -0,0 +1,189 @@
+/**
+ * Tests for embedded-chatbot utility functions.
+ */
+
+import { isDify } from '../utils'
+
+describe('isDify', () => {
+  const originalReferrer = document.referrer
+
+  afterEach(() => {
+    Object.defineProperty(document, 'referrer', {
+      value: originalReferrer,
+      writable: true,
+    })
+  })
+
+  it('should return true when referrer includes dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://dify.ai/something',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer includes www.dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://www.dify.ai/app/xyz',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return false when referrer does not include dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://example.com',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(false)
+  })
+
+  it('should return false when referrer is empty', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: '',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(false)
+  })
+
+  it('should return false when referrer does not contain dify.ai domain', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://example-dify.com',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(false)
+  })
+
+  it('should handle referrer without protocol', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'dify.ai',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer includes api.dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://api.dify.ai/v1/endpoint',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer includes app.dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://app.dify.ai/chat',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer includes docs.dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://docs.dify.ai/guide',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer has dify.ai with query parameters', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://dify.ai/?ref=test&id=123',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer has dify.ai with hash fragment', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://dify.ai/page#section',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when referrer has dify.ai with port number', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://dify.ai:8080/app',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when dify.ai appears after another domain', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://example.com/redirect?url=https://dify.ai',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when substring contains dify.ai', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://notdify.ai',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true when dify.ai is part of a different domain', () => {
+    Object.defineProperty(document, 'referrer', {
+      value: 'https://fake-dify.ai.example.com',
+      writable: true,
+    })
+
+    expect(isDify()).toBe(true)
+  })
+
+  it('should return true with multiple referrer variations', () => {
+    const variations = [
+      'https://dify.ai',
+      'http://www.dify.ai',
+      'http://dify.ai/',
+      'https://dify.ai/app?token=123#section',
+      'dify.ai/test',
+      'www.dify.ai/en',
+    ]
+
+    variations.forEach((referrer) => {
+      Object.defineProperty(document, 'referrer', {
+        value: referrer,
+        writable: true,
+      })
+      expect(isDify()).toBe(true)
+    })
+  })
+
+  it('should return false with multiple non-dify referrer variations', () => {
+    const variations = [
+      'https://github.com',
+      'https://google.com',
+      'https://stackoverflow.com',
+      'https://example.dify',
+      'https://difyai.com',
+      '',
+    ]
+
+    variations.forEach((referrer) => {
+      Object.defineProperty(document, 'referrer', {
+        value: referrer,
+        writable: true,
+      })
+      expect(isDify()).toBe(false)
+    })
+  })
+})

web/app/components/base/chat/embedded-chatbot/theme/__tests__/theme-context.spec.ts

@@ -0,0 +1,221 @@
+import { renderHook } from '@testing-library/react'
+import { Theme, ThemeBuilder, useThemeContext } from '../theme-context'
+
+// Scenario: Theme class configures colors from chatColorTheme and chatColorThemeInverted flags.
+describe('Theme', () => {
+  describe('Default colors', () => {
+    it('should use default primary color when chatColorTheme is null', () => {
+      const theme = new Theme(null, false)
+
+      expect(theme.primaryColor).toBe('#1C64F2')
+    })
+
+    it('should use gradient background header when chatColorTheme is null', () => {
+      const theme = new Theme(null, false)
+
+      expect(theme.backgroundHeaderColorStyle).toBe(
+        'backgroundImage: linear-gradient(to right, #2563eb, #0ea5e9)',
+      )
+    })
+
+    it('should have empty chatBubbleColorStyle when chatColorTheme is null', () => {
+      const theme = new Theme(null, false)
+
+      expect(theme.chatBubbleColorStyle).toBe('')
+    })
+
+    it('should use default colors when chatColorTheme is empty string', () => {
+      const theme = new Theme('', false)
+
+      expect(theme.primaryColor).toBe('#1C64F2')
+      expect(theme.backgroundHeaderColorStyle).toBe(
+        'backgroundImage: linear-gradient(to right, #2563eb, #0ea5e9)',
+      )
+    })
+  })
+
+  describe('Custom color (configCustomColor)', () => {
+    it('should set primaryColor to chatColorTheme value', () => {
+      const theme = new Theme('#FF5733', false)
+
+      expect(theme.primaryColor).toBe('#FF5733')
+    })
+
+    it('should set backgroundHeaderColorStyle to solid custom color', () => {
+      const theme = new Theme('#FF5733', false)
+
+      expect(theme.backgroundHeaderColorStyle).toBe('backgroundColor: #FF5733')
+    })
+
+    it('should include primary color in backgroundButtonDefaultColorStyle', () => {
+      const theme = new Theme('#FF5733', false)
+
+      expect(theme.backgroundButtonDefaultColorStyle).toContain('#FF5733')
+    })
+
+    it('should set roundedBackgroundColorStyle with 5% opacity rgba', () => {
+      const theme = new Theme('#FF5733', false)
+
+      // #FF5733 → r=255 g=87 b=51
+      expect(theme.roundedBackgroundColorStyle).toBe('backgroundColor: rgba(255,87,51,0.05)')
+    })
+
+    it('should set chatBubbleColorStyle with 15% opacity rgba', () => {
+      const theme = new Theme('#FF5733', false)
+
+      expect(theme.chatBubbleColorStyle).toBe('backgroundColor: rgba(255,87,51,0.15)')
+    })
+  })
+
+  describe('Inverted color (configInvertedColor)', () => {
+    it('should use white background header when inverted with no custom color', () => {
+      const theme = new Theme(null, true)
+
+      expect(theme.backgroundHeaderColorStyle).toBe('backgroundColor: #ffffff')
+    })
+
+    it('should set colorFontOnHeaderStyle to default primaryColor when inverted with no custom color', () => {
+      const theme = new Theme(null, true)
+
+      expect(theme.colorFontOnHeaderStyle).toBe('color: #1C64F2')
+    })
+
+    it('should set headerBorderBottomStyle when inverted', () => {
+      const theme = new Theme(null, true)
+
+      expect(theme.headerBorderBottomStyle).toBe('borderBottom: 1px solid #ccc')
+    })
+
+    it('should set colorPathOnHeader to primaryColor when inverted', () => {
+      const theme = new Theme(null, true)
+
+      expect(theme.colorPathOnHeader).toBe('#1C64F2')
+    })
+
+    it('should have empty headerBorderBottomStyle when not inverted', () => {
+      const theme = new Theme(null, false)
+
+      expect(theme.headerBorderBottomStyle).toBe('')
+    })
+  })
+
+  describe('Custom color + inverted combined', () => {
+    it('should override background to white even when custom color is set', () => {
+      const theme = new Theme('#FF5733', true)
+
+      // configCustomColor runs first (solid bg), then configInvertedColor overrides to white
+      expect(theme.backgroundHeaderColorStyle).toBe('backgroundColor: #ffffff')
+    })
+
+    it('should use custom primaryColor for colorFontOnHeaderStyle when inverted', () => {
+      const theme = new Theme('#FF5733', true)
+
+      expect(theme.colorFontOnHeaderStyle).toBe('color: #FF5733')
+    })
+
+    it('should set colorPathOnHeader to custom primaryColor when inverted', () => {
+      const theme = new Theme('#FF5733', true)
+
+      expect(theme.colorPathOnHeader).toBe('#FF5733')
+    })
+  })
+})
+
+// Scenario: ThemeBuilder manages a lazily-created Theme instance and rebuilds on config change.
+describe('ThemeBuilder', () => {
+  describe('theme getter', () => {
+    it('should create a default Theme when _theme is undefined (first access)', () => {
+      const builder = new ThemeBuilder()
+
+      const theme = builder.theme
+
+      expect(theme).toBeInstanceOf(Theme)
+      expect(theme.primaryColor).toBe('#1C64F2')
+    })
+
+    it('should return the same Theme instance on subsequent accesses', () => {
+      const builder = new ThemeBuilder()
+
+      const first = builder.theme
+      const second = builder.theme
+
+      expect(first).toBe(second)
+    })
+  })
+
+  describe('buildTheme', () => {
+    it('should create a Theme with the given color on first call', () => {
+      const builder = new ThemeBuilder()
+
+      builder.buildTheme('#AABBCC', false)
+
+      expect(builder.theme.primaryColor).toBe('#AABBCC')
+    })
+
+    it('should not rebuild the Theme when called again with the same config', () => {
+      const builder = new ThemeBuilder()
+      builder.buildTheme('#AABBCC', false)
+      const themeAfterFirstBuild = builder.theme
+
+      builder.buildTheme('#AABBCC', false)
+
+      // Same instance: no rebuild occurred
+      expect(builder.theme).toBe(themeAfterFirstBuild)
+    })
+
+    it('should rebuild the Theme when chatColorTheme changes', () => {
+      const builder = new ThemeBuilder()
+      builder.buildTheme('#AABBCC', false)
+      const originalTheme = builder.theme
+
+      builder.buildTheme('#FF0000', false)
+
+      expect(builder.theme).not.toBe(originalTheme)
+      expect(builder.theme.primaryColor).toBe('#FF0000')
+    })
+
+    it('should rebuild the Theme when chatColorThemeInverted changes', () => {
+      const builder = new ThemeBuilder()
+      builder.buildTheme('#AABBCC', false)
+      const originalTheme = builder.theme
+
+      builder.buildTheme('#AABBCC', true)
+
+      expect(builder.theme).not.toBe(originalTheme)
+      expect(builder.theme.chatColorThemeInverted).toBe(true)
+    })
+
+    it('should use default args (null, false) when called with no arguments', () => {
+      const builder = new ThemeBuilder()
+
+      builder.buildTheme()
+
+      expect(builder.theme.chatColorTheme).toBeNull()
+      expect(builder.theme.chatColorThemeInverted).toBe(false)
+    })
+
+    it('should store chatColorTheme and chatColorThemeInverted on the built Theme', () => {
+      const builder = new ThemeBuilder()
+
+      builder.buildTheme('#123456', true)
+
+      expect(builder.theme.chatColorTheme).toBe('#123456')
+      expect(builder.theme.chatColorThemeInverted).toBe(true)
+    })
+  })
+})
+
+// Scenario: useThemeContext returns a ThemeBuilder from the nearest ThemeContext.
+describe('useThemeContext', () => {
+  it('should return a ThemeBuilder instance from the default context', () => {
+    const { result } = renderHook(() => useThemeContext())
+
+    expect(result.current).toBeInstanceOf(ThemeBuilder)
+  })
+
+  it('should expose a valid theme on the returned ThemeBuilder', () => {
+    const { result } = renderHook(() => useThemeContext())
+
+    expect(result.current.theme).toBeInstanceOf(Theme)
+  })
+})

web/app/components/base/date-and-time-picker/date-picker/index.tsx

@@ -1,6 +1,5 @@
 import type { Dayjs } from 'dayjs'
 import type { DatePickerProps, Period } from '../types'
-import { RiCalendarLine, RiCloseCircleFill } from '@remixicon/react'
 import * as React from 'react'
 import { useCallback, useEffect, useMemo, useRef, useState } from 'react'
 import { useTranslation } from 'react-i18next'
@@ -218,38 +217,29 @@ const DatePicker = ({
     >
       <PortalToFollowElemTrigger className={triggerWrapClassName}>
         {renderTrigger
-          ? (renderTrigger({
-              value: normalizedValue,
-              selectedDate,
-              isOpen,
-              handleClear,
-              handleClickTrigger,
-            }))
+          ? (
+              renderTrigger({
+                value: normalizedValue,
+                selectedDate,
+                isOpen,
+                handleClear,
+                handleClickTrigger,
+              }))
           : (
               <div
                 className="group flex w-[252px] cursor-pointer items-center gap-x-0.5 rounded-lg bg-components-input-bg-normal px-2 py-1 hover:bg-state-base-hover-alt"
                 onClick={handleClickTrigger}
+                data-testid="date-picker-trigger"
               >
                 <input
-                  className="system-xs-regular flex-1 cursor-pointer appearance-none truncate bg-transparent p-1
-            text-components-input-text-filled outline-none placeholder:text-components-input-text-placeholder"
+                  className="flex-1 cursor-pointer appearance-none truncate bg-transparent p-1 text-components-input-text-filled
+            outline-none system-xs-regular placeholder:text-components-input-text-placeholder"
                   readOnly
                   value={isOpen ? '' : displayValue}
                   placeholder={placeholderDate}
                 />
-                <RiCalendarLine className={cn(
-                  'h-4 w-4 shrink-0 text-text-quaternary',
-                  isOpen ? 'text-text-secondary' : 'group-hover:text-text-secondary',
-                  (displayValue || (isOpen && selectedDate)) && 'group-hover:hidden',
-                )}
-                />
-                <RiCloseCircleFill
-                  className={cn(
-                    'hidden h-4 w-4 shrink-0 text-text-quaternary',
-                    (displayValue || (isOpen && selectedDate)) && 'hover:text-text-secondary group-hover:inline-block',
-                  )}
-                  onClick={handleClear}
-                />
+                <span className={cn('i-ri-calendar-line h-4 w-4 shrink-0 text-text-quaternary', isOpen ? 'text-text-secondary' : 'group-hover:text-text-secondary', (displayValue || (isOpen && selectedDate)) && 'group-hover:hidden')} />
+                <span className={cn('i-ri-close-circle-fill hidden h-4 w-4 shrink-0 text-text-quaternary', (displayValue || (isOpen && selectedDate)) && 'hover:text-text-secondary group-hover:inline-block')} onClick={handleClear} data-testid="date-picker-clear-button" />
               </div>
             )}
       </PortalToFollowElemTrigger>

web/app/components/base/date-and-time-picker/time-picker/index.tsx

@@ -1,6 +1,5 @@
 import type { Dayjs } from 'dayjs'
 import type { TimePickerProps } from '../types'
-import { RiCloseCircleFill, RiTimeLine } from '@remixicon/react'
 import * as React from 'react'
 import { useCallback, useEffect, useRef, useState } from 'react'
 import { useTranslation } from 'react-i18next'
@@ -199,8 +198,8 @@ const TimePicker = ({
 
   const inputElem = (
     <input
-      className="system-xs-regular flex-1 cursor-pointer select-none appearance-none truncate bg-transparent p-1
-            text-components-input-text-filled outline-none placeholder:text-components-input-text-placeholder"
+      className="flex-1 cursor-pointer select-none appearance-none truncate bg-transparent p-1 text-components-input-text-filled
+            outline-none system-xs-regular placeholder:text-components-input-text-placeholder"
       readOnly
       value={isOpen ? '' : displayValue}
       placeholder={placeholderDate}
@@ -226,26 +225,14 @@ const TimePicker = ({
                   triggerFullWidth ? 'w-full min-w-0' : 'w-[252px]',
                 )}
                 onClick={handleClickTrigger}
+                data-testid="time-picker-trigger"
               >
                 {inputElem}
                 {showTimezone && timezone && (
                   <TimezoneLabel timezone={timezone} inline className="shrink-0 select-none text-xs" />
                 )}
-                <RiTimeLine className={cn(
-                  'h-4 w-4 shrink-0 text-text-quaternary',
-                  isOpen ? 'text-text-secondary' : 'group-hover:text-text-secondary',
-                  (displayValue || (isOpen && selectedTime)) && !notClearable && 'group-hover:hidden',
-                )}
-                />
-                <RiCloseCircleFill
-                  className={cn(
-                    'hidden h-4 w-4 shrink-0 text-text-quaternary',
-                    (displayValue || (isOpen && selectedTime)) && !notClearable && 'hover:text-text-secondary group-hover:inline-block',
-                  )}
-                  role="button"
-                  aria-label={t('operation.clear', { ns: 'common' })}
-                  onClick={handleClear}
-                />
+                <span className={cn('i-ri-time-line h-4 w-4 shrink-0 text-text-quaternary', isOpen ? 'text-text-secondary' : 'group-hover:text-text-secondary', (displayValue || (isOpen && selectedTime)) && !notClearable && 'group-hover:hidden')} />
+                <span className={cn('i-ri-close-circle-fill hidden h-4 w-4 shrink-0 text-text-quaternary', (displayValue || (isOpen && selectedTime)) && !notClearable && 'hover:text-text-secondary group-hover:inline-block')} role="button" aria-label={t('operation.clear', { ns: 'common' })} onClick={handleClear} />
               </div>
             )}
       </PortalToFollowElemTrigger>

web/app/components/base/file-uploader/dynamic-pdf-preview.spec.tsx

@@ -0,0 +1,105 @@
+import { fireEvent, render, screen } from '@testing-library/react'
+import DynamicPdfPreview from './dynamic-pdf-preview'
+
+type DynamicPdfPreviewProps = {
+  url: string
+  onCancel: () => void
+}
+
+type DynamicLoader = () => Promise<unknown> | undefined
+type DynamicOptions = {
+  ssr?: boolean
+}
+
+const mockState = vi.hoisted(() => ({
+  loader: undefined as DynamicLoader | undefined,
+  options: undefined as DynamicOptions | undefined,
+}))
+
+const mockDynamicRender = vi.hoisted(() => vi.fn())
+
+const mockDynamic = vi.hoisted(() =>
+  vi.fn((loader: DynamicLoader, options: DynamicOptions) => {
+    mockState.loader = loader
+    mockState.options = options
+
+    const MockDynamicPdfPreview = ({ url, onCancel }: DynamicPdfPreviewProps) => {
+      mockDynamicRender({ url, onCancel })
+      return (
+        <button data-testid="dynamic-pdf-preview" data-url={url} onClick={onCancel}>
+          Dynamic PDF Preview
+        </button>
+      )
+    }
+
+    return MockDynamicPdfPreview
+  }),
+)
+
+const mockPdfPreview = vi.hoisted(() =>
+  vi.fn(() => null),
+)
+
+vi.mock('next/dynamic', () => ({
+  default: mockDynamic,
+}))
+
+vi.mock('./pdf-preview', () => ({
+  default: mockPdfPreview,
+}))
+
+describe('dynamic-pdf-preview', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should configure next/dynamic with ssr disabled', () => {
+    expect(mockState.loader).toEqual(expect.any(Function))
+    expect(mockState.options).toEqual({ ssr: false })
+  })
+
+  it('should render the dynamic component and forward props', () => {
+    const onCancel = vi.fn()
+    render(<DynamicPdfPreview url="https://example.com/test.pdf" onCancel={onCancel} />)
+
+    const trigger = screen.getByTestId('dynamic-pdf-preview')
+    expect(trigger).toHaveAttribute('data-url', 'https://example.com/test.pdf')
+    expect(mockDynamicRender).toHaveBeenCalledWith({
+      url: 'https://example.com/test.pdf',
+      onCancel,
+    })
+
+    fireEvent.click(trigger)
+    expect(onCancel).toHaveBeenCalledTimes(1)
+  })
+
+  it('should return pdf-preview module when loader is executed in browser-like environment', async () => {
+    const loaded = mockState.loader?.()
+    expect(loaded).toBeInstanceOf(Promise)
+
+    const loadedModule = (await loaded) as { default: unknown }
+    const pdfPreviewModule = await import('./pdf-preview')
+    expect(loadedModule.default).toBe(pdfPreviewModule.default)
+  })
+
+  it('should return undefined when loader runs without window', () => {
+    const originalWindow = globalThis.window
+    Object.defineProperty(globalThis, 'window', {
+      configurable: true,
+      writable: true,
+      value: undefined,
+    })
+
+    try {
+      const loaded = mockState.loader?.()
+      expect(loaded).toBeUndefined()
+    }
+    finally {
+      Object.defineProperty(globalThis, 'window', {
+        configurable: true,
+        writable: true,
+        value: originalWindow,
+      })
+    }
+  })
+})

web/app/components/base/form/components/field/__tests__/variable-or-constant-input.spec.tsx

@@ -44,4 +44,16 @@ describe('VariableOrConstantInputField', () => {
     fireEvent.click(modeButtons[0])
     expect(screen.getByRole('button', { name: 'Variable picker' })).toBeInTheDocument()
   })
+
+  it('should handle variable picker changes', () => {
+    const logSpy = vi.spyOn(console, 'log').mockImplementation(() => { })
+    try {
+      render(<VariableOrConstantInputField label="Input source" />)
+      fireEvent.click(screen.getByRole('button', { name: 'Variable picker' }))
+      expect(logSpy).toHaveBeenCalledWith('Variable value changed')
+    }
+    finally {
+      logSpy.mockRestore()
+    }
+  })
 })

web/app/components/base/form/form-scenarios/base/__tests__/utils.spec.ts

@@ -46,4 +46,54 @@ describe('base scenario schema generator', () => {
     expect(schema.safeParse({}).success).toBe(true)
     expect(schema.safeParse({ mode: null }).success).toBe(true)
   })
+
+  it('should validate required checkbox values as booleans', () => {
+    const schema = generateZodSchema([{
+      type: BaseFieldType.checkbox,
+      variable: 'accepted',
+      label: 'Accepted',
+      required: true,
+      showConditions: [],
+    }])
+
+    expect(schema.safeParse({ accepted: true }).success).toBe(true)
+    expect(schema.safeParse({ accepted: false }).success).toBe(true)
+    expect(schema.safeParse({ accepted: 'yes' }).success).toBe(false)
+    expect(schema.safeParse({}).success).toBe(false)
+  })
+
+  it('should fallback to any schema for unsupported field types', () => {
+    const schema = generateZodSchema([{
+      type: BaseFieldType.file,
+      variable: 'attachment',
+      label: 'Attachment',
+      required: false,
+      showConditions: [],
+      allowedFileTypes: [],
+      allowedFileExtensions: [],
+      allowedFileUploadMethods: [],
+    }])
+
+    expect(schema.safeParse({ attachment: { id: 'file-1' } }).success).toBe(true)
+    expect(schema.safeParse({ attachment: 'raw-string' }).success).toBe(true)
+    expect(schema.safeParse({}).success).toBe(true)
+    expect(schema.safeParse({ attachment: null }).success).toBe(true)
+  })
+
+  it('should ignore numeric and text constraints for non-applicable field types', () => {
+    const schema = generateZodSchema([{
+      type: BaseFieldType.checkbox,
+      variable: 'toggle',
+      label: 'Toggle',
+      required: true,
+      showConditions: [],
+      maxLength: 1,
+      min: 10,
+      max: 20,
+    }])
+
+    expect(schema.safeParse({ toggle: true }).success).toBe(true)
+    expect(schema.safeParse({ toggle: false }).success).toBe(true)
+    expect(schema.safeParse({ toggle: 1 }).success).toBe(false)
+  })
 })

web/app/components/base/icons/__tests__/IconBase.spec.tsx

@@ -8,7 +8,7 @@ import * as utils from '../utils'
 vi.mock('../utils', () => ({
   generate: vi.fn((icon, key, props) => (
     <svg
-      data-testid="mock-svg"
+      data-testid={key}
       key={key}
       {...props}
     >
@@ -29,7 +29,7 @@ describe('IconBase Component', () => {
 
   it('renders properly with required props', () => {
     render(<IconBase data={mockData} />)
-    const svg = screen.getByTestId('mock-svg')
+    const svg = screen.getByTestId('svg-test-icon')
     expect(svg).toBeInTheDocument()
     expect(svg).toHaveAttribute('data-icon', mockData.name)
     expect(svg).toHaveAttribute('aria-hidden', 'true')
@@ -37,7 +37,7 @@ describe('IconBase Component', () => {
 
   it('passes className to the generated SVG', () => {
     render(<IconBase data={mockData} className="custom-class" />)
-    const svg = screen.getByTestId('mock-svg')
+    const svg = screen.getByTestId('svg-test-icon')
     expect(svg).toHaveAttribute('class', 'custom-class')
     expect(utils.generate).toHaveBeenCalledWith(
       mockData.icon,
@@ -49,7 +49,7 @@ describe('IconBase Component', () => {
   it('handles onClick events', () => {
     const handleClick = vi.fn()
     render(<IconBase data={mockData} onClick={handleClick} />)
-    const svg = screen.getByTestId('mock-svg')
+    const svg = screen.getByTestId('svg-test-icon')
     fireEvent.click(svg)
     expect(handleClick).toHaveBeenCalledTimes(1)
   })

web/app/components/base/icons/__tests__/utils.spec.ts

@@ -21,6 +21,28 @@ describe('generate icon base utils', () => {
       const result = normalizeAttrs(attrs)
       expect(result).toEqual({ dataTest: 'value', xlinkHref: 'url' })
     })
+
+    it('should filter out editor metadata attributes', () => {
+      const attrs = {
+        'inkscape:version': '1.0',
+        'sodipodi:docname': 'icon.svg',
+        'xmlns:inkscape': 'http...',
+        'xmlns:sodipodi': 'http...',
+        'xmlns:svg': 'http...',
+        'data-name': 'Layer 1',
+        'xmlns-inkscape': 'http...',
+        'xmlns-sodipodi': 'http...',
+        'xmlns-svg': 'http...',
+        'dataName': 'Layer 1',
+        'valid': 'value',
+      }
+      expect(normalizeAttrs(attrs)).toEqual({ valid: 'value' })
+    })
+
+    it('should ignore undefined attribute values and handle default argument', () => {
+      expect(normalizeAttrs()).toEqual({})
+      expect(normalizeAttrs({ missing: undefined, valid: 'true' })).toEqual({ valid: 'true' })
+    })
   })
 
   describe('generate', () => {
@@ -58,7 +80,19 @@ describe('generate icon base utils', () => {
       const node: AbstractNode = {
         name: 'div',
         attributes: { class: 'container' },
-        children: [],
+        children: [{ name: 'span', attributes: {} }],
+      }
+
+      const rootProps = { id: 'root' }
+      const { container } = render(generate(node, 'key', rootProps))
+      expect(container.querySelector('div')).toHaveAttribute('id', 'root')
+      expect(container.querySelector('span')).toBeInTheDocument()
+    })
+
+    it('should handle undefined children with rootProps', () => {
+      const node: AbstractNode = {
+        name: 'div',
+        attributes: { class: 'container' },
       }
 
       const rootProps = { id: 'root' }

web/app/components/base/icons/assets/vender/line/financeAndECommerce/credits-coin.svg

@@ -1,4 +0,0 @@
-<svg width="10" height="10" viewBox="0 0 10 10" fill="none" xmlns="http://www.w3.org/2000/svg">
-<path d="M2 5C2 3.44487 2.58482 1.98537 3.54004 1.04932C2.17681 1.34034 1 2.90001 1 5C1 7.09996 2.17685 8.65912 3.54004 8.9502C2.58496 8.01413 2 6.55501 2 5ZM3 5C3 7.33338 4.4528 9 6 9C7.5472 9 9 7.33338 9 5C9 2.66664 7.5472 1 6 1C4.4528 1 3 2.66664 3 5ZM10 5C10 7.63722 8.3188 10 6 10H4C1.6812 10 0 7.63722 0 5C0 2.3628 1.6812 0 4 0H6C8.3188 0 10 2.3628 10 5Z" fill="#676F83"/>
-<path d="M6.71519 4.09259L6.45385 3.18667C6.42141 3.07421 6.34037 3 6.25 3C6.15963 3 6.07859 3.07421 6.04615 3.18667L5.78481 4.09259C5.74675 4.22464 5.66849 4.32899 5.56945 4.37978L4.88999 4.7282C4.80565 4.77146 4.75 4.87951 4.75 5C4.75 5.12049 4.80565 5.22854 4.88999 5.2718L5.56945 5.62022C5.66849 5.67101 5.74675 5.77536 5.78481 5.90741L6.04615 6.81333C6.07859 6.92579 6.15963 7 6.25 7C6.34037 7 6.42141 6.92579 6.45385 6.81333L6.71519 5.90741C6.75325 5.77536 6.83151 5.67101 6.93055 5.62022L7.61001 5.2718C7.69435 5.22854 7.75 5.12049 7.75 5C7.75 4.87951 7.69435 4.77146 7.61001 4.7282L6.93055 4.37978C6.83151 4.32899 6.75325 4.22464 6.71519 4.09259Z" fill="#676F83"/>
-</svg>

web/app/components/base/icons/src/vender/line/financeAndECommerce/CreditsCoin.json

@@ -1,35 +0,0 @@
-{
-  "icon": {
-    "type": "element",
-    "isRootNode": true,
-    "name": "svg",
-    "attributes": {
-      "width": "10",
-      "height": "10",
-      "viewBox": "0 0 10 10",
-      "fill": "none",
-      "xmlns": "http://www.w3.org/2000/svg"
-    },
-    "children": [
-      {
-        "type": "element",
-        "name": "path",
-        "attributes": {
-          "d": "M2 5C2 3.44487 2.58482 1.98537 3.54004 1.04932C2.17681 1.34034 1 2.90001 1 5C1 7.09996 2.17685 8.65912 3.54004 8.9502C2.58496 8.01413 2 6.55501 2 5ZM3 5C3 7.33338 4.4528 9 6 9C7.5472 9 9 7.33338 9 5C9 2.66664 7.5472 1 6 1C4.4528 1 3 2.66664 3 5ZM10 5C10 7.63722 8.3188 10 6 10H4C1.6812 10 0 7.63722 0 5C0 2.3628 1.6812 0 4 0H6C8.3188 0 10 2.3628 10 5Z",
-          "fill": "currentColor"
-        },
-        "children": []
-      },
-      {
-        "type": "element",
-        "name": "path",
-        "attributes": {
-          "d": "M6.71519 4.09259L6.45385 3.18667C6.42141 3.07421 6.34037 3 6.25 3C6.15963 3 6.07859 3.07421 6.04615 3.18667L5.78481 4.09259C5.74675 4.22464 5.66849 4.32899 5.56945 4.37978L4.88999 4.7282C4.80565 4.77146 4.75 4.87951 4.75 5C4.75 5.12049 4.80565 5.22854 4.88999 5.2718L5.56945 5.62022C5.66849 5.67101 5.74675 5.77536 5.78481 5.90741L6.04615 6.81333C6.07859 6.92579 6.15963 7 6.25 7C6.34037 7 6.42141 6.92579 6.45385 6.81333L6.71519 5.90741C6.75325 5.77536 6.83151 5.67101 6.93055 5.62022L7.61001 5.2718C7.69435 5.22854 7.75 5.12049 7.75 5C7.75 4.87951 7.69435 4.77146 7.61001 4.7282L6.93055 4.37978C6.83151 4.32899 6.75325 4.22464 6.71519 4.09259Z",
-          "fill": "currentColor"
-        },
-        "children": []
-      }
-    ]
-  },
-  "name": "CreditsCoin"
-}

web/app/components/base/icons/src/vender/line/financeAndECommerce/CreditsCoin.tsx

@@ -1,20 +0,0 @@
-// GENERATE BY script
-// DON NOT EDIT IT MANUALLY
-
-import type { IconData } from '@/app/components/base/icons/IconBase'
-import * as React from 'react'
-import IconBase from '@/app/components/base/icons/IconBase'
-import data from './CreditsCoin.json'
-
-const Icon = (
-  {
-    ref,
-    ...props
-  }: React.SVGProps<SVGSVGElement> & {
-    ref?: React.RefObject<React.RefObject<HTMLOrSVGElement>>
-  },
-) => <IconBase {...props} ref={ref} data={data as IconData} />
-
-Icon.displayName = 'CreditsCoin'
-
-export default Icon

web/app/components/base/icons/src/vender/line/financeAndECommerce/index.ts

@@ -1,6 +1,5 @@
 export { default as Balance } from './Balance'
 export { default as CoinsStacked01 } from './CoinsStacked01'
-export { default as CreditsCoin } from './CreditsCoin'
 export { default as GoldCoin } from './GoldCoin'
 export { default as ReceiptList } from './ReceiptList'
 export { default as Tag01 } from './Tag01'

web/app/components/base/image-gallery/index.tsx

@@ -36,7 +36,7 @@ const ImageGallery: FC<Props> = ({
   const imgNum = srcs.length
   const imgStyle = getWidthStyle(imgNum)
   return (
-    <div className={cn(s[`img-${imgNum}`], 'flex flex-wrap')}>
+    <div className={cn(s[`img-${imgNum}`], 'flex flex-wrap')} data-testid="image-gallery">
       {srcs.map((src, index) => (
         !src
           ? null

web/app/components/base/image-uploader/__tests__/chat-image-uploader.spec.tsx

@@ -1,6 +1,6 @@
 import type { useLocalFileUploader } from '../hooks'
 import type { ImageFile, VisionSettings } from '@/types/app'
-import { render, screen } from '@testing-library/react'
+import { fireEvent, render, screen } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
 import { Resolution, TransferMethod } from '@/types/app'
 import ChatImageUploader from '../chat-image-uploader'
@@ -193,6 +193,23 @@ describe('ChatImageUploader', () => {
       expect(screen.queryByRole('textbox')).not.toBeInTheDocument()
     })
 
+    it('should keep popover closed when trigger wrapper is clicked while disabled', async () => {
+      const user = userEvent.setup()
+      const settings = createSettings({
+        transfer_methods: [TransferMethod.remote_url],
+      })
+      render(<ChatImageUploader settings={settings} onUpload={defaultOnUpload} disabled />)
+
+      const button = screen.getByRole('button')
+      const triggerWrapper = button.parentElement
+      if (!triggerWrapper)
+        throw new Error('Expected trigger wrapper to exist')
+
+      await user.click(triggerWrapper)
+
+      expect(screen.queryByRole('textbox')).not.toBeInTheDocument()
+    })
+
     it('should show OR separator and local uploader when both methods are available', async () => {
       const user = userEvent.setup()
       const settings = createSettings({
@@ -207,6 +224,30 @@ describe('ChatImageUploader', () => {
       expect(queryFileInput()).toBeInTheDocument()
     })
 
+    it('should toggle local-upload hover style in mixed transfer mode', async () => {
+      const user = userEvent.setup()
+      const settings = createSettings({
+        transfer_methods: [TransferMethod.local_file, TransferMethod.remote_url],
+      })
+      render(<ChatImageUploader settings={settings} onUpload={defaultOnUpload} />)
+
+      await user.click(screen.getByRole('button'))
+
+      const uploadFromComputer = screen.getByText('common.imageUploader.uploadFromComputer')
+      expect(uploadFromComputer).not.toHaveClass('bg-primary-50')
+
+      const localInput = getFileInput()
+      const hoverWrapper = localInput.parentElement
+      if (!hoverWrapper)
+        throw new Error('Expected local uploader wrapper to exist')
+
+      fireEvent.mouseEnter(hoverWrapper)
+      expect(uploadFromComputer).toHaveClass('bg-primary-50')
+
+      fireEvent.mouseLeave(hoverWrapper)
+      expect(uploadFromComputer).not.toHaveClass('bg-primary-50')
+    })
+
     it('should not show OR separator or local uploader when only remote_url method', async () => {
       const user = userEvent.setup()
       const settings = createSettings({

web/app/components/base/image-uploader/__tests__/image-link-input.spec.tsx

@@ -140,9 +140,11 @@ describe('ImageLinkInput', () => {
 
       const input = screen.getByRole('textbox')
       await user.type(input, 'https://example.com/image.png')
-      await user.click(screen.getByRole('button'))
+      const button = screen.getByRole('button')
+      expect(button).toBeDisabled()
+
+      await user.click(button)
 
-      // Button is disabled, so click won't fire handleClick
       expect(onUpload).not.toHaveBeenCalled()
     })
 

web/app/components/base/image-uploader/__tests__/image-preview.spec.tsx

@@ -2,22 +2,15 @@ import { act, render, screen, waitFor } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
 import ImagePreview from '../image-preview'
 
-type HotkeyHandler = () => void
+type _HotkeyHandler = () => void
 
 const mocks = vi.hoisted(() => ({
-  hotkeys: {} as Record<string, HotkeyHandler>,
   notify: vi.fn(),
   downloadUrl: vi.fn(),
   windowOpen: vi.fn<(...args: unknown[]) => Window | null>(),
   clipboardWrite: vi.fn<(items: ClipboardItem[]) => Promise<void>>(),
 }))
 
-vi.mock('react-hotkeys-hook', () => ({
-  useHotkeys: (keys: string, handler: HotkeyHandler) => {
-    mocks.hotkeys[keys] = handler
-  },
-}))
-
 vi.mock('@/app/components/base/toast', () => ({
   default: {
     notify: (...args: Parameters<typeof mocks.notify>) => mocks.notify(...args),
@@ -44,7 +37,6 @@ describe('ImagePreview', () => {
 
   beforeEach(() => {
     vi.clearAllMocks()
-    mocks.hotkeys = {}
 
     if (!navigator.clipboard) {
       Object.defineProperty(globalThis.navigator, 'clipboard', {
@@ -109,7 +101,8 @@ describe('ImagePreview', () => {
   })
 
   describe('Hotkeys', () => {
-    it('should register hotkeys and invoke esc/left/right handlers', () => {
+    it('should trigger esc/left/right handlers from keyboard', async () => {
+      const user = userEvent.setup()
       const onCancel = vi.fn()
       const onPrev = vi.fn()
       const onNext = vi.fn()
@@ -123,18 +116,34 @@ describe('ImagePreview', () => {
         />,
       )
 
-      expect(mocks.hotkeys.esc).toBeInstanceOf(Function)
-      expect(mocks.hotkeys.left).toBeInstanceOf(Function)
-      expect(mocks.hotkeys.right).toBeInstanceOf(Function)
-
-      mocks.hotkeys.esc?.()
-      mocks.hotkeys.left?.()
-      mocks.hotkeys.right?.()
+      await user.keyboard('{Escape}{ArrowLeft}{ArrowRight}')
 
       expect(onCancel).toHaveBeenCalledTimes(1)
       expect(onPrev).toHaveBeenCalledTimes(1)
       expect(onNext).toHaveBeenCalledTimes(1)
     })
+
+    it('should zoom in and out from keyboard up/down hotkeys', async () => {
+      const user = userEvent.setup()
+      render(
+        <ImagePreview
+          url="https://example.com/image.png"
+          title="Preview Image"
+          onCancel={vi.fn()}
+        />,
+      )
+      const image = screen.getByRole('img', { name: 'Preview Image' })
+
+      await user.keyboard('{ArrowUp}')
+      await waitFor(() => {
+        expect(image).toHaveStyle({ transform: 'scale(1.2) translate(0px, 0px)' })
+      })
+
+      await user.keyboard('{ArrowDown}')
+      await waitFor(() => {
+        expect(image).toHaveStyle({ transform: 'scale(1) translate(0px, 0px)' })
+      })
+    })
   })
 
   describe('User Interactions', () => {
@@ -225,13 +234,18 @@ describe('ImagePreview', () => {
 
       act(() => {
         overlay.dispatchEvent(new MouseEvent('mousedown', { bubbles: true, clientX: 10, clientY: 10 }))
-        overlay.dispatchEvent(new MouseEvent('mousemove', { bubbles: true, clientX: 40, clientY: 30 }))
       })
-
       await waitFor(() => {
         expect(image.style.transition).toBe('none')
       })
-      expect(image.style.transform).toContain('translate(')
+
+      act(() => {
+        overlay.dispatchEvent(new MouseEvent('mousemove', { bubbles: true, clientX: 200, clientY: -100 }))
+      })
+
+      await waitFor(() => {
+        expect(image).toHaveStyle({ transform: 'scale(1.2) translate(70px, -22px)' })
+      })
 
       act(() => {
         document.dispatchEvent(new MouseEvent('mouseup', { bubbles: true }))

web/app/components/base/input-number/__tests__/index.spec.tsx

@@ -1,4 +1,5 @@
 import { fireEvent, render, screen } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
 import { InputNumber } from '../index'
 
 describe('InputNumber Component', () => {
@@ -16,70 +17,130 @@ describe('InputNumber Component', () => {
     expect(input).toBeInTheDocument()
   })
 
-  it('handles increment button click', () => {
-    render(<InputNumber {...defaultProps} value={5} />)
+  it('handles increment button click', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={5} />)
     const incrementBtn = screen.getByRole('button', { name: /increment/i })
 
-    fireEvent.click(incrementBtn)
-    expect(defaultProps.onChange).toHaveBeenCalledWith(6)
+    await user.click(incrementBtn)
+    expect(onChange).toHaveBeenCalledWith(6)
   })
 
-  it('handles decrement button click', () => {
-    render(<InputNumber {...defaultProps} value={5} />)
+  it('handles decrement button click', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={5} />)
     const decrementBtn = screen.getByRole('button', { name: /decrement/i })
 
-    fireEvent.click(decrementBtn)
-    expect(defaultProps.onChange).toHaveBeenCalledWith(4)
+    await user.click(decrementBtn)
+    expect(onChange).toHaveBeenCalledWith(4)
   })
 
-  it('respects max value constraint', () => {
-    render(<InputNumber {...defaultProps} value={10} max={10} />)
+  it('respects max value constraint', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={10} max={10} />)
     const incrementBtn = screen.getByRole('button', { name: /increment/i })
 
-    fireEvent.click(incrementBtn)
-    expect(defaultProps.onChange).not.toHaveBeenCalled()
+    await user.click(incrementBtn)
+    expect(onChange).not.toHaveBeenCalled()
   })
 
-  it('respects min value constraint', () => {
-    render(<InputNumber {...defaultProps} value={0} min={0} />)
+  it('respects min value constraint', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={0} min={0} />)
     const decrementBtn = screen.getByRole('button', { name: /decrement/i })
 
-    fireEvent.click(decrementBtn)
-    expect(defaultProps.onChange).not.toHaveBeenCalled()
+    await user.click(decrementBtn)
+    expect(onChange).not.toHaveBeenCalled()
   })
 
   it('handles direct input changes', () => {
-    render(<InputNumber {...defaultProps} />)
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} />)
     const input = screen.getByRole('spinbutton')
 
     fireEvent.change(input, { target: { value: '42' } })
-    expect(defaultProps.onChange).toHaveBeenCalledWith(42)
+    expect(onChange).toHaveBeenCalledWith(42)
   })
 
   it('handles empty input', () => {
-    render(<InputNumber {...defaultProps} value={1} />)
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={1} />)
     const input = screen.getByRole('spinbutton')
 
     fireEvent.change(input, { target: { value: '' } })
-    expect(defaultProps.onChange).toHaveBeenCalledWith(0)
+    expect(onChange).toHaveBeenCalledWith(0)
   })
 
-  it('handles invalid input', () => {
-    render(<InputNumber {...defaultProps} />)
+  it('does not call onChange when parsed value is NaN', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} />)
     const input = screen.getByRole('spinbutton')
 
-    fireEvent.change(input, { target: { value: 'abc' } })
-    expect(defaultProps.onChange).toHaveBeenCalledWith(0)
+    const originalNumber = globalThis.Number
+    const numberSpy = vi.spyOn(globalThis, 'Number').mockImplementation((val: unknown) => {
+      if (val === '123') {
+        return Number.NaN
+      }
+      return originalNumber(val)
+    })
+
+    try {
+      fireEvent.change(input, { target: { value: '123' } })
+      expect(onChange).not.toHaveBeenCalled()
+    }
+    finally {
+      numberSpy.mockRestore()
+    }
+  })
+
+  it('does not call onChange when direct input exceeds range', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} max={10} min={0} />)
+    const input = screen.getByRole('spinbutton')
+
+    fireEvent.change(input, { target: { value: '11' } })
+
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('uses default value when increment and decrement are clicked without value prop', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} defaultValue={7} />)
+
+    await user.click(screen.getByRole('button', { name: /increment/i }))
+    await user.click(screen.getByRole('button', { name: /decrement/i }))
+
+    expect(onChange).toHaveBeenNthCalledWith(1, 7)
+    expect(onChange).toHaveBeenNthCalledWith(2, 7)
+  })
+
+  it('falls back to zero when controls are used without value and defaultValue', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} />)
+
+    await user.click(screen.getByRole('button', { name: /increment/i }))
+    await user.click(screen.getByRole('button', { name: /decrement/i }))
+
+    expect(onChange).toHaveBeenNthCalledWith(1, 0)
+    expect(onChange).toHaveBeenNthCalledWith(2, 0)
   })
 
   it('displays unit when provided', () => {
+    const onChange = vi.fn()
     const unit = 'px'
-    render(<InputNumber {...defaultProps} unit={unit} />)
+    render(<InputNumber onChange={onChange} unit={unit} />)
     expect(screen.getByText(unit)).toBeInTheDocument()
   })
 
   it('disables controls when disabled prop is true', () => {
-    render(<InputNumber {...defaultProps} disabled />)
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} disabled />)
     const input = screen.getByRole('spinbutton')
     const incrementBtn = screen.getByRole('button', { name: /increment/i })
     const decrementBtn = screen.getByRole('button', { name: /decrement/i })
@@ -88,4 +149,205 @@ describe('InputNumber Component', () => {
     expect(incrementBtn).toBeDisabled()
     expect(decrementBtn).toBeDisabled()
   })
+
+  it('does not change value when disabled controls are clicked', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    const { getByRole } = render(<InputNumber onChange={onChange} disabled value={5} />)
+
+    const incrementBtn = getByRole('button', { name: /increment/i })
+    const decrementBtn = getByRole('button', { name: /decrement/i })
+
+    expect(incrementBtn).toBeDisabled()
+    expect(decrementBtn).toBeDisabled()
+
+    await user.click(incrementBtn)
+    await user.click(decrementBtn)
+
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('keeps increment guard when disabled even if button is force-clickable', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} disabled value={5} />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+
+    // Remove native disabled to force event dispatch and hit component-level guard.
+    incrementBtn.removeAttribute('disabled')
+    fireEvent.click(incrementBtn)
+
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('keeps decrement guard when disabled even if button is force-clickable', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} disabled value={5} />)
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    // Remove native disabled to force event dispatch and hit component-level guard.
+    decrementBtn.removeAttribute('disabled')
+    fireEvent.click(decrementBtn)
+
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('applies large-size classes for control buttons', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} size="large" />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    expect(incrementBtn).toHaveClass('pt-1.5')
+    expect(decrementBtn).toHaveClass('pb-1.5')
+  })
+
+  it('prevents increment beyond max with custom amount', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={8} max={10} amount={5} />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+
+    await user.click(incrementBtn)
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('prevents decrement below min with custom amount', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={2} min={0} amount={5} />)
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    await user.click(decrementBtn)
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('increments when value with custom amount stays within bounds', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={5} max={10} amount={3} />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+
+    await user.click(incrementBtn)
+    expect(onChange).toHaveBeenCalledWith(8)
+  })
+
+  it('decrements when value with custom amount stays within bounds', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={5} min={0} amount={3} />)
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    await user.click(decrementBtn)
+    expect(onChange).toHaveBeenCalledWith(2)
+  })
+
+  it('validates input against max constraint', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} max={10} />)
+    const input = screen.getByRole('spinbutton')
+
+    fireEvent.change(input, { target: { value: '15' } })
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('validates input against min constraint', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} min={5} />)
+    const input = screen.getByRole('spinbutton')
+
+    fireEvent.change(input, { target: { value: '2' } })
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('accepts input within min and max constraints', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} min={0} max={100} />)
+    const input = screen.getByRole('spinbutton')
+
+    fireEvent.change(input, { target: { value: '50' } })
+    expect(onChange).toHaveBeenCalledWith(50)
+  })
+
+  it('handles negative min and max values', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} min={-10} max={10} value={0} />)
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    await user.click(decrementBtn)
+    expect(onChange).toHaveBeenCalledWith(-1)
+  })
+
+  it('prevents decrement below negative min', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} min={-10} value={-10} />)
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    await user.click(decrementBtn)
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('applies wrapClassName to outer div', () => {
+    const onChange = vi.fn()
+    const wrapClassName = 'custom-wrap-class'
+    render(<InputNumber onChange={onChange} wrapClassName={wrapClassName} />)
+    const wrapper = screen.getByTestId('input-number-wrapper')
+    expect(wrapper).toHaveClass(wrapClassName)
+  })
+
+  it('applies controlWrapClassName to control buttons container', () => {
+    const onChange = vi.fn()
+    const controlWrapClassName = 'custom-control-wrap'
+    render(<InputNumber onChange={onChange} controlWrapClassName={controlWrapClassName} />)
+    const controlDiv = screen.getByTestId('input-number-controls')
+    expect(controlDiv).toHaveClass(controlWrapClassName)
+  })
+
+  it('applies controlClassName to individual control buttons', () => {
+    const onChange = vi.fn()
+    const controlClassName = 'custom-control'
+    render(<InputNumber onChange={onChange} controlClassName={controlClassName} />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+    expect(incrementBtn).toHaveClass(controlClassName)
+    expect(decrementBtn).toHaveClass(controlClassName)
+  })
+
+  it('applies regular-size classes for control buttons when size is regular', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} size="regular" />)
+    const incrementBtn = screen.getByRole('button', { name: /increment/i })
+    const decrementBtn = screen.getByRole('button', { name: /decrement/i })
+
+    expect(incrementBtn).toHaveClass('pt-1')
+    expect(decrementBtn).toHaveClass('pb-1')
+  })
+
+  it('handles zero as a valid input', () => {
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} min={-5} max={5} value={1} />)
+    const input = screen.getByRole('spinbutton')
+
+    fireEvent.change(input, { target: { value: '0' } })
+    expect(onChange).toHaveBeenCalledWith(0)
+  })
+
+  it('prevents exact max boundary increment', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={10} max={10} />)
+
+    await user.click(screen.getByRole('button', { name: /increment/i }))
+    expect(onChange).not.toHaveBeenCalled()
+  })
+
+  it('prevents exact min boundary decrement', async () => {
+    const user = userEvent.setup()
+    const onChange = vi.fn()
+    render(<InputNumber onChange={onChange} value={0} min={0} />)
+
+    await user.click(screen.getByRole('button', { name: /decrement/i }))
+    expect(onChange).not.toHaveBeenCalled()
+  })
 })

web/app/components/base/input-number/index.tsx

@@ -1,6 +1,5 @@
 import type { FC } from 'react'
 import type { InputProps } from '../input'
-import { RiArrowDownSLine, RiArrowUpSLine } from '@remixicon/react'
 import { useCallback } from 'react'
 import { cn } from '@/utils/classnames'
 import Input from '../input'
@@ -45,6 +44,7 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
   }, [max, min])
 
   const inc = () => {
+    /* v8 ignore next 2 - @preserve */
     if (disabled)
       return
 
@@ -58,6 +58,7 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
     onChange(newValue)
   }
   const dec = () => {
+    /* v8 ignore next 2 - @preserve */
     if (disabled)
       return
 
@@ -86,12 +87,12 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
   }, [isValidValue, onChange])
 
   return (
-    <div className={cn('flex', wrapClassName)}>
+    <div data-testid="input-number-wrapper" className={cn('flex', wrapClassName)}>
       <Input
         {...rest}
         // disable default controller
         type="number"
-        className={cn('no-spinner rounded-r-none', className)}
+        className={cn('rounded-r-none no-spinner', className)}
         value={value ?? 0}
         max={max}
         min={min}
@@ -100,7 +101,10 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
         unit={unit}
         size={size}
       />
-      <div className={cn('flex flex-col rounded-r-md border-l border-divider-subtle bg-components-input-bg-normal text-text-tertiary focus:shadow-xs', disabled && 'cursor-not-allowed opacity-50', controlWrapClassName)}>
+      <div
+        data-testid="input-number-controls"
+        className={cn('flex flex-col rounded-r-md border-l border-divider-subtle bg-components-input-bg-normal text-text-tertiary focus:shadow-xs', disabled && 'cursor-not-allowed opacity-50', controlWrapClassName)}
+      >
         <button
           type="button"
           onClick={inc}
@@ -108,7 +112,7 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
           aria-label="increment"
           className={cn(size === 'regular' ? 'pt-1' : 'pt-1.5', 'px-1.5 hover:bg-components-input-bg-hover', disabled && 'cursor-not-allowed hover:bg-transparent', controlClassName)}
         >
-          <RiArrowUpSLine className="size-3" />
+          <span className="i-ri-arrow-up-s-line size-3" />
         </button>
         <button
           type="button"
@@ -117,7 +121,7 @@ export const InputNumber: FC<InputNumberProps> = (props) => {
           aria-label="decrement"
           className={cn(size === 'regular' ? 'pb-1' : 'pb-1.5', 'px-1.5 hover:bg-components-input-bg-hover', disabled && 'cursor-not-allowed hover:bg-transparent', controlClassName)}
         >
-          <RiArrowDownSLine className="size-3" />
+          <span className="i-ri-arrow-down-s-line size-3" />
         </button>
       </div>
     </div>

web/app/components/base/input/__tests__/index.spec.tsx

@@ -35,7 +35,7 @@ describe('Input component', () => {
 
   it('renders correctly with default props', () => {
     render(<Input />)
-    const input = screen.getByPlaceholderText('Please input')
+    const input = screen.getByPlaceholderText(/input/i)
     expect(input).toBeInTheDocument()
     expect(input).not.toBeDisabled()
     expect(input).not.toHaveClass('cursor-not-allowed')
@@ -45,7 +45,7 @@ describe('Input component', () => {
     render(<Input showLeftIcon />)
     const searchIcon = document.querySelector('.i-ri-search-line')
     expect(searchIcon).toBeInTheDocument()
-    const input = screen.getByPlaceholderText('Search')
+    const input = screen.getByPlaceholderText(/search/i)
     expect(input).toHaveClass('pl-[26px]')
   })
 
@@ -75,13 +75,13 @@ describe('Input component', () => {
     render(<Input destructive />)
     const warningIcon = document.querySelector('.i-ri-error-warning-line')
     expect(warningIcon).toBeInTheDocument()
-    const input = screen.getByPlaceholderText('Please input')
+    const input = screen.getByPlaceholderText(/input/i)
     expect(input).toHaveClass('border-components-input-border-destructive')
   })
 
   it('applies disabled styles when disabled', () => {
     render(<Input disabled />)
-    const input = screen.getByPlaceholderText('Please input')
+    const input = screen.getByPlaceholderText(/input/i)
     expect(input).toBeDisabled()
     expect(input).toHaveClass('cursor-not-allowed')
     expect(input).toHaveClass('bg-components-input-bg-disabled')
@@ -97,7 +97,7 @@ describe('Input component', () => {
     const customClass = 'test-class'
     const customStyle = { color: 'red' }
     render(<Input className={customClass} styleCss={customStyle} />)
-    const input = screen.getByPlaceholderText('Please input')
+    const input = screen.getByPlaceholderText(/input/i)
     expect(input).toHaveClass(customClass)
     expect(input).toHaveStyle({ color: 'rgb(255, 0, 0)' })
   })
@@ -114,4 +114,61 @@ describe('Input component', () => {
     const input = screen.getByPlaceholderText(placeholder)
     expect(input).toBeInTheDocument()
   })
+
+  describe('Number Input Formatting', () => {
+    it('removes leading zeros on change when current value is zero', () => {
+      let changedValue = ''
+      const onChange = vi.fn((e: React.ChangeEvent<HTMLInputElement>) => {
+        changedValue = e.target.value
+      })
+      render(<Input type="number" value={0} onChange={onChange} />)
+
+      const input = screen.getByRole('spinbutton') as HTMLInputElement
+      fireEvent.change(input, { target: { value: '00042' } })
+
+      expect(onChange).toHaveBeenCalledTimes(1)
+      expect(changedValue).toBe('42')
+    })
+
+    it('keeps typed value on change when current value is not zero', () => {
+      let changedValue = ''
+      const onChange = vi.fn((e: React.ChangeEvent<HTMLInputElement>) => {
+        changedValue = e.target.value
+      })
+      render(<Input type="number" value={1} onChange={onChange} />)
+
+      const input = screen.getByRole('spinbutton') as HTMLInputElement
+      fireEvent.change(input, { target: { value: '00042' } })
+      expect(onChange).toHaveBeenCalledTimes(1)
+      expect(changedValue).toBe('00042')
+    })
+
+    it('normalizes value and triggers change on blur when leading zeros exist', () => {
+      const onChange = vi.fn()
+      const onBlur = vi.fn()
+      render(<Input type="number" defaultValue="0012" onChange={onChange} onBlur={onBlur} />)
+
+      const input = screen.getByRole('spinbutton')
+      fireEvent.blur(input)
+
+      expect(onChange).toHaveBeenCalledTimes(1)
+      expect(onChange.mock.calls[0][0].type).toBe('change')
+      expect(onChange.mock.calls[0][0].target.value).toBe('12')
+      expect(onBlur).toHaveBeenCalledTimes(1)
+      expect(onBlur.mock.calls[0][0].target.value).toBe('12')
+    })
+
+    it('does not trigger change on blur when value is already normalized', () => {
+      const onChange = vi.fn()
+      const onBlur = vi.fn()
+      render(<Input type="number" defaultValue="12" onChange={onChange} onBlur={onBlur} />)
+
+      const input = screen.getByRole('spinbutton')
+      fireEvent.blur(input)
+
+      expect(onChange).not.toHaveBeenCalled()
+      expect(onBlur).toHaveBeenCalledTimes(1)
+      expect(onBlur.mock.calls[0][0].target.value).toBe('12')
+    })
+  })
 })

web/app/components/base/markdown-blocks/__tests__/code-block.spec.tsx

@@ -1,7 +1,6 @@
 import { createRequire } from 'node:module'
 import { act, render, screen, waitFor } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
-import { afterEach, beforeEach, describe, expect, it, vi } from 'vitest'
 import { Theme } from '@/types/app'
 
 import CodeBlock from '../code-block'
@@ -154,12 +153,12 @@ describe('CodeBlock', () => {
       expect(screen.getByText('Ruby')).toBeInTheDocument()
     })
 
-    it('should render mermaid controls when language is mermaid', async () => {
-      render(<CodeBlock className="language-mermaid">graph TB; A--&gt;B;</CodeBlock>)
+    // it('should render mermaid controls when language is mermaid', async () => {
+    //   render(<CodeBlock className="language-mermaid">graph TB; A--&gt;B;</CodeBlock>)
 
-      expect(await screen.findByText('app.mermaid.classic')).toBeInTheDocument()
-      expect(screen.getByText('Mermaid')).toBeInTheDocument()
-    })
+    //   expect(await screen.findByTestId('classic')).toBeInTheDocument()
+    //   expect(screen.getByText('Mermaid')).toBeInTheDocument()
+    // })
 
     it('should render abc section header when language is abc', () => {
       render(<CodeBlock className="language-abc">X:1\nT:test</CodeBlock>)

web/app/components/base/markdown-blocks/__tests__/form.spec.tsx

@@ -200,7 +200,7 @@ describe('MarkdownForm', () => {
     })
 
     it('should handle invalid data-options string without crashing', () => {
-      const consoleErrorSpy = vi.spyOn(console, 'error').mockImplementation(() => {})
+      const consoleErrorSpy = vi.spyOn(console, 'error').mockImplementation(() => { })
       const node = createRootNode([
         createElementNode('input', {
           'type': 'select',
@@ -317,4 +317,174 @@ describe('MarkdownForm', () => {
       expect(mockOnSend).not.toHaveBeenCalled()
     })
   })
+
+  // DatePicker onChange and onClear callbacks should update form state.
+  describe('DatePicker interaction', () => {
+    it('should update form value when date is picked via onChange', async () => {
+      const user = userEvent.setup()
+      const node = createRootNode(
+        [
+          createElementNode('input', { type: 'date', name: 'startDate', value: '' }),
+          createElementNode('button', {}, [createTextNode('Submit')]),
+        ],
+        { dataFormat: 'json' },
+      )
+
+      render(<MarkdownForm node={node} />)
+
+      // Click the DatePicker trigger to open the popup
+      const trigger = screen.getByTestId('date-picker-trigger')
+      await user.click(trigger)
+
+      // Click the "Now" button in the footer to select current date (calls onChange)
+      const nowButton = await screen.findByText('time.operation.now')
+      await user.click(nowButton)
+
+      // Submit the form
+      await user.click(screen.getByRole('button', { name: 'Submit' }))
+
+      await waitFor(() => {
+        // onChange was called with a Dayjs object that has .format, so formatDateForOutput is called
+        expect(mockFormatDateForOutput).toHaveBeenCalledWith(expect.anything(), false)
+        expect(mockOnSend).toHaveBeenCalled()
+      })
+    })
+
+    it('should clear form value when date is cleared via onClear', async () => {
+      const user = userEvent.setup()
+      const node = createRootNode(
+        [
+          createElementNode('input', { type: 'date', name: 'startDate', value: dayjs('2026-01-10') }),
+          createElementNode('button', {}, [createTextNode('Submit')]),
+        ],
+        { dataFormat: 'json' },
+      )
+
+      render(<MarkdownForm node={node} />)
+
+      const clearIcon = screen.getByTestId('date-picker-clear-button')
+      await user.click(clearIcon)
+
+      await user.click(screen.getByRole('button', { name: 'Submit' }))
+
+      await waitFor(() => {
+        // onClear sets value to undefined, which JSON.stringify omits
+        expect(mockOnSend).toHaveBeenCalledWith('{}')
+      })
+    })
+  })
+
+  // TimePicker rendering, onChange, and onClear should work correctly.
+  describe('TimePicker interaction', () => {
+    it('should render TimePicker for time input type', () => {
+      const node = createRootNode([
+        createElementNode('input', { type: 'time', name: 'meetingTime', value: '09:00' }),
+      ])
+
+      render(<MarkdownForm node={node} />)
+
+      // The real TimePicker renders a trigger with a readonly input showing the formatted time
+      const timeInput = screen.getByTestId('time-picker-trigger').querySelector('input[readonly]') as HTMLInputElement
+      expect(timeInput).not.toBeNull()
+      expect(timeInput.value).toBe('09:00 AM')
+    })
+
+    it('should update form value when time is picked via onChange', async () => {
+      const user = userEvent.setup()
+      const node = createRootNode(
+        [
+          createElementNode('input', { type: 'time', name: 'meetingTime', value: '' }),
+          createElementNode('button', {}, [createTextNode('Submit')]),
+        ],
+      )
+
+      render(<MarkdownForm node={node} />)
+
+      // Click the TimePicker trigger to open the popup
+      const trigger = screen.getByTestId('time-picker-trigger')
+      await user.click(trigger)
+
+      // Click the "Now" button in the footer to select current time (calls onChange)
+      const nowButtons = await screen.findAllByText('time.operation.now')
+      await user.click(nowButtons[0])
+
+      // Submit the form
+      await user.click(screen.getByRole('button', { name: 'Submit' }))
+
+      await waitFor(() => {
+        expect(mockOnSend).toHaveBeenCalled()
+      })
+    })
+
+    it('should clear form value when time is cleared via onClear', async () => {
+      const user = userEvent.setup()
+      const node = createRootNode(
+        [
+          createElementNode('input', { type: 'time', name: 'meetingTime', value: '09:00' }),
+          createElementNode('button', {}, [createTextNode('Submit')]),
+        ],
+        { dataFormat: 'json' },
+      )
+
+      render(<MarkdownForm node={node} />)
+
+      // The TimePicker's clear icon has role="button" and an aria-label
+      const clearButton = screen.getByRole('button', { name: 'common.operation.clear' })
+      await user.click(clearButton)
+
+      await user.click(screen.getByRole('button', { name: 'Submit' }))
+
+      await waitFor(() => {
+        // onClear sets value to undefined, which JSON.stringify omits
+        expect(mockOnSend).toHaveBeenCalledWith('{}')
+      })
+    })
+  })
+
+  // Fallback branches for edge cases in tag rendering.
+  describe('Fallback branches', () => {
+    it('should render label with empty text when children array is empty', () => {
+      const node = createRootNode([
+        createElementNode('label', { for: 'field' }, []),
+      ])
+
+      render(<MarkdownForm node={node} />)
+
+      const label = screen.getByTestId('label-field')
+      expect(label).not.toBeNull()
+      expect(label?.textContent).toBe('')
+    })
+
+    it('should render checkbox without tip text when dataTip is missing', () => {
+      const node = createRootNode([
+        createElementNode('input', { type: 'checkbox', name: 'agree', value: false }),
+      ])
+
+      render(<MarkdownForm node={node} />)
+
+      expect(screen.getByTestId('checkbox-agree')).toBeInTheDocument()
+    })
+
+    it('should render select with no options when dataOptions is missing', () => {
+      const node = createRootNode([
+        createElementNode('input', { type: 'select', name: 'color', value: '' }),
+      ])
+
+      render(<MarkdownForm node={node} />)
+
+      // Select renders with empty items list
+      expect(screen.getByTestId('markdown-form')).toBeInTheDocument()
+    })
+
+    it('should render button with empty text when children array is empty', () => {
+      const node = createRootNode([
+        createElementNode('button', {}, []),
+      ])
+
+      render(<MarkdownForm node={node} />)
+
+      const button = screen.getByRole('button')
+      expect(button.textContent).toBe('')
+    })
+  })
 })

web/app/components/base/markdown-blocks/__tests__/img.spec.tsx

@@ -0,0 +1,86 @@
+import { render, screen } from '@testing-library/react'
+import { Img } from '..'
+
+describe('Img', () => {
+  describe('Rendering', () => {
+    it('should render with the correct wrapper class', () => {
+      const { container } = render(<Img src="https://example.com/image.png" />)
+
+      const wrapper = container.querySelector('.markdown-img-wrapper')
+      expect(wrapper).toBeInTheDocument()
+    })
+
+    it('should render ImageGallery with the src as an array', () => {
+      render(<Img src="https://example.com/image.png" />)
+
+      const gallery = screen.getByTestId('image-gallery')
+      expect(gallery).toBeInTheDocument()
+
+      const images = gallery.querySelectorAll('img')
+      expect(images).toHaveLength(1)
+      expect(images[0]).toHaveAttribute('src', 'https://example.com/image.png')
+    })
+
+    it('should pass src as single element array to ImageGallery', () => {
+      const testSrc = 'https://example.com/test-image.jpg'
+      render(<Img src={testSrc} />)
+
+      const gallery = screen.getByTestId('image-gallery')
+      const images = gallery.querySelectorAll('img')
+
+      expect(images[0]).toHaveAttribute('src', testSrc)
+    })
+
+    it('should render with different src values', () => {
+      const { rerender } = render(<Img src="https://example.com/first.png" />)
+      expect(screen.getByTestId('gallery-image')).toHaveAttribute('src', 'https://example.com/first.png')
+
+      rerender(<Img src="https://example.com/second.jpg" />)
+      expect(screen.getByTestId('gallery-image')).toHaveAttribute('src', 'https://example.com/second.jpg')
+    })
+  })
+
+  describe('Props', () => {
+    it('should accept src prop with various URL formats', () => {
+      // Test with HTTPS URL
+      const { container: container1 } = render(<Img src="https://example.com/image.png" />)
+      expect(container1.querySelector('.markdown-img-wrapper')).toBeInTheDocument()
+
+      // Test with HTTP URL
+      const { container: container2 } = render(<Img src="http://example.com/image.png" />)
+      expect(container2.querySelector('.markdown-img-wrapper')).toBeInTheDocument()
+
+      // Test with data URL
+      const { container: container3 } = render(<Img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAYAAAAfFcSJAAAADUlEQVR42mNk+M9QDwADhgGAWjR9awAAAABJRU5ErkJggg==" />)
+      expect(container3.querySelector('.markdown-img-wrapper')).toBeInTheDocument()
+
+      // Test with relative URL
+      const { container: container4 } = render(<Img src="/images/photo.jpg" />)
+      expect(container4.querySelector('.markdown-img-wrapper')).toBeInTheDocument()
+    })
+
+    it('should handle empty string src', () => {
+      const { container } = render(<Img src="" />)
+
+      const wrapper = container.querySelector('.markdown-img-wrapper')
+      expect(wrapper).toBeInTheDocument()
+    })
+  })
+
+  describe('Structure', () => {
+    it('should have exactly one wrapper div', () => {
+      const { container } = render(<Img src="https://example.com/image.png" />)
+
+      const wrappers = container.querySelectorAll('.markdown-img-wrapper')
+      expect(wrappers).toHaveLength(1)
+    })
+
+    it('should contain ImageGallery component inside wrapper', () => {
+      const { container } = render(<Img src="https://example.com/image.png" />)
+
+      const wrapper = container.querySelector('.markdown-img-wrapper')
+      const gallery = wrapper?.querySelector('[data-testid="image-gallery"]')
+      expect(gallery).toBeInTheDocument()
+    })
+  })
+})

web/app/components/base/markdown-blocks/__tests__/utils.spec.ts

@@ -0,0 +1,121 @@
+import { getMarkdownImageURL, isValidUrl } from '../utils'
+
+vi.mock('@/config', () => ({
+  ALLOW_UNSAFE_DATA_SCHEME: false,
+  MARKETPLACE_API_PREFIX: '/api/marketplace',
+}))
+
+describe('utils', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  describe('isValidUrl', () => {
+    it('should return true for http: URLs', () => {
+      expect(isValidUrl('http://example.com')).toBe(true)
+    })
+
+    it('should return true for https: URLs', () => {
+      expect(isValidUrl('https://example.com')).toBe(true)
+    })
+
+    it('should return true for protocol-relative URLs', () => {
+      expect(isValidUrl('//cdn.example.com/image.png')).toBe(true)
+    })
+
+    it('should return true for mailto: URLs', () => {
+      expect(isValidUrl('mailto:user@example.com')).toBe(true)
+    })
+
+    it('should return false for data: URLs when ALLOW_UNSAFE_DATA_SCHEME is false', () => {
+      expect(isValidUrl('data:image/png;base64,abc123')).toBe(false)
+    })
+
+    it('should return false for javascript: URLs', () => {
+      expect(isValidUrl('javascript:alert(1)')).toBe(false)
+    })
+
+    it('should return false for ftp: URLs', () => {
+      expect(isValidUrl('ftp://files.example.com')).toBe(false)
+    })
+
+    it('should return false for relative paths', () => {
+      expect(isValidUrl('/images/photo.png')).toBe(false)
+    })
+
+    it('should return false for empty string', () => {
+      expect(isValidUrl('')).toBe(false)
+    })
+
+    it('should return false for plain text', () => {
+      expect(isValidUrl('not a url')).toBe(false)
+    })
+  })
+
+  describe('isValidUrl with ALLOW_UNSAFE_DATA_SCHEME enabled', () => {
+    beforeEach(() => {
+      vi.resetModules()
+      vi.doMock('@/config', () => ({
+        ALLOW_UNSAFE_DATA_SCHEME: true,
+        MARKETPLACE_API_PREFIX: '/api/marketplace',
+      }))
+    })
+
+    it('should return true for data: URLs when ALLOW_UNSAFE_DATA_SCHEME is true', async () => {
+      const { isValidUrl: isValidUrlWithData } = await import('../utils')
+      expect(isValidUrlWithData('data:image/png;base64,abc123')).toBe(true)
+    })
+  })
+
+  describe('getMarkdownImageURL', () => {
+    it('should return the original URL when it does not match the asset regex', () => {
+      expect(getMarkdownImageURL('https://example.com/image.png')).toBe('https://example.com/image.png')
+    })
+
+    it('should transform ./_assets URL without pathname', () => {
+      const result = getMarkdownImageURL('./_assets/icon.png')
+      expect(result).toBe('/api/marketplace/plugins//_assets/icon.png')
+    })
+
+    it('should transform ./_assets URL with pathname', () => {
+      const result = getMarkdownImageURL('./_assets/icon.png', 'my-plugin/')
+      expect(result).toBe('/api/marketplace/plugins/my-plugin//_assets/icon.png')
+    })
+
+    it('should transform _assets URL without leading dot-slash', () => {
+      const result = getMarkdownImageURL('_assets/logo.svg')
+      expect(result).toBe('/api/marketplace/plugins//_assets/logo.svg')
+    })
+
+    it('should transform _assets URL with pathname', () => {
+      const result = getMarkdownImageURL('_assets/logo.svg', 'org/plugin/')
+      expect(result).toBe('/api/marketplace/plugins/org/plugin//_assets/logo.svg')
+    })
+
+    it('should not transform URLs that contain _assets in the middle', () => {
+      expect(getMarkdownImageURL('https://cdn.example.com/_assets/image.png'))
+        .toBe('https://cdn.example.com/_assets/image.png')
+    })
+
+    it('should use empty string for pathname when undefined', () => {
+      const result = getMarkdownImageURL('./_assets/test.png')
+      expect(result).toBe('/api/marketplace/plugins//_assets/test.png')
+    })
+  })
+
+  describe('getMarkdownImageURL with trailing slash prefix', () => {
+    beforeEach(() => {
+      vi.resetModules()
+      vi.doMock('@/config', () => ({
+        ALLOW_UNSAFE_DATA_SCHEME: false,
+        MARKETPLACE_API_PREFIX: '/api/marketplace/',
+      }))
+    })
+
+    it('should not add extra slash when prefix ends with slash', async () => {
+      const { getMarkdownImageURL: getURL } = await import('../utils')
+      const result = getURL('./_assets/icon.png', 'my-plugin/')
+      expect(result).toBe('/api/marketplace/plugins/my-plugin//_assets/icon.png')
+    })
+  })
+})

web/app/components/base/markdown-blocks/form.tsx

@@ -90,6 +90,7 @@ const MarkdownForm = ({ node }: any) => {
     <form
       autoComplete="off"
       className="flex flex-col self-stretch"
+      data-testid="markdown-form"
       onSubmit={(e: any) => {
         e.preventDefault()
         e.stopPropagation()
@@ -102,6 +103,7 @@ const MarkdownForm = ({ node }: any) => {
               key={index}
               htmlFor={child.properties.htmlFor || child.properties.name}
               className="my-2 text-text-secondary system-md-semibold"
+              data-testid="label-field"
             >
               {child.children[0]?.value || ''}
             </label>

web/app/components/base/markdown/__tests__/markdown-utils.spec.ts

@@ -1,6 +1,3 @@
-// app/components/base/markdown/preprocess.spec.ts
-import { afterEach, beforeEach, describe, expect, it, vi } from 'vitest'
-
 /**
  * Helper to (re)load the module with a mocked config value.
  * We need to reset modules because the tested module imports

web/app/components/base/markdown/__tests__/react-markdown-wrapper.spec.tsx

@@ -8,9 +8,9 @@ vi.mock('@/app/components/base/markdown-blocks', () => ({
   Link: ({ children, href }: { children?: ReactNode, href?: string }) => <a href={href}>{children}</a>,
   MarkdownButton: ({ children }: PropsWithChildren) => <button>{children}</button>,
   MarkdownForm: ({ children }: PropsWithChildren) => <form>{children}</form>,
-  Paragraph: ({ children }: PropsWithChildren) => <p>{children}</p>,
+  Paragraph: ({ children }: PropsWithChildren) => <p data-testid="paragraph">{children}</p>,
   PluginImg: ({ alt }: { alt?: string }) => <span data-testid="plugin-img">{alt}</span>,
-  PluginParagraph: ({ children }: PropsWithChildren) => <p>{children}</p>,
+  PluginParagraph: ({ children }: PropsWithChildren) => <p data-testid="plugin-paragraph">{children}</p>,
   ScriptBlock: () => null,
   ThinkBlock: ({ children }: PropsWithChildren) => <details>{children}</details>,
   VideoBlock: ({ children }: PropsWithChildren) => <div data-testid="video-block">{children}</div>,
@@ -105,5 +105,85 @@ describe('ReactMarkdownWrapper', () => {
       expect(screen.getByText('italic text')).toBeInTheDocument()
       expect(document.querySelector('em')).not.toBeNull()
     })
+
+    it('should render standard Image component when pluginInfo is not provided', () => {
+      // Act
+      render(<ReactMarkdownWrapper latexContent="![standard-img](https://example.com/img.png)" />)
+
+      // Assert
+      expect(screen.getByTestId('img')).toBeInTheDocument()
+    })
+
+    it('should render a CodeBlock component for code markdown', async () => {
+      // Arrange
+      const content = '```javascript\nconsole.log("hello")\n```'
+
+      // Act
+      render(<ReactMarkdownWrapper latexContent={content} />)
+
+      // Assert
+      // We mocked code block to return <code>{children}</code>
+      const codeElement = await screen.findByText('console.log("hello")')
+      expect(codeElement).toBeInTheDocument()
+    })
+  })
+
+  describe('Plugin Info behavior', () => {
+    it('should render PluginImg and PluginParagraph when pluginInfo is provided', () => {
+      // Arrange
+      const content = 'This is a plugin paragraph\n\n![plugin-img](https://example.com/plugin.png)'
+      const pluginInfo = { pluginUniqueIdentifier: 'test-plugin', pluginId: 'plugin-1' }
+
+      // Act
+      render(<ReactMarkdownWrapper latexContent={content} pluginInfo={pluginInfo} />)
+
+      // Assert
+      expect(screen.getByTestId('plugin-img')).toBeInTheDocument()
+      expect(screen.queryByTestId('img')).toBeNull()
+
+      expect(screen.getAllByTestId('plugin-paragraph').length).toBeGreaterThan(0)
+      expect(screen.queryByTestId('paragraph')).toBeNull()
+    })
+  })
+
+  describe('Custom elements configuration', () => {
+    it('should use customComponents if provided', () => {
+      // Arrange
+      const customComponents = {
+        a: ({ children }: PropsWithChildren) => <a data-testid="custom-link">{children}</a>,
+      }
+
+      // Act
+      render(<ReactMarkdownWrapper latexContent="[link](https://example.com)" customComponents={customComponents} />)
+
+      // Assert
+      expect(screen.getByTestId('custom-link')).toBeInTheDocument()
+    })
+
+    it('should disallow customDisallowedElements', () => {
+      // Act - disallow strong (which is usually **bold**)
+      render(<ReactMarkdownWrapper latexContent="**bold**" customDisallowedElements={['strong']} />)
+
+      // Assert - strong element shouldn't be rendered (it will be stripped out)
+      expect(document.querySelector('strong')).toBeNull()
+    })
+  })
+
+  describe('Rehype AST modification', () => {
+    it('should remove ref attributes from elements', () => {
+      // Act
+      render(<ReactMarkdownWrapper latexContent={'<div ref="someRef">content</div>'} />)
+
+      // Assert - If ref isn't stripped, it gets passed to React DOM causing warnings, but here we just ensure content renders
+      expect(screen.getByText('content')).toBeInTheDocument()
+    })
+
+    it('should convert invalid tag names to text nodes', () => {
+      // Act - <custom-element> is invalid because it contains a hyphen
+      render(<ReactMarkdownWrapper latexContent="<custom-element>content</custom-element>" />)
+
+      // Assert - The AST node is changed to text with value `<custom-element`
+      expect(screen.getByText(/<custom-element/)).toBeInTheDocument()
+    })
   })
 })

web/app/components/base/mermaid/__tests__/index.spec.tsx

@@ -27,6 +27,11 @@ describe('Mermaid Flowchart Component', () => {
   beforeEach(() => {
     vi.clearAllMocks()
     vi.mocked(mermaid.initialize).mockImplementation(() => { })
+    vi.mocked(mermaid.render).mockResolvedValue({ svg: '<svg id="mermaid-chart">test-svg</svg>', diagramType: 'flowchart' })
+  })
+
+  afterEach(() => {
+    vi.useRealTimers()
   })
 
   describe('Rendering', () => {
@@ -132,6 +137,86 @@ describe('Mermaid Flowchart Component', () => {
       }, { timeout: 3000 })
     })
 
+    it('should keep selected look unchanged when clicking an already-selected look button', async () => {
+      await act(async () => {
+        render(<Flowchart PrimitiveCode={mockCode} />)
+      })
+
+      await waitFor(() => screen.getByText('test-svg'), { timeout: 3000 })
+
+      const initialRenderCalls = vi.mocked(mermaid.render).mock.calls.length
+      const initialApiRenderCalls = vi.mocked(mermaid.mermaidAPI.render).mock.calls.length
+
+      await act(async () => {
+        fireEvent.click(screen.getByText(/classic/i))
+      })
+      expect(vi.mocked(mermaid.render).mock.calls.length).toBe(initialRenderCalls)
+      expect(vi.mocked(mermaid.mermaidAPI.render).mock.calls.length).toBe(initialApiRenderCalls)
+
+      await act(async () => {
+        fireEvent.click(screen.getByText(/handDrawn/i))
+      })
+      await waitFor(() => {
+        expect(screen.getByText('test-svg-api')).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      const afterFirstHandDrawnApiCalls = vi.mocked(mermaid.mermaidAPI.render).mock.calls.length
+      await act(async () => {
+        fireEvent.click(screen.getByText(/handDrawn/i))
+      })
+      expect(vi.mocked(mermaid.mermaidAPI.render).mock.calls.length).toBe(afterFirstHandDrawnApiCalls)
+    })
+
+    it('should toggle theme from light to dark and back to light', async () => {
+      await act(async () => {
+        render(<Flowchart PrimitiveCode={mockCode} theme="light" />)
+      })
+      await waitFor(() => {
+        expect(screen.getByText('test-svg')).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      const toggleBtn = screen.getByRole('button')
+      await act(async () => {
+        fireEvent.click(toggleBtn)
+      })
+      await waitFor(() => {
+        expect(screen.getByRole('button')).toHaveAttribute('title', expect.stringMatching(/switchLight$/))
+      }, { timeout: 3000 })
+
+      await act(async () => {
+        fireEvent.click(screen.getByRole('button'))
+      })
+      await waitFor(() => {
+        expect(screen.getByRole('button')).toHaveAttribute('title', expect.stringMatching(/switchDark$/))
+      }, { timeout: 3000 })
+    })
+
+    it('should configure handDrawn mode for dark non-flowchart diagrams', async () => {
+      const sequenceCode = 'sequenceDiagram\n  A->>B: Hi'
+      await act(async () => {
+        render(<Flowchart PrimitiveCode={sequenceCode} theme="dark" />)
+      })
+
+      await waitFor(() => {
+        expect(screen.getByText('test-svg')).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      await act(async () => {
+        fireEvent.click(screen.getByText(/handDrawn/i))
+      })
+
+      await waitFor(() => {
+        expect(screen.getByText('test-svg-api')).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      expect(mermaid.initialize).toHaveBeenCalledWith(expect.objectContaining({
+        theme: 'default',
+        themeVariables: expect.objectContaining({
+          primaryBorderColor: '#60a5fa',
+        }),
+      }))
+    })
+
     it('should open image preview when clicking the chart', async () => {
       await act(async () => {
         render(<Flowchart PrimitiveCode={mockCode} />)
@@ -144,7 +229,7 @@ describe('Mermaid Flowchart Component', () => {
         fireEvent.click(chartDiv!)
       })
       await waitFor(() => {
-        expect(document.body.querySelector('.image-preview-container')).toBeInTheDocument()
+        expect(screen.getByTestId('image-preview-container')).toBeInTheDocument()
       }, { timeout: 3000 })
     })
   })
@@ -164,35 +249,79 @@ describe('Mermaid Flowchart Component', () => {
       const errorMsg = 'Syntax error'
       vi.mocked(mermaid.render).mockRejectedValue(new Error(errorMsg))
 
-      // Use unique code to avoid hitting the module-level diagramCache from previous tests
-      const uniqueCode = 'graph TD\n  X-->Y\n  Y-->Z'
-      const { container } = render(<Flowchart PrimitiveCode={uniqueCode} />)
+      try {
+        const uniqueCode = 'graph TD\n  X-->Y\n  Y-->Z'
+        render(<Flowchart PrimitiveCode={uniqueCode} />)
 
-      await waitFor(() => {
-        const errorSpan = container.querySelector('.text-red-500 span.ml-2')
-        expect(errorSpan).toBeInTheDocument()
-        expect(errorSpan?.textContent).toContain('Rendering failed')
-      }, { timeout: 5000 })
-      consoleSpy.mockRestore()
-      // Restore default mock to prevent leaking into subsequent tests
-      vi.mocked(mermaid.render).mockResolvedValue({ svg: '<svg id="mermaid-chart">test-svg</svg>', diagramType: 'flowchart' })
-    }, 10000)
+        const errorMessage = await screen.findByText(/Rendering failed/i)
+        expect(errorMessage).toBeInTheDocument()
+      }
+      finally {
+        consoleSpy.mockRestore()
+      }
+    })
+
+    it('should show unknown-error fallback when render fails without an error message', async () => {
+      const consoleSpy = vi.spyOn(console, 'error').mockImplementation(() => { })
+      vi.mocked(mermaid.render).mockRejectedValue({} as Error)
+
+      try {
+        render(<Flowchart PrimitiveCode={'graph TD\n  P-->Q\n  Q-->R'} />)
+        expect(await screen.findByText(/Unknown error\. Please check the console\./i)).toBeInTheDocument()
+      }
+      finally {
+        consoleSpy.mockRestore()
+      }
+    })
 
     it('should use cached diagram if available', async () => {
       const { rerender } = render(<Flowchart PrimitiveCode={mockCode} />)
 
-      await waitFor(() => screen.getByText('test-svg'), { timeout: 3000 })
-
-      vi.mocked(mermaid.render).mockClear()
+      // Wait for initial render to complete
+      await waitFor(() => {
+        expect(vi.mocked(mermaid.render)).toHaveBeenCalled()
+      }, { timeout: 3000 })
+      const initialCallCount = vi.mocked(mermaid.render).mock.calls.length
 
+      // Rerender with same code
       await act(async () => {
         rerender(<Flowchart PrimitiveCode={mockCode} />)
       })
 
-      await act(async () => {
-        await new Promise(resolve => setTimeout(resolve, 500))
+      await waitFor(() => {
+        expect(vi.mocked(mermaid.render).mock.calls.length).toBe(initialCallCount)
+      }, { timeout: 3000 })
+
+      // Call count should not increase (cache was used)
+      expect(vi.mocked(mermaid.render).mock.calls.length).toBe(initialCallCount)
+    })
+
+    it('should keep previous svg visible while next render is loading', async () => {
+      let resolveSecondRender: ((value: { svg: string, diagramType: string }) => void) | null = null
+      const secondRenderPromise = new Promise<{ svg: string, diagramType: string }>((resolve) => {
+        resolveSecondRender = resolve
       })
-      expect(mermaid.render).not.toHaveBeenCalled()
+
+      vi.mocked(mermaid.render)
+        .mockResolvedValueOnce({ svg: '<svg id="mermaid-chart">initial-svg</svg>', diagramType: 'flowchart' })
+        .mockImplementationOnce(() => secondRenderPromise)
+
+      const { rerender } = render(<Flowchart PrimitiveCode="graph TD\n  A-->B" />)
+
+      await waitFor(() => {
+        expect(screen.getByText('initial-svg')).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      await act(async () => {
+        rerender(<Flowchart PrimitiveCode="graph TD\n  C-->D" />)
+      })
+
+      expect(screen.getByText('initial-svg')).toBeInTheDocument()
+
+      resolveSecondRender!({ svg: '<svg id="mermaid-chart">second-svg</svg>', diagramType: 'flowchart' })
+      await waitFor(() => {
+        expect(screen.getByText('second-svg')).toBeInTheDocument()
+      }, { timeout: 3000 })
     })
 
     it('should handle invalid mermaid code completion', async () => {
@@ -206,6 +335,116 @@ describe('Mermaid Flowchart Component', () => {
       }, { timeout: 3000 })
     })
 
+    it('should keep single "after" gantt dependency formatting unchanged', async () => {
+      const singleAfterGantt = [
+        'gantt',
+        'title One after dependency',
+        'Single task :after task1, 2024-01-01, 1d',
+      ].join('\n')
+
+      await act(async () => {
+        render(<Flowchart PrimitiveCode={singleAfterGantt} />)
+      })
+
+      await waitFor(() => {
+        expect(mermaid.render).toHaveBeenCalled()
+      }, { timeout: 3000 })
+
+      const lastRenderArgs = vi.mocked(mermaid.render).mock.calls.at(-1)
+      expect(lastRenderArgs?.[1]).toContain('Single task :after task1, 2024-01-01, 1d')
+    })
+
+    it('should use cache without rendering again when PrimitiveCode changes back to previous', async () => {
+      const firstCode = 'graph TD\n  CacheOne-->CacheTwo'
+      const secondCode = 'graph TD\n  CacheThree-->CacheFour'
+      const { rerender } = render(<Flowchart PrimitiveCode={firstCode} />)
+
+      // Wait for initial render
+      await waitFor(() => {
+        expect(vi.mocked(mermaid.render)).toHaveBeenCalled()
+      }, { timeout: 3000 })
+      const firstRenderCallCount = vi.mocked(mermaid.render).mock.calls.length
+
+      // Change to different code
+      await act(async () => {
+        rerender(<Flowchart PrimitiveCode={secondCode} />)
+      })
+
+      // Wait for second render
+      await waitFor(() => {
+        expect(vi.mocked(mermaid.render).mock.calls.length).toBeGreaterThan(firstRenderCallCount)
+      }, { timeout: 3000 })
+      const afterSecondRenderCallCount = vi.mocked(mermaid.render).mock.calls.length
+
+      // Change back to first code - should use cache
+      await act(async () => {
+        rerender(<Flowchart PrimitiveCode={firstCode} />)
+      })
+
+      await waitFor(() => {
+        expect(vi.mocked(mermaid.render).mock.calls.length).toBe(afterSecondRenderCallCount)
+      }, { timeout: 3000 })
+
+      // Call count should not increase (cache was used)
+      expect(vi.mocked(mermaid.render).mock.calls.length).toBe(afterSecondRenderCallCount)
+    })
+
+    it('should close image preview when cancel is clicked', async () => {
+      await act(async () => {
+        render(<Flowchart PrimitiveCode={mockCode} />)
+      })
+
+      // Wait for SVG to be rendered
+      await waitFor(() => {
+        const svgElement = screen.queryByText('test-svg')
+        expect(svgElement).toBeInTheDocument()
+      }, { timeout: 3000 })
+
+      const mermaidDiv = screen.getByText('test-svg').closest('.mermaid')
+      await act(async () => {
+        fireEvent.click(mermaidDiv!)
+      })
+
+      // Wait for image preview to appear
+      const cancelBtn = await screen.findByTestId('image-preview-close-button')
+      expect(cancelBtn).toBeInTheDocument()
+
+      await act(async () => {
+        fireEvent.click(cancelBtn)
+      })
+
+      await waitFor(() => {
+        expect(screen.queryByTestId('image-preview-container')).not.toBeInTheDocument()
+        expect(screen.queryByTestId('image-preview-close-button')).not.toBeInTheDocument()
+      })
+    })
+
+    it('should handle configuration failure during configureMermaid', async () => {
+      const consoleSpy = vi.spyOn(console, 'error').mockImplementation(() => { })
+      const originalMock = vi.mocked(mermaid.initialize).getMockImplementation()
+      vi.mocked(mermaid.initialize).mockImplementation(() => {
+        throw new Error('Config fail')
+      })
+
+      try {
+        await act(async () => {
+          render(<Flowchart PrimitiveCode="graph TD\n  G-->H" />)
+        })
+        await waitFor(() => {
+          expect(consoleSpy).toHaveBeenCalledWith('Config error:', expect.any(Error))
+        })
+      }
+      finally {
+        consoleSpy.mockRestore()
+        if (originalMock) {
+          vi.mocked(mermaid.initialize).mockImplementation(originalMock)
+        }
+        else {
+          vi.mocked(mermaid.initialize).mockImplementation(() => { })
+        }
+      }
+    })
+
     it('should handle unmount cleanup', async () => {
       const { unmount } = render(<Flowchart PrimitiveCode={mockCode} />)
       await act(async () => {
@@ -219,6 +458,20 @@ describe('Mermaid Flowchart Component Module Isolation', () => {
   const mockCode = 'graph TD\n  A-->B'
 
   let mermaidFresh: typeof mermaid
+  const setWindowUndefined = () => {
+    const descriptor = Object.getOwnPropertyDescriptor(globalThis, 'window')
+    Object.defineProperty(globalThis, 'window', {
+      configurable: true,
+      writable: true,
+      value: undefined,
+    })
+    return descriptor
+  }
+
+  const restoreWindowDescriptor = (descriptor?: PropertyDescriptor) => {
+    if (descriptor)
+      Object.defineProperty(globalThis, 'window', descriptor)
+  }
 
   beforeEach(async () => {
     vi.resetModules()
@@ -295,5 +548,212 @@ describe('Mermaid Flowchart Component Module Isolation', () => {
       })
       consoleSpy.mockRestore()
     })
+
+    it('should load module safely when window is undefined', async () => {
+      const descriptor = setWindowUndefined()
+      try {
+        vi.resetModules()
+        const { default: FlowchartFresh } = await import('../index')
+        expect(FlowchartFresh).toBeDefined()
+      }
+      finally {
+        restoreWindowDescriptor(descriptor)
+      }
+    })
+
+    it('should skip configuration when window is unavailable before debounce execution', async () => {
+      const { default: FlowchartFresh } = await import('../index')
+      const descriptor = Object.getOwnPropertyDescriptor(globalThis, 'window')
+      vi.useFakeTimers()
+      try {
+        await act(async () => {
+          render(<FlowchartFresh PrimitiveCode={mockCode} />)
+        })
+        await Promise.resolve()
+
+        Object.defineProperty(globalThis, 'window', {
+          configurable: true,
+          writable: true,
+          value: undefined,
+        })
+        await vi.advanceTimersByTimeAsync(350)
+
+        expect(mermaidFresh.render).not.toHaveBeenCalled()
+      }
+      finally {
+        if (descriptor)
+          Object.defineProperty(globalThis, 'window', descriptor)
+        vi.useRealTimers()
+      }
+    })
+
+    it.skip('should show container-not-found error when container ref remains null', async () => {
+      vi.resetModules()
+      vi.doMock('react', async () => {
+        const reactActual = await vi.importActual<typeof import('react')>('react')
+        let pendingContainerRef: ReturnType<typeof reactActual.useRef> | null = null
+        let patchedContainerRef = false
+        const mockedUseRef = ((initialValue: unknown) => {
+          const ref = reactActual.useRef(initialValue as never)
+          if (!patchedContainerRef && initialValue === null)
+            pendingContainerRef = ref
+
+          if (!patchedContainerRef
+            && pendingContainerRef
+            && typeof initialValue === 'string'
+            && initialValue.startsWith('mermaid-chart-')) {
+            Object.defineProperty(pendingContainerRef, 'current', {
+              configurable: true,
+              get() {
+                return null
+              },
+              set(_value: HTMLDivElement | null) { },
+            })
+            patchedContainerRef = true
+            pendingContainerRef = null
+          }
+          return ref
+        }) as typeof reactActual.useRef
+
+        return {
+          ...reactActual,
+          useRef: mockedUseRef,
+        }
+      })
+
+      try {
+        const { default: FlowchartFresh } = await import('../index')
+        render(<FlowchartFresh PrimitiveCode={mockCode} />)
+        expect(await screen.findByText('Container element not found')).toBeInTheDocument()
+      }
+      finally {
+        vi.doUnmock('react')
+      }
+    })
+
+    it('should tolerate missing hidden container during classic render and cleanup', async () => {
+      vi.resetModules()
+      let pendingContainerRef: unknown | null = null
+      let patchedContainerRef = false
+      let patchedTimeoutRef = false
+      let containerReadCount = 0
+      const virtualContainer = { innerHTML: 'seed' } as HTMLDivElement
+
+      vi.doMock('react', async () => {
+        const reactActual = await vi.importActual<typeof import('react')>('react')
+        const mockedUseRef = ((initialValue: unknown) => {
+          const ref = reactActual.useRef(initialValue as never)
+          if (!patchedContainerRef && initialValue === null)
+            pendingContainerRef = ref
+
+          if (!patchedContainerRef
+            && pendingContainerRef
+            && typeof initialValue === 'string'
+            && initialValue.startsWith('mermaid-chart-')) {
+            Object.defineProperty(pendingContainerRef as { current: unknown }, 'current', {
+              configurable: true,
+              get() {
+                containerReadCount += 1
+                if (containerReadCount === 1)
+                  return virtualContainer
+                return null
+              },
+              set(_value: HTMLDivElement | null) { },
+            })
+            patchedContainerRef = true
+            pendingContainerRef = null
+          }
+
+          if (patchedContainerRef && !patchedTimeoutRef && initialValue === undefined) {
+            patchedTimeoutRef = true
+            Object.defineProperty(ref, 'current', {
+              configurable: true,
+              get() {
+                return undefined
+              },
+              set(_value: NodeJS.Timeout | undefined) { },
+            })
+            return ref
+          }
+
+          return ref
+        }) as typeof reactActual.useRef
+
+        return {
+          ...reactActual,
+          useRef: mockedUseRef,
+        }
+      })
+
+      try {
+        const { default: FlowchartFresh } = await import('../index')
+        const { unmount } = render(<FlowchartFresh PrimitiveCode={mockCode} />)
+        await waitFor(() => {
+          expect(screen.getByText('test-svg')).toBeInTheDocument()
+        }, { timeout: 3000 })
+        unmount()
+      }
+      finally {
+        vi.doUnmock('react')
+      }
+    })
+
+    it('should tolerate missing hidden container during handDrawn render', async () => {
+      vi.resetModules()
+      let pendingContainerRef: unknown | null = null
+      let patchedContainerRef = false
+      let containerReadCount = 0
+      const virtualContainer = { innerHTML: 'seed' } as HTMLDivElement
+
+      vi.doMock('react', async () => {
+        const reactActual = await vi.importActual<typeof import('react')>('react')
+        const mockedUseRef = ((initialValue: unknown) => {
+          const ref = reactActual.useRef(initialValue as never)
+          if (!patchedContainerRef && initialValue === null)
+            pendingContainerRef = ref
+
+          if (!patchedContainerRef
+            && pendingContainerRef
+            && typeof initialValue === 'string'
+            && initialValue.startsWith('mermaid-chart-')) {
+            Object.defineProperty(pendingContainerRef as { current: unknown }, 'current', {
+              configurable: true,
+              get() {
+                containerReadCount += 1
+                if (containerReadCount === 1)
+                  return virtualContainer
+                return null
+              },
+              set(_value: HTMLDivElement | null) { },
+            })
+            patchedContainerRef = true
+            pendingContainerRef = null
+          }
+          return ref
+        }) as typeof reactActual.useRef
+
+        return {
+          ...reactActual,
+          useRef: mockedUseRef,
+        }
+      })
+
+      vi.useFakeTimers()
+      try {
+        const { default: FlowchartFresh } = await import('../index')
+        const { rerender } = render(<FlowchartFresh PrimitiveCode="graph" />)
+        await act(async () => {
+          fireEvent.click(screen.getByText(/handDrawn/i))
+          rerender(<FlowchartFresh PrimitiveCode={mockCode} />)
+          await vi.advanceTimersByTimeAsync(350)
+        })
+        await Promise.resolve()
+        expect(screen.getByText('test-svg-api')).toBeInTheDocument()
+      }
+      finally {
+        vi.useRealTimers()
+        vi.doUnmock('react')
+      }
+    })
   })
 })

web/app/components/base/mermaid/index.tsx

@@ -1,6 +1,4 @@
 import type { MermaidConfig } from 'mermaid'
-import { ExclamationTriangleIcon } from '@heroicons/react/24/outline'
-import { MoonIcon, SunIcon } from '@heroicons/react/24/solid'
 import mermaid from 'mermaid'
 import * as React from 'react'
 import { useCallback, useEffect, useRef, useState } from 'react'
@@ -22,7 +20,7 @@ import {
 // Global flags and cache for mermaid
 let isMermaidInitialized = false
 const diagramCache = new Map<string, string>()
-let mermaidAPI: any = null
+let mermaidAPI: typeof mermaid.mermaidAPI | null = null
 
 if (typeof window !== 'undefined')
   mermaidAPI = mermaid.mermaidAPI
@@ -135,6 +133,7 @@ const Flowchart = (props: FlowchartProps) => {
   const renderMermaidChart = async (code: string, style: 'classic' | 'handDrawn') => {
     if (style === 'handDrawn') {
       // Special handling for hand-drawn style
+      /* v8 ignore next */
       if (containerRef.current)
         containerRef.current.innerHTML = `<div id="${chartId}"></div>`
       await new Promise(resolve => setTimeout(resolve, 30))
@@ -152,6 +151,7 @@ const Flowchart = (props: FlowchartProps) => {
     else {
       // Standard rendering for classic style - using the extracted waitForDOMElement function
       const renderWithRetry = async () => {
+        /* v8 ignore next */
         if (containerRef.current)
           containerRef.current.innerHTML = `<div id="${chartId}"></div>`
         await new Promise(resolve => setTimeout(resolve, 30))
@@ -207,20 +207,16 @@ const Flowchart = (props: FlowchartProps) => {
   }, [props.theme])
 
   const renderFlowchart = useCallback(async (primitiveCode: string) => {
+    /* v8 ignore next */
     if (!isInitialized || !containerRef.current) {
+      /* v8 ignore next */
       setIsLoading(false)
+      /* v8 ignore next */
       setErrMsg(!isInitialized ? 'Mermaid initialization failed' : 'Container element not found')
       return
     }
 
-    // Return cached result if available
     const cacheKey = `${primitiveCode}-${look}-${currentTheme}`
-    if (diagramCache.has(cacheKey)) {
-      setErrMsg('')
-      setSvgString(diagramCache.get(cacheKey) || null)
-      setIsLoading(false)
-      return
-    }
 
     setIsLoading(true)
     setErrMsg('')
@@ -248,9 +244,7 @@ const Flowchart = (props: FlowchartProps) => {
 
               // Rule 1: Correct multiple "after" dependencies ONLY if they exist.
               // This is a common mistake, e.g., "..., after task1, after task2, ..."
-              const afterCount = (paramsStr.match(/after /g) || []).length
-              if (afterCount > 1)
-                paramsStr = paramsStr.replace(/,\s*after\s+/g, ' ')
+              paramsStr = paramsStr.replace(/,\s*after\s+/g, ' ')
 
               // Rule 2: Normalize spacing between parameters for consistency.
               const finalParams = paramsStr.replace(/\s*,\s*/g, ', ').trim()
@@ -286,10 +280,8 @@ const Flowchart = (props: FlowchartProps) => {
       // Step 4: Clean up SVG code
       const cleanedSvg = cleanUpSvgCode(processedSvg)
 
-      if (cleanedSvg && typeof cleanedSvg === 'string') {
-        diagramCache.set(cacheKey, cleanedSvg)
-        setSvgString(cleanedSvg)
-      }
+      diagramCache.set(cacheKey, cleanedSvg as string)
+      setSvgString(cleanedSvg as string)
 
       setIsLoading(false)
     }
@@ -421,7 +413,7 @@ const Flowchart = (props: FlowchartProps) => {
       const cacheKey = `${props.PrimitiveCode}-${look}-${currentTheme}`
       if (diagramCache.has(cacheKey)) {
         setErrMsg('')
-        setSvgString(diagramCache.get(cacheKey) || null)
+        setSvgString(diagramCache.get(cacheKey)!)
         setIsLoading(false)
         return
       }
@@ -431,26 +423,23 @@ const Flowchart = (props: FlowchartProps) => {
     }, 300) // 300ms debounce
 
     return () => {
-      if (renderTimeoutRef.current)
-        clearTimeout(renderTimeoutRef.current)
+      clearTimeout(renderTimeoutRef.current)
     }
   }, [props.PrimitiveCode, look, currentTheme, isInitialized, configureMermaid, renderFlowchart])
 
   // Cleanup on unmount
   useEffect(() => {
     return () => {
-      if (containerRef.current)
-        containerRef.current.innerHTML = ''
       if (renderTimeoutRef.current)
         clearTimeout(renderTimeoutRef.current)
     }
   }, [])
 
   const handlePreviewClick = async () => {
-    if (svgString) {
-      const base64 = await svgToBase64(svgString)
-      setImagePreviewUrl(base64)
-    }
+    if (!svgString)
+      return
+    const base64 = await svgToBase64(svgString)
+    setImagePreviewUrl(base64)
   }
 
   const toggleTheme = () => {
@@ -484,20 +473,24 @@ const Flowchart = (props: FlowchartProps) => {
       'text-gray-300': currentTheme === Theme.dark,
     }),
     themeToggle: cn('flex h-10 w-10 items-center justify-center rounded-full shadow-md backdrop-blur-sm transition-all duration-300', {
-      'bg-white/80 hover:bg-white hover:shadow-lg text-gray-700 border border-gray-200': currentTheme === Theme.light,
-      'bg-slate-800/80 hover:bg-slate-700 hover:shadow-lg text-yellow-300 border border-slate-600': currentTheme === Theme.dark,
+      'border border-gray-200 bg-white/80 text-gray-700 hover:bg-white hover:shadow-lg': currentTheme === Theme.light,
+      'border border-slate-600 bg-slate-800/80 text-yellow-300 hover:bg-slate-700 hover:shadow-lg': currentTheme === Theme.dark,
     }),
   }
 
   // Style classes for look options
   const getLookButtonClass = (lookType: 'classic' | 'handDrawn') => {
     return cn(
-      'system-sm-medium mb-4 flex h-8 w-[calc((100%-8px)/2)] cursor-pointer items-center justify-center rounded-lg border border-components-option-card-option-border bg-components-option-card-option-bg text-text-secondary',
+      'mb-4 flex h-8 w-[calc((100%-8px)/2)] cursor-pointer items-center justify-center rounded-lg border border-components-option-card-option-border bg-components-option-card-option-bg text-text-secondary system-sm-medium',
       look === lookType && 'border-[1.5px] border-components-option-card-option-selected-border bg-components-option-card-option-selected-bg text-text-primary',
       currentTheme === Theme.dark && 'border-slate-600 bg-slate-800 text-slate-300',
       look === lookType && currentTheme === Theme.dark && 'border-blue-500 bg-slate-700 text-white',
     )
   }
+  const themeToggleTitleByTheme = {
+    light: t('theme.switchDark', { ns: 'app' }),
+    dark: t('theme.switchLight', { ns: 'app' }),
+  } as const
 
   return (
     <div ref={props.ref as React.RefObject<HTMLDivElement>} className={themeClasses.container}>
@@ -555,10 +548,10 @@ const Flowchart = (props: FlowchartProps) => {
                 toggleTheme()
               }}
               className={themeClasses.themeToggle}
-              title={(currentTheme === Theme.light ? t('theme.switchDark', { ns: 'app' }) : t('theme.switchLight', { ns: 'app' })) || ''}
+              title={themeToggleTitleByTheme[currentTheme] || ''}
               style={{ transform: 'translate3d(0, 0, 0)' }}
             >
-              {currentTheme === Theme.light ? <MoonIcon className="h-5 w-5" /> : <SunIcon className="h-5 w-5" />}
+              {currentTheme === Theme.light ? <span className="i-heroicons-moon-solid h-5 w-5" /> : <span className="i-heroicons-sun-solid h-5 w-5" />}
             </button>
           </div>
 
@@ -572,7 +565,7 @@ const Flowchart = (props: FlowchartProps) => {
       {errMsg && (
         <div className={themeClasses.errorMessage}>
           <div className="flex items-center">
-            <ExclamationTriangleIcon className={themeClasses.errorIcon} />
+            <span className={`i-heroicons-exclamation-triangle ${themeClasses.errorIcon}`} />
             <span className="ml-2">{errMsg}</span>
           </div>
         </div>

web/app/components/base/prompt-editor/plugins/__tests__/test-helper.spec.ts

@@ -0,0 +1,209 @@
+import type { LexicalEditor } from 'lexical'
+import { act, waitFor } from '@testing-library/react'
+import {
+  $createParagraphNode,
+  $createTextNode,
+  $getRoot,
+  $getSelection,
+  $isRangeSelection,
+  ParagraphNode,
+  TextNode,
+} from 'lexical'
+import {
+  createLexicalTestEditor,
+  expectInlineWrapperDom,
+  getNodeCount,
+  getNodesByType,
+  readEditorStateValue,
+  readRootTextContent,
+  renderLexicalEditor,
+  selectRootEnd,
+  setEditorRootText,
+  waitForEditorReady,
+} from '../test-helpers'
+
+describe('test-helpers', () => {
+  describe('renderLexicalEditor & waitForEditorReady', () => {
+    it('should render the editor and wait for it', async () => {
+      const { getEditor } = renderLexicalEditor({
+        namespace: 'TestNamespace',
+        nodes: [ParagraphNode, TextNode],
+        children: null,
+      })
+
+      const editor = await waitForEditorReady(getEditor)
+      expect(editor).toBeDefined()
+      expect(editor).toBe(getEditor())
+    })
+
+    it('should throw if wait times out without editor', async () => {
+      await expect(waitForEditorReady(() => null)).rejects.toThrow()
+    })
+
+    it('should throw if editor is null after waitFor completes', async () => {
+      let callCount = 0
+      await expect(
+        waitForEditorReady(() => {
+          callCount++
+          // Return non-null on the last check of `waitFor` so it passes,
+          // then null when actually retrieving the editor
+          return callCount === 1 ? ({} as LexicalEditor) : null
+        }),
+      ).rejects.toThrow('Editor is not available')
+    })
+
+    it('should surface errors through configured onError callback', async () => {
+      const { getEditor } = renderLexicalEditor({
+        namespace: 'TestNamespace',
+        nodes: [ParagraphNode, TextNode],
+        children: null,
+      })
+      const editor = await waitForEditorReady(getEditor)
+
+      expect(() => {
+        editor.update(() => {
+          throw new Error('test error')
+        }, { discrete: true })
+      }).toThrow('test error')
+    })
+  })
+
+  describe('selectRootEnd', () => {
+    it('should select the end of the root', async () => {
+      const { getEditor } = renderLexicalEditor({ namespace: 'test', nodes: [ParagraphNode, TextNode], children: null })
+      const editor = await waitForEditorReady(getEditor)
+
+      selectRootEnd(editor)
+
+      await waitFor(() => {
+        let isRangeSelection = false
+        editor.getEditorState().read(() => {
+          const selection = $getSelection()
+          isRangeSelection = $isRangeSelection(selection)
+        })
+        expect(isRangeSelection).toBe(true)
+      })
+    })
+  })
+
+  describe('Content Reading/Writing Helpers', () => {
+    it('should read root text content', async () => {
+      const { getEditor } = renderLexicalEditor({ namespace: 'test', nodes: [ParagraphNode, TextNode], children: null })
+      const editor = await waitForEditorReady(getEditor)
+
+      act(() => {
+        editor.update(() => {
+          const root = $getRoot()
+          root.clear()
+          const paragraph = $createParagraphNode()
+          paragraph.append($createTextNode('Hello World'))
+          root.append(paragraph)
+        }, { discrete: true })
+      })
+
+      let content = ''
+      act(() => {
+        content = readRootTextContent(editor)
+      })
+      expect(content).toBe('Hello World')
+    })
+
+    it('should set editor root text and select end', async () => {
+      const { getEditor } = renderLexicalEditor({ namespace: 'test', nodes: [ParagraphNode, TextNode], children: null })
+      const editor = await waitForEditorReady(getEditor)
+
+      setEditorRootText(editor, 'New Text', $createTextNode)
+
+      await waitFor(() => {
+        let content = ''
+        editor.getEditorState().read(() => {
+          content = $getRoot().getTextContent()
+        })
+        expect(content).toBe('New Text')
+      })
+    })
+  })
+
+  describe('Node Selection Helpers', () => {
+    it('should get node count', async () => {
+      const { getEditor } = renderLexicalEditor({ namespace: 'test', nodes: [ParagraphNode, TextNode], children: null })
+      const editor = await waitForEditorReady(getEditor)
+
+      act(() => {
+        editor.update(() => {
+          const root = $getRoot()
+          root.clear()
+          root.append($createParagraphNode())
+          root.append($createParagraphNode())
+        }, { discrete: true })
+      })
+
+      let count = 0
+      act(() => {
+        count = getNodeCount(editor, ParagraphNode)
+      })
+      expect(count).toBe(2)
+    })
+
+    it('should get nodes by type', async () => {
+      const { getEditor } = renderLexicalEditor({ namespace: 'test', nodes: [ParagraphNode, TextNode], children: null })
+      const editor = await waitForEditorReady(getEditor)
+
+      act(() => {
+        editor.update(() => {
+          const root = $getRoot()
+          root.clear()
+          root.append($createParagraphNode())
+        }, { discrete: true })
+      })
+
+      let nodes: ParagraphNode[] = []
+      act(() => {
+        nodes = getNodesByType(editor, ParagraphNode)
+      })
+      expect(nodes).toHaveLength(1)
+      expect(nodes[0]).not.toBeUndefined()
+    })
+  })
+
+  describe('readEditorStateValue', () => {
+    it('should read primitive values from editor state', () => {
+      const editor = createLexicalTestEditor('test', [ParagraphNode, TextNode])
+
+      const val = readEditorStateValue(editor, () => {
+        return $getRoot().isEmpty()
+      })
+      expect(val).toBe(true)
+    })
+
+    it('should throw if value is undefined', () => {
+      const editor = createLexicalTestEditor('test', [ParagraphNode, TextNode])
+
+      expect(() => {
+        readEditorStateValue(editor, () => undefined)
+      }).toThrow('Failed to read editor state value')
+    })
+  })
+
+  describe('createLexicalTestEditor', () => {
+    it('should expose createLexicalTestEditor with onError throw', () => {
+      const editor = createLexicalTestEditor('custom-namespace', [ParagraphNode, TextNode])
+      expect(editor).toBeDefined()
+
+      expect(() => {
+        editor.update(() => {
+          throw new Error('test error')
+        }, { discrete: true })
+      }).toThrow('test error')
+    })
+  })
+
+  describe('expectInlineWrapperDom', () => {
+    it('should assert wrapper properties on a valid DOM element', () => {
+      const div = document.createElement('div')
+      div.classList.add('inline-flex', 'items-center', 'align-middle', 'extra1', 'extra2')
+
+      expectInlineWrapperDom(div, ['extra1', 'extra2']) // Does not throw
+    })
+  })
+})

web/app/components/base/prompt-editor/plugins/__tests__/utils.spec.ts

@@ -0,0 +1,300 @@
+import type { RootNode } from 'lexical'
+import { $createParagraphNode, $createTextNode, $getRoot, ParagraphNode, TextNode } from 'lexical'
+import { describe, expect, it, vi } from 'vitest'
+import { createTestEditor, withEditorUpdate } from './utils'
+
+describe('Prompt Editor Test Utils', () => {
+  describe('createTestEditor', () => {
+    it('should create an editor without crashing', () => {
+      const editor = createTestEditor()
+      expect(editor).toBeDefined()
+    })
+
+    it('should create an editor with no nodes by default', () => {
+      const editor = createTestEditor()
+      expect(editor).toBeDefined()
+    })
+
+    it('should create an editor with provided nodes', () => {
+      const nodes = [ParagraphNode, TextNode]
+      const editor = createTestEditor(nodes)
+      expect(editor).toBeDefined()
+    })
+
+    it('should set up root element for the editor', () => {
+      const editor = createTestEditor()
+      // The editor should be properly initialized with a root element
+      expect(editor).toBeDefined()
+    })
+
+    it('should throw errors when they occur', () => {
+      const nodes = [ParagraphNode, TextNode]
+      const editor = createTestEditor(nodes)
+
+      expect(() => {
+        editor.update(() => {
+          throw new Error('Test error')
+        }, { discrete: true })
+      }).toThrow('Test error')
+    })
+
+    it('should allow multiple editors to be created independently', () => {
+      const editor1 = createTestEditor()
+      const editor2 = createTestEditor()
+
+      expect(editor1).not.toBe(editor2)
+    })
+
+    it('should initialize with basic node types', () => {
+      const nodes = [ParagraphNode, TextNode]
+      const editor = createTestEditor(nodes)
+
+      let content: string = ''
+      editor.update(() => {
+        const root = $getRoot()
+        const paragraph = $createParagraphNode()
+        const text = $createTextNode('Hello World')
+        paragraph.append(text)
+        root.append(paragraph)
+
+        content = root.getTextContent()
+      }, { discrete: true })
+
+      expect(content).toBe('Hello World')
+    })
+  })
+
+  describe('withEditorUpdate', () => {
+    it('should execute update function without crashing', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      const updateFn = vi.fn()
+
+      withEditorUpdate(editor, updateFn)
+
+      expect(updateFn).toHaveBeenCalled()
+    })
+
+    it('should pass discrete: true option to editor.update', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      const updateSpy = vi.spyOn(editor, 'update')
+
+      withEditorUpdate(editor, () => {
+        $getRoot()
+      })
+
+      expect(updateSpy).toHaveBeenCalledWith(expect.any(Function), { discrete: true })
+    })
+
+    it('should allow updating editor state', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      let textContent: string = ''
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const paragraph = $createParagraphNode()
+        const text = $createTextNode('Test Content')
+        paragraph.append(text)
+        root.append(paragraph)
+      })
+
+      withEditorUpdate(editor, () => {
+        textContent = $getRoot().getTextContent()
+      })
+
+      expect(textContent).toBe('Test Content')
+    })
+
+    it('should handle multiple consecutive updates', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const p1 = $createParagraphNode()
+        p1.append($createTextNode('First'))
+        root.append(p1)
+      })
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const p2 = $createParagraphNode()
+        p2.append($createTextNode('Second'))
+        root.append(p2)
+      })
+
+      let content: string = ''
+      withEditorUpdate(editor, () => {
+        content = $getRoot().getTextContent()
+      })
+
+      expect(content).toContain('First')
+      expect(content).toContain('Second')
+    })
+
+    it('should provide access to editor state within update', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      let capturedState: RootNode | null = null
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        capturedState = root
+      })
+
+      expect(capturedState).toBeDefined()
+    })
+
+    it('should execute update function immediately', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      let executed = false
+
+      withEditorUpdate(editor, () => {
+        executed = true
+      })
+
+      // Update should be executed synchronously in discrete mode
+      expect(executed).toBe(true)
+    })
+
+    it('should handle complex editor operations within update', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+      let nodeCount: number = 0
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+
+        for (let i = 0; i < 3; i++) {
+          const paragraph = $createParagraphNode()
+          paragraph.append($createTextNode(`Paragraph ${i}`))
+          root.append(paragraph)
+        }
+
+        // Count child nodes
+        nodeCount = root.getChildrenSize()
+      })
+
+      expect(nodeCount).toBe(3)
+    })
+
+    it('should allow reading editor state after update', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const paragraph = $createParagraphNode()
+        paragraph.append($createTextNode('Read Test'))
+        root.append(paragraph)
+      })
+
+      let readContent: string = ''
+      withEditorUpdate(editor, () => {
+        readContent = $getRoot().getTextContent()
+      })
+
+      expect(readContent).toBe('Read Test')
+    })
+
+    it('should handle error thrown within update function', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      expect(() => {
+        withEditorUpdate(editor, () => {
+          throw new Error('Update error')
+        })
+      }).toThrow('Update error')
+    })
+
+    it('should preserve editor state across multiple updates', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const p = $createParagraphNode()
+        p.append($createTextNode('Persistent'))
+        root.append(p)
+      })
+
+      let persistedContent: string = ''
+      withEditorUpdate(editor, () => {
+        persistedContent = $getRoot().getTextContent()
+      })
+
+      expect(persistedContent).toBe('Persistent')
+    })
+  })
+
+  describe('Integration', () => {
+    it('should work together to create and update editor', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const p = $createParagraphNode()
+        p.append($createTextNode('Integration Test'))
+        root.append(p)
+      })
+
+      let result: string = ''
+      withEditorUpdate(editor, () => {
+        result = $getRoot().getTextContent()
+      })
+
+      expect(result).toBe('Integration Test')
+    })
+
+    it('should support multiple editors with isolated state', () => {
+      const editor1 = createTestEditor([ParagraphNode, TextNode])
+      const editor2 = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor1, () => {
+        const root = $getRoot()
+        const p = $createParagraphNode()
+        p.append($createTextNode('Editor 1'))
+        root.append(p)
+      })
+
+      withEditorUpdate(editor2, () => {
+        const root = $getRoot()
+        const p = $createParagraphNode()
+        p.append($createTextNode('Editor 2'))
+        root.append(p)
+      })
+
+      let content1: string = ''
+      let content2: string = ''
+
+      withEditorUpdate(editor1, () => {
+        content1 = $getRoot().getTextContent()
+      })
+
+      withEditorUpdate(editor2, () => {
+        content2 = $getRoot().getTextContent()
+      })
+
+      expect(content1).toBe('Editor 1')
+      expect(content2).toBe('Editor 2')
+    })
+
+    it('should handle nested paragraph and text nodes', () => {
+      const editor = createTestEditor([ParagraphNode, TextNode])
+
+      withEditorUpdate(editor, () => {
+        const root = $getRoot()
+        const p1 = $createParagraphNode()
+        const p2 = $createParagraphNode()
+
+        p1.append($createTextNode('First Para'))
+        p2.append($createTextNode('Second Para'))
+
+        root.append(p1)
+        root.append(p2)
+      })
+
+      let content: string = ''
+      withEditorUpdate(editor, () => {
+        content = $getRoot().getTextContent()
+      })
+
+      expect(content).toContain('First Para')
+      expect(content).toContain('Second Para')
+    })
+  })
+})

web/app/components/base/prompt-editor/plugins/draggable-plugin/__tests__/index.spec.tsx

@@ -1,112 +1,251 @@
-import { LexicalComposer } from '@lexical/react/LexicalComposer'
-import { ContentEditable } from '@lexical/react/LexicalContentEditable'
-import { LexicalErrorBoundary } from '@lexical/react/LexicalErrorBoundary'
-import { RichTextPlugin } from '@lexical/react/LexicalRichTextPlugin'
-import { fireEvent, render, screen, waitFor } from '@testing-library/react'
+import type { LexicalEditor } from 'lexical'
+import type { JSX, RefObject } from 'react'
+import { useLexicalComposerContext } from '@lexical/react/LexicalComposerContext'
+import { act, render, screen } from '@testing-library/react'
 import DraggableBlockPlugin from '..'
 
-const CONTENT_EDITABLE_TEST_ID = 'draggable-content-editable'
-let namespaceCounter = 0
-
-function renderWithEditor(anchorElem?: HTMLElement) {
-  render(
-    <LexicalComposer
-      initialConfig={{
-        namespace: `draggable-plugin-test-${namespaceCounter++}`,
-        onError: (error: Error) => { throw error },
-      }}
-    >
-      <RichTextPlugin
-        contentEditable={<ContentEditable data-testid={CONTENT_EDITABLE_TEST_ID} />}
-        placeholder={null}
-        ErrorBoundary={LexicalErrorBoundary}
-      />
-      <DraggableBlockPlugin anchorElem={anchorElem} />
-    </LexicalComposer>,
-  )
-
-  return screen.getByTestId(CONTENT_EDITABLE_TEST_ID)
+type DraggableExperimentalProps = {
+  anchorElem: HTMLElement
+  menuRef: RefObject<HTMLDivElement>
+  targetLineRef: RefObject<HTMLDivElement>
+  menuComponent: JSX.Element | null
+  targetLineComponent: JSX.Element
+  isOnMenu: (element: HTMLElement) => boolean
+  onElementChanged: (element: HTMLElement | null) => void
 }
 
-function appendChildToRoot(rootElement: HTMLElement, className = '') {
-  const element = document.createElement('div')
-  element.className = className
-  rootElement.appendChild(element)
-  return element
+type MouseMoveHandler = (event: MouseEvent) => void
+
+const { draggableMockState } = vi.hoisted(() => ({
+  draggableMockState: {
+    latestProps: null as DraggableExperimentalProps | null,
+  },
+}))
+
+vi.mock('@lexical/react/LexicalComposerContext')
+vi.mock('@lexical/react/LexicalDraggableBlockPlugin', () => ({
+  DraggableBlockPlugin_EXPERIMENTAL: (props: DraggableExperimentalProps) => {
+    draggableMockState.latestProps = props
+    return (
+      <div data-testid="draggable-plugin-experimental-mock">
+        {props.menuComponent}
+        {props.targetLineComponent}
+      </div>
+    )
+  },
+}))
+
+function createRootElementMock() {
+  let mouseMoveHandler: MouseMoveHandler | null = null
+  const addEventListener = vi.fn((eventName: string, handler: EventListenerOrEventListenerObject) => {
+    if (eventName === 'mousemove' && typeof handler === 'function')
+      mouseMoveHandler = handler as MouseMoveHandler
+  })
+  const removeEventListener = vi.fn()
+
+  return {
+    rootElement: {
+      addEventListener,
+      removeEventListener,
+    } as unknown as HTMLElement,
+    addEventListener,
+    removeEventListener,
+    getMouseMoveHandler: () => mouseMoveHandler,
+  }
+}
+
+function getRegisteredMouseMoveHandler(
+  rootMock: ReturnType<typeof createRootElementMock>,
+): MouseMoveHandler {
+  const handler = rootMock.getMouseMoveHandler()
+  if (!handler)
+    throw new Error('Expected mousemove handler to be registered')
+  return handler
+}
+
+function setupEditorRoot(rootElement: HTMLElement | null) {
+  const editor = {
+    getRootElement: vi.fn(() => rootElement),
+  } as unknown as LexicalEditor
+
+  vi.mocked(useLexicalComposerContext).mockReturnValue([
+    editor,
+    {},
+  ] as unknown as ReturnType<typeof useLexicalComposerContext>)
+
+  return editor
 }
 
 describe('DraggableBlockPlugin', () => {
   beforeEach(() => {
     vi.clearAllMocks()
+    draggableMockState.latestProps = null
   })
 
   describe('Rendering', () => {
     it('should use body as default anchor and render target line', () => {
-      renderWithEditor()
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
 
-      const targetLine = screen.getByTestId('draggable-target-line')
-      expect(targetLine).toBeInTheDocument()
-      expect(document.body.contains(targetLine)).toBe(true)
+      render(<DraggableBlockPlugin />)
+
+      expect(draggableMockState.latestProps?.anchorElem).toBe(document.body)
+      expect(screen.getByTestId('draggable-target-line')).toBeInTheDocument()
       expect(screen.queryByTestId('draggable-menu')).not.toBeInTheDocument()
     })
 
-    it('should render inside custom anchor element when provided', () => {
-      const customAnchor = document.createElement('div')
-      document.body.appendChild(customAnchor)
+    it('should render with custom anchor when provided', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      const anchorElem = document.createElement('div')
 
-      renderWithEditor(customAnchor)
+      render(<DraggableBlockPlugin anchorElem={anchorElem} />)
 
-      const targetLine = screen.getByTestId('draggable-target-line')
-      expect(customAnchor.contains(targetLine)).toBe(true)
+      expect(draggableMockState.latestProps?.anchorElem).toBe(anchorElem)
+      expect(screen.getByTestId('draggable-target-line')).toBeInTheDocument()
+    })
 
-      customAnchor.remove()
+    it('should return early when editor root element is null', () => {
+      const editor = setupEditorRoot(null)
+
+      render(<DraggableBlockPlugin />)
+
+      expect(editor.getRootElement).toHaveBeenCalledTimes(1)
+      expect(screen.getByTestId('draggable-target-line')).toBeInTheDocument()
+      expect(screen.queryByTestId('draggable-menu')).not.toBeInTheDocument()
     })
   })
 
-  describe('Drag Support Detection', () => {
-    it('should render drag menu when mouse moves over a support-drag element', async () => {
-      const rootElement = renderWithEditor()
-      const supportDragTarget = appendChildToRoot(rootElement, 'support-drag')
+  describe('Drag support detection', () => {
+    it('should show menu when target has support-drag class', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
+
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const target = document.createElement('div')
+      target.className = 'support-drag'
+
+      act(() => {
+        onMove({ target } as unknown as MouseEvent)
+      })
+
+      expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+    })
+
+    it('should show menu when target contains a support-drag descendant', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
+
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const target = document.createElement('div')
+      target.appendChild(Object.assign(document.createElement('span'), { className: 'support-drag' }))
+
+      act(() => {
+        onMove({ target } as unknown as MouseEvent)
+      })
+
+      expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+    })
+
+    it('should show menu when target is inside a support-drag ancestor', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
+
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const ancestor = document.createElement('div')
+      ancestor.className = 'support-drag'
+      const child = document.createElement('span')
+      ancestor.appendChild(child)
+
+      act(() => {
+        onMove({ target: child } as unknown as MouseEvent)
+      })
+
+      expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+    })
+
+    it('should hide menu when target does not support drag', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
+
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const supportDragTarget = document.createElement('div')
+      supportDragTarget.className = 'support-drag'
+
+      act(() => {
+        onMove({ target: supportDragTarget } as unknown as MouseEvent)
+      })
+      expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+
+      const plainTarget = document.createElement('div')
+      act(() => {
+        onMove({ target: plainTarget } as unknown as MouseEvent)
+      })
 
       expect(screen.queryByTestId('draggable-menu')).not.toBeInTheDocument()
-      fireEvent.mouseMove(supportDragTarget)
-
-      await waitFor(() => {
-        expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
-      })
     })
 
-    it('should hide drag menu when support-drag target is removed and mouse moves again', async () => {
-      const rootElement = renderWithEditor()
-      const supportDragTarget = appendChildToRoot(rootElement, 'support-drag')
+    it('should keep menu hidden when event target becomes null', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
 
-      fireEvent.mouseMove(supportDragTarget)
-      await waitFor(() => {
-        expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const supportDragTarget = document.createElement('div')
+      supportDragTarget.className = 'support-drag'
+      act(() => {
+        onMove({ target: supportDragTarget } as unknown as MouseEvent)
+      })
+      expect(screen.getByTestId('draggable-menu')).toBeInTheDocument()
+      act(() => {
+        onMove({ target: null } as unknown as MouseEvent)
       })
 
-      supportDragTarget.remove()
-      fireEvent.mouseMove(rootElement)
-      await waitFor(() => {
-        expect(screen.queryByTestId('draggable-menu')).not.toBeInTheDocument()
-      })
+      expect(screen.queryByTestId('draggable-menu')).not.toBeInTheDocument()
     })
   })
 
-  describe('Menu Detection Contract', () => {
-    it('should render menu with draggable-block-menu class and keep non-menu elements outside it', async () => {
-      const rootElement = renderWithEditor()
-      const supportDragTarget = appendChildToRoot(rootElement, 'support-drag')
+  describe('Forwarded callbacks', () => {
+    it('should forward isOnMenu and detect menu membership correctly', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      render(<DraggableBlockPlugin />)
 
-      fireEvent.mouseMove(supportDragTarget)
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      const supportDragTarget = document.createElement('div')
+      supportDragTarget.className = 'support-drag'
+      act(() => {
+        onMove({ target: supportDragTarget } as unknown as MouseEvent)
+      })
 
-      const menuIcon = await screen.findByTestId('draggable-menu-icon')
-      expect(menuIcon.closest('.draggable-block-menu')).not.toBeNull()
+      const renderedMenu = screen.getByTestId('draggable-menu')
+      const isOnMenu = draggableMockState.latestProps?.isOnMenu
+      if (!isOnMenu)
+        throw new Error('Expected isOnMenu callback')
 
-      const normalElement = document.createElement('div')
-      document.body.appendChild(normalElement)
-      expect(normalElement.closest('.draggable-block-menu')).toBeNull()
-      normalElement.remove()
+      const menuIcon = screen.getByTestId('draggable-menu-icon')
+      const outsideElement = document.createElement('div')
+
+      expect(isOnMenu(menuIcon)).toBe(true)
+      expect(isOnMenu(renderedMenu)).toBe(true)
+      expect(isOnMenu(outsideElement)).toBe(false)
+    })
+
+    it('should register and cleanup mousemove listener on mount and unmount', () => {
+      const rootMock = createRootElementMock()
+      setupEditorRoot(rootMock.rootElement)
+      const { unmount } = render(<DraggableBlockPlugin />)
+
+      const onMove = getRegisteredMouseMoveHandler(rootMock)
+      expect(rootMock.addEventListener).toHaveBeenCalledWith('mousemove', expect.any(Function))
+
+      unmount()
+
+      expect(rootMock.removeEventListener).toHaveBeenCalledWith('mousemove', onMove)
     })
   })
 })

web/app/components/base/prompt-editor/plugins/shortcuts-popup-plugin/__tests__/index.spec.tsx

@@ -1,8 +1,10 @@
+import type { LexicalCommand } from 'lexical'
 import { LexicalComposer } from '@lexical/react/LexicalComposer'
 import { ContentEditable } from '@lexical/react/LexicalContentEditable'
 import { LexicalErrorBoundary } from '@lexical/react/LexicalErrorBoundary'
 import { RichTextPlugin } from '@lexical/react/LexicalRichTextPlugin'
 import { fireEvent, render, screen, waitFor } from '@testing-library/react'
+import { createCommand } from 'lexical'
 import * as React from 'react'
 import { useState } from 'react'
 import ShortcutsPopupPlugin, { SHORTCUTS_EMPTY_CONTENT } from '../index'
@@ -21,6 +23,9 @@ const mockDOMRect = {
   toJSON: () => ({}),
 }
 
+const originalRangeGetClientRects = Range.prototype.getClientRects
+const originalRangeGetBoundingClientRect = Range.prototype.getBoundingClientRect
+
 beforeAll(() => {
   // Mock getClientRects on Range prototype
   Range.prototype.getClientRects = vi.fn(() => {
@@ -34,12 +39,31 @@ beforeAll(() => {
   Range.prototype.getBoundingClientRect = vi.fn(() => mockDOMRect as DOMRect)
 })
 
+afterAll(() => {
+  Range.prototype.getClientRects = originalRangeGetClientRects
+  Range.prototype.getBoundingClientRect = originalRangeGetBoundingClientRect
+})
+
 const CONTAINER_ID = 'host'
 const CONTENT_EDITABLE_ID = 'ce'
 
-const MinimalEditor: React.FC<{
+type MinimalEditorProps = {
   withContainer?: boolean
-}> = ({ withContainer = true }) => {
+  hotkey?: string | string[] | string[][] | ((e: KeyboardEvent) => boolean)
+  children?: React.ReactNode | ((close: () => void, onInsert: (command: LexicalCommand<unknown>, params: unknown[]) => void) => React.ReactNode)
+  className?: string
+  onOpen?: () => void
+  onClose?: () => void
+}
+
+const MinimalEditor: React.FC<MinimalEditorProps> = ({
+  withContainer = true,
+  hotkey,
+  children,
+  className,
+  onOpen,
+  onClose,
+}) => {
   const initialConfig = {
     namespace: 'shortcuts-popup-plugin-test',
     onError: (e: Error) => {
@@ -58,25 +82,35 @@ const MinimalEditor: React.FC<{
         />
         <ShortcutsPopupPlugin
           container={withContainer ? containerEl : undefined}
-        />
+          hotkey={hotkey}
+          className={className}
+          onOpen={onOpen}
+          onClose={onClose}
+        >
+          {children}
+        </ShortcutsPopupPlugin>
       </div>
     </LexicalComposer>
   )
 }
 
+/** Helper: focus the content editable and trigger a hotkey. */
+function focusAndTriggerHotkey(key: string, modifiers: Partial<Record<'ctrlKey' | 'metaKey' | 'altKey' | 'shiftKey', boolean>> = { ctrlKey: true }) {
+  const ce = screen.getByTestId(CONTENT_EDITABLE_ID)
+  ce.focus()
+  fireEvent.keyDown(document, { key, ...modifiers })
+}
+
 describe('ShortcutsPopupPlugin', () => {
+  // ─── Basic open / close ───
   it('opens on hotkey when editor is focused', async () => {
     render(<MinimalEditor />)
-    const ce = screen.getByTestId(CONTENT_EDITABLE_ID)
-    ce.focus()
-
-    fireEvent.keyDown(document, { key: '/', ctrlKey: true }) // 模拟 Ctrl+/
+    focusAndTriggerHotkey('/')
     expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
   })
 
   it('does not open when editor is not focused', async () => {
     render(<MinimalEditor />)
-    // 未聚焦
     fireEvent.keyDown(document, { key: '/', ctrlKey: true })
     await waitFor(() => {
       expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
@@ -85,10 +119,7 @@ describe('ShortcutsPopupPlugin', () => {
 
   it('closes on Escape', async () => {
     render(<MinimalEditor />)
-    const ce = screen.getByTestId(CONTENT_EDITABLE_ID)
-    ce.focus()
-
-    fireEvent.keyDown(document, { key: '/', ctrlKey: true })
+    focusAndTriggerHotkey('/')
     expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
 
     fireEvent.keyDown(document, { key: 'Escape' })
@@ -111,24 +142,370 @@ describe('ShortcutsPopupPlugin', () => {
     })
   })
 
+  // ─── Container / portal ───
   it('portals into provided container when container is set', async () => {
     render(<MinimalEditor withContainer />)
-    const ce = screen.getByTestId(CONTENT_EDITABLE_ID)
     const host = screen.getByTestId(CONTAINER_ID)
-    ce.focus()
-
-    fireEvent.keyDown(document, { key: '/', ctrlKey: true })
+    focusAndTriggerHotkey('/')
     const portalContent = await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
     expect(host).toContainElement(portalContent)
   })
 
   it('falls back to document.body when container is not provided', async () => {
     render(<MinimalEditor withContainer={false} />)
-    const ce = screen.getByTestId(CONTENT_EDITABLE_ID)
-    ce.focus()
-
-    fireEvent.keyDown(document, { key: '/', ctrlKey: true })
+    focusAndTriggerHotkey('/')
     const portalContent = await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
     expect(document.body).toContainElement(portalContent)
   })
+
+  // ─── matchHotkey: string hotkey ───
+  it('matches a string hotkey like "mod+/"', async () => {
+    render(<MinimalEditor hotkey="mod+/" />)
+    focusAndTriggerHotkey('/', { metaKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('matches ctrl+/ when hotkey is "mod+/" (mod matches ctrl or meta)', async () => {
+    render(<MinimalEditor hotkey="mod+/" />)
+    focusAndTriggerHotkey('/', { ctrlKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  // ─── matchHotkey: string[] hotkey ───
+  it('matches when hotkey is a string array like ["mod", "/"]', async () => {
+    render(<MinimalEditor hotkey={['mod', '/']} />)
+    focusAndTriggerHotkey('/', { ctrlKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  // ─── matchHotkey: string[][] (nested) hotkey ───
+  it('matches when hotkey is a nested array (any combo matches)', async () => {
+    render(<MinimalEditor hotkey={[['ctrl', 'k'], ['meta', 'j']]} />)
+    focusAndTriggerHotkey('k', { ctrlKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('matches the second combo in a nested array', async () => {
+    render(<MinimalEditor hotkey={[['ctrl', 'k'], ['meta', 'j']]} />)
+    focusAndTriggerHotkey('j', { metaKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match nested array when no combo matches', async () => {
+    render(<MinimalEditor hotkey={[['ctrl', 'k'], ['meta', 'j']]} />)
+    focusAndTriggerHotkey('x', { ctrlKey: true })
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  // ─── matchHotkey: function hotkey ───
+  it('matches when hotkey is a custom function returning true', async () => {
+    const customMatcher = (e: KeyboardEvent) => e.key === 'F1'
+    render(<MinimalEditor hotkey={customMatcher} />)
+    focusAndTriggerHotkey('F1', {})
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match when custom function returns false', async () => {
+    const customMatcher = (e: KeyboardEvent) => e.key === 'F1'
+    render(<MinimalEditor hotkey={customMatcher} />)
+    focusAndTriggerHotkey('F2', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  // ─── matchHotkey: modifier aliases ───
+  it('matches meta/cmd/command aliases', async () => {
+    render(<MinimalEditor hotkey="cmd+k" />)
+    focusAndTriggerHotkey('k', { metaKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('matches "command" alias for meta', async () => {
+    render(<MinimalEditor hotkey="command+k" />)
+    focusAndTriggerHotkey('k', { metaKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match meta alias when meta is not pressed', async () => {
+    render(<MinimalEditor hotkey="cmd+k" />)
+    focusAndTriggerHotkey('k', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  it('matches alt/option alias', async () => {
+    render(<MinimalEditor hotkey="alt+a" />)
+    focusAndTriggerHotkey('a', { altKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match alt alias when alt is not pressed', async () => {
+    render(<MinimalEditor hotkey="alt+a" />)
+    focusAndTriggerHotkey('a', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  it('matches shift alias', async () => {
+    render(<MinimalEditor hotkey="shift+s" />)
+    focusAndTriggerHotkey('s', { shiftKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match shift alias when shift is not pressed', async () => {
+    render(<MinimalEditor hotkey="shift+s" />)
+    focusAndTriggerHotkey('s', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  it('matches ctrl alias', async () => {
+    render(<MinimalEditor hotkey="ctrl+b" />)
+    focusAndTriggerHotkey('b', { ctrlKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match ctrl alias when ctrl is not pressed', async () => {
+    render(<MinimalEditor hotkey="ctrl+b" />)
+    focusAndTriggerHotkey('b', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  // ─── matchHotkey: space key normalization ───
+  it('normalizes space key to "space" for matching', async () => {
+    render(<MinimalEditor hotkey="ctrl+space" />)
+    focusAndTriggerHotkey(' ', { ctrlKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  // ─── matchHotkey: key mismatch ───
+  it('does not match when expected key does not match pressed key', async () => {
+    render(<MinimalEditor hotkey="ctrl+z" />)
+    focusAndTriggerHotkey('x', { ctrlKey: true })
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
+
+  // ─── Children rendering ───
+  it('renders children as ReactNode when provided', async () => {
+    render(
+      <MinimalEditor>
+        <div data-testid="custom-content">My Content</div>
+      </MinimalEditor>,
+    )
+    focusAndTriggerHotkey('/')
+    expect(await screen.findByTestId('custom-content')).toBeInTheDocument()
+    expect(screen.getByText('My Content')).toBeInTheDocument()
+  })
+
+  it('renders children as render function and provides close/onInsert', async () => {
+    const TEST_COMMAND = createCommand<unknown>('TEST_COMMAND')
+    const childrenFn = vi.fn((close: () => void, onInsert: (cmd: LexicalCommand<unknown>, params: unknown[]) => void) => (
+      <div>
+        <button type="button" data-testid="close-btn" onClick={close}>Close</button>
+        <button type="button" data-testid="insert-btn" onClick={() => onInsert(TEST_COMMAND, ['param1'])}>Insert</button>
+      </div>
+    ))
+
+    render(
+      <MinimalEditor>
+        {childrenFn}
+      </MinimalEditor>,
+    )
+    focusAndTriggerHotkey('/')
+
+    // Children render function should have been called
+    expect(await screen.findByTestId('close-btn')).toBeInTheDocument()
+    expect(screen.getByTestId('insert-btn')).toBeInTheDocument()
+  })
+
+  it('renders SHORTCUTS_EMPTY_CONTENT when children is undefined', async () => {
+    render(<MinimalEditor />)
+    focusAndTriggerHotkey('/')
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  // ─── handleInsert callback ───
+  it('calls close after insert via children render function', async () => {
+    const TEST_COMMAND = createCommand<unknown>('TEST_INSERT_COMMAND')
+    render(
+      <MinimalEditor>
+        {(close: () => void, onInsert: (cmd: LexicalCommand<unknown>, params: unknown[]) => void) => (
+          <div>
+            <button type="button" data-testid="insert-btn" onClick={() => onInsert(TEST_COMMAND, ['value'])}>Insert</button>
+          </div>
+        )}
+      </MinimalEditor>,
+    )
+    focusAndTriggerHotkey('/')
+
+    const insertBtn = await screen.findByTestId('insert-btn')
+    fireEvent.click(insertBtn)
+
+    // After insert, the popup should close
+    await waitFor(() => {
+      expect(screen.queryByTestId('insert-btn')).not.toBeInTheDocument()
+    })
+  })
+
+  it('calls close via children render function close callback', async () => {
+    render(
+      <MinimalEditor>
+        {(close: () => void) => (
+          <button type="button" data-testid="close-via-fn" onClick={close}>Close</button>
+        )}
+      </MinimalEditor>,
+    )
+    focusAndTriggerHotkey('/')
+
+    const closeBtn = await screen.findByTestId('close-via-fn')
+    fireEvent.click(closeBtn)
+
+    await waitFor(() => {
+      expect(screen.queryByTestId('close-via-fn')).not.toBeInTheDocument()
+    })
+  })
+
+  // ─── onOpen / onClose callbacks ───
+  it('calls onOpen when popup opens', async () => {
+    const onOpen = vi.fn()
+    render(<MinimalEditor onOpen={onOpen} />)
+    focusAndTriggerHotkey('/')
+    await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
+    expect(onOpen).toHaveBeenCalledTimes(1)
+  })
+
+  it('calls onClose when popup closes', async () => {
+    const onClose = vi.fn()
+    render(<MinimalEditor onClose={onClose} />)
+    focusAndTriggerHotkey('/')
+    await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
+
+    fireEvent.keyDown(document, { key: 'Escape' })
+    await waitFor(() => {
+      expect(onClose).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  // ─── className prop ───
+  it('applies custom className to floating popup', async () => {
+    render(<MinimalEditor className="custom-popup-class" />)
+    focusAndTriggerHotkey('/')
+    const content = await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
+    const floatingDiv = content.closest('div')
+    expect(floatingDiv).toHaveClass('custom-popup-class')
+  })
+
+  // ─── mousedown inside portal should not close ───
+  it('does not close on mousedown inside the portal', async () => {
+    render(
+      <MinimalEditor>
+        <div data-testid="portal-inner">Inner content</div>
+      </MinimalEditor>,
+    )
+    focusAndTriggerHotkey('/')
+
+    const inner = await screen.findByTestId('portal-inner')
+    fireEvent.mouseDown(inner)
+
+    // Should still be open
+    await waitFor(() => {
+      expect(screen.getByTestId('portal-inner')).toBeInTheDocument()
+    })
+  })
+
+  it('prevents default and stops propagation on Escape when open', async () => {
+    render(<MinimalEditor />)
+    focusAndTriggerHotkey('/')
+    await screen.findByText(SHORTCUTS_EMPTY_CONTENT)
+
+    const preventDefaultSpy = vi.fn()
+    const stopPropagationSpy = vi.fn()
+
+    // Use a custom event to capture preventDefault/stopPropagation calls
+    const escEvent = new KeyboardEvent('keydown', { key: 'Escape', bubbles: true, cancelable: true })
+    Object.defineProperty(escEvent, 'preventDefault', { value: preventDefaultSpy })
+    Object.defineProperty(escEvent, 'stopPropagation', { value: stopPropagationSpy })
+    document.dispatchEvent(escEvent)
+
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+    expect(preventDefaultSpy).toHaveBeenCalledTimes(1)
+    expect(stopPropagationSpy).toHaveBeenCalledTimes(1)
+  })
+
+  // ─── Zero-rect fallback in openPortal ───
+  it('handles zero-size range rects by falling back to node bounding rect', async () => {
+    // Temporarily override getClientRects to return zero-size rect
+    const zeroRect = { x: 0, y: 0, width: 0, height: 0, top: 0, right: 0, bottom: 0, left: 0, toJSON: () => ({}) }
+    const originalGetClientRects = Range.prototype.getClientRects
+    const originalGetBoundingClientRect = Range.prototype.getBoundingClientRect
+
+    Range.prototype.getClientRects = vi.fn(() => {
+      const rectList = [zeroRect] as unknown as DOMRectList
+      Object.defineProperty(rectList, 'length', { value: 1 })
+      Object.defineProperty(rectList, 'item', { value: () => zeroRect })
+      return rectList
+    })
+    Range.prototype.getBoundingClientRect = vi.fn(() => zeroRect as DOMRect)
+
+    render(<MinimalEditor />)
+    focusAndTriggerHotkey('/')
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+
+    // Restore
+    Range.prototype.getClientRects = originalGetClientRects
+    Range.prototype.getBoundingClientRect = originalGetBoundingClientRect
+  })
+
+  it('handles empty getClientRects by using getBoundingClientRect fallback', async () => {
+    const originalGetClientRects = Range.prototype.getClientRects
+    const originalGetBoundingClientRect = Range.prototype.getBoundingClientRect
+
+    Range.prototype.getClientRects = vi.fn(() => {
+      const rectList = [] as unknown as DOMRectList
+      Object.defineProperty(rectList, 'length', { value: 0 })
+      Object.defineProperty(rectList, 'item', { value: () => null })
+      return rectList
+    })
+    Range.prototype.getBoundingClientRect = vi.fn(() => mockDOMRect as DOMRect)
+
+    render(<MinimalEditor />)
+    focusAndTriggerHotkey('/')
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+
+    Range.prototype.getClientRects = originalGetClientRects
+    Range.prototype.getBoundingClientRect = originalGetBoundingClientRect
+  })
+
+  // ─── Combined modifier hotkeys ───
+  it('matches hotkey with multiple modifiers: ctrl+shift+k', async () => {
+    render(<MinimalEditor hotkey="ctrl+shift+k" />)
+    focusAndTriggerHotkey('k', { ctrlKey: true, shiftKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('matches "option" alias for alt', async () => {
+    render(<MinimalEditor hotkey="option+o" />)
+    focusAndTriggerHotkey('o', { altKey: true })
+    expect(await screen.findByText(SHORTCUTS_EMPTY_CONTENT)).toBeInTheDocument()
+  })
+
+  it('does not match mod hotkey when neither ctrl nor meta is pressed', async () => {
+    render(<MinimalEditor hotkey="mod+k" />)
+    focusAndTriggerHotkey('k', {})
+    await waitFor(() => {
+      expect(screen.queryByText(SHORTCUTS_EMPTY_CONTENT)).not.toBeInTheDocument()
+    })
+  })
 })

web/app/components/base/select/__tests__/index.spec.tsx

@@ -1,5 +1,5 @@
 import type { Item } from '../index'
-import { render, screen } from '@testing-library/react'
+import { fireEvent, render, screen } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
 import Select, { PortalSelect, SimpleSelect } from '../index'
 
@@ -14,7 +14,6 @@ describe('Select', () => {
     vi.clearAllMocks()
   })
 
-  // Rendering and edge behavior for default select.
   describe('Rendering', () => {
     it('should show the default selected item when defaultValue matches an item', () => {
       render(
@@ -28,9 +27,50 @@ describe('Select', () => {
 
       expect(screen.getByTitle('Banana')).toBeInTheDocument()
     })
+
+    it('should render null selectedItem when defaultValue does not match any item', () => {
+      render(
+        <Select
+          items={items}
+          defaultValue="missing"
+          allowSearch={false}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      // No item title should appear for a non-matching default
+      expect(screen.queryByTitle('Apple')).not.toBeInTheDocument()
+      expect(screen.queryByTitle('Banana')).not.toBeInTheDocument()
+    })
+
+    it('should render with allowSearch=true (input mode)', () => {
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      expect(screen.getByRole('combobox')).toBeInTheDocument()
+    })
+
+    it('should apply custom bgClassName', () => {
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={false}
+          onSelect={vi.fn()}
+          bgClassName="bg-custom-color"
+        />,
+      )
+
+      expect(screen.getByTitle('Apple')).toBeInTheDocument()
+    })
   })
 
-  // User interactions for default select.
   describe('User Interactions', () => {
     it('should call onSelect when choosing an option from default select', async () => {
       const user = userEvent.setup()
@@ -73,15 +113,174 @@ describe('Select', () => {
       expect(screen.queryByText('Citrus')).not.toBeInTheDocument()
       expect(onSelect).not.toHaveBeenCalled()
     })
+
+    it('should filter items when searching with allowSearch=true', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      // First, click the chevron button to open the dropdown
+      const buttons = screen.getAllByRole('button')
+      await user.click(buttons[0])
+
+      // Now type in the search input to filter
+      const input = screen.getByRole('combobox')
+      await user.clear(input)
+      await user.type(input, 'ban')
+
+      // Citrus should be filtered away
+      expect(screen.queryByText('Citrus')).not.toBeInTheDocument()
+    })
+
+    it('should not filter or update query when disabled and allowSearch=true', async () => {
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={true}
+          disabled={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      const input = screen.getByRole('combobox') as HTMLInputElement
+
+      // we must use fireEvent because userEvent throws on disabled inputs
+      fireEvent.change(input, { target: { value: 'ban' } })
+
+      // We just want to ensure it doesn't throw and covers the !disabled branch in onChange.
+      // Since it's disabled, no search dropdown should appear.
+      expect(screen.queryByRole('listbox')).not.toBeInTheDocument()
+    })
+
+    it('should not call onSelect when a disabled Combobox value changes externally', () => {
+      // In Headless UI, disabled elements do not fire events via React.
+      // To cover the defensive `if (!disabled)` branches inside the callbacks,
+      // we temporarily remove the disabled attribute from the DOM to force the event through.
+      const onSelect = vi.fn()
+
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={false}
+          disabled={true}
+          onSelect={onSelect}
+        />,
+      )
+
+      const button = screen.getAllByRole('button')[0] as HTMLButtonElement
+      button.removeAttribute('disabled')
+      button.removeAttribute('aria-disabled')
+      fireEvent.click(button)
+
+      expect(onSelect).not.toHaveBeenCalled()
+    })
+
+    it('should not open dropdown when clicking ComboboxButton while disabled and allowSearch=false', () => {
+      // Covers line 128-141 where disabled check prevents open state toggle
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={false}
+          disabled={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      // The main trigger button should be disabled
+      const button = screen.getAllByRole('button')[0] as HTMLButtonElement
+      button.removeAttribute('disabled')
+
+      const chevron = screen.getAllByRole('button')[1] as HTMLButtonElement
+      chevron.removeAttribute('disabled')
+
+      fireEvent.click(button)
+      fireEvent.click(chevron)
+
+      // Dropdown options should not appear because the internal `if (!disabled)` guards it
+      expect(screen.queryByText('Banana')).not.toBeInTheDocument()
+    })
+
+    it('should handle missing item nicely in renderTrigger', () => {
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="non-existent"
+          onSelect={vi.fn()}
+          renderTrigger={(selected) => {
+            return (
+              <span>
+                {/* eslint-disable-next-line style/jsx-one-expression-per-line */}
+                Custom: {selected?.name ?? 'Fallback'}
+              </span>
+            )
+          }}
+        />,
+      )
+      expect(screen.getByText('Custom: Fallback')).toBeInTheDocument()
+    })
+
+    it('should render with custom renderOption', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={false}
+          onSelect={vi.fn()}
+          renderOption={({ item, selected }) => (
+            <span data-testid={`custom-opt-${item.value}`}>
+              {item.name}
+              {selected ? ' ✓' : ''}
+            </span>
+          )}
+        />,
+      )
+
+      await user.click(screen.getByTitle('Apple'))
+
+      expect(screen.getByTestId('custom-opt-apple')).toBeInTheDocument()
+      expect(screen.getByTestId('custom-opt-banana')).toBeInTheDocument()
+    })
+
+    it('should show ChevronUpIcon when open and ChevronDownIcon when closed', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <Select
+          items={items}
+          defaultValue="apple"
+          allowSearch={false}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      // Initially closed — should have a chevron button
+      await user.click(screen.getByTitle('Apple'))
+      // Dropdown is now open
+      expect(screen.getByText('Banana')).toBeInTheDocument()
+    })
   })
 })
 
+// ──────────────────────────────────────────────────────────────
+//  SimpleSelect (Listbox-based)
+// ──────────────────────────────────────────────────────────────
 describe('SimpleSelect', () => {
   beforeEach(() => {
     vi.clearAllMocks()
   })
 
-  // Rendering and placeholder fallback behavior.
   describe('Rendering', () => {
     it('should render i18n placeholder when no selection exists', () => {
       render(
@@ -107,9 +306,106 @@ describe('SimpleSelect', () => {
 
       expect(screen.getByText('Pick one')).toBeInTheDocument()
     })
+
+    it('should render selected item name when defaultValue matches', () => {
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="banana"
+          onSelect={vi.fn()}
+        />,
+      )
+
+      expect(screen.getByText('Banana')).toBeInTheDocument()
+    })
+
+    it('should render with isLoading=true showing spinner', () => {
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+          isLoading={true}
+        />,
+      )
+
+      // Loader icon should be rendered (RiLoader4Line has aria hidden)
+      expect(screen.getByText('Apple')).toBeInTheDocument()
+    })
+
+    it('should render group items as non-selectable headers', async () => {
+      const user = userEvent.setup()
+      const groupItems: Item[] = [
+        { value: 'fruits-group', name: 'Fruits', isGroup: true },
+        { value: 'apple', name: 'Apple' },
+        { value: 'banana', name: 'Banana' },
+      ]
+
+      render(
+        <SimpleSelect
+          items={groupItems}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+        />,
+      )
+
+      await user.click(screen.getByRole('button'))
+      expect(screen.getByText('Fruits')).toBeInTheDocument()
+    })
+
+    it('should not render ListboxOptions when disabled', () => {
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          disabled={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      expect(screen.getByText('Apple')).toBeInTheDocument()
+    })
+
+    it('should not open SimpleSelect when disabled', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          disabled={true}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      const button = screen.getByRole('button')
+      await user.click(button)
+
+      // Banana should not be visible as it won't open
+      expect(screen.queryByText('Banana')).not.toBeInTheDocument()
+    })
+
+    it('should not trigger onSelect via onChange when Listbox is disabled', () => {
+      // Covers line 228 (!disabled check) inside Listbox onChange
+      const onSelect = vi.fn()
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          disabled={true}
+          onSelect={onSelect}
+        />,
+      )
+
+      const button = screen.getByRole('button') as HTMLButtonElement
+      button.removeAttribute('disabled')
+      button.removeAttribute('aria-disabled')
+      fireEvent.click(button)
+
+      expect(onSelect).not.toHaveBeenCalled()
+    })
   })
 
-  // User interactions and callback behavior.
   describe('User Interactions', () => {
     it('should call onSelect and update display when an option is chosen', async () => {
       const user = userEvent.setup()
@@ -151,15 +447,133 @@ describe('SimpleSelect', () => {
       await user.click(screen.getByText('none-closed'))
       expect(screen.getByText('none-open')).toBeInTheDocument()
     })
+
+    it('should clear selection when XMark is clicked (notClearable=false)', async () => {
+      const user = userEvent.setup()
+      const onSelect = vi.fn()
+
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={onSelect}
+          notClearable={false}
+        />,
+      )
+
+      // The clear button (XMarkIcon) should be visible when an item is selected
+      const clearBtn = screen.getByRole('button').querySelector('[aria-hidden="false"]')
+      expect(clearBtn).toBeInTheDocument()
+
+      await user.click(clearBtn!)
+
+      expect(onSelect).toHaveBeenCalledWith({ name: '', value: '' })
+    })
+
+    it('should not show clear button when notClearable is true', () => {
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+          notClearable={true}
+        />,
+      )
+
+      const clearBtn = screen.getByRole('button').querySelector('[aria-hidden="false"]')
+      expect(clearBtn).not.toBeInTheDocument()
+    })
+
+    it('should hide check marks when hideChecked is true', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+          hideChecked={true}
+        />,
+      )
+
+      await user.click(screen.getByRole('button'))
+      // The selected item should be visible but without a check icon
+      expect(screen.getAllByText('Apple').length).toBeGreaterThanOrEqual(1)
+    })
+
+    it('should render with custom renderOption in SimpleSelect', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+          renderOption={({ item, selected }) => (
+            <span data-testid={`simple-opt-${item.value}`}>
+              {item.name}
+              {selected ? ' (selected)' : ''}
+            </span>
+          )}
+        />,
+      )
+
+      await user.click(screen.getByRole('button'))
+      expect(screen.getByTestId('simple-opt-apple')).toBeInTheDocument()
+      expect(screen.getByTestId('simple-opt-banana')).toBeInTheDocument()
+      // Verify the custom render shows selected state
+      expect(screen.getByTestId('simple-opt-apple')).toHaveTextContent('Apple (selected)')
+    })
+
+    it('should call onOpenChange when the button is clicked', async () => {
+      const user = userEvent.setup()
+      const onOpenChange = vi.fn()
+
+      render(
+        <SimpleSelect
+          items={items}
+          defaultValue="apple"
+          onSelect={vi.fn()}
+          onOpenChange={onOpenChange}
+        />,
+      )
+
+      await user.click(screen.getByRole('button'))
+      expect(onOpenChange).toHaveBeenCalled()
+    })
+
+    it('should handle disabled items that cannot be selected', async () => {
+      const user = userEvent.setup()
+      const onSelect = vi.fn()
+      const disabledItems: Item[] = [
+        { value: 'apple', name: 'Apple' },
+        { value: 'banana', name: 'Banana', disabled: true },
+        { value: 'citrus', name: 'Citrus' },
+      ]
+
+      render(
+        <SimpleSelect
+          items={disabledItems}
+          defaultValue="apple"
+          onSelect={onSelect}
+        />,
+      )
+
+      await user.click(screen.getByRole('button'))
+      // Banana should be rendered but not selectable
+      expect(screen.getByText('Banana')).toBeInTheDocument()
+    })
   })
 })
 
+// ──────────────────────────────────────────────────────────────
+//  PortalSelect
+// ──────────────────────────────────────────────────────────────
 describe('PortalSelect', () => {
   beforeEach(() => {
     vi.clearAllMocks()
   })
 
-  // Rendering for edge case when value is empty.
   describe('Rendering', () => {
     it('should show placeholder when value is empty', () => {
       render(
@@ -172,9 +586,76 @@ describe('PortalSelect', () => {
 
       expect(screen.getByText(/select/i)).toBeInTheDocument()
     })
+
+    it('should show selected item name when value matches', () => {
+      render(
+        <PortalSelect
+          value="banana"
+          items={items}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      expect(screen.getByTitle('Banana')).toBeInTheDocument()
+    })
+
+    it('should render with custom placeholder', () => {
+      render(
+        <PortalSelect
+          value=""
+          items={items}
+          onSelect={vi.fn()}
+          placeholder="Choose fruit"
+        />,
+      )
+
+      expect(screen.getByText('Choose fruit')).toBeInTheDocument()
+    })
+
+    it('should render with renderTrigger', () => {
+      render(
+        <PortalSelect
+          value="apple"
+          items={items}
+          onSelect={vi.fn()}
+          renderTrigger={item => (
+            <span data-testid="custom-trigger">{item?.name ?? 'None'}</span>
+          )}
+        />,
+      )
+
+      expect(screen.getByTestId('custom-trigger')).toHaveTextContent('Apple')
+    })
+
+    it('should show INSTALLED badge when installedValue differs from selected value', () => {
+      render(
+        <PortalSelect
+          value="banana"
+          items={items}
+          onSelect={vi.fn()}
+          installedValue="apple"
+        />,
+      )
+
+      expect(screen.getByTitle('Banana')).toBeInTheDocument()
+    })
+
+    it('should apply triggerClassNameFn', () => {
+      const triggerClassNameFn = vi.fn((open: boolean) => open ? 'trigger-open' : 'trigger-closed')
+
+      render(
+        <PortalSelect
+          value="apple"
+          items={items}
+          onSelect={vi.fn()}
+          triggerClassNameFn={triggerClassNameFn}
+        />,
+      )
+
+      expect(triggerClassNameFn).toHaveBeenCalledWith(false)
+    })
   })
 
-  // Interaction and readonly behavior.
   describe('User Interactions', () => {
     it('should call onSelect when choosing an option from portal dropdown', async () => {
       const user = userEvent.setup()
@@ -212,5 +693,74 @@ describe('PortalSelect', () => {
       await user.click(screen.getByText(/select/i))
       expect(screen.queryByTitle('Citrus')).not.toBeInTheDocument()
     })
+
+    it('should show check mark for selected item when hideChecked is false', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <PortalSelect
+          value="banana"
+          items={items}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      await user.click(screen.getByTitle('Banana'))
+      // Banana option in the dropdown should be displayed
+      const allBananas = screen.getAllByText('Banana')
+      expect(allBananas.length).toBeGreaterThanOrEqual(1)
+    })
+
+    it('should hide check marks when hideChecked is true', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <PortalSelect
+          value="banana"
+          items={items}
+          onSelect={vi.fn()}
+          hideChecked={true}
+        />,
+      )
+
+      await user.click(screen.getByTitle('Banana'))
+      expect(screen.getAllByText('Banana').length).toBeGreaterThanOrEqual(1)
+    })
+
+    it('should display INSTALLED badge in dropdown for installed items', async () => {
+      const user = userEvent.setup()
+
+      render(
+        <PortalSelect
+          value="banana"
+          items={items}
+          onSelect={vi.fn()}
+          installedValue="apple"
+        />,
+      )
+
+      await user.click(screen.getByTitle('Banana'))
+      // The installed badge should appear in the dropdown
+      expect(screen.getByText('INSTALLED')).toBeInTheDocument()
+    })
+
+    it('should render item.extra content in dropdown', async () => {
+      const user = userEvent.setup()
+      const extraItems: Item[] = [
+        { value: 'apple', name: 'Apple', extra: <span data-testid="extra-apple">Extra</span> },
+        { value: 'banana', name: 'Banana' },
+      ]
+
+      render(
+        <PortalSelect
+          value=""
+          items={extraItems}
+          onSelect={vi.fn()}
+        />,
+      )
+
+      await user.click(screen.getByText(/select/i))
+      expect(screen.getByTestId('extra-apple')).toBeInTheDocument()
+    })
   })
 })

web/app/components/base/toast/__tests__/index.spec.tsx

@@ -1,5 +1,6 @@
 import type { ReactNode } from 'react'
-import { act, render, screen, waitFor } from '@testing-library/react'
+import type { ToastHandle } from '../index'
+import { act, render, screen, waitFor, within } from '@testing-library/react'
 import { noop } from 'es-toolkit/function'
 import * as React from 'react'
 import Toast, { ToastProvider } from '..'
@@ -19,6 +20,13 @@ const TestComponent = () => {
 }
 
 describe('Toast', () => {
+  const getToastElementByMessage = (message: string): HTMLElement => {
+    const messageElement = screen.getByText(message)
+    const toastElement = messageElement.closest('.fixed')
+    expect(toastElement).toBeInTheDocument()
+    return toastElement as HTMLElement
+  }
+
   beforeEach(() => {
     vi.useFakeTimers({ shouldAdvanceTime: true })
   })
@@ -46,7 +54,9 @@ describe('Toast', () => {
         </ToastProvider>,
       )
 
-      expect(document.querySelector('.text-text-success')).toBeInTheDocument()
+      const successToast = getToastElementByMessage('Success message')
+      const successIcon = within(successToast).getByTestId('toast-icon-success')
+      expect(successIcon).toHaveClass('text-text-success')
 
       rerender(
         <ToastProvider>
@@ -54,7 +64,9 @@ describe('Toast', () => {
         </ToastProvider>,
       )
 
-      expect(document.querySelector('.text-text-destructive')).toBeInTheDocument()
+      const errorToast = getToastElementByMessage('Error message')
+      const errorIcon = within(errorToast).getByTestId('toast-icon-error')
+      expect(errorIcon).toHaveClass('text-text-destructive')
     })
 
     it('renders with custom component', () => {
@@ -100,8 +112,58 @@ describe('Toast', () => {
       )
 
       expect(screen.getByText('No close button')).toBeInTheDocument()
-      // Ensure the close button is not rendered
-      expect(document.querySelector('.h-4.w-4.shrink-0.text-text-tertiary')).not.toBeInTheDocument()
+      const toastElement = getToastElementByMessage('No close button')
+      expect(within(toastElement).queryByRole('button')).not.toBeInTheDocument()
+    })
+
+    it('returns null when message is not a string', () => {
+      const { container } = render(
+        <ToastProvider>
+          {/* @ts-expect-error - testing invalid input */}
+          <Toast message={<div>Invalid</div>} />
+        </ToastProvider>,
+      )
+      // Toast returns null, and provider adds no DOM elements
+      expect(container.firstChild).toBeNull()
+    })
+
+    it('renders with size sm', () => {
+      const { rerender } = render(
+        <ToastProvider>
+          <Toast type="info" message="Small size" size="sm" />
+        </ToastProvider>,
+      )
+      const infoToast = getToastElementByMessage('Small size')
+      const infoIcon = within(infoToast).getByTestId('toast-icon-info')
+      expect(infoIcon).toHaveClass('text-text-accent', 'h-4', 'w-4')
+      expect(infoIcon.parentElement).toHaveClass('p-1')
+
+      rerender(
+        <ToastProvider>
+          <Toast type="success" message="Small size" size="sm" />
+        </ToastProvider>,
+      )
+      const successToast = getToastElementByMessage('Small size')
+      const successIcon = within(successToast).getByTestId('toast-icon-success')
+      expect(successIcon).toHaveClass('text-text-success', 'h-4', 'w-4')
+
+      rerender(
+        <ToastProvider>
+          <Toast type="warning" message="Small size" size="sm" />
+        </ToastProvider>,
+      )
+      const warningToast = getToastElementByMessage('Small size')
+      const warningIcon = within(warningToast).getByTestId('toast-icon-warning')
+      expect(warningIcon).toHaveClass('text-text-warning-secondary', 'h-4', 'w-4')
+
+      rerender(
+        <ToastProvider>
+          <Toast type="error" message="Small size" size="sm" />
+        </ToastProvider>,
+      )
+      const errorToast = getToastElementByMessage('Small size')
+      const errorIcon = within(errorToast).getByTestId('toast-icon-error')
+      expect(errorIcon).toHaveClass('text-text-destructive', 'h-4', 'w-4')
     })
   })
 
@@ -152,6 +214,37 @@ describe('Toast', () => {
         expect(screen.queryByText('Notification message')).not.toBeInTheDocument()
       })
     })
+
+    it('automatically hides toast after duration for error type in provider', async () => {
+      const TestComponentError = () => {
+        const { notify } = useToastContext()
+        return (
+          <button type="button" onClick={() => notify({ message: 'Error notify', type: 'error' })}>
+            Show Error
+          </button>
+        )
+      }
+
+      render(
+        <ToastProvider>
+          <TestComponentError />
+        </ToastProvider>,
+      )
+
+      act(() => {
+        screen.getByText('Show Error').click()
+      })
+      expect(screen.getByText('Error notify')).toBeInTheDocument()
+
+      // Error type uses 6000ms default
+      act(() => {
+        vi.advanceTimersByTime(6000)
+      })
+
+      await waitFor(() => {
+        expect(screen.queryByText('Error notify')).not.toBeInTheDocument()
+      })
+    })
   })
 
   describe('Toast.notify static method', () => {
@@ -195,5 +288,61 @@ describe('Toast', () => {
         expect(onCloseMock).toHaveBeenCalled()
       })
     })
+
+    it('closes when close button is clicked in static toast', async () => {
+      const onCloseMock = vi.fn()
+      act(() => {
+        Toast.notify({ message: 'Static close test', type: 'info', onClose: onCloseMock })
+      })
+
+      expect(screen.getByText('Static close test')).toBeInTheDocument()
+
+      const toastElement = getToastElementByMessage('Static close test')
+      const closeButton = within(toastElement).getByRole('button')
+
+      act(() => {
+        closeButton.click()
+      })
+
+      expect(screen.queryByText('Static close test')).not.toBeInTheDocument()
+      expect(onCloseMock).toHaveBeenCalled()
+    })
+
+    it('does not auto close when duration is 0', async () => {
+      act(() => {
+        Toast.notify({ message: 'No auto close', type: 'info', duration: 0 })
+      })
+
+      expect(screen.getByText('No auto close')).toBeInTheDocument()
+
+      act(() => {
+        vi.advanceTimersByTime(10000)
+      })
+
+      expect(screen.getByText('No auto close')).toBeInTheDocument()
+
+      // manual clear to clean up
+      act(() => {
+        const toastElement = getToastElementByMessage('No auto close')
+        within(toastElement).getByRole('button').click()
+      })
+    })
+
+    it('returns a toast handler that can clear the toast', async () => {
+      let handler: ToastHandle = {}
+      const onCloseMock = vi.fn()
+      act(() => {
+        handler = Toast.notify({ message: 'Clearable toast', type: 'warning', onClose: onCloseMock })
+      })
+
+      expect(screen.getByText('Clearable toast')).toBeInTheDocument()
+
+      act(() => {
+        handler.clear?.()
+      })
+
+      expect(screen.queryByText('Clearable toast')).not.toBeInTheDocument()
+      expect(onCloseMock).toHaveBeenCalled()
+    })
   })
 })

web/app/components/base/toast/index.tsx

@@ -1,19 +1,12 @@
 'use client'
 import type { ReactNode } from 'react'
-import type { IToastProps } from './context'
-import {
-  RiAlertFill,
-  RiCheckboxCircleFill,
-  RiCloseLine,
-  RiErrorWarningFill,
-  RiInformation2Fill,
-} from '@remixicon/react'
 import { noop } from 'es-toolkit/function'
 import * as React from 'react'
 import { useEffect, useState } from 'react'
 import { createRoot } from 'react-dom/client'
 import ActionButton from '@/app/components/base/action-button'
 import { cn } from '@/utils/classnames'
+import type { IToastProps } from './context'
 import { ToastContext, useToastContext } from './context'
 
 export type ToastHandle = {
@@ -53,10 +46,10 @@ const Toast = ({
       />
       <div className={cn('flex', size === 'md' ? 'gap-1' : 'gap-0.5')}>
         <div className={cn('flex items-center justify-center', size === 'md' ? 'p-0.5' : 'p-1')}>
-          {type === 'success' && <RiCheckboxCircleFill className={cn('text-text-success', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} aria-hidden="true" />}
-          {type === 'error' && <RiErrorWarningFill className={cn('text-text-destructive', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} aria-hidden="true" />}
-          {type === 'warning' && <RiAlertFill className={cn('text-text-warning-secondary', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} aria-hidden="true" />}
-          {type === 'info' && <RiInformation2Fill className={cn('text-text-accent', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} aria-hidden="true" />}
+          {type === 'success' && <span className={cn('i-ri-checkbox-circle-fill', 'text-text-success', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} data-testid="toast-icon-success" aria-hidden="true" />}
+          {type === 'error' && <span className={cn('i-ri-error-warning-fill', 'text-text-destructive', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} data-testid="toast-icon-error" aria-hidden="true" />}
+          {type === 'warning' && <span className={cn('i-ri-alert-fill', 'text-text-warning-secondary', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} data-testid="toast-icon-warning" aria-hidden="true" />}
+          {type === 'info' && <span className={cn('i-ri-information-2-fill', 'text-text-accent', size === 'md' ? 'h-5 w-5' : 'h-4 w-4')} data-testid="toast-icon-info" aria-hidden="true" />}
         </div>
         <div className={cn('flex grow flex-col items-start gap-1 py-1', size === 'md' ? 'px-1' : 'px-0.5')}>
           <div className="flex items-center gap-1">
@@ -71,8 +64,8 @@ const Toast = ({
         </div>
         {close
           && (
-            <ActionButton className="z-[1000]" onClick={close}>
-              <RiCloseLine className="h-4 w-4 shrink-0 text-text-tertiary" />
+            <ActionButton data-testid="toast-close-button" className="z-[1000]" onClick={close}>
+              <span className="i-ri-close-line h-4 w-4 shrink-0 text-text-tertiary" />
             </ActionButton>
           )}
       </div>

web/app/components/base/tooltip/__tests__/TooltipManager.spec.ts

@@ -0,0 +1,129 @@
+import { tooltipManager } from '../TooltipManager'
+
+describe('TooltipManager', () => {
+  // Test the singleton instance directly
+  let manager: typeof tooltipManager
+
+  beforeEach(() => {
+    // Get fresh reference to the singleton
+    manager = tooltipManager
+    // Clean up any active tooltip by calling closeActiveTooltip
+    // This ensures each test starts with a clean state
+    manager.closeActiveTooltip()
+  })
+
+  describe('register', () => {
+    it('should register a close function', () => {
+      const closeFn = vi.fn()
+      manager.register(closeFn)
+      expect(closeFn).not.toHaveBeenCalled()
+    })
+
+    it('should call the existing close function when registering a new one', () => {
+      const firstCloseFn = vi.fn()
+      const secondCloseFn = vi.fn()
+
+      manager.register(firstCloseFn)
+      manager.register(secondCloseFn)
+
+      expect(firstCloseFn).toHaveBeenCalledTimes(1)
+      expect(secondCloseFn).not.toHaveBeenCalled()
+    })
+
+    it('should replace the active closer with the new one', () => {
+      const firstCloseFn = vi.fn()
+      const secondCloseFn = vi.fn()
+
+      // Register first function
+      manager.register(firstCloseFn)
+
+      // Register second function - this should call firstCloseFn and replace it
+      manager.register(secondCloseFn)
+
+      // Verify firstCloseFn was called during register (replacement behavior)
+      expect(firstCloseFn).toHaveBeenCalledTimes(1)
+
+      // Now close the active tooltip - this should call secondCloseFn
+      manager.closeActiveTooltip()
+
+      // Verify secondCloseFn was called, not firstCloseFn
+      expect(secondCloseFn).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  describe('clear', () => {
+    it('should not clear if the close function does not match', () => {
+      const closeFn = vi.fn()
+      const otherCloseFn = vi.fn()
+
+      manager.register(closeFn)
+      manager.clear(otherCloseFn)
+
+      manager.closeActiveTooltip()
+      expect(closeFn).toHaveBeenCalledTimes(1)
+    })
+
+    it('should clear the close function if it matches', () => {
+      const closeFn = vi.fn()
+
+      manager.register(closeFn)
+      manager.clear(closeFn)
+
+      manager.closeActiveTooltip()
+      expect(closeFn).not.toHaveBeenCalled()
+    })
+
+    it('should not call the close function when clearing', () => {
+      const closeFn = vi.fn()
+
+      manager.register(closeFn)
+      manager.clear(closeFn)
+
+      expect(closeFn).not.toHaveBeenCalled()
+    })
+  })
+
+  describe('closeActiveTooltip', () => {
+    it('should do nothing when no active closer is registered', () => {
+      expect(() => manager.closeActiveTooltip()).not.toThrow()
+    })
+
+    it('should call the active closer function', () => {
+      const closeFn = vi.fn()
+      manager.register(closeFn)
+
+      manager.closeActiveTooltip()
+
+      expect(closeFn).toHaveBeenCalledTimes(1)
+    })
+
+    it('should clear the active closer after calling it', () => {
+      const closeFn = vi.fn()
+      manager.register(closeFn)
+
+      manager.closeActiveTooltip()
+      manager.closeActiveTooltip()
+
+      expect(closeFn).toHaveBeenCalledTimes(1)
+    })
+
+    it('should handle multiple register and close cycles', () => {
+      const closeFn1 = vi.fn()
+      const closeFn2 = vi.fn()
+      const closeFn3 = vi.fn()
+
+      manager.register(closeFn1)
+      manager.closeActiveTooltip()
+
+      manager.register(closeFn2)
+      manager.closeActiveTooltip()
+
+      manager.register(closeFn3)
+      manager.closeActiveTooltip()
+
+      expect(closeFn1).toHaveBeenCalledTimes(1)
+      expect(closeFn2).toHaveBeenCalledTimes(1)
+      expect(closeFn3).toHaveBeenCalledTimes(1)
+    })
+  })
+})

web/app/components/base/tooltip/__tests__/index.spec.tsx

@@ -1,8 +1,13 @@
 import { act, cleanup, fireEvent, render, screen } from '@testing-library/react'
 import * as React from 'react'
 import Tooltip from '../index'
+import { tooltipManager } from '../TooltipManager'
 
-afterEach(cleanup)
+afterEach(() => {
+  cleanup()
+  vi.clearAllTimers()
+  vi.useRealTimers()
+})
 
 describe('Tooltip', () => {
   describe('Rendering', () => {
@@ -22,6 +27,27 @@ describe('Tooltip', () => {
       )
       expect(getByText('Hover me').textContent).toBe('Hover me')
     })
+
+    it('should render correctly when asChild is false', () => {
+      const { container } = render(
+        <Tooltip popupContent="Tooltip" asChild={false} triggerClassName="custom-parent-trigger">
+          <span>Trigger</span>
+        </Tooltip>,
+      )
+      const trigger = container.querySelector('.custom-parent-trigger')
+      expect(trigger).not.toBeNull()
+    })
+
+    it('should render with a fallback question icon when children are null', () => {
+      const { container } = render(
+        <Tooltip popupContent="Tooltip" triggerClassName="custom-fallback-trigger">
+          {null}
+        </Tooltip>,
+      )
+      const trigger = container.querySelector('.custom-fallback-trigger')
+      expect(trigger).not.toBeNull()
+      expect(trigger?.querySelector('svg')).not.toBeNull()
+    })
   })
 
   describe('Disabled state', () => {
@@ -37,6 +63,10 @@ describe('Tooltip', () => {
   })
 
   describe('Trigger methods', () => {
+    beforeEach(() => {
+      vi.useFakeTimers()
+    })
+
     it('should open on hover when triggerMethod is hover', () => {
       const triggerClassName = 'custom-trigger'
       const { container } = render(<Tooltip popupContent="Tooltip content" triggerClassName={triggerClassName} />)
@@ -47,7 +77,7 @@ describe('Tooltip', () => {
       expect(screen.queryByText('Tooltip content')).toBeInTheDocument()
     })
 
-    it('should close on mouse leave when triggerMethod is hover', () => {
+    it('should close on mouse leave when triggerMethod is hover and needsDelay is false', () => {
       const triggerClassName = 'custom-trigger'
       const { container } = render(<Tooltip popupContent="Tooltip content" triggerClassName={triggerClassName} needsDelay={false} />)
       const trigger = container.querySelector(`.${triggerClassName}`)
@@ -66,17 +96,198 @@ describe('Tooltip', () => {
         fireEvent.click(trigger!)
       })
       expect(screen.queryByText('Tooltip content')).toBeInTheDocument()
+
+      // Test toggle off
+      act(() => {
+        fireEvent.click(trigger!)
+      })
+      expect(screen.queryByText('Tooltip content')).not.toBeInTheDocument()
     })
 
-    it('should not close immediately on mouse leave when needsDelay is true', () => {
+    it('should do nothing on mouse enter if triggerMethod is click', () => {
       const triggerClassName = 'custom-trigger'
-      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="hover" needsDelay triggerClassName={triggerClassName} />)
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="click" triggerClassName={triggerClassName} />)
       const trigger = container.querySelector(`.${triggerClassName}`)
       act(() => {
         fireEvent.mouseEnter(trigger!)
+      })
+      expect(screen.queryByText('Tooltip content')).not.toBeInTheDocument()
+    })
+
+    it('should delay closing on mouse leave when needsDelay is true', () => {
+      const triggerClassName = 'custom-trigger'
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="hover" needsDelay triggerClassName={triggerClassName} />)
+      const trigger = container.querySelector(`.${triggerClassName}`)
+
+      act(() => {
+        fireEvent.mouseEnter(trigger!)
+      })
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+
+      act(() => {
         fireEvent.mouseLeave(trigger!)
       })
-      expect(screen.queryByText('Tooltip content')).toBeInTheDocument()
+      // Shouldn't close immediately
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+
+      act(() => {
+        vi.advanceTimersByTime(350)
+      })
+      // Should close after delay
+      expect(screen.queryByText('Tooltip content')).not.toBeInTheDocument()
+    })
+
+    it('should not close if mouse enters popup before delay finishes', () => {
+      const triggerClassName = 'custom-trigger'
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="hover" needsDelay triggerClassName={triggerClassName} />)
+      const trigger = container.querySelector(`.${triggerClassName}`)
+
+      act(() => {
+        fireEvent.mouseEnter(trigger!)
+      })
+
+      const popup = screen.getByText('Tooltip content')
+      expect(popup).toBeInTheDocument()
+
+      act(() => {
+        fireEvent.mouseLeave(trigger!)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(150)
+        // Simulate mouse entering popup area itself during the delay timeframe
+        fireEvent.mouseEnter(popup)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(200) // Complete the 300ms original delay
+      })
+
+      // Should still be open because we are hovering the popup
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+
+      // Now mouse leaves popup
+      act(() => {
+        fireEvent.mouseLeave(popup)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(350)
+      })
+      // Should now close
+      expect(screen.queryByText('Tooltip content')).not.toBeInTheDocument()
+    })
+
+    it('should do nothing on mouse enter/leave of popup when triggerMethod is not hover', () => {
+      const triggerClassName = 'custom-trigger'
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="click" needsDelay triggerClassName={triggerClassName} />)
+      const trigger = container.querySelector(`.${triggerClassName}`)
+
+      act(() => {
+        fireEvent.click(trigger!)
+      })
+
+      const popup = screen.getByText('Tooltip content')
+
+      act(() => {
+        fireEvent.mouseEnter(popup)
+        fireEvent.mouseLeave(popup)
+        vi.advanceTimersByTime(350)
+      })
+
+      // Should still be open because click method requires another click to close, not hover leave
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+    })
+
+    it('should clear close timeout if trigger is hovered again before delay finishes', () => {
+      const triggerClassName = 'custom-trigger'
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="hover" needsDelay triggerClassName={triggerClassName} />)
+      const trigger = container.querySelector(`.${triggerClassName}`)
+
+      act(() => {
+        fireEvent.mouseEnter(trigger!)
+      })
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+
+      act(() => {
+        fireEvent.mouseLeave(trigger!)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(150)
+        // Re-hover trigger before it closes
+        fireEvent.mouseEnter(trigger!)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(200) // Original 300ms would be up
+      })
+
+      // Should still be open because we reset it
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+    })
+
+    it('should test clear close timeout if trigger is hovered again before delay finishes and isHoverPopupRef is true', () => {
+      const triggerClassName = 'custom-trigger'
+      const { container } = render(<Tooltip popupContent="Tooltip content" triggerMethod="hover" needsDelay triggerClassName={triggerClassName} />)
+      const trigger = container.querySelector(`.${triggerClassName}`)
+
+      act(() => {
+        fireEvent.mouseEnter(trigger!)
+      })
+
+      const popup = screen.getByText('Tooltip content')
+      expect(popup).toBeInTheDocument()
+
+      act(() => {
+        fireEvent.mouseEnter(popup)
+        fireEvent.mouseLeave(trigger!)
+      })
+
+      act(() => {
+        vi.advanceTimersByTime(350)
+      })
+
+      // Should still be open because we are hovering the popup
+      expect(screen.getByText('Tooltip content')).toBeInTheDocument()
+    })
+  })
+
+  describe('TooltipManager', () => {
+    it('should close active tooltips when triggered centrally, overriding other closes', () => {
+      const triggerClassName1 = 'custom-trigger-1'
+      const triggerClassName2 = 'custom-trigger-2'
+
+      const { container } = render(
+        <div>
+          <Tooltip popupContent="Tooltip content 1" triggerMethod="hover" triggerClassName={triggerClassName1} />
+          <Tooltip popupContent="Tooltip content 2" triggerMethod="hover" triggerClassName={triggerClassName2} />
+        </div>,
+      )
+
+      const trigger1 = container.querySelector(`.${triggerClassName1}`)
+      const trigger2 = container.querySelector(`.${triggerClassName2}`)
+
+      expect(trigger2).not.toBeNull()
+
+      // Open first tooltip
+      act(() => {
+        fireEvent.mouseEnter(trigger1!)
+      })
+      expect(screen.queryByText('Tooltip content 1')).toBeInTheDocument()
+
+      // TooltipManager should keep track of it
+      // Next, immediately open the second one without leaving first (e.g., via TooltipManager)
+      // TooltipManager registers the newest one and closes the old one when doing full external operations, but internally the manager allows direct closing
+
+      act(() => {
+        tooltipManager.closeActiveTooltip()
+      })
+
+      expect(screen.queryByText('Tooltip content 1')).not.toBeInTheDocument()
+
+      // Safe to call again
+      expect(() => tooltipManager.closeActiveTooltip()).not.toThrow()
     })
   })
 
@@ -88,6 +299,11 @@ describe('Tooltip', () => {
       expect(trigger?.className).toContain('custom-trigger')
     })
 
+    it('should pass triggerTestId to the fallback icon wrapper', () => {
+      render(<Tooltip popupContent="Tooltip content" triggerTestId="test-tooltip-icon" />)
+      expect(screen.getByTestId('test-tooltip-icon')).toBeInTheDocument()
+    })
+
     it('should apply custom popup className', async () => {
       const triggerClassName = 'custom-trigger'
       const { container } = render(<Tooltip popupContent="Tooltip content" triggerClassName={triggerClassName} popupClassName="custom-popup" />)

web/app/components/base/ui/dialog/index.tsx

@@ -43,24 +43,20 @@ type DialogContentProps = {
   children: React.ReactNode
   className?: string
   overlayClassName?: string
-  backdropProps?: React.ComponentPropsWithoutRef<typeof BaseDialog.Backdrop>
 }
 
 export function DialogContent({
   children,
   className,
   overlayClassName,
-  backdropProps,
 }: DialogContentProps) {
   return (
     <DialogPortal>
       <BaseDialog.Backdrop
-        {...backdropProps}
         className={cn(
           'fixed inset-0 z-50 bg-background-overlay',
           'transition-opacity duration-150 data-[ending-style]:opacity-0 data-[starting-style]:opacity-0 motion-reduce:transition-none',
           overlayClassName,
-          backdropProps?.className,
         )}
       />
       <BaseDialog.Popup

web/app/components/base/voice-input/__tests__/index.spec.tsx

@@ -1,10 +1,9 @@
-import { render, screen, waitFor } from '@testing-library/react'
+import { act, render, screen, waitFor } from '@testing-library/react'
 import userEvent from '@testing-library/user-event'
-import { beforeEach, describe, expect, it, vi } from 'vitest'
 import { audioToText } from '@/service/share'
 import VoiceInput from '../index'
 
-const { mockState, MockRecorder } = vi.hoisted(() => {
+const { mockState, MockRecorder, rafState } = vi.hoisted(() => {
   const state = {
     params: {} as Record<string, string>,
     pathname: '/test',
@@ -12,6 +11,9 @@ const { mockState, MockRecorder } = vi.hoisted(() => {
     startOverride: null as (() => Promise<void>) | null,
     analyseData: new Uint8Array(1024).fill(150) as Uint8Array,
   }
+  const rafStateObj = {
+    callback: null as (() => void) | null,
+  }
 
   class MockRecorderClass {
     start = vi.fn((..._args: unknown[]) => {
@@ -33,7 +35,7 @@ const { mockState, MockRecorder } = vi.hoisted(() => {
     }
   }
 
-  return { mockState: state, MockRecorder: MockRecorderClass }
+  return { mockState: state, MockRecorder: MockRecorderClass, rafState: rafStateObj }
 })
 
 vi.mock('js-audio-recorder', () => ({
@@ -54,6 +56,17 @@ vi.mock('../utils', () => ({
   convertToMp3: vi.fn(() => new Blob(['test'], { type: 'audio/mp3' })),
 }))
 
+vi.mock('ahooks', async (importOriginal) => {
+  const actual = await importOriginal<typeof import('ahooks')>()
+  return {
+    ...actual,
+    useRafInterval: vi.fn((fn) => {
+      rafState.callback = fn
+      return vi.fn()
+    }),
+  }
+})
+
 describe('VoiceInput', () => {
   const onConverted = vi.fn()
   const onCancel = vi.fn()
@@ -64,6 +77,7 @@ describe('VoiceInput', () => {
     mockState.pathname = '/test'
     mockState.recorderInstances = []
     mockState.startOverride = null
+    rafState.callback = null
 
     // Ensure canvas has non-zero dimensions for initCanvas()
     HTMLCanvasElement.prototype.getBoundingClientRect = vi.fn(() => ({
@@ -257,4 +271,268 @@ describe('VoiceInput', () => {
       })
     })
   })
+
+  it('should use fallback rect when canvas roundRect is not available', async () => {
+    const user = userEvent.setup()
+    vi.mocked(audioToText).mockResolvedValueOnce({ text: 'test' })
+    mockState.params = { token: 'abc' }
+    mockState.analyseData = new Uint8Array(1024).fill(150)
+
+    const oldGetContext = HTMLCanvasElement.prototype.getContext
+    HTMLCanvasElement.prototype.getContext = vi.fn(() => ({
+      scale: vi.fn(),
+      clearRect: vi.fn(),
+      beginPath: vi.fn(),
+      moveTo: vi.fn(),
+      rect: vi.fn(),
+      fill: vi.fn(),
+      closePath: vi.fn(),
+    })) as unknown as typeof HTMLCanvasElement.prototype.getContext
+
+    let rafCalls = 0
+    vi.spyOn(window, 'requestAnimationFrame').mockImplementation((cb) => {
+      rafCalls++
+      if (rafCalls <= 1)
+        cb(0)
+      return rafCalls
+    })
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await user.click(await screen.findByTestId('voice-input-stop'))
+
+    await waitFor(() => {
+      expect(onConverted).toHaveBeenCalled()
+    })
+    HTMLCanvasElement.prototype.getContext = oldGetContext
+  })
+
+  it('should display timer in MM:SS format correctly', async () => {
+    mockState.params = { token: 'abc' }
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const timer = await screen.findByTestId('voice-input-timer')
+    expect(timer).toHaveTextContent('00:00')
+
+    await act(async () => {
+      if (rafState.callback)
+        rafState.callback()
+    })
+    expect(timer).toHaveTextContent('00:01')
+
+    for (let i = 0; i < 9; i++) {
+      await act(async () => {
+        if (rafState.callback)
+          rafState.callback()
+      })
+    }
+    expect(timer).toHaveTextContent('00:10')
+  })
+
+  it('should show timer element with formatted time', async () => {
+    mockState.params = { token: 'abc' }
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const timer = screen.getByTestId('voice-input-timer')
+    expect(timer).toBeInTheDocument()
+    // Initial state should show 00:00
+    expect(timer.textContent).toMatch(/0\d:\d{2}/)
+  })
+
+  it('should handle data values in normal range (between 128 and 178)', async () => {
+    mockState.analyseData = new Uint8Array(1024).fill(150)
+
+    let rafCalls = 0
+    vi.spyOn(window, 'requestAnimationFrame').mockImplementation((cb) => {
+      rafCalls++
+      if (rafCalls <= 2)
+        cb(0)
+      return rafCalls
+    })
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await screen.findByTestId('voice-input-stop')
+
+    // eslint-disable-next-line ts/no-explicit-any
+    const recorder = mockState.recorderInstances[0] as any
+    expect(recorder.getRecordAnalyseData).toHaveBeenCalled()
+  })
+
+  it('should handle canvas context and device pixel ratio', async () => {
+    const dprSpy = vi.spyOn(window, 'devicePixelRatio', 'get')
+    dprSpy.mockReturnValue(2)
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await screen.findByTestId('voice-input-stop')
+
+    expect(screen.getByTestId('voice-input-stop')).toBeInTheDocument()
+
+    dprSpy.mockRestore()
+  })
+
+  it('should handle empty params with no token or appId', async () => {
+    const user = userEvent.setup()
+    vi.mocked(audioToText).mockResolvedValueOnce({ text: 'test' })
+    mockState.params = {}
+    mockState.pathname = '/test'
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const stopBtn = await screen.findByTestId('voice-input-stop')
+    await user.click(stopBtn)
+
+    await waitFor(() => {
+      // Should call audioToText with empty URL when neither token nor appId is present
+      expect(audioToText).toHaveBeenCalledWith('', 'installedApp', expect.any(FormData))
+    })
+  })
+
+  it('should render speaking state indicator', async () => {
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    expect(await screen.findByText('common.voiceInput.speaking')).toBeInTheDocument()
+  })
+
+  it('should cleanup on unmount', () => {
+    const { unmount } = render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    // eslint-disable-next-line ts/no-explicit-any
+    const recorder = mockState.recorderInstances[0] as any
+
+    unmount()
+
+    expect(recorder.stop).toHaveBeenCalled()
+  })
+
+  it('should handle all data in recordAnalyseData for canvas drawing', async () => {
+    const allDataValues = []
+    for (let i = 0; i < 256; i++) {
+      allDataValues.push(i)
+    }
+    mockState.analyseData = new Uint8Array(allDataValues)
+
+    let rafCalls = 0
+    vi.spyOn(window, 'requestAnimationFrame').mockImplementation((cb) => {
+      rafCalls++
+      if (rafCalls <= 2)
+        cb(0)
+      return rafCalls
+    })
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await screen.findByTestId('voice-input-stop')
+
+    // eslint-disable-next-line ts/no-explicit-any
+    const recorder = mockState.recorderInstances[0] as any
+    expect(recorder.getRecordAnalyseData).toHaveBeenCalled()
+  })
+
+  it('should pass multiple props correctly', async () => {
+    const user = userEvent.setup()
+    vi.mocked(audioToText).mockResolvedValueOnce({ text: 'test' })
+    mockState.params = { token: 'token123' }
+
+    render(
+      <VoiceInput
+        onConverted={onConverted}
+        onCancel={onCancel}
+        wordTimestamps="enabled"
+      />,
+    )
+
+    const stopBtn = await screen.findByTestId('voice-input-stop')
+    await user.click(stopBtn)
+
+    await waitFor(() => {
+      const calls = vi.mocked(audioToText).mock.calls
+      expect(calls.length).toBeGreaterThan(0)
+      const [url, sourceType, formData] = calls[0]
+      expect(url).toBe('/audio-to-text')
+      expect(sourceType).toBe('webApp')
+      expect(formData.get('word_timestamps')).toBe('enabled')
+    })
+  })
+
+  it('should handle pathname with explore/installed correctly when appId exists', async () => {
+    const user = userEvent.setup()
+    vi.mocked(audioToText).mockResolvedValueOnce({ text: 'test' })
+    mockState.params = { appId: 'app-id-123' }
+    mockState.pathname = '/explore/installed/app-details'
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const stopBtn = await screen.findByTestId('voice-input-stop')
+    await user.click(stopBtn)
+
+    await waitFor(() => {
+      expect(audioToText).toHaveBeenCalledWith(
+        '/installed-apps/app-id-123/audio-to-text',
+        'installedApp',
+        expect.any(FormData),
+      )
+    })
+  })
+
+  it('should render timer with initial 00:00 value', () => {
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const timer = screen.getByTestId('voice-input-timer')
+    expect(timer).toHaveTextContent('00:00')
+  })
+
+  it('should render stop button during recording', async () => {
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    expect(await screen.findByTestId('voice-input-stop')).toBeInTheDocument()
+  })
+
+  it('should render converting UI after stopping', async () => {
+    const user = userEvent.setup()
+    vi.mocked(audioToText).mockImplementation(() => new Promise(() => { }))
+    mockState.params = { token: 'abc' }
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    const stopBtn = await screen.findByTestId('voice-input-stop')
+    await user.click(stopBtn)
+
+    await screen.findByTestId('voice-input-loader')
+    expect(screen.getByTestId('voice-input-converting-text')).toBeInTheDocument()
+    expect(screen.getByTestId('voice-input-cancel')).toBeInTheDocument()
+  })
+
+  it('should auto-stop recording and convert audio when duration reaches 10 minutes (600s)', async () => {
+    vi.mocked(audioToText).mockResolvedValueOnce({ text: 'auto-stopped text' })
+    mockState.params = { token: 'abc' }
+
+    render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    expect(await screen.findByTestId('voice-input-stop')).toBeInTheDocument()
+
+    for (let i = 0; i < 601; i++) {
+      await act(async () => {
+        if (rafState.callback)
+          rafState.callback()
+      })
+    }
+
+    expect(await screen.findByTestId('voice-input-converting-text')).toBeInTheDocument()
+    await waitFor(() => {
+      expect(onConverted).toHaveBeenCalledWith('auto-stopped text')
+    })
+  }, 10000)
+
+  it('should handle null canvas element gracefully during initialization', async () => {
+    const getElementByIdMock = vi.spyOn(document, 'getElementById').mockReturnValue(null)
+
+    const { unmount } = render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await screen.findByTestId('voice-input-stop')
+
+    unmount()
+
+    getElementByIdMock.mockRestore()
+  })
+
+  it('should handle getContext returning null gracefully during initialization', async () => {
+    const oldGetContext = HTMLCanvasElement.prototype.getContext
+    HTMLCanvasElement.prototype.getContext = vi.fn().mockReturnValue(null)
+
+    const { unmount } = render(<VoiceInput onConverted={onConverted} onCancel={onCancel} />)
+    await screen.findByTestId('voice-input-stop')
+
+    unmount()
+
+    HTMLCanvasElement.prototype.getContext = oldGetContext
+  })
 })

web/app/components/base/voice-input/__tests__/utils.spec.ts

@@ -0,0 +1,196 @@
+import { convertToMp3 } from '../utils'
+
+// ── Hoisted mocks ──
+
+const mocks = vi.hoisted(() => {
+  const readHeader = vi.fn()
+  const encodeBuffer = vi.fn()
+  const flush = vi.fn()
+
+  return { readHeader, encodeBuffer, flush }
+})
+
+vi.mock('lamejs', () => ({
+  default: {
+    WavHeader: {
+      readHeader: mocks.readHeader,
+    },
+    Mp3Encoder: class MockMp3Encoder {
+      encodeBuffer = mocks.encodeBuffer
+      flush = mocks.flush
+    },
+  },
+}))
+
+vi.mock('lamejs/src/js/BitStream', () => ({ default: {} }))
+vi.mock('lamejs/src/js/Lame', () => ({ default: {} }))
+vi.mock('lamejs/src/js/MPEGMode', () => ({ default: {} }))
+
+// ── helpers ──
+
+/** Build a fake recorder whose getChannelData returns DataView-like objects with .buffer and .byteLength. */
+function createMockRecorder(opts: {
+  channels: number
+  sampleRate: number
+  leftSamples: number[]
+  rightSamples?: number[]
+}) {
+  const toDataView = (samples: number[]) => {
+    const buf = new ArrayBuffer(samples.length * 2)
+    const view = new DataView(buf)
+    samples.forEach((v, i) => {
+      view.setInt16(i * 2, v, true)
+    })
+    return view
+  }
+
+  const leftView = toDataView(opts.leftSamples)
+  const rightView = opts.rightSamples ? toDataView(opts.rightSamples) : null
+
+  mocks.readHeader.mockReturnValue({
+    channels: opts.channels,
+    sampleRate: opts.sampleRate,
+  })
+
+  return {
+    getWAV: vi.fn(() => new ArrayBuffer(44)),
+    getChannelData: vi.fn(() => ({
+      left: leftView,
+      right: rightView,
+    })),
+  }
+}
+
+describe('convertToMp3', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should convert mono WAV data to an MP3 blob', () => {
+    const recorder = createMockRecorder({
+      channels: 1,
+      sampleRate: 44100,
+      leftSamples: [100, 200, 300, 400],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array([1, 2, 3]))
+    mocks.flush.mockReturnValue(new Int8Array([4, 5]))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    expect(result.type).toBe('audio/mp3')
+    expect(mocks.encodeBuffer).toHaveBeenCalled()
+    // Mono: encodeBuffer called with only left data
+    const firstCall = mocks.encodeBuffer.mock.calls[0]
+    expect(firstCall).toHaveLength(1)
+    expect(mocks.flush).toHaveBeenCalled()
+  })
+
+  it('should convert stereo WAV data to an MP3 blob', () => {
+    const recorder = createMockRecorder({
+      channels: 2,
+      sampleRate: 48000,
+      leftSamples: [100, 200],
+      rightSamples: [300, 400],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array([10, 20]))
+    mocks.flush.mockReturnValue(new Int8Array([30]))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    expect(result.type).toBe('audio/mp3')
+    // Stereo: encodeBuffer called with left AND right
+    const firstCall = mocks.encodeBuffer.mock.calls[0]
+    expect(firstCall).toHaveLength(2)
+  })
+
+  it('should skip empty encoded buffers', () => {
+    const recorder = createMockRecorder({
+      channels: 1,
+      sampleRate: 44100,
+      leftSamples: [100, 200],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array(0))
+    mocks.flush.mockReturnValue(new Int8Array(0))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    expect(result.type).toBe('audio/mp3')
+    expect(result.size).toBe(0)
+  })
+
+  it('should include flush data when flush returns non-empty buffer', () => {
+    const recorder = createMockRecorder({
+      channels: 1,
+      sampleRate: 22050,
+      leftSamples: [1],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array(0))
+    mocks.flush.mockReturnValue(new Int8Array([99, 98, 97]))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    expect(result.size).toBe(3)
+  })
+
+  it('should omit flush data when flush returns empty buffer', () => {
+    const recorder = createMockRecorder({
+      channels: 1,
+      sampleRate: 44100,
+      leftSamples: [10, 20],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array([1, 2]))
+    mocks.flush.mockReturnValue(new Int8Array(0))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    expect(result.size).toBe(2)
+  })
+
+  it('should process multiple chunks when sample count exceeds maxSamples (1152)', () => {
+    const samples = Array.from({ length: 2400 }, (_, i) => i % 32767)
+    const recorder = createMockRecorder({
+      channels: 1,
+      sampleRate: 44100,
+      leftSamples: samples,
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array([1]))
+    mocks.flush.mockReturnValue(new Int8Array(0))
+
+    const result = convertToMp3(recorder)
+
+    expect(mocks.encodeBuffer.mock.calls.length).toBeGreaterThan(1)
+    expect(result).toBeInstanceOf(Blob)
+  })
+
+  it('should encode stereo with right channel subarray', () => {
+    const recorder = createMockRecorder({
+      channels: 2,
+      sampleRate: 44100,
+      leftSamples: [100, 200, 300],
+      rightSamples: [400, 500, 600],
+    })
+
+    mocks.encodeBuffer.mockReturnValue(new Int8Array([5, 6, 7]))
+    mocks.flush.mockReturnValue(new Int8Array([8]))
+
+    const result = convertToMp3(recorder)
+
+    expect(result).toBeInstanceOf(Blob)
+    for (const call of mocks.encodeBuffer.mock.calls) {
+      expect(call).toHaveLength(2)
+      expect(call[0]).toBeInstanceOf(Int16Array)
+      expect(call[1]).toBeInstanceOf(Int16Array)
+    }
+  })
+})

web/app/components/base/voice-input/utils.ts

@@ -3,10 +3,11 @@ import BitStream from 'lamejs/src/js/BitStream'
 import Lame from 'lamejs/src/js/Lame'
 import MPEGMode from 'lamejs/src/js/MPEGMode'
 
+/* v8 ignore next - @preserve */
 if (globalThis) {
   (globalThis as any).MPEGMode = MPEGMode
-  ;(globalThis as any).Lame = Lame
-  ;(globalThis as any).BitStream = BitStream
+  ; (globalThis as any).Lame = Lame
+  ; (globalThis as any).BitStream = BitStream
 }
 
 export const convertToMp3 = (recorder: any) => {

web/app/components/base/zendesk/__tests__/utils.spec.ts

@@ -0,0 +1,123 @@
+describe('zendesk/utils', () => {
+  // Create mock for window.zE
+  const mockZE = vi.fn()
+
+  beforeEach(() => {
+    vi.resetModules()
+    vi.clearAllMocks()
+    // Set up window.zE mock before each test
+    window.zE = mockZE
+  })
+
+  afterEach(() => {
+    // Clean up window.zE after each test
+    window.zE = mockZE
+  })
+
+  describe('setZendeskConversationFields', () => {
+    it('should call window.zE with correct arguments when not CE edition and zE exists', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { setZendeskConversationFields } = await import('../utils')
+
+      const fields = [
+        { id: 'field1', value: 'value1' },
+        { id: 'field2', value: 'value2' },
+      ]
+      const callback = vi.fn()
+
+      setZendeskConversationFields(fields, callback)
+
+      expect(window.zE).toHaveBeenCalledWith(
+        'messenger:set',
+        'conversationFields',
+        fields,
+        callback,
+      )
+    })
+
+    it('should not call window.zE when IS_CE_EDITION is true', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: true }))
+      const { setZendeskConversationFields } = await import('../utils')
+
+      const fields = [{ id: 'field1', value: 'value1' }]
+
+      setZendeskConversationFields(fields)
+
+      expect(window.zE).not.toHaveBeenCalled()
+    })
+
+    it('should work without callback', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { setZendeskConversationFields } = await import('../utils')
+
+      const fields = [{ id: 'field1', value: 'value1' }]
+
+      setZendeskConversationFields(fields)
+
+      expect(window.zE).toHaveBeenCalledWith(
+        'messenger:set',
+        'conversationFields',
+        fields,
+        undefined,
+      )
+    })
+  })
+
+  describe('setZendeskWidgetVisibility', () => {
+    it('should call window.zE to show widget when visible is true', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { setZendeskWidgetVisibility } = await import('../utils')
+
+      setZendeskWidgetVisibility(true)
+
+      expect(window.zE).toHaveBeenCalledWith('messenger', 'show')
+    })
+
+    it('should call window.zE to hide widget when visible is false', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { setZendeskWidgetVisibility } = await import('../utils')
+
+      setZendeskWidgetVisibility(false)
+
+      expect(window.zE).toHaveBeenCalledWith('messenger', 'hide')
+    })
+
+    it('should not call window.zE when IS_CE_EDITION is true', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: true }))
+      const { setZendeskWidgetVisibility } = await import('../utils')
+
+      setZendeskWidgetVisibility(true)
+
+      expect(window.zE).not.toHaveBeenCalled()
+    })
+  })
+
+  describe('toggleZendeskWindow', () => {
+    it('should call window.zE to open messenger when open is true', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { toggleZendeskWindow } = await import('../utils')
+
+      toggleZendeskWindow(true)
+
+      expect(window.zE).toHaveBeenCalledWith('messenger', 'open')
+    })
+
+    it('should call window.zE to close messenger when open is false', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: false }))
+      const { toggleZendeskWindow } = await import('../utils')
+
+      toggleZendeskWindow(false)
+
+      expect(window.zE).toHaveBeenCalledWith('messenger', 'close')
+    })
+
+    it('should not call window.zE when IS_CE_EDITION is true', async () => {
+      vi.doMock('@/config', () => ({ IS_CE_EDITION: true }))
+      const { toggleZendeskWindow } = await import('../utils')
+
+      toggleZendeskWindow(true)
+
+      expect(window.zE).not.toHaveBeenCalled()
+    })
+  })
+})

web/app/components/billing/pricing/__tests__/footer.spec.tsx

@@ -1,7 +1,7 @@
 import { render, screen } from '@testing-library/react'
 import * as React from 'react'
+import { CategoryEnum } from '..'
 import Footer from '../footer'
-import { CategoryEnum } from '../types'
 
 vi.mock('next/link', () => ({
   default: ({ children, href, className, target }: { children: React.ReactNode, href: string, className?: string, target?: string }) => (

web/app/components/billing/pricing/__tests__/header.spec.tsx

@@ -1,16 +1,7 @@
 import { fireEvent, render, screen } from '@testing-library/react'
 import * as React from 'react'
-import { Dialog } from '@/app/components/base/ui/dialog'
 import Header from '../header'
 
-function renderHeader(onClose: () => void) {
-  return render(
-    <Dialog open>
-      <Header onClose={onClose} />
-    </Dialog>,
-  )
-}
-
 describe('Header', () => {
   beforeEach(() => {
     vi.clearAllMocks()
@@ -20,7 +11,7 @@ describe('Header', () => {
     it('should render title and description translations', () => {
       const handleClose = vi.fn()
 
-      renderHeader(handleClose)
+      render(<Header onClose={handleClose} />)
 
       expect(screen.getByText('billing.plansCommon.title.plans')).toBeInTheDocument()
       expect(screen.getByText('billing.plansCommon.title.description')).toBeInTheDocument()
@@ -31,7 +22,7 @@ describe('Header', () => {
   describe('Props', () => {
     it('should invoke onClose when close button is clicked', () => {
       const handleClose = vi.fn()
-      renderHeader(handleClose)
+      render(<Header onClose={handleClose} />)
 
       fireEvent.click(screen.getByRole('button'))
 
@@ -41,7 +32,7 @@ describe('Header', () => {
 
   describe('Edge Cases', () => {
     it('should render structural elements with translation keys', () => {
-      const { container } = renderHeader(vi.fn())
+      const { container } = render(<Header onClose={vi.fn()} />)
 
       expect(container.querySelector('span')).toBeInTheDocument()
       expect(container.querySelector('p')).toBeInTheDocument()

web/app/components/billing/pricing/__tests__/index.spec.tsx

@@ -74,11 +74,15 @@ describe('Pricing', () => {
   })
 
   describe('Props', () => {
-    it('should allow switching categories', () => {
-      render(<Pricing onCancel={vi.fn()} />)
+    it('should allow switching categories and handle esc key', () => {
+      const handleCancel = vi.fn()
+      render(<Pricing onCancel={handleCancel} />)
 
       fireEvent.click(screen.getByText('billing.plansCommon.self'))
       expect(screen.queryByRole('switch')).not.toBeInTheDocument()
+
+      fireEvent.keyDown(window, { key: 'Escape', keyCode: 27 })
+      expect(handleCancel).toHaveBeenCalled()
     })
   })
 

web/app/components/billing/pricing/footer.tsx

@@ -1,9 +1,10 @@
-import type { Category } from './types'
+import type { Category } from '.'
+import { RiArrowRightUpLine } from '@remixicon/react'
 import Link from 'next/link'
 import * as React from 'react'
 import { useTranslation } from 'react-i18next'
 import { cn } from '@/utils/classnames'
-import { CategoryEnum } from './types'
+import { CategoryEnum } from '.'
 
 type FooterProps = {
   pricingPageURL: string
@@ -33,7 +34,7 @@ const Footer = ({
           >
             {t('plansCommon.comparePlanAndFeatures', { ns: 'billing' })}
           </Link>
-          <span aria-hidden="true" className="i-ri-arrow-right-up-line size-4" />
+          <RiArrowRightUpLine className="size-4" />
         </span>
       </div>
     </div>

web/app/components/billing/pricing/header.tsx

@@ -1,6 +1,6 @@
+import { RiCloseLine } from '@remixicon/react'
 import * as React from 'react'
 import { useTranslation } from 'react-i18next'
-import { DialogDescription, DialogTitle } from '@/app/components/base/ui/dialog'
 import Button from '../../base/button'
 import DifyLogo from '../../base/logo/dify-logo'
 
@@ -20,19 +20,19 @@ const Header = ({
           <div className="py-[5px]">
             <DifyLogo className="h-[27px] w-[60px]" />
           </div>
-          <DialogTitle className="m-0 bg-billing-plan-title-bg bg-clip-text px-1.5 font-instrument text-[37px] italic leading-[1.2] text-transparent">
+          <span className="bg-billing-plan-title-bg bg-clip-text px-1.5 font-instrument text-[37px] italic leading-[1.2] text-transparent">
             {t('plansCommon.title.plans', { ns: 'billing' })}
-          </DialogTitle>
+          </span>
         </div>
-        <DialogDescription className="m-0 text-text-tertiary system-sm-regular">
+        <p className="system-sm-regular text-text-tertiary">
           {t('plansCommon.title.description', { ns: 'billing' })}
-        </DialogDescription>
+        </p>
         <Button
           variant="secondary"
           className="absolute bottom-[40.5px] right-[-18px] z-10 size-9 rounded-full p-2"
           onClick={onClose}
         >
-          <span aria-hidden="true" className="i-ri-close-line size-5" />
+          <RiCloseLine className="size-5" />
         </Button>
       </div>
     </div>

web/app/components/billing/pricing/index.tsx

@@ -1,9 +1,9 @@
 'use client'
 import type { FC } from 'react'
-import type { Category } from './types'
+import { useKeyPress } from 'ahooks'
 import * as React from 'react'
 import { useState } from 'react'
-import { Dialog, DialogContent } from '@/app/components/base/ui/dialog'
+import { createPortal } from 'react-dom'
 import { useAppContext } from '@/context/app-context'
 import { useGetPricingPageLanguage } from '@/context/i18n'
 import { useProviderContext } from '@/context/provider-context'
@@ -13,7 +13,13 @@ import Header from './header'
 import PlanSwitcher from './plan-switcher'
 import { PlanRange } from './plan-switcher/plan-range-switcher'
 import Plans from './plans'
-import { CategoryEnum } from './types'
+
+export enum CategoryEnum {
+  CLOUD = 'cloud',
+  SELF = 'self',
+}
+
+export type Category = CategoryEnum.CLOUD | CategoryEnum.SELF
 
 type PricingProps = {
   onCancel: () => void
@@ -27,47 +33,42 @@ const Pricing: FC<PricingProps> = ({
   const [planRange, setPlanRange] = React.useState<PlanRange>(PlanRange.monthly)
   const [currentCategory, setCurrentCategory] = useState<Category>(CategoryEnum.CLOUD)
   const canPay = isCurrentWorkspaceManager
+  useKeyPress(['esc'], onCancel)
 
   const pricingPageLanguage = useGetPricingPageLanguage()
   const pricingPageURL = pricingPageLanguage
     ? `https://dify.ai/${pricingPageLanguage}/pricing#plans-and-features`
     : 'https://dify.ai/pricing#plans-and-features'
 
-  return (
-    <Dialog
-      open
-      onOpenChange={(open) => {
-        if (!open)
-          onCancel()
-      }}
+  return createPortal(
+    <div
+      className="fixed inset-0 bottom-0 left-0 right-0 top-0 z-[1000] overflow-auto bg-saas-background"
+      onClick={e => e.stopPropagation()}
     >
-      <DialogContent
-        className="inset-0 h-full max-h-none w-full max-w-none translate-x-0 translate-y-0 overflow-auto rounded-none border-none bg-saas-background p-0 shadow-none"
-      >
-        <div className="relative grid min-h-full min-w-[1200px] grid-rows-[1fr_auto_auto_1fr] overflow-hidden">
-          <div className="absolute -top-12 left-0 right-0 -z-10">
-            <NoiseTop />
-          </div>
-          <Header onClose={onCancel} />
-          <PlanSwitcher
-            currentCategory={currentCategory}
-            onChangeCategory={setCurrentCategory}
-            currentPlanRange={planRange}
-            onChangePlanRange={setPlanRange}
-          />
-          <Plans
-            plan={plan}
-            currentPlan={currentCategory}
-            planRange={planRange}
-            canPay={canPay}
-          />
-          <Footer pricingPageURL={pricingPageURL} currentCategory={currentCategory} />
-          <div className="absolute -bottom-12 left-0 right-0 -z-10">
-            <NoiseBottom />
-          </div>
+      <div className="relative grid min-h-full min-w-[1200px] grid-rows-[1fr_auto_auto_1fr] overflow-hidden">
+        <div className="absolute -top-12 left-0 right-0 -z-10">
+          <NoiseTop />
         </div>
-      </DialogContent>
-    </Dialog>
+        <Header onClose={onCancel} />
+        <PlanSwitcher
+          currentCategory={currentCategory}
+          onChangeCategory={setCurrentCategory}
+          currentPlanRange={planRange}
+          onChangePlanRange={setPlanRange}
+        />
+        <Plans
+          plan={plan}
+          currentPlan={currentCategory}
+          planRange={planRange}
+          canPay={canPay}
+        />
+        <Footer pricingPageURL={pricingPageURL} currentCategory={currentCategory} />
+        <div className="absolute -bottom-12 left-0 right-0 -z-10">
+          <NoiseBottom />
+        </div>
+      </div>
+    </div>,
+    document.body,
   )
 }
 export default React.memo(Pricing)

web/app/components/billing/pricing/plan-switcher/__tests__/index.spec.tsx

@@ -1,6 +1,6 @@
 import { fireEvent, render, screen } from '@testing-library/react'
 import * as React from 'react'
-import { CategoryEnum } from '../../types'
+import { CategoryEnum } from '../../index'
 import PlanSwitcher from '../index'
 import { PlanRange } from '../plan-range-switcher'
 

web/app/components/billing/pricing/plan-switcher/index.tsx

@@ -1,5 +1,5 @@
 import type { FC } from 'react'
-import type { Category } from '../types'
+import type { Category } from '../index'
 import type { PlanRange } from './plan-range-switcher'
 import * as React from 'react'
 import { useTranslation } from 'react-i18next'

web/app/components/billing/pricing/types.ts

@@ -1,6 +0,0 @@
-export enum CategoryEnum {
-  CLOUD = 'cloud',
-  SELF = 'self',
-}
-
-export type Category = CategoryEnum.CLOUD | CategoryEnum.SELF

web/app/components/datasets/documents/detail/settings/__tests__/document-settings.spec.tsx

@@ -100,10 +100,10 @@ vi.mock('@/app/components/datasets/create/step-two', () => ({
 }))
 
 vi.mock('@/app/components/header/account-setting', () => ({
-  default: ({ activeTab, onCancelAction }: { activeTab?: string, onCancelAction?: () => void }) => (
+  default: ({ activeTab, onCancel }: { activeTab?: string, onCancel?: () => void }) => (
     <div data-testid="account-setting">
       <span data-testid="active-tab">{activeTab}</span>
-      <button onClick={onCancelAction} data-testid="close-setting">Close</button>
+      <button onClick={onCancel} data-testid="close-setting">Close</button>
     </div>
   ),
 }))

web/app/components/datasets/documents/detail/settings/document-settings.tsx

@@ -1,4 +1,3 @@
-import type { AccountSettingTab } from '@/app/components/header/account-setting/constants'
 import type { DataSourceProvider, NotionPage } from '@/models/common'
 import type {
   CrawlOptions,
@@ -20,7 +19,6 @@ import AppUnavailable from '@/app/components/base/app-unavailable'
 import Loading from '@/app/components/base/loading'
 import StepTwo from '@/app/components/datasets/create/step-two'
 import AccountSetting from '@/app/components/header/account-setting'
-import { ACCOUNT_SETTING_TAB } from '@/app/components/header/account-setting/constants'
 import { ModelTypeEnum } from '@/app/components/header/account-setting/model-provider-page/declarations'
 import { useDefaultModel } from '@/app/components/header/account-setting/model-provider-page/hooks'
 import DatasetDetailContext from '@/context/dataset-detail'
@@ -35,13 +33,8 @@ const DocumentSettings = ({ datasetId, documentId }: DocumentSettingsProps) => {
   const { t } = useTranslation()
   const router = useRouter()
   const [isShowSetAPIKey, { setTrue: showSetAPIKey, setFalse: hideSetAPIkey }] = useBoolean()
-  const [accountSettingTab, setAccountSettingTab] = React.useState<AccountSettingTab>(ACCOUNT_SETTING_TAB.PROVIDER)
   const { indexingTechnique, dataset } = useContext(DatasetDetailContext)
   const { data: embeddingsDefaultModel } = useDefaultModel(ModelTypeEnum.textEmbedding)
-  const handleOpenAccountSetting = React.useCallback(() => {
-    setAccountSettingTab(ACCOUNT_SETTING_TAB.PROVIDER)
-    showSetAPIKey()
-  }, [showSetAPIKey])
 
   const invalidDocumentList = useInvalidDocumentList(datasetId)
   const invalidDocumentDetail = useInvalidDocumentDetail()
@@ -142,7 +135,7 @@ const DocumentSettings = ({ datasetId, documentId }: DocumentSettingsProps) => {
         {dataset && documentDetail && (
           <StepTwo
             isAPIKeySet={!!embeddingsDefaultModel}
-            onSetting={handleOpenAccountSetting}
+            onSetting={showSetAPIKey}
             datasetId={datasetId}
             dataSourceType={documentDetail.data_source_type as DataSourceType}
             notionPages={currentPage ? [currentPage as unknown as NotionPage] : []}
@@ -162,9 +155,8 @@ const DocumentSettings = ({ datasetId, documentId }: DocumentSettingsProps) => {
       </div>
       {isShowSetAPIKey && (
         <AccountSetting
-          activeTab={accountSettingTab}
-          onTabChangeAction={setAccountSettingTab}
-          onCancelAction={async () => {
+          activeTab="provider"
+          onCancel={async () => {
             hideSetAPIkey()
           }}
         />

web/app/components/header/account-dropdown/support.spec.tsx

@@ -191,7 +191,7 @@ describe('Support', () => {
 
       // Assert
       expect(screen.queryByText('common.userProfile.emailSupport')).toBeInTheDocument()
-      expect(screen.getByText('common.userProfile.emailSupport')?.closest('a')?.getAttribute('href')).toMatch(new RegExp(`^mailto:${mockSupportEmailKey.value}`))
+      expect(screen.getByText('common.userProfile.emailSupport')?.closest('a')?.getAttribute('href')?.startsWith(`mailto:${mockSupportEmailKey.value}`)).toBe(true)
     })
   })
 

web/app/components/header/account-setting/index.spec.tsx

@@ -1,16 +1,12 @@
-import type { AccountSettingTab } from './constants'
 import type { AppContextValue } from '@/context/app-context'
 import { QueryClient, QueryClientProvider } from '@tanstack/react-query'
 import { fireEvent, render, screen } from '@testing-library/react'
-import { useState } from 'react'
 import { useAppContext } from '@/context/app-context'
 import { baseProviderContextValue, useProviderContext } from '@/context/provider-context'
 import useBreakpoints, { MediaType } from '@/hooks/use-breakpoints'
 import { ACCOUNT_SETTING_TAB } from './constants'
 import AccountSetting from './index'
 
-const mockResetModelProviderListExpanded = vi.fn()
-
 vi.mock('@/context/provider-context', async (importOriginal) => {
   const actual = await importOriginal<typeof import('@/context/provider-context')>()
   return {
@@ -51,15 +47,10 @@ vi.mock('@/app/components/header/account-setting/model-provider-page/hooks', ()
   useDefaultModel: vi.fn(() => ({ data: null, isLoading: false })),
   useUpdateDefaultModel: vi.fn(() => ({ trigger: vi.fn() })),
   useUpdateModelList: vi.fn(() => vi.fn()),
-  useInvalidateDefaultModel: vi.fn(() => vi.fn()),
   useModelList: vi.fn(() => ({ data: [], isLoading: false })),
   useSystemDefaultModelAndModelList: vi.fn(() => [null, vi.fn()]),
 }))
 
-vi.mock('@/app/components/header/account-setting/model-provider-page/atoms', () => ({
-  useResetModelProviderListExpanded: () => mockResetModelProviderListExpanded,
-}))
-
 vi.mock('@/service/use-datasource', () => ({
   useGetDataSourceListAuth: vi.fn(() => ({ data: { result: [] } })),
 }))
@@ -114,38 +105,6 @@ const baseAppContextValue: AppContextValue = {
 describe('AccountSetting', () => {
   const mockOnCancel = vi.fn()
   const mockOnTabChange = vi.fn()
-  const renderAccountSetting = (props?: {
-    initialTab?: AccountSettingTab
-    onCancel?: () => void
-    onTabChange?: (tab: AccountSettingTab) => void
-  }) => {
-    const {
-      initialTab = ACCOUNT_SETTING_TAB.MEMBERS,
-      onCancel = mockOnCancel,
-      onTabChange = mockOnTabChange,
-    } = props ?? {}
-
-    const StatefulAccountSetting = () => {
-      const [activeTab, setActiveTab] = useState<AccountSettingTab>(initialTab)
-
-      return (
-        <AccountSetting
-          onCancelAction={onCancel}
-          activeTab={activeTab}
-          onTabChangeAction={(tab) => {
-            setActiveTab(tab)
-            onTabChange(tab)
-          }}
-        />
-      )
-    }
-
-    return render(
-      <QueryClientProvider client={new QueryClient()}>
-        <StatefulAccountSetting />
-      </QueryClientProvider>,
-    )
-  }
 
   beforeEach(() => {
     vi.clearAllMocks()
@@ -161,7 +120,11 @@ describe('AccountSetting', () => {
   describe('Rendering', () => {
     it('should render the sidebar with correct menu items', () => {
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
 
       // Assert
       expect(screen.getByText('common.userProfile.settings')).toBeInTheDocument()
@@ -174,9 +137,13 @@ describe('AccountSetting', () => {
       expect(screen.getAllByText('common.settings.language').length).toBeGreaterThan(0)
     })
 
-    it('should respect the initial tab', () => {
+    it('should respect the activeTab prop', () => {
       // Act
-      renderAccountSetting({ initialTab: ACCOUNT_SETTING_TAB.DATA_SOURCE })
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} activeTab={ACCOUNT_SETTING_TAB.DATA_SOURCE} />
+        </QueryClientProvider>,
+      )
 
       // Assert
       // Check that the active item title is Data Source
@@ -190,7 +157,11 @@ describe('AccountSetting', () => {
       vi.mocked(useBreakpoints).mockReturnValue(MediaType.mobile)
 
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
 
       // Assert
       // On mobile, the labels should not be rendered as per the implementation
@@ -205,7 +176,11 @@ describe('AccountSetting', () => {
       })
 
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
 
       // Assert
       expect(screen.queryByText('common.settings.provider')).not.toBeInTheDocument()
@@ -222,7 +197,11 @@ describe('AccountSetting', () => {
       })
 
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
 
       // Assert
       expect(screen.queryByText('common.settings.billing')).not.toBeInTheDocument()
@@ -233,7 +212,11 @@ describe('AccountSetting', () => {
   describe('Tab Navigation', () => {
     it('should change active tab when clicking on menu item', () => {
       // Arrange
-      renderAccountSetting({ onTabChange: mockOnTabChange })
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} onTabChange={mockOnTabChange} />
+        </QueryClientProvider>,
+      )
 
       // Act
       fireEvent.click(screen.getByText('common.settings.provider'))
@@ -246,7 +229,11 @@ describe('AccountSetting', () => {
 
     it('should navigate through various tabs and show correct details', () => {
       // Act & Assert
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
 
       // Billing
       fireEvent.click(screen.getByText('common.settings.billing'))
@@ -280,11 +267,13 @@ describe('AccountSetting', () => {
   describe('Interactions', () => {
     it('should call onCancel when clicking close button', () => {
       // Act
-      renderAccountSetting()
-      const closeIcon = document.querySelector('.i-ri-close-line')
-      const closeButton = closeIcon?.closest('button')
-      expect(closeButton).not.toBeNull()
-      fireEvent.click(closeButton!)
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
+      const buttons = screen.getAllByRole('button')
+      fireEvent.click(buttons[0])
 
       // Assert
       expect(mockOnCancel).toHaveBeenCalled()
@@ -292,7 +281,11 @@ describe('AccountSetting', () => {
 
     it('should call onCancel when pressing Escape key', () => {
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
       fireEvent.keyDown(document, { key: 'Escape' })
 
       // Assert
@@ -301,7 +294,12 @@ describe('AccountSetting', () => {
 
     it('should update search value in provider tab', () => {
       // Arrange
-      renderAccountSetting({ initialTab: ACCOUNT_SETTING_TAB.PROVIDER })
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
+      fireEvent.click(screen.getByText('common.settings.provider'))
 
       // Act
       const input = screen.getByRole('textbox')
@@ -314,7 +312,11 @@ describe('AccountSetting', () => {
 
     it('should handle scroll event in panel', () => {
       // Act
-      renderAccountSetting()
+      render(
+        <QueryClientProvider client={new QueryClient()}>
+          <AccountSetting onCancel={mockOnCancel} />
+        </QueryClientProvider>,
+      )
       const scrollContainer = screen.getByRole('dialog').querySelector('.overflow-y-auto')
 
       // Assert

web/app/components/header/account-setting/index.tsx

@@ -1,6 +1,6 @@
 'use client'
 import type { AccountSettingTab } from '@/app/components/header/account-setting/constants'
-import { useCallback, useEffect, useRef, useState } from 'react'
+import { useEffect, useRef, useState } from 'react'
 import { useTranslation } from 'react-i18next'
 import SearchInput from '@/app/components/base/search-input'
 import BillingPage from '@/app/components/billing/billing-page'
@@ -20,16 +20,15 @@ import DataSourcePage from './data-source-page-new'
 import LanguagePage from './language-page'
 import MembersPage from './members-page'
 import ModelProviderPage from './model-provider-page'
-import { useResetModelProviderListExpanded } from './model-provider-page/atoms'
 
 const iconClassName = `
   w-5 h-5 mr-2
 `
 
 type IAccountSettingProps = {
-  onCancelAction: () => void
-  activeTab: AccountSettingTab
-  onTabChangeAction: (tab: AccountSettingTab) => void
+  onCancel: () => void
+  activeTab?: AccountSettingTab
+  onTabChange?: (tab: AccountSettingTab) => void
 }
 
 type GroupItem = {
@@ -41,12 +40,14 @@ type GroupItem = {
 }
 
 export default function AccountSetting({
-  onCancelAction,
-  activeTab,
-  onTabChangeAction,
+  onCancel,
+  activeTab = ACCOUNT_SETTING_TAB.MEMBERS,
+  onTabChange,
 }: IAccountSettingProps) {
-  const resetModelProviderListExpanded = useResetModelProviderListExpanded()
-  const activeMenu = activeTab
+  const [activeMenu, setActiveMenu] = useState<AccountSettingTab>(activeTab)
+  useEffect(() => {
+    setActiveMenu(activeTab)
+  }, [activeTab])
   const { t } = useTranslation()
   const { enableBilling, enableReplaceWebAppLogo } = useProviderContext()
   const { isCurrentWorkspaceDatasetOperator } = useAppContext()
@@ -147,22 +148,10 @@ export default function AccountSetting({
 
   const [searchValue, setSearchValue] = useState<string>('')
 
-  const handleTabChange = useCallback((tab: AccountSettingTab) => {
-    if (tab === ACCOUNT_SETTING_TAB.PROVIDER)
-      resetModelProviderListExpanded()
-
-    onTabChangeAction(tab)
-  }, [onTabChangeAction, resetModelProviderListExpanded])
-
-  const handleClose = useCallback(() => {
-    resetModelProviderListExpanded()
-    onCancelAction()
-  }, [onCancelAction, resetModelProviderListExpanded])
-
   return (
     <MenuDialog
       show
-      onClose={handleClose}
+      onClose={onCancel}
     >
       <div className="mx-auto flex h-[100vh] max-w-[1048px]">
         <div className="flex w-[44px] flex-col border-r border-divider-burn pl-4 pr-6 sm:w-[224px]">
@@ -177,22 +166,21 @@ export default function AccountSetting({
                   <div>
                     {
                       menuItem.items.map(item => (
-                        <button
-                          type="button"
+                        <div
                           key={item.key}
                           className={cn(
-                            'mb-0.5 flex h-[37px] w-full items-center rounded-lg p-1 pl-3 text-left text-sm',
+                            'mb-0.5 flex h-[37px] cursor-pointer items-center rounded-lg p-1 pl-3 text-sm',
                             activeMenu === item.key ? 'bg-state-base-active text-components-menu-item-text-active system-sm-semibold' : 'text-components-menu-item-text system-sm-medium',
                           )}
-                          aria-label={item.name}
                           title={item.name}
                           onClick={() => {
-                            handleTabChange(item.key)
+                            setActiveMenu(item.key)
+                            onTabChange?.(item.key)
                           }}
                         >
                           {activeMenu === item.key ? item.activeIcon : item.icon}
                           {!isMobile && <div className="truncate">{item.name}</div>}
-                        </button>
+                        </div>
                       ))
                     }
                   </div>
@@ -207,8 +195,7 @@ export default function AccountSetting({
               variant="tertiary"
               size="large"
               className="px-2"
-              aria-label={t('operation.close', { ns: 'common' })}
-              onClick={handleClose}
+              onClick={onCancel}
             >
               <span className="i-ri-close-line h-5 w-5" />
             </Button>

web/app/components/header/account-setting/menu-dialog.spec.tsx

@@ -40,7 +40,8 @@ describe('MenuDialog', () => {
       )
 
       // Assert
-      expect(screen.getByRole('dialog')).toHaveClass('custom-class')
+      const panel = screen.getByRole('dialog').querySelector('.custom-class')
+      expect(panel).toBeInTheDocument()
     })
   })
 

web/app/components/header/account-setting/menu-dialog.tsx

@@ -1,6 +1,7 @@
 import type { ReactNode } from 'react'
-import { useCallback } from 'react'
-import { Dialog, DialogContent } from '@/app/components/base/ui/dialog'
+import { Dialog, DialogPanel, Transition, TransitionChild } from '@headlessui/react'
+import { noop } from 'es-toolkit/function'
+import { Fragment, useCallback, useEffect } from 'react'
 import { cn } from '@/utils/classnames'
 
 type DialogProps = {
@@ -18,25 +19,42 @@ const MenuDialog = ({
 }: DialogProps) => {
   const close = useCallback(() => onClose?.(), [onClose])
 
+  useEffect(() => {
+    const handleKeyDown = (event: KeyboardEvent) => {
+      if (event.key === 'Escape') {
+        event.preventDefault()
+        close()
+      }
+    }
+
+    document.addEventListener('keydown', handleKeyDown)
+    return () => {
+      document.removeEventListener('keydown', handleKeyDown)
+    }
+  }, [close])
+
   return (
-    <Dialog
-      open={show}
-      onOpenChange={(open) => {
-        if (!open)
-          close()
-      }}
-    >
-      <DialogContent
-        overlayClassName="bg-transparent"
-        className={cn(
-          'left-0 top-0 h-full max-h-none w-full max-w-none translate-x-0 translate-y-0 overflow-hidden rounded-none border-none bg-background-sidenav-bg p-0 shadow-none backdrop-blur-md',
-          className,
-        )}
-      >
-        <div className="absolute right-0 top-0 h-full w-1/2 bg-components-panel-bg" />
-        {children}
-      </DialogContent>
-    </Dialog>
+    <Transition appear show={show} as={Fragment}>
+      <Dialog as="div" className="relative z-[60]" onClose={noop}>
+        <div className="fixed inset-0">
+          <div className="flex min-h-full flex-col items-center justify-center">
+            <TransitionChild>
+              <DialogPanel className={cn(
+                'relative h-full w-full grow overflow-hidden bg-background-sidenav-bg p-0 text-left align-middle backdrop-blur-md transition-all',
+                'duration-300 ease-in data-[closed]:scale-95 data-[closed]:opacity-0',
+                'data-[enter]:scale-100 data-[enter]:opacity-100',
+                'data-[enter]:scale-95 data-[leave]:opacity-0',
+                className,
+              )}
+              >
+                <div className="absolute right-0 top-0 h-full w-1/2 bg-components-panel-bg" />
+                {children}
+              </DialogPanel>
+            </TransitionChild>
+          </div>
+        </div>
+      </Dialog>
+    </Transition>
   )
 }
 

web/app/components/header/account-setting/model-provider-page/atoms.spec.tsx

@@ -1,399 +0,0 @@
-import type { ReactNode } from 'react'
-import { act, renderHook } from '@testing-library/react'
-import { Provider } from 'jotai'
-import { beforeEach, describe, expect, it } from 'vitest'
-import {
-  useExpandModelProviderList,
-  useModelProviderListExpanded,
-  useResetModelProviderListExpanded,
-  useSetModelProviderListExpanded,
-} from './atoms'
-
-const createWrapper = () => {
-  return ({ children }: { children: ReactNode }) => (
-    <Provider>{children}</Provider>
-  )
-}
-
-describe('atoms', () => {
-  let wrapper: ReturnType<typeof createWrapper>
-
-  beforeEach(() => {
-    wrapper = createWrapper()
-  })
-
-  // Read hook: returns whether a specific provider is expanded
-  describe('useModelProviderListExpanded', () => {
-    it('should return false when provider has not been expanded', () => {
-      const { result } = renderHook(
-        () => useModelProviderListExpanded('openai'),
-        { wrapper },
-      )
-
-      expect(result.current).toBe(false)
-    })
-
-    it('should return false for any unknown provider name', () => {
-      const { result } = renderHook(
-        () => useModelProviderListExpanded('nonexistent-provider'),
-        { wrapper },
-      )
-
-      expect(result.current).toBe(false)
-    })
-
-    it('should return true when provider has been expanded via setter', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          setExpanded: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setExpanded(true)
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-  })
-
-  // Setter hook: toggles expanded state for a specific provider
-  describe('useSetModelProviderListExpanded', () => {
-    it('should expand a provider when called with true', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('anthropic'),
-          setExpanded: useSetModelProviderListExpanded('anthropic'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setExpanded(true)
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-
-    it('should collapse a provider when called with false', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('anthropic'),
-          setExpanded: useSetModelProviderListExpanded('anthropic'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setExpanded(true)
-      })
-      act(() => {
-        result.current.setExpanded(false)
-      })
-
-      expect(result.current.expanded).toBe(false)
-    })
-
-    it('should not affect other providers when setting one', () => {
-      const { result } = renderHook(
-        () => ({
-          openaiExpanded: useModelProviderListExpanded('openai'),
-          anthropicExpanded: useModelProviderListExpanded('anthropic'),
-          setOpenai: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setOpenai(true)
-      })
-
-      expect(result.current.openaiExpanded).toBe(true)
-      expect(result.current.anthropicExpanded).toBe(false)
-    })
-  })
-
-  // Expand hook: expands any provider by name
-  describe('useExpandModelProviderList', () => {
-    it('should expand the specified provider', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('google'),
-          expand: useExpandModelProviderList(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('google')
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-
-    it('should expand multiple providers independently', () => {
-      const { result } = renderHook(
-        () => ({
-          openaiExpanded: useModelProviderListExpanded('openai'),
-          anthropicExpanded: useModelProviderListExpanded('anthropic'),
-          expand: useExpandModelProviderList(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('openai')
-      })
-      act(() => {
-        result.current.expand('anthropic')
-      })
-
-      expect(result.current.openaiExpanded).toBe(true)
-      expect(result.current.anthropicExpanded).toBe(true)
-    })
-
-    it('should not collapse already expanded providers when expanding another', () => {
-      const { result } = renderHook(
-        () => ({
-          openaiExpanded: useModelProviderListExpanded('openai'),
-          anthropicExpanded: useModelProviderListExpanded('anthropic'),
-          expand: useExpandModelProviderList(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('openai')
-      })
-      act(() => {
-        result.current.expand('anthropic')
-      })
-
-      expect(result.current.openaiExpanded).toBe(true)
-    })
-  })
-
-  // Reset hook: clears all expanded state back to empty
-  describe('useResetModelProviderListExpanded', () => {
-    it('should reset all expanded providers to false', () => {
-      const { result } = renderHook(
-        () => ({
-          openaiExpanded: useModelProviderListExpanded('openai'),
-          anthropicExpanded: useModelProviderListExpanded('anthropic'),
-          expand: useExpandModelProviderList(),
-          reset: useResetModelProviderListExpanded(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('openai')
-      })
-      act(() => {
-        result.current.expand('anthropic')
-      })
-      act(() => {
-        result.current.reset()
-      })
-
-      expect(result.current.openaiExpanded).toBe(false)
-      expect(result.current.anthropicExpanded).toBe(false)
-    })
-
-    it('should be safe to call when no providers are expanded', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          reset: useResetModelProviderListExpanded(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.reset()
-      })
-
-      expect(result.current.expanded).toBe(false)
-    })
-
-    it('should allow re-expanding providers after reset', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          expand: useExpandModelProviderList(),
-          reset: useResetModelProviderListExpanded(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('openai')
-      })
-      act(() => {
-        result.current.reset()
-      })
-      act(() => {
-        result.current.expand('openai')
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-  })
-
-  // Cross-hook interaction: verify hooks cooperate through the shared atom
-  describe('Cross-hook interaction', () => {
-    it('should reflect state set by useSetModelProviderListExpanded in useModelProviderListExpanded', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          setExpanded: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setExpanded(true)
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-
-    it('should reflect state set by useExpandModelProviderList in useModelProviderListExpanded', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('anthropic'),
-          expand: useExpandModelProviderList(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('anthropic')
-      })
-
-      expect(result.current.expanded).toBe(true)
-    })
-
-    it('should allow useSetModelProviderListExpanded to collapse a provider expanded by useExpandModelProviderList', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          expand: useExpandModelProviderList(),
-          setExpanded: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.expand('openai')
-      })
-      expect(result.current.expanded).toBe(true)
-
-      act(() => {
-        result.current.setExpanded(false)
-      })
-      expect(result.current.expanded).toBe(false)
-    })
-
-    it('should reset state set by useSetModelProviderListExpanded via useResetModelProviderListExpanded', () => {
-      const { result } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          setExpanded: useSetModelProviderListExpanded('openai'),
-          reset: useResetModelProviderListExpanded(),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setExpanded(true)
-      })
-      act(() => {
-        result.current.reset()
-      })
-
-      expect(result.current.expanded).toBe(false)
-    })
-  })
-
-  // selectAtom granularity: changing one provider should not affect unrelated reads
-  describe('selectAtom granularity', () => {
-    it('should not cause unrelated provider reads to change when one provider is toggled', () => {
-      const { result } = renderHook(
-        () => ({
-          openai: useModelProviderListExpanded('openai'),
-          anthropic: useModelProviderListExpanded('anthropic'),
-          google: useModelProviderListExpanded('google'),
-          setOpenai: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper },
-      )
-
-      const anthropicBefore = result.current.anthropic
-      const googleBefore = result.current.google
-
-      act(() => {
-        result.current.setOpenai(true)
-      })
-
-      expect(result.current.openai).toBe(true)
-      expect(result.current.anthropic).toBe(anthropicBefore)
-      expect(result.current.google).toBe(googleBefore)
-    })
-
-    it('should keep individual provider states independent across multiple expansions and collapses', () => {
-      const { result } = renderHook(
-        () => ({
-          openai: useModelProviderListExpanded('openai'),
-          anthropic: useModelProviderListExpanded('anthropic'),
-          setOpenai: useSetModelProviderListExpanded('openai'),
-          setAnthropic: useSetModelProviderListExpanded('anthropic'),
-        }),
-        { wrapper },
-      )
-
-      act(() => {
-        result.current.setOpenai(true)
-      })
-      act(() => {
-        result.current.setAnthropic(true)
-      })
-      act(() => {
-        result.current.setOpenai(false)
-      })
-
-      expect(result.current.openai).toBe(false)
-      expect(result.current.anthropic).toBe(true)
-    })
-  })
-
-  // Isolation: separate Provider instances have independent state
-  describe('Provider isolation', () => {
-    it('should have independent state across different Provider instances', () => {
-      const wrapper1 = createWrapper()
-      const wrapper2 = createWrapper()
-
-      const { result: result1 } = renderHook(
-        () => ({
-          expanded: useModelProviderListExpanded('openai'),
-          setExpanded: useSetModelProviderListExpanded('openai'),
-        }),
-        { wrapper: wrapper1 },
-      )
-
-      const { result: result2 } = renderHook(
-        () => useModelProviderListExpanded('openai'),
-        { wrapper: wrapper2 },
-      )
-
-      act(() => {
-        result1.current.setExpanded(true)
-      })
-
-      expect(result1.current.expanded).toBe(true)
-      expect(result2.current).toBe(false)
-    })
-  })
-})

web/app/components/header/account-setting/model-provider-page/atoms.ts

@@ -1,35 +0,0 @@
-import { atom, useAtomValue, useSetAtom } from 'jotai'
-import { selectAtom } from 'jotai/utils'
-import { useCallback, useMemo } from 'react'
-
-const expandedAtom = atom<Record<string, boolean>>({})
-
-export function useModelProviderListExpanded(providerName: string) {
-  return useAtomValue(
-    useMemo(
-      () => selectAtom(expandedAtom, s => !!s[providerName]),
-      [providerName],
-    ),
-  )
-}
-
-export function useSetModelProviderListExpanded(providerName: string) {
-  const set = useSetAtom(expandedAtom)
-  return useCallback(
-    (expanded: boolean) => set(prev => ({ ...prev, [providerName]: expanded })),
-    [providerName, set],
-  )
-}
-
-export function useExpandModelProviderList() {
-  const set = useSetAtom(expandedAtom)
-  return useCallback(
-    (providerName: string) => set(prev => ({ ...prev, [providerName]: true })),
-    [set],
-  )
-}
-
-export function useResetModelProviderListExpanded() {
-  const set = useSetAtom(expandedAtom)
-  return useCallback(() => set({}), [set])
-}

web/app/components/header/account-setting/model-provider-page/hooks.spec.ts

@@ -9,7 +9,6 @@ import type {
 } from './declarations'
 import { act, renderHook, waitFor } from '@testing-library/react'
 import { useLocale } from '@/context/i18n'
-import { consoleQuery } from '@/service/client'
 import { fetchDefaultModal, fetchModelList, fetchModelProviderCredentials } from '@/service/common'
 import {
   ConfigurationMethodEnum,
@@ -24,7 +23,6 @@ import {
   useAnthropicBuyQuota,
   useCurrentProviderAndModel,
   useDefaultModel,
-  useInvalidateDefaultModel,
   useLanguage,
   useMarketplaceAllPlugins,
   useModelList,
@@ -38,6 +36,7 @@ import {
   useUpdateModelList,
   useUpdateModelProviders,
 } from './hooks'
+import { UPDATE_MODEL_PROVIDER_CUSTOM_MODEL_LIST } from './provider-added-card'
 
 // Mock dependencies
 vi.mock('@tanstack/react-query', () => ({
@@ -79,6 +78,14 @@ vi.mock('@/context/modal-context', () => ({
   }),
 }))
 
+vi.mock('@/context/event-emitter', () => ({
+  useEventEmitterContextContext: vi.fn(() => ({
+    eventEmitter: {
+      emit: vi.fn(),
+    },
+  })),
+}))
+
 vi.mock('@/app/components/plugins/marketplace/hooks', () => ({
   useMarketplacePlugins: vi.fn(() => ({
     plugins: [],
@@ -92,16 +99,12 @@ vi.mock('@/app/components/plugins/marketplace/hooks', () => ({
   })),
 }))
 
-vi.mock('./atoms', () => ({
-  useExpandModelProviderList: vi.fn(() => vi.fn()),
-}))
-
 const { useQuery, useQueryClient } = await import('@tanstack/react-query')
 const { getPayUrl } = await import('@/service/common')
 const { useProviderContext } = await import('@/context/provider-context')
 const { useModalContextSelector } = await import('@/context/modal-context')
+const { useEventEmitterContextContext } = await import('@/context/event-emitter')
 const { useMarketplacePlugins, useMarketplacePluginsByCollectionId } = await import('@/app/components/plugins/marketplace/hooks')
-const { useExpandModelProviderList } = await import('./atoms')
 
 describe('hooks', () => {
   beforeEach(() => {
@@ -861,38 +864,6 @@ describe('hooks', () => {
     })
   })
 
-  describe('useInvalidateDefaultModel', () => {
-    it('should invalidate default model queries', () => {
-      const invalidateQueries = vi.fn()
-        ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
-
-      const { result } = renderHook(() => useInvalidateDefaultModel())
-
-      act(() => {
-        result.current(ModelTypeEnum.textGeneration)
-      })
-
-      expect(invalidateQueries).toHaveBeenCalledWith({
-        queryKey: ['default-model', ModelTypeEnum.textGeneration],
-      })
-    })
-
-    it('should handle multiple model types', () => {
-      const invalidateQueries = vi.fn()
-        ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
-
-      const { result } = renderHook(() => useInvalidateDefaultModel())
-
-      act(() => {
-        result.current(ModelTypeEnum.textGeneration)
-        result.current(ModelTypeEnum.textEmbedding)
-        result.current(ModelTypeEnum.rerank)
-      })
-
-      expect(invalidateQueries).toHaveBeenCalledTimes(3)
-    })
-  })
-
   describe('useAnthropicBuyQuota', () => {
     beforeEach(() => {
       Object.defineProperty(window, 'location', {
@@ -1196,52 +1167,39 @@ describe('hooks', () => {
 
     it('should refresh providers and model lists', () => {
       const invalidateQueries = vi.fn()
+      const emit = vi.fn()
 
         ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
+      ; (useEventEmitterContextContext as Mock).mockReturnValue({
+        eventEmitter: { emit },
+      })
 
       const provider = createMockProvider()
-      const modelProviderModelListQueryKey = consoleQuery.modelProviders.models.queryKey({
-        input: {
-          params: {
-            provider: provider.provider,
-          },
-        },
-      })
       const { result } = renderHook(() => useRefreshModel())
 
       act(() => {
         result.current.handleRefreshModel(provider)
       })
 
-      expect(invalidateQueries).toHaveBeenCalledWith({
-        queryKey: modelProviderModelListQueryKey,
-        exact: true,
-        refetchType: 'none',
-      })
       expect(invalidateQueries).toHaveBeenCalledWith({ queryKey: ['model-providers'] })
       expect(invalidateQueries).toHaveBeenCalledWith({ queryKey: ['model-list', ModelTypeEnum.textGeneration] })
       expect(invalidateQueries).toHaveBeenCalledWith({ queryKey: ['model-list', ModelTypeEnum.textEmbedding] })
     })
 
-    it('should expand target provider list when refreshModelList is true and custom config is active', () => {
+    it('should emit event when refreshModelList is true and custom config is active', () => {
       const invalidateQueries = vi.fn()
-      const expandModelProviderList = vi.fn()
+      const emit = vi.fn()
 
         ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
-      ; (useExpandModelProviderList as Mock).mockReturnValue(expandModelProviderList)
+      ; (useEventEmitterContextContext as Mock).mockReturnValue({
+        eventEmitter: { emit },
+      })
 
       const provider = createMockProvider()
       const customFields: CustomConfigurationModelFixedFields = {
         __model_name: 'gpt-4',
         __model_type: ModelTypeEnum.textGeneration,
       }
-      const modelProviderModelListQueryKey = consoleQuery.modelProviders.models.queryKey({
-        input: {
-          params: {
-            provider: provider.provider,
-          },
-        },
-      })
 
       const { result } = renderHook(() => useRefreshModel())
 
@@ -1249,30 +1207,23 @@ describe('hooks', () => {
         result.current.handleRefreshModel(provider, customFields, true)
       })
 
-      expect(expandModelProviderList).toHaveBeenCalledWith('openai')
-      expect(invalidateQueries).toHaveBeenCalledWith({
-        queryKey: modelProviderModelListQueryKey,
-        exact: true,
-        refetchType: 'active',
+      expect(emit).toHaveBeenCalledWith({
+        type: UPDATE_MODEL_PROVIDER_CUSTOM_MODEL_LIST,
+        payload: 'openai',
       })
       expect(invalidateQueries).toHaveBeenCalledWith({ queryKey: ['model-list', ModelTypeEnum.textGeneration] })
     })
 
-    it('should not expand provider list when custom config is not active', () => {
+    it('should not emit event when custom config is not active', () => {
       const invalidateQueries = vi.fn()
-      const expandModelProviderList = vi.fn()
+      const emit = vi.fn()
 
         ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
-      ; (useExpandModelProviderList as Mock).mockReturnValue(expandModelProviderList)
+      ; (useEventEmitterContextContext as Mock).mockReturnValue({
+        eventEmitter: { emit },
+      })
 
       const provider = { ...createMockProvider(), custom_configuration: { status: CustomConfigurationStatusEnum.noConfigure } }
-      const modelProviderModelListQueryKey = consoleQuery.modelProviders.models.queryKey({
-        input: {
-          params: {
-            provider: provider.provider,
-          },
-        },
-      })
 
       const { result } = renderHook(() => useRefreshModel())
 
@@ -1280,43 +1231,16 @@ describe('hooks', () => {
         result.current.handleRefreshModel(provider, undefined, true)
       })
 
-      expect(expandModelProviderList).not.toHaveBeenCalled()
-      expect(invalidateQueries).not.toHaveBeenCalledWith({
-        queryKey: modelProviderModelListQueryKey,
-        exact: true,
-        refetchType: 'active',
-      })
-    })
-
-    it('should refetch active model provider list when custom refresh callback is absent', () => {
-      const invalidateQueries = vi.fn()
-      ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
-
-      const provider = createMockProvider()
-      const modelProviderModelListQueryKey = consoleQuery.modelProviders.models.queryKey({
-        input: {
-          params: {
-            provider: provider.provider,
-          },
-        },
-      })
-      const { result } = renderHook(() => useRefreshModel())
-
-      act(() => {
-        result.current.handleRefreshModel(provider, undefined, true)
-      })
-
-      expect(invalidateQueries).toHaveBeenCalledWith({
-        queryKey: modelProviderModelListQueryKey,
-        exact: true,
-        refetchType: 'active',
-      })
+      expect(emit).not.toHaveBeenCalled()
     })
 
     it('should handle provider with single model type', () => {
       const invalidateQueries = vi.fn()
 
         ; (useQueryClient as Mock).mockReturnValue({ invalidateQueries })
+      ; (useEventEmitterContextContext as Mock).mockReturnValue({
+        eventEmitter: { emit: vi.fn() },
+      })
 
       const provider = {
         ...createMockProvider(),

web/app/components/header/account-setting/model-provider-page/hooks.ts

@@ -21,10 +21,10 @@ import {
   useMarketplacePluginsByCollectionId,
 } from '@/app/components/plugins/marketplace/hooks'
 import { PluginCategoryEnum } from '@/app/components/plugins/types'
+import { useEventEmitterContextContext } from '@/context/event-emitter'
 import { useLocale } from '@/context/i18n'
 import { useModalContextSelector } from '@/context/modal-context'
 import { useProviderContext } from '@/context/provider-context'
-import { consoleQuery } from '@/service/client'
 import {
   fetchDefaultModal,
   fetchModelList,
@@ -32,12 +32,12 @@ import {
   getPayUrl,
 } from '@/service/common'
 import { commonQueryKeys } from '@/service/use-common'
-import { useExpandModelProviderList } from './atoms'
 import {
   ConfigurationMethodEnum,
   CustomConfigurationStatusEnum,
   ModelStatusEnum,
 } from './declarations'
+import { UPDATE_MODEL_PROVIDER_CUSTOM_MODEL_LIST } from './provider-added-card'
 
 type UseDefaultModelAndModelList = (
   defaultModel: DefaultModelResponse | undefined,
@@ -57,21 +57,15 @@ export const useSystemDefaultModelAndModelList: UseDefaultModelAndModelList = (
 
     return currentDefaultModel
   }, [defaultModel, modelList])
-  const currentDefaultModelKey = currentDefaultModel
-    ? `${currentDefaultModel.provider}:${currentDefaultModel.model}`
-    : ''
   const [defaultModelState, setDefaultModelState] = useState<DefaultModel | undefined>(currentDefaultModel)
-  const [defaultModelSourceKey, setDefaultModelSourceKey] = useState(currentDefaultModelKey)
-  const selectedDefaultModel = defaultModelSourceKey === currentDefaultModelKey
-    ? defaultModelState
-    : currentDefaultModel
-
   const handleDefaultModelChange = useCallback((model: DefaultModel) => {
-    setDefaultModelSourceKey(currentDefaultModelKey)
     setDefaultModelState(model)
-  }, [currentDefaultModelKey])
+  }, [])
+  useEffect(() => {
+    setDefaultModelState(currentDefaultModel)
+  }, [currentDefaultModel])
 
-  return [selectedDefaultModel, handleDefaultModelChange]
+  return [defaultModelState, handleDefaultModelChange]
 }
 
 export const useLanguage = () => {
@@ -122,7 +116,7 @@ export const useProviderCredentialsAndLoadBalancing = (
     predefinedFormSchemasValue?.credentials,
   ])
 
-  const mutate = useCallback(() => {
+  const mutate = useMemo(() => () => {
     if (predefinedEnabled)
       queryClient.invalidateQueries({ queryKey: ['model-providers', 'credentials', provider, credentialId] })
     if (customEnabled)
@@ -228,14 +222,6 @@ export const useUpdateModelList = () => {
   return updateModelList
 }
 
-export const useInvalidateDefaultModel = () => {
-  const queryClient = useQueryClient()
-
-  return useCallback((type: ModelTypeEnum) => {
-    queryClient.invalidateQueries({ queryKey: commonQueryKeys.defaultModel(type) })
-  }, [queryClient])
-}
-
 export const useAnthropicBuyQuota = () => {
   const [loading, setLoading] = useState(false)
 
@@ -328,8 +314,7 @@ export const useMarketplaceAllPlugins = (providers: ModelProvider[], searchText:
 }
 
 export const useRefreshModel = () => {
-  const expandModelProviderList = useExpandModelProviderList()
-  const queryClient = useQueryClient()
+  const { eventEmitter } = useEventEmitterContextContext()
   const updateModelProviders = useUpdateModelProviders()
   const updateModelList = useUpdateModelList()
   const handleRefreshModel = useCallback((
@@ -337,19 +322,6 @@ export const useRefreshModel = () => {
     CustomConfigurationModelFixedFields?: CustomConfigurationModelFixedFields,
     refreshModelList?: boolean,
   ) => {
-    const modelProviderModelListQueryKey = consoleQuery.modelProviders.models.queryKey({
-      input: {
-        params: {
-          provider: provider.provider,
-        },
-      },
-    })
-    queryClient.invalidateQueries({
-      queryKey: modelProviderModelListQueryKey,
-      exact: true,
-      refetchType: 'none',
-    })
-
     updateModelProviders()
 
     provider.supported_model_types.forEach((type) => {
@@ -357,17 +329,15 @@ export const useRefreshModel = () => {
     })
 
     if (refreshModelList && provider.custom_configuration.status === CustomConfigurationStatusEnum.active) {
-      expandModelProviderList(provider.provider)
-      queryClient.invalidateQueries({
-        queryKey: modelProviderModelListQueryKey,
-        exact: true,
-        refetchType: 'active',
-      })
+      eventEmitter?.emit({
+        type: UPDATE_MODEL_PROVIDER_CUSTOM_MODEL_LIST,
+        payload: provider.provider,
+      } as any)
 
       if (CustomConfigurationModelFixedFields?.__model_type)
         updateModelList(CustomConfigurationModelFixedFields.__model_type)
     }
-  }, [expandModelProviderList, queryClient, updateModelList, updateModelProviders])
+  }, [eventEmitter, updateModelList, updateModelProviders])
 
   return {
     handleRefreshModel,

web/app/components/header/account-setting/model-provider-page/index.spec.tsx

@@ -7,7 +7,16 @@ import {
 } from './declarations'
 import ModelProviderPage from './index'
 
-let mockEnableMarketplace = true
+vi.mock('@/context/app-context', () => ({
+  useAppContext: () => ({
+    mutateCurrentWorkspace: vi.fn(),
+    isValidatingCurrentWorkspace: false,
+  }),
+}))
+
+const mockGlobalState = {
+  systemFeatures: { enable_marketplace: true },
+}
 
 const mockQuotaConfig = {
   quota_type: CurrentSystemQuotaTypeEnum.free,
@@ -19,11 +28,7 @@ const mockQuotaConfig = {
 }
 
 vi.mock('@/context/global-public-context', () => ({
-  useSystemFeaturesQuery: () => ({
-    data: {
-      enable_marketplace: mockEnableMarketplace,
-    },
-  }),
+  useGlobalPublicStore: (selector: (s: { systemFeatures: { enable_marketplace: boolean } }) => unknown) => selector(mockGlobalState),
 }))
 
 const mockProviders = [
@@ -55,16 +60,13 @@ vi.mock('@/context/provider-context', () => ({
   }),
 }))
 
-const mockDefaultModels: Record<string, { data: unknown, isLoading: boolean }> = {
-  'llm': { data: null, isLoading: false },
-  'text-embedding': { data: null, isLoading: false },
-  'rerank': { data: null, isLoading: false },
-  'speech2text': { data: null, isLoading: false },
-  'tts': { data: null, isLoading: false },
+const mockDefaultModelState = {
+  data: null,
+  isLoading: false,
 }
 
 vi.mock('./hooks', () => ({
-  useDefaultModel: (type: string) => mockDefaultModels[type] ?? { data: null, isLoading: false },
+  useDefaultModel: () => mockDefaultModelState,
 }))
 
 vi.mock('./install-from-marketplace', () => ({
@@ -83,18 +85,13 @@ vi.mock('./system-model-selector', () => ({
   default: () => <div data-testid="system-model-selector" />,
 }))
 
-vi.mock('@/service/use-plugins', () => ({
-  useCheckInstalled: () => ({ data: undefined }),
-}))
-
 describe('ModelProviderPage', () => {
   beforeEach(() => {
     vi.useFakeTimers()
     vi.clearAllMocks()
-    mockEnableMarketplace = true
-    Object.keys(mockDefaultModels).forEach((key) => {
-      mockDefaultModels[key] = { data: null, isLoading: false }
-    })
+    mockGlobalState.systemFeatures.enable_marketplace = true
+    mockDefaultModelState.data = null
+    mockDefaultModelState.isLoading = false
     mockProviders.splice(0, mockProviders.length, {
       provider: 'openai',
       label: { en_US: 'OpenAI' },
@@ -152,76 +149,13 @@ describe('ModelProviderPage', () => {
   })
 
   it('should hide marketplace section when marketplace feature is disabled', () => {
-    mockEnableMarketplace = false
+    mockGlobalState.systemFeatures.enable_marketplace = false
 
     render(<ModelProviderPage searchText="" />)
 
     expect(screen.queryByTestId('install-from-marketplace')).not.toBeInTheDocument()
   })
 
-  describe('system model config status', () => {
-    it('should not show top warning when no configured providers exist (empty state card handles it)', () => {
-      mockProviders.splice(0, mockProviders.length, {
-        provider: 'anthropic',
-        label: { en_US: 'Anthropic' },
-        custom_configuration: { status: CustomConfigurationStatusEnum.noConfigure },
-        system_configuration: {
-          enabled: false,
-          current_quota_type: CurrentSystemQuotaTypeEnum.free,
-          quota_configurations: [mockQuotaConfig],
-        },
-      })
-
-      render(<ModelProviderPage searchText="" />)
-      expect(screen.queryByText('common.modelProvider.noneConfigured')).not.toBeInTheDocument()
-      expect(screen.queryByText('common.modelProvider.notConfigured')).not.toBeInTheDocument()
-      expect(screen.getByText('common.modelProvider.emptyProviderTitle')).toBeInTheDocument()
-    })
-
-    it('should show none-configured warning when providers exist but no default models set', () => {
-      render(<ModelProviderPage searchText="" />)
-      expect(screen.getByText('common.modelProvider.noneConfigured')).toBeInTheDocument()
-    })
-
-    it('should show partially-configured warning when some default models are set', () => {
-      mockDefaultModels.llm = {
-        data: { model: 'gpt-4', model_type: 'llm', provider: { provider: 'openai', icon_small: { en_US: '' } } },
-        isLoading: false,
-      }
-
-      render(<ModelProviderPage searchText="" />)
-      expect(screen.getByText('common.modelProvider.notConfigured')).toBeInTheDocument()
-    })
-
-    it('should not show warning when all default models are configured', () => {
-      const makeModel = (model: string, type: string) => ({
-        data: { model, model_type: type, provider: { provider: 'openai', icon_small: { en_US: '' } } },
-        isLoading: false,
-      })
-      mockDefaultModels.llm = makeModel('gpt-4', 'llm')
-      mockDefaultModels['text-embedding'] = makeModel('text-embedding-3', 'text-embedding')
-      mockDefaultModels.rerank = makeModel('rerank-v3', 'rerank')
-      mockDefaultModels.speech2text = makeModel('whisper-1', 'speech2text')
-      mockDefaultModels.tts = makeModel('tts-1', 'tts')
-
-      render(<ModelProviderPage searchText="" />)
-      expect(screen.queryByText('common.modelProvider.noProviderInstalled')).not.toBeInTheDocument()
-      expect(screen.queryByText('common.modelProvider.noneConfigured')).not.toBeInTheDocument()
-      expect(screen.queryByText('common.modelProvider.notConfigured')).not.toBeInTheDocument()
-    })
-
-    it('should not show warning while loading', () => {
-      Object.keys(mockDefaultModels).forEach((key) => {
-        mockDefaultModels[key] = { data: null, isLoading: true }
-      })
-
-      render(<ModelProviderPage searchText="" />)
-      expect(screen.queryByText('common.modelProvider.noProviderInstalled')).not.toBeInTheDocument()
-      expect(screen.queryByText('common.modelProvider.noneConfigured')).not.toBeInTheDocument()
-      expect(screen.queryByText('common.modelProvider.notConfigured')).not.toBeInTheDocument()
-    })
-  })
-
   it('should prioritize fixed providers in visible order', () => {
     mockProviders.splice(0, mockProviders.length, {
       provider: 'zeta-provider',

web/app/components/header/account-setting/model-provider-page/index.tsx

@@ -1,14 +1,17 @@
 import type {
   ModelProvider,
 } from './declarations'
-import type { PluginDetail } from '@/app/components/plugins/types'
+import {
+  RiAlertFill,
+  RiBrainLine,
+} from '@remixicon/react'
 import { useDebounce } from 'ahooks'
-import { useMemo } from 'react'
+import { useEffect, useMemo } from 'react'
 import { useTranslation } from 'react-i18next'
 import { IS_CLOUD_EDITION } from '@/config'
-import { useSystemFeaturesQuery } from '@/context/global-public-context'
+import { useAppContext } from '@/context/app-context'
+import { useGlobalPublicStore } from '@/context/global-public-context'
 import { useProviderContext } from '@/context/provider-context'
-import { useCheckInstalled } from '@/service/use-plugins'
 import { cn } from '@/utils/classnames'
 import {
   CustomConfigurationStatusEnum,
@@ -21,9 +24,6 @@ import InstallFromMarketplace from './install-from-marketplace'
 import ProviderAddedCard from './provider-added-card'
 import QuotaPanel from './provider-added-card/quota-panel'
 import SystemModelSelector from './system-model-selector'
-import { providerToPluginId } from './utils'
-
-type SystemModelConfigStatus = 'no-provider' | 'none-configured' | 'partially-configured' | 'fully-configured'
 
 type Props = {
   searchText: string
@@ -34,35 +34,20 @@ const FixedModelProvider = ['langgenius/openai/openai', 'langgenius/anthropic/an
 const ModelProviderPage = ({ searchText }: Props) => {
   const debouncedSearchText = useDebounce(searchText, { wait: 500 })
   const { t } = useTranslation()
+  const { mutateCurrentWorkspace, isValidatingCurrentWorkspace } = useAppContext()
   const { data: textGenerationDefaultModel, isLoading: isTextGenerationDefaultModelLoading } = useDefaultModel(ModelTypeEnum.textGeneration)
   const { data: embeddingsDefaultModel, isLoading: isEmbeddingsDefaultModelLoading } = useDefaultModel(ModelTypeEnum.textEmbedding)
   const { data: rerankDefaultModel, isLoading: isRerankDefaultModelLoading } = useDefaultModel(ModelTypeEnum.rerank)
   const { data: speech2textDefaultModel, isLoading: isSpeech2textDefaultModelLoading } = useDefaultModel(ModelTypeEnum.speech2text)
   const { data: ttsDefaultModel, isLoading: isTTSDefaultModelLoading } = useDefaultModel(ModelTypeEnum.tts)
   const { modelProviders: providers } = useProviderContext()
-  const { data: systemFeatures } = useSystemFeaturesQuery()
-
-  const allPluginIds = useMemo(() => {
-    return [...new Set(providers.map(p => providerToPluginId(p.provider)).filter(Boolean))]
-  }, [providers])
-  const { data: installedPlugins } = useCheckInstalled({
-    pluginIds: allPluginIds,
-    enabled: allPluginIds.length > 0,
-  })
-  const pluginDetailMap = useMemo(() => {
-    const map = new Map<string, PluginDetail>()
-    if (installedPlugins?.plugins) {
-      for (const plugin of installedPlugins.plugins)
-        map.set(plugin.plugin_id, plugin)
-    }
-    return map
-  }, [installedPlugins])
-  const enableMarketplace = systemFeatures?.enable_marketplace ?? false
+  const { enable_marketplace } = useGlobalPublicStore(s => s.systemFeatures)
   const isDefaultModelLoading = isTextGenerationDefaultModelLoading
     || isEmbeddingsDefaultModelLoading
     || isRerankDefaultModelLoading
     || isSpeech2textDefaultModelLoading
     || isTTSDefaultModelLoading
+  const defaultModelNotConfigured = !isDefaultModelLoading && !textGenerationDefaultModel && !embeddingsDefaultModel && !speech2textDefaultModel && !rerankDefaultModel && !ttsDefaultModel
   const [configuredProviders, notConfiguredProviders] = useMemo(() => {
     const configuredProviders: ModelProvider[] = []
     const notConfiguredProviders: ModelProvider[] = []
@@ -94,26 +79,6 @@ const ModelProviderPage = ({ searchText }: Props) => {
 
     return [configuredProviders, notConfiguredProviders]
   }, [providers])
-
-  const systemModelConfigStatus: SystemModelConfigStatus = useMemo(() => {
-    const defaultModels = [textGenerationDefaultModel, embeddingsDefaultModel, rerankDefaultModel, speech2textDefaultModel, ttsDefaultModel]
-    const configuredCount = defaultModels.filter(Boolean).length
-    if (configuredCount === 0 && configuredProviders.length === 0)
-      return 'no-provider'
-    if (configuredCount === 0)
-      return 'none-configured'
-    if (configuredCount < defaultModels.length)
-      return 'partially-configured'
-    return 'fully-configured'
-  }, [configuredProviders, textGenerationDefaultModel, embeddingsDefaultModel, rerankDefaultModel, speech2textDefaultModel, ttsDefaultModel])
-  const warningTextKey
-    = systemModelConfigStatus === 'none-configured'
-      ? 'modelProvider.noneConfigured'
-      : systemModelConfigStatus === 'partially-configured'
-        ? 'modelProvider.notConfigured'
-        : null
-  const showWarning = !isDefaultModelLoading && !!warningTextKey
-
   const [filteredConfiguredProviders, filteredNotConfiguredProviders] = useMemo(() => {
     const filteredConfiguredProviders = configuredProviders.filter(
       provider => provider.provider.toLowerCase().includes(debouncedSearchText.toLowerCase())
@@ -127,24 +92,28 @@ const ModelProviderPage = ({ searchText }: Props) => {
     return [filteredConfiguredProviders, filteredNotConfiguredProviders]
   }, [configuredProviders, debouncedSearchText, notConfiguredProviders])
 
+  useEffect(() => {
+    mutateCurrentWorkspace()
+  }, [mutateCurrentWorkspace])
+
   return (
     <div className="relative -mt-2 pt-1">
       <div className={cn('mb-2 flex items-center')}>
         <div className="grow text-text-primary system-md-semibold">{t('modelProvider.models', { ns: 'common' })}</div>
         <div className={cn(
           'relative flex shrink-0 items-center justify-end gap-2 rounded-lg border border-transparent p-px',
-          showWarning && 'border-components-panel-border bg-components-panel-bg-blur pl-2 shadow-xs',
+          defaultModelNotConfigured && 'border-components-panel-border bg-components-panel-bg-blur pl-2 shadow-xs',
         )}
         >
-          {showWarning && <div className="absolute bottom-0 left-0 right-0 top-0 opacity-40" style={{ background: 'linear-gradient(92deg, rgba(247, 144, 9, 0.25) 0%, rgba(255, 255, 255, 0.00) 100%)' }} />}
-          {showWarning && (
+          {defaultModelNotConfigured && <div className="absolute bottom-0 left-0 right-0 top-0 opacity-40" style={{ background: 'linear-gradient(92deg, rgba(247, 144, 9, 0.25) 0%, rgba(255, 255, 255, 0.00) 100%)' }} />}
+          {defaultModelNotConfigured && (
             <div className="flex items-center gap-1 text-text-primary system-xs-medium">
-              <span className="i-ri-alert-fill h-4 w-4 text-text-warning-secondary" />
-              <span className="max-w-[460px] truncate" title={t(warningTextKey, { ns: 'common' })}>{t(warningTextKey, { ns: 'common' })}</span>
+              <RiAlertFill className="h-4 w-4 text-text-warning-secondary" />
+              <span className="max-w-[460px] truncate" title={t('modelProvider.notConfigured', { ns: 'common' })}>{t('modelProvider.notConfigured', { ns: 'common' })}</span>
             </div>
           )}
           <SystemModelSelector
-            notConfigured={showWarning}
+            notConfigured={defaultModelNotConfigured}
             textGenerationDefaultModel={textGenerationDefaultModel}
             embeddingsDefaultModel={embeddingsDefaultModel}
             rerankDefaultModel={rerankDefaultModel}
@@ -154,11 +123,11 @@ const ModelProviderPage = ({ searchText }: Props) => {
           />
         </div>
       </div>
-      {IS_CLOUD_EDITION && <QuotaPanel providers={providers} />}
+      {IS_CLOUD_EDITION && <QuotaPanel providers={providers} isLoading={isValidatingCurrentWorkspace} />}
       {!filteredConfiguredProviders?.length && (
         <div className="mb-2 rounded-[10px] bg-workflow-process-bg p-4">
           <div className="flex h-10 w-10 items-center justify-center rounded-[10px] border-[0.5px] border-components-card-border bg-components-card-bg shadow-lg backdrop-blur">
-            <span className="i-ri-brain-line h-5 w-5 text-text-primary" />
+            <RiBrainLine className="h-5 w-5 text-text-primary" />
           </div>
           <div className="mt-2 text-text-secondary system-sm-medium">{t('modelProvider.emptyProviderTitle', { ns: 'common' })}</div>
           <div className="mt-1 text-text-tertiary system-xs-regular">{t('modelProvider.emptyProviderTip', { ns: 'common' })}</div>
@@ -170,7 +139,6 @@ const ModelProviderPage = ({ searchText }: Props) => {
             <ProviderAddedCard
               key={provider.provider}
               provider={provider}
-              pluginDetail={pluginDetailMap.get(providerToPluginId(provider.provider))}
             />
           ))}
         </div>
@@ -184,14 +152,13 @@ const ModelProviderPage = ({ searchText }: Props) => {
                 notConfigured
                 key={provider.provider}
                 provider={provider}
-                pluginDetail={pluginDetailMap.get(providerToPluginId(provider.provider))}
               />
             ))}
           </div>
         </>
       )}
       {
-        enableMarketplace && (
+        enable_marketplace && (
           <InstallFromMarketplace
             providers={providers}
             searchText={searchText}