diff --git a/web/app/components/base/ui/dialog/__tests__/index.spec.tsx b/web/app/components/base/ui/dialog/__tests__/index.spec.tsx
new file mode 100644
index 0000000000..eb8cb179a6
--- /dev/null
+++ b/web/app/components/base/ui/dialog/__tests__/index.spec.tsx
@@ -0,0 +1,150 @@
+import type { ComponentPropsWithoutRef } from 'react'
+import { Dialog as BaseDialog } from '@base-ui/react/dialog'
+import { render, screen } from '@testing-library/react'
+import { beforeEach, describe, expect, it, vi } from 'vitest'
+import {
+  Dialog,
+  DialogClose,
+  DialogContent,
+  DialogDescription,
+  DialogTitle,
+  DialogTrigger,
+} from '../index'
+
+type PrimitiveProps = ComponentPropsWithoutRef<'div'>
+
+vi.mock('@base-ui/react/dialog', () => {
+  const createPrimitive = (testId: string) => {
+    return vi.fn(({ children, ...props }: PrimitiveProps) => (
+      <div data-testid={testId} {...props}>
+        {children}
+      </div>
+    ))
+  }
+
+  return {
+    Dialog: {
+      Root: createPrimitive('base-dialog-root'),
+      Trigger: createPrimitive('base-dialog-trigger'),
+      Title: createPrimitive('base-dialog-title'),
+      Description: createPrimitive('base-dialog-description'),
+      Close: createPrimitive('base-dialog-close'),
+      Portal: createPrimitive('base-dialog-portal'),
+      Backdrop: createPrimitive('base-dialog-backdrop'),
+      Popup: createPrimitive('base-dialog-popup'),
+    },
+  }
+})
+
+describe('Dialog wrapper', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  // Rendering behavior for wrapper-specific structure and content.
+  describe('Rendering', () => {
+    it('should render backdrop and popup when DialogContent is rendered', () => {
+      // Arrange
+      const contentText = 'dialog body'
+
+      // Act
+      render(
+        <DialogContent>
+          <span>{contentText}</span>
+        </DialogContent>,
+      )
+
+      // Assert
+      expect(screen.getByTestId('base-dialog-portal')).toBeInTheDocument()
+      expect(screen.getByTestId('base-dialog-backdrop')).toBeInTheDocument()
+      expect(screen.getByTestId('base-dialog-popup')).toBeInTheDocument()
+      expect(screen.getByText(contentText)).toBeInTheDocument()
+    })
+
+    it('should apply default wrapper class names when no override classes are provided', () => {
+      // Arrange
+      render(
+        <DialogContent>
+          <span>content</span>
+        </DialogContent>,
+      )
+
+      // Act
+      const backdrop = screen.getByTestId('base-dialog-backdrop')
+      const popup = screen.getByTestId('base-dialog-popup')
+
+      // Assert
+      expect(backdrop).toHaveClass('fixed', 'inset-0', 'z-50', 'bg-background-overlay')
+      expect(backdrop).toHaveClass('transition-opacity', 'duration-150')
+      expect(backdrop).toHaveClass('data-[ending-style]:opacity-0', 'data-[starting-style]:opacity-0')
+
+      expect(popup).toHaveClass('fixed', 'left-1/2', 'top-1/2', 'z-50')
+      expect(popup).toHaveClass('max-h-[80dvh]', 'w-[480px]', 'max-w-[calc(100vw-2rem)]')
+      expect(popup).toHaveClass('-translate-x-1/2', '-translate-y-1/2')
+      expect(popup).toHaveClass('rounded-2xl', 'border-[0.5px]', 'bg-components-panel-bg', 'p-6', 'shadow-xl')
+      expect(popup).toHaveClass('transition-all', 'duration-150')
+      expect(popup).toHaveClass(
+        'data-[ending-style]:scale-95',
+        'data-[starting-style]:scale-95',
+        'data-[ending-style]:opacity-0',
+        'data-[starting-style]:opacity-0',
+      )
+    })
+  })
+
+  // Props behavior for class merging and custom styling.
+  describe('Props', () => {
+    it('should merge overlayClassName and className with default classes when overrides are provided', () => {
+      // Arrange
+      const overlayClassName = 'custom-overlay opacity-90'
+      const className = 'custom-popup max-w-[640px]'
+
+      // Act
+      render(
+        <DialogContent overlayClassName={overlayClassName} className={className}>
+          <span>content</span>
+        </DialogContent>,
+      )
+
+      const backdrop = screen.getByTestId('base-dialog-backdrop')
+      const popup = screen.getByTestId('base-dialog-popup')
+
+      // Assert
+      expect(backdrop).toHaveClass('fixed', 'inset-0', 'custom-overlay', 'opacity-90')
+      expect(popup).toHaveClass('fixed', 'left-1/2', 'custom-popup', 'max-w-[640px]')
+      expect(popup).not.toHaveClass('max-w-[calc(100vw-2rem)]')
+    })
+
+    it('should render children inside popup when children are provided', () => {
+      // Arrange
+      const childText = 'child content'
+
+      // Act
+      render(
+        <DialogContent>
+          <div>{childText}</div>
+        </DialogContent>,
+      )
+
+      const popup = screen.getByTestId('base-dialog-popup')
+
+      // Assert
+      expect(popup).toContainElement(screen.getByText(childText))
+    })
+  })
+
+  // Export mapping ensures wrapper aliases point to base primitives.
+  describe('Exports', () => {
+    it('should map dialog aliases to the matching base dialog primitives', () => {
+      // Arrange
+      const basePrimitives = BaseDialog
+
+      // Act & Assert
+      expect(Dialog).toBe(basePrimitives.Root)
+      expect(DialogTrigger).toBe(basePrimitives.Trigger)
+      expect(DialogTitle).toBe(basePrimitives.Title)
+      expect(DialogDescription).toBe(basePrimitives.Description)
+      expect(DialogClose).toBe(basePrimitives.Close)
+    })
+  })
+})
diff --git a/web/app/components/base/ui/dropdown-menu/__tests__/index.spec.tsx b/web/app/components/base/ui/dropdown-menu/__tests__/index.spec.tsx
new file mode 100644
index 0000000000..4ccf74209b
--- /dev/null
+++ b/web/app/components/base/ui/dropdown-menu/__tests__/index.spec.tsx
@@ -0,0 +1,322 @@
+import type { Placement } from '@floating-ui/react'
+import { Menu } from '@base-ui/react/menu'
+import { render, screen } from '@testing-library/react'
+import { parsePlacement } from '@/app/components/base/ui/placement'
+import {
+  DropdownMenu,
+  DropdownMenuCheckboxItem,
+  DropdownMenuCheckboxItemIndicator,
+  DropdownMenuContent,
+  DropdownMenuGroup,
+  DropdownMenuGroupLabel,
+  DropdownMenuItem,
+  DropdownMenuPortal,
+  DropdownMenuRadioGroup,
+  DropdownMenuRadioItem,
+  DropdownMenuRadioItemIndicator,
+  DropdownMenuSeparator,
+  DropdownMenuSub,
+  DropdownMenuSubContent,
+  DropdownMenuSubTrigger,
+  DropdownMenuTrigger,
+} from '../index'
+
+vi.mock('@base-ui/react/menu', async () => {
+  const React = await import('react')
+
+  type PrimitiveProps = React.HTMLAttributes<HTMLDivElement> & {
+    children?: React.ReactNode
+  }
+
+  type PositionerProps = PrimitiveProps & {
+    side?: string
+    align?: string
+    sideOffset?: number
+    alignOffset?: number
+  }
+
+  const createPrimitive = (testId: string) => {
+    const Primitive = React.forwardRef<HTMLDivElement, PrimitiveProps>(({ children, ...props }, ref) => {
+      return React.createElement('div', { ref, 'data-testid': testId, ...props }, children)
+    })
+    Primitive.displayName = testId
+    return Primitive
+  }
+
+  const Positioner = React.forwardRef<HTMLDivElement, PositionerProps>(({ children, side, align, sideOffset, alignOffset, ...props }, ref) => {
+    return React.createElement(
+      'div',
+      {
+        ref,
+        'data-testid': 'menu-positioner',
+        'data-side': side,
+        'data-align': align,
+        'data-side-offset': sideOffset,
+        'data-align-offset': alignOffset,
+        ...props,
+      },
+      children,
+    )
+  })
+  Positioner.displayName = 'menu-positioner'
+
+  const Menu = {
+    Root: createPrimitive('menu-root'),
+    Portal: createPrimitive('menu-portal'),
+    Trigger: createPrimitive('menu-trigger'),
+    SubmenuRoot: createPrimitive('menu-submenu-root'),
+    Group: createPrimitive('menu-group'),
+    GroupLabel: createPrimitive('menu-group-label'),
+    RadioGroup: createPrimitive('menu-radio-group'),
+    RadioItem: createPrimitive('menu-radio-item'),
+    RadioItemIndicator: createPrimitive('menu-radio-item-indicator'),
+    CheckboxItem: createPrimitive('menu-checkbox-item'),
+    CheckboxItemIndicator: createPrimitive('menu-checkbox-item-indicator'),
+    Positioner,
+    Popup: createPrimitive('menu-popup'),
+    SubmenuTrigger: createPrimitive('menu-submenu-trigger'),
+    Item: createPrimitive('menu-item'),
+    Separator: createPrimitive('menu-separator'),
+  }
+
+  return { Menu }
+})
+
+vi.mock('@/app/components/base/ui/placement', () => ({
+  parsePlacement: vi.fn((placement: Placement) => {
+    const [side, align] = placement.split('-') as [string, string | undefined]
+    return {
+      side: side as 'top' | 'right' | 'bottom' | 'left',
+      align: (align ?? 'center') as 'start' | 'center' | 'end',
+    }
+  }),
+}))
+
+describe('dropdown-menu wrapper', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  // Ensures exported aliases stay aligned with the wrapped Menu primitives.
+  describe('alias exports', () => {
+    it('should map each alias export to the corresponding Menu primitive', () => {
+      // Arrange
+
+      // Act
+
+      // Assert
+      expect(DropdownMenu).toBe(Menu.Root)
+      expect(DropdownMenuPortal).toBe(Menu.Portal)
+      expect(DropdownMenuTrigger).toBe(Menu.Trigger)
+      expect(DropdownMenuSub).toBe(Menu.SubmenuRoot)
+      expect(DropdownMenuGroup).toBe(Menu.Group)
+      expect(DropdownMenuGroupLabel).toBe(Menu.GroupLabel)
+      expect(DropdownMenuRadioGroup).toBe(Menu.RadioGroup)
+      expect(DropdownMenuRadioItem).toBe(Menu.RadioItem)
+      expect(DropdownMenuRadioItemIndicator).toBe(Menu.RadioItemIndicator)
+      expect(DropdownMenuCheckboxItem).toBe(Menu.CheckboxItem)
+      expect(DropdownMenuCheckboxItemIndicator).toBe(Menu.CheckboxItemIndicator)
+    })
+  })
+
+  describe('DropdownMenuContent', () => {
+    it('should use default placement and offsets when props are omitted', () => {
+      // Arrange
+      const parsePlacementMock = vi.mocked(parsePlacement)
+
+      // Act
+      render(
+        <DropdownMenuContent>
+          <span>content child</span>
+        </DropdownMenuContent>,
+      )
+
+      // Assert
+      const positioner = screen.getByTestId('menu-positioner')
+      const popup = screen.getByTestId('menu-popup')
+
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('bottom-end')
+      expect(positioner).toHaveAttribute('data-side', 'bottom')
+      expect(positioner).toHaveAttribute('data-align', 'end')
+      expect(positioner).toHaveAttribute('data-side-offset', '4')
+      expect(positioner).toHaveAttribute('data-align-offset', '0')
+      expect(positioner).toHaveClass('outline-none')
+      expect(popup).toHaveClass('rounded-xl')
+      expect(popup).toHaveClass('py-1')
+      expect(screen.getByText('content child')).toBeInTheDocument()
+    })
+
+    it('should parse custom placement and merge custom class names', () => {
+      // Arrange
+      const parsePlacementMock = vi.mocked(parsePlacement)
+
+      // Act
+      render(
+        <DropdownMenuContent
+          placement="top-start"
+          sideOffset={12}
+          alignOffset={-3}
+          className="content-positioner-custom"
+          popupClassName="content-popup-custom"
+        >
+          <span>custom content</span>
+        </DropdownMenuContent>,
+      )
+
+      // Assert
+      const positioner = screen.getByTestId('menu-positioner')
+      const popup = screen.getByTestId('menu-popup')
+
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('top-start')
+      expect(positioner).toHaveAttribute('data-side', 'top')
+      expect(positioner).toHaveAttribute('data-align', 'start')
+      expect(positioner).toHaveAttribute('data-side-offset', '12')
+      expect(positioner).toHaveAttribute('data-align-offset', '-3')
+      expect(positioner).toHaveClass('outline-none')
+      expect(positioner).toHaveClass('content-positioner-custom')
+      expect(popup).toHaveClass('content-popup-custom')
+      expect(screen.getByText('custom content')).toBeInTheDocument()
+    })
+  })
+
+  describe('DropdownMenuSubContent', () => {
+    it('should use the default sub-content placement and offsets', () => {
+      // Arrange
+      const parsePlacementMock = vi.mocked(parsePlacement)
+
+      // Act
+      render(
+        <DropdownMenuSubContent>
+          <span>sub content child</span>
+        </DropdownMenuSubContent>,
+      )
+
+      // Assert
+      const positioner = screen.getByTestId('menu-positioner')
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('left-start')
+      expect(positioner).toHaveAttribute('data-side', 'left')
+      expect(positioner).toHaveAttribute('data-align', 'start')
+      expect(positioner).toHaveAttribute('data-side-offset', '4')
+      expect(positioner).toHaveAttribute('data-align-offset', '0')
+      expect(positioner).toHaveClass('outline-none')
+      expect(screen.getByText('sub content child')).toBeInTheDocument()
+    })
+
+    it('should parse custom placement and merge popup class names', () => {
+      // Arrange
+      const parsePlacementMock = vi.mocked(parsePlacement)
+
+      // Act
+      render(
+        <DropdownMenuSubContent
+          placement="right-end"
+          sideOffset={6}
+          alignOffset={2}
+          className="sub-positioner-custom"
+          popupClassName="sub-popup-custom"
+        >
+          <span>custom sub content</span>
+        </DropdownMenuSubContent>,
+      )
+
+      // Assert
+      const positioner = screen.getByTestId('menu-positioner')
+      const popup = screen.getByTestId('menu-popup')
+
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('right-end')
+      expect(positioner).toHaveAttribute('data-side', 'right')
+      expect(positioner).toHaveAttribute('data-align', 'end')
+      expect(positioner).toHaveAttribute('data-side-offset', '6')
+      expect(positioner).toHaveAttribute('data-align-offset', '2')
+      expect(positioner).toHaveClass('outline-none')
+      expect(positioner).toHaveClass('sub-positioner-custom')
+      expect(popup).toHaveClass('sub-popup-custom')
+    })
+  })
+
+  describe('DropdownMenuSubTrigger', () => {
+    it('should merge className and apply destructive style when destructive is true', () => {
+      // Arrange
+
+      // Act
+      render(
+        <DropdownMenuSubTrigger className="sub-trigger-custom" destructive>
+          Trigger item
+        </DropdownMenuSubTrigger>,
+      )
+
+      // Assert
+      const subTrigger = screen.getByTestId('menu-submenu-trigger')
+      expect(subTrigger).toHaveClass('mx-1')
+      expect(subTrigger).toHaveClass('sub-trigger-custom')
+      expect(subTrigger).toHaveClass('text-text-destructive')
+    })
+
+    it('should not apply destructive style when destructive is false', () => {
+      // Arrange
+
+      // Act
+      render(
+        <DropdownMenuSubTrigger className="sub-trigger-custom">
+          Trigger item
+        </DropdownMenuSubTrigger>,
+      )
+
+      // Assert
+      expect(screen.getByTestId('menu-submenu-trigger')).not.toHaveClass('text-text-destructive')
+    })
+  })
+
+  describe('DropdownMenuItem', () => {
+    it('should merge className and apply destructive style when destructive is true', () => {
+      // Arrange
+
+      // Act
+      render(
+        <DropdownMenuItem className="item-custom" destructive>
+          Item label
+        </DropdownMenuItem>,
+      )
+
+      // Assert
+      const item = screen.getByTestId('menu-item')
+      expect(item).toHaveClass('mx-1')
+      expect(item).toHaveClass('item-custom')
+      expect(item).toHaveClass('text-text-destructive')
+    })
+
+    it('should not apply destructive style when destructive is false', () => {
+      // Arrange
+
+      // Act
+      render(
+        <DropdownMenuItem className="item-custom">
+          Item label
+        </DropdownMenuItem>,
+      )
+
+      // Assert
+      expect(screen.getByTestId('menu-item')).not.toHaveClass('text-text-destructive')
+    })
+  })
+
+  describe('DropdownMenuSeparator', () => {
+    it('should merge custom class names with default separator classes', () => {
+      // Arrange
+
+      // Act
+      render(<DropdownMenuSeparator className="separator-custom" />)
+
+      // Assert
+      const separator = screen.getByTestId('menu-separator')
+      expect(separator).toHaveClass('my-1')
+      expect(separator).toHaveClass('h-px')
+      expect(separator).toHaveClass('bg-divider-regular')
+      expect(separator).toHaveClass('separator-custom')
+    })
+  })
+})
diff --git a/web/app/components/base/ui/popover/__tests__/index.spec.tsx b/web/app/components/base/ui/popover/__tests__/index.spec.tsx
new file mode 100644
index 0000000000..d9176e26c0
--- /dev/null
+++ b/web/app/components/base/ui/popover/__tests__/index.spec.tsx
@@ -0,0 +1,187 @@
+import type { Placement } from '@floating-ui/react'
+import type { ComponentPropsWithoutRef, ReactNode } from 'react'
+import { render, screen } from '@testing-library/react'
+import { PopoverContent } from '..'
+
+type ParsedPlacement = {
+  side: 'top' | 'bottom' | 'left' | 'right'
+  align: 'start' | 'center' | 'end'
+}
+
+type PositionerMockProps = ComponentPropsWithoutRef<'div'> & {
+  side?: ParsedPlacement['side']
+  align?: ParsedPlacement['align']
+  sideOffset?: number
+  alignOffset?: number
+}
+
+const positionerPropsSpy = vi.fn<(props: PositionerMockProps) => void>()
+const popupClassNameSpy = vi.fn<(className: string | undefined) => void>()
+const parsePlacementMock = vi.fn<(placement: Placement) => ParsedPlacement>()
+
+vi.mock('@base-ui/react/popover', () => {
+  const Root = ({ children, ...props }: ComponentPropsWithoutRef<'div'>) => (
+    <div {...props}>{children}</div>
+  )
+
+  const Trigger = ({ children, ...props }: ComponentPropsWithoutRef<'button'>) => (
+    <button type="button" {...props}>{children}</button>
+  )
+
+  const Close = ({ children, ...props }: ComponentPropsWithoutRef<'button'>) => (
+    <button type="button" {...props}>{children}</button>
+  )
+
+  const Title = ({ children, ...props }: ComponentPropsWithoutRef<'h2'>) => (
+    <h2 {...props}>{children}</h2>
+  )
+
+  const Description = ({ children, ...props }: ComponentPropsWithoutRef<'p'>) => (
+    <p {...props}>{children}</p>
+  )
+
+  const Portal = ({ children }: { children?: ReactNode }) => (
+    <div data-testid="mock-portal">{children}</div>
+  )
+
+  const Positioner = ({ children, ...props }: PositionerMockProps) => {
+    positionerPropsSpy(props)
+    return (
+      <div data-testid="mock-positioner" className={props.className}>
+        {children}
+      </div>
+    )
+  }
+
+  const Popup = ({ children, className }: ComponentPropsWithoutRef<'div'>) => {
+    popupClassNameSpy(className)
+    return (
+      <div data-testid="mock-popup" className={className}>
+        {children}
+      </div>
+    )
+  }
+
+  return {
+    Popover: {
+      Root,
+      Trigger,
+      Close,
+      Title,
+      Description,
+      Portal,
+      Positioner,
+      Popup,
+    },
+  }
+})
+
+vi.mock('@/app/components/base/ui/placement', () => ({
+  parsePlacement: (placement: Placement) => parsePlacementMock(placement),
+}))
+
+describe('PopoverContent', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    parsePlacementMock.mockReturnValue({
+      side: 'bottom',
+      align: 'center',
+    })
+  })
+
+  describe('Default props', () => {
+    it('should use bottom placement and default offsets when optional props are not provided', () => {
+      // Arrange
+      render(
+        <PopoverContent>
+          <span>Default content</span>
+        </PopoverContent>,
+      )
+
+      // Act
+      const positioner = screen.getByTestId('mock-positioner')
+
+      // Assert
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('bottom')
+      expect(positionerPropsSpy).toHaveBeenCalledWith(
+        expect.objectContaining({
+          side: 'bottom',
+          align: 'center',
+          sideOffset: 8,
+          alignOffset: 0,
+        }),
+      )
+      expect(positioner).toHaveClass('outline-none')
+      expect(screen.getByText('Default content')).toBeInTheDocument()
+    })
+  })
+
+  describe('Placement parsing', () => {
+    it('should use parsePlacement output and forward custom placement offsets to Positioner', () => {
+      // Arrange
+      parsePlacementMock.mockReturnValue({
+        side: 'left',
+        align: 'end',
+      })
+
+      // Act
+      render(
+        <PopoverContent placement="top-end" sideOffset={14} alignOffset={6}>
+          <span>Parsed content</span>
+        </PopoverContent>,
+      )
+
+      // Assert
+      expect(parsePlacementMock).toHaveBeenCalledTimes(1)
+      expect(parsePlacementMock).toHaveBeenCalledWith('top-end')
+      expect(positionerPropsSpy).toHaveBeenCalledWith(
+        expect.objectContaining({
+          side: 'left',
+          align: 'end',
+          sideOffset: 14,
+          alignOffset: 6,
+        }),
+      )
+    })
+  })
+
+  describe('ClassName behavior', () => {
+    it('should merge custom className values into Positioner and Popup class names', () => {
+      // Arrange
+      render(
+        <PopoverContent className="custom-positioner" popupClassName="custom-popup">
+          <span>Styled content</span>
+        </PopoverContent>,
+      )
+
+      // Act
+      const positioner = screen.getByTestId('mock-positioner')
+      const popup = screen.getByTestId('mock-popup')
+
+      // Assert
+      expect(positioner).toHaveClass('outline-none')
+      expect(positioner).toHaveClass('custom-positioner')
+      expect(popup).toHaveClass('rounded-xl')
+      expect(popup).toHaveClass('custom-popup')
+      expect(popupClassNameSpy).toHaveBeenCalledWith(expect.stringContaining('custom-popup'))
+    })
+  })
+
+  describe('Children rendering', () => {
+    it('should render children inside Popup', () => {
+      // Arrange
+      render(
+        <PopoverContent>
+          <button type="button">Child action</button>
+        </PopoverContent>,
+      )
+
+      // Act
+      const popup = screen.getByTestId('mock-popup')
+
+      // Assert
+      expect(popup).toContainElement(screen.getByRole('button', { name: 'Child action' }))
+    })
+  })
+})
diff --git a/web/app/components/base/ui/select/__tests__/index.spec.tsx b/web/app/components/base/ui/select/__tests__/index.spec.tsx
new file mode 100644
index 0000000000..386b25c4f2
--- /dev/null
+++ b/web/app/components/base/ui/select/__tests__/index.spec.tsx
@@ -0,0 +1,263 @@
+import type { Placement } from '@floating-ui/react'
+import type {
+  ButtonHTMLAttributes,
+  HTMLAttributes,
+  ReactNode,
+} from 'react'
+import { render, screen } from '@testing-library/react'
+import { beforeEach, describe, expect, it, vi } from 'vitest'
+import {
+  SelectContent,
+  SelectItem,
+  SelectTrigger,
+} from '../index'
+
+type ParsedPlacement = {
+  side: 'top' | 'bottom' | 'left' | 'right'
+  align: 'start' | 'center' | 'end'
+}
+
+const { mockParsePlacement } = vi.hoisted(() => ({
+  mockParsePlacement: vi.fn<(placement: Placement) => ParsedPlacement>(),
+}))
+
+vi.mock('@/app/components/base/ui/placement', () => ({
+  parsePlacement: mockParsePlacement,
+}))
+
+vi.mock('@base-ui/react/select', () => {
+  type WithChildren = { children?: ReactNode }
+  type PositionerProps = HTMLAttributes<HTMLDivElement> & {
+    side?: 'top' | 'bottom' | 'left' | 'right'
+    align?: 'start' | 'center' | 'end'
+    sideOffset?: number
+    alignOffset?: number
+  }
+
+  const Root = ({ children }: WithChildren) => <div data-testid="base-select-root">{children}</div>
+  const Value = ({ children }: WithChildren) => <span data-testid="base-select-value">{children}</span>
+  const Group = ({ children }: WithChildren) => <div data-testid="base-select-group">{children}</div>
+  const GroupLabel = ({ children }: WithChildren) => <div data-testid="base-select-group-label">{children}</div>
+  const Separator = (props: HTMLAttributes<HTMLHRElement>) => <hr data-testid="base-select-separator" {...props} />
+
+  const Trigger = ({ children, ...props }: ButtonHTMLAttributes<HTMLButtonElement>) => (
+    <button data-testid="base-select-trigger" type="button" {...props}>
+      {children}
+    </button>
+  )
+  const Icon = ({ children, ...props }: HTMLAttributes<HTMLSpanElement>) => (
+    <span data-testid="base-select-icon" {...props}>
+      {children}
+    </span>
+  )
+
+  const Portal = ({ children }: WithChildren) => <div data-testid="base-select-portal">{children}</div>
+  const Positioner = ({
+    children,
+    side,
+    align,
+    sideOffset,
+    alignOffset,
+    className,
+    ...props
+  }: PositionerProps) => (
+    <div
+      data-align={align}
+      data-align-offset={alignOffset}
+      data-side={side}
+      data-side-offset={sideOffset}
+      data-testid="base-select-positioner"
+      className={className}
+      {...props}
+    >
+      {children}
+    </div>
+  )
+  const Popup = ({ children, ...props }: HTMLAttributes<HTMLDivElement>) => (
+    <div data-testid="base-select-popup" {...props}>
+      {children}
+    </div>
+  )
+  const List = ({ children, ...props }: HTMLAttributes<HTMLDivElement>) => (
+    <div data-testid="base-select-list" {...props}>
+      {children}
+    </div>
+  )
+
+  const Item = ({ children, ...props }: HTMLAttributes<HTMLDivElement>) => (
+    <div data-testid="base-select-item" {...props}>
+      {children}
+    </div>
+  )
+  const ItemText = ({ children, ...props }: HTMLAttributes<HTMLSpanElement>) => (
+    <span data-testid="base-select-item-text" {...props}>
+      {children}
+    </span>
+  )
+  const ItemIndicator = ({ children, ...props }: HTMLAttributes<HTMLSpanElement>) => (
+    <span data-testid="base-select-item-indicator" {...props}>
+      {children}
+    </span>
+  )
+
+  return {
+    Select: {
+      Root,
+      Value,
+      Group,
+      GroupLabel,
+      Separator,
+      Trigger,
+      Icon,
+      Portal,
+      Positioner,
+      Popup,
+      List,
+      Item,
+      ItemText,
+      ItemIndicator,
+    },
+  }
+})
+
+describe('Select wrappers', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockParsePlacement.mockReturnValue({ side: 'bottom', align: 'start' })
+  })
+
+  // Covers trigger-level wrapper behavior.
+  describe('SelectTrigger', () => {
+    it('should forward trigger props when trigger props are provided', () => {
+      // Arrange
+      render(
+        <SelectTrigger
+          aria-label="Choose option"
+          data-testid="custom-trigger"
+          disabled
+        >
+          Trigger Label
+        </SelectTrigger>,
+      )
+
+      // Assert
+      const trigger = screen.getByTestId('custom-trigger')
+      expect(trigger).toBeDisabled()
+      expect(trigger).toHaveAttribute('aria-label', 'Choose option')
+      expect(trigger).toHaveAttribute('data-testid', 'custom-trigger')
+    })
+
+    it('should compose default and custom class names when className is provided', () => {
+      // Arrange & Act
+      render(<SelectTrigger className="custom-trigger-class">Trigger Label</SelectTrigger>)
+
+      // Assert
+      const trigger = screen.getByTestId('base-select-trigger')
+      expect(trigger).toHaveClass('group')
+      expect(trigger).toHaveClass('h-8')
+      expect(trigger).toHaveClass('custom-trigger-class')
+    })
+
+    it('should render children and icon when content is provided', () => {
+      // Arrange & Act
+      render(<SelectTrigger>Trigger Label</SelectTrigger>)
+
+      // Assert
+      expect(screen.getByText('Trigger Label')).toBeInTheDocument()
+      expect(screen.getByTestId('base-select-icon')).toBeInTheDocument()
+    })
+  })
+
+  // Covers content placement parsing and positioner forwarding.
+  describe('SelectContent', () => {
+    it('should call parsePlacement with default placement when placement is not provided', () => {
+      // Arrange
+      mockParsePlacement.mockReturnValueOnce({ side: 'bottom', align: 'start' })
+
+      // Act
+      render(<SelectContent><div>Option A</div></SelectContent>)
+
+      // Assert
+      expect(mockParsePlacement).toHaveBeenCalledWith('bottom-start')
+    })
+
+    it('should pass parsed side align and offsets to Positioner when custom placement and offsets are provided', () => {
+      // Arrange
+      mockParsePlacement.mockReturnValueOnce({ side: 'top', align: 'end' })
+
+      // Act
+      render(
+        <SelectContent alignOffset={6} placement="top-end" sideOffset={12}>
+          <div>Option A</div>
+        </SelectContent>,
+      )
+
+      // Assert
+      const positioner = screen.getByTestId('base-select-positioner')
+      expect(mockParsePlacement).toHaveBeenCalledWith('top-end')
+      expect(positioner).toHaveAttribute('data-side', 'top')
+      expect(positioner).toHaveAttribute('data-align', 'end')
+      expect(positioner).toHaveAttribute('data-side-offset', '12')
+      expect(positioner).toHaveAttribute('data-align-offset', '6')
+    })
+
+    it('should compose positioner popup and list class names when custom class props are provided', () => {
+      // Arrange & Act
+      render(
+        <SelectContent
+          className="custom-positioner"
+          listClassName="custom-list"
+          popupClassName="custom-popup"
+        >
+          <div>Option A</div>
+        </SelectContent>,
+      )
+
+      // Assert
+      expect(screen.getByTestId('base-select-positioner')).toHaveClass('outline-none', 'custom-positioner')
+      expect(screen.getByTestId('base-select-popup')).toHaveClass('rounded-xl', 'custom-popup')
+      expect(screen.getByTestId('base-select-list')).toHaveClass('max-h-80', 'custom-list')
+    })
+
+    it('should render children inside list when children are provided', () => {
+      // Arrange & Act
+      render(
+        <SelectContent>
+          <span data-testid="list-child">Option A</span>
+        </SelectContent>,
+      )
+
+      // Assert
+      const list = screen.getByTestId('base-select-list')
+      expect(list).toContainElement(screen.getByTestId('list-child'))
+    })
+  })
+
+  // Covers option item wrapper behavior.
+  describe('SelectItem', () => {
+    it('should forward props and compose class names when item props are provided', () => {
+      // Arrange & Act
+      render(
+        <SelectItem aria-label="City option" className="custom-item-class" data-testid="city-option-item">
+          Seattle
+        </SelectItem>,
+      )
+
+      // Assert
+      const item = screen.getByTestId('city-option-item')
+      expect(item).toHaveAttribute('aria-label', 'City option')
+      expect(item).toHaveAttribute('data-testid', 'city-option-item')
+      expect(item).toHaveClass('h-8')
+      expect(item).toHaveClass('custom-item-class')
+    })
+
+    it('should render item text and indicator when children are provided', () => {
+      // Arrange & Act
+      render(<SelectItem>Seattle</SelectItem>)
+
+      // Assert
+      expect(screen.getByTestId('base-select-item-text')).toHaveTextContent('Seattle')
+      expect(screen.getByTestId('base-select-item-indicator')).toBeInTheDocument()
+    })
+  })
+})
diff --git a/web/app/components/base/ui/tooltip/__tests__/index.spec.tsx b/web/app/components/base/ui/tooltip/__tests__/index.spec.tsx
new file mode 100644
index 0000000000..3432b19eaa
--- /dev/null
+++ b/web/app/components/base/ui/tooltip/__tests__/index.spec.tsx
@@ -0,0 +1,219 @@
+import type { Placement } from '@floating-ui/react'
+import type { HTMLAttributes, ReactNode } from 'react'
+import { Tooltip as BaseTooltip } from '@base-ui/react/tooltip'
+import { render, screen } from '@testing-library/react'
+import { beforeEach, describe, expect, it, vi } from 'vitest'
+import { parsePlacement } from '@/app/components/base/ui/placement'
+import { Tooltip, TooltipContent, TooltipProvider, TooltipTrigger } from '../index'
+
+type MockPortalProps = {
+  children: ReactNode
+}
+
+type MockPositionerProps = {
+  children: ReactNode
+  side: string
+  align: string
+  sideOffset: number
+  alignOffset: number
+  className?: string
+}
+
+type MockPopupProps = HTMLAttributes<HTMLDivElement> & {
+  children: ReactNode
+  className?: string
+}
+
+vi.mock('@/app/components/base/ui/placement', () => ({
+  parsePlacement: vi.fn(),
+}))
+
+vi.mock('@base-ui/react/tooltip', () => ({
+  Tooltip: {
+    Portal: ({ children }: MockPortalProps) => (
+      <div data-testid="tooltip-portal">{children}</div>
+    ),
+    Positioner: ({
+      children,
+      side,
+      align,
+      sideOffset,
+      alignOffset,
+      className,
+    }: MockPositionerProps) => (
+      <div
+        data-testid="tooltip-positioner"
+        data-side={side}
+        data-align={align}
+        data-side-offset={String(sideOffset)}
+        data-align-offset={String(alignOffset)}
+        className={className}
+      >
+        {children}
+      </div>
+    ),
+    Popup: ({ children, className, ...props }: MockPopupProps) => (
+      <div data-testid="tooltip-popup" className={className} {...props}>
+        {children}
+      </div>
+    ),
+    Provider: ({ children }: MockPortalProps) => (
+      <div data-testid="tooltip-provider">{children}</div>
+    ),
+    Root: ({ children }: MockPortalProps) => (
+      <div data-testid="tooltip-root">{children}</div>
+    ),
+    Trigger: ({ children }: MockPortalProps) => (
+      <button data-testid="tooltip-trigger" type="button">
+        {children}
+      </button>
+    ),
+  },
+}))
+
+const mockParsePlacement = vi.mocked(parsePlacement)
+
+describe('TooltipContent', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockParsePlacement.mockReturnValue({ side: 'top', align: 'center' })
+  })
+
+  describe('Placement and offsets', () => {
+    it('should use default placement and offsets when optional props are not provided', () => {
+      // Arrange
+      render(<TooltipContent>Tooltip body</TooltipContent>)
+
+      // Act
+      const positioner = screen.getByTestId('tooltip-positioner')
+
+      // Assert
+      expect(mockParsePlacement).toHaveBeenCalledWith('top')
+      expect(positioner).toHaveAttribute('data-side', 'top')
+      expect(positioner).toHaveAttribute('data-align', 'center')
+      expect(positioner).toHaveAttribute('data-side-offset', '8')
+      expect(positioner).toHaveAttribute('data-align-offset', '0')
+    })
+
+    it('should use parsed placement and custom offsets when placement props are provided', () => {
+      // Arrange
+      mockParsePlacement.mockReturnValue({ side: 'bottom', align: 'start' })
+      const customPlacement: Placement = 'bottom-start'
+
+      // Act
+      render(
+        <TooltipContent
+          placement={customPlacement}
+          sideOffset={16}
+          alignOffset={6}
+        >
+          Tooltip body
+        </TooltipContent>,
+      )
+      const positioner = screen.getByTestId('tooltip-positioner')
+
+      // Assert
+      expect(mockParsePlacement).toHaveBeenCalledWith(customPlacement)
+      expect(positioner).toHaveAttribute('data-side', 'bottom')
+      expect(positioner).toHaveAttribute('data-align', 'start')
+      expect(positioner).toHaveAttribute('data-side-offset', '16')
+      expect(positioner).toHaveAttribute('data-align-offset', '6')
+    })
+  })
+
+  describe('Class behavior', () => {
+    it('should merge the positioner className with wrapper base class', () => {
+      // Arrange
+      render(<TooltipContent className="custom-positioner">Tooltip body</TooltipContent>)
+
+      // Act
+      const positioner = screen.getByTestId('tooltip-positioner')
+
+      // Assert
+      expect(positioner).toHaveClass('outline-none')
+      expect(positioner).toHaveClass('custom-positioner')
+    })
+
+    it('should apply default variant popup classes and merge popupClassName when variant is default', () => {
+      // Arrange
+      render(
+        <TooltipContent popupClassName="custom-popup">
+          Tooltip body
+        </TooltipContent>,
+      )
+
+      // Act
+      const popup = screen.getByTestId('tooltip-popup')
+
+      // Assert
+      expect(popup.className).toContain('bg-components-panel-bg')
+      expect(popup.className).toContain('rounded-md')
+      expect(popup).toHaveClass('custom-popup')
+    })
+
+    it('should avoid default variant popup classes when variant is plain', () => {
+      // Arrange
+      render(
+        <TooltipContent variant="plain" popupClassName="plain-popup">
+          Tooltip body
+        </TooltipContent>,
+      )
+
+      // Act
+      const popup = screen.getByTestId('tooltip-popup')
+
+      // Assert
+      expect(popup).toHaveClass('plain-popup')
+      expect(popup.className).not.toContain('bg-components-panel-bg')
+      expect(popup.className).not.toContain('rounded-md')
+    })
+  })
+
+  describe('Popup prop forwarding', () => {
+    it('should forward popup props to BaseTooltip.Popup when popup props are provided', () => {
+      // Arrange
+      render(
+        <TooltipContent
+          id="popup-id"
+          role="tooltip"
+          aria-label="help text"
+          data-track-id="tooltip-track"
+        >
+          Tooltip body
+        </TooltipContent>,
+      )
+
+      // Act
+      const popup = screen.getByTestId('tooltip-popup')
+
+      // Assert
+      expect(popup).toHaveAttribute('id', 'popup-id')
+      expect(popup).toHaveAttribute('role', 'tooltip')
+      expect(popup).toHaveAttribute('aria-label', 'help text')
+      expect(popup).toHaveAttribute('data-track-id', 'tooltip-track')
+    })
+  })
+})
+
+describe('Tooltip aliases', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should map alias exports to BaseTooltip components when wrapper exports are imported', () => {
+    // Arrange
+    const provider = BaseTooltip.Provider
+    const root = BaseTooltip.Root
+    const trigger = BaseTooltip.Trigger
+
+    // Act
+    const exportedProvider = TooltipProvider
+    const exportedTooltip = Tooltip
+    const exportedTrigger = TooltipTrigger
+
+    // Assert
+    expect(exportedProvider).toBe(provider)
+    expect(exportedTooltip).toBe(root)
+    expect(exportedTrigger).toBe(trigger)
+  })
+})